| 6.7 |
20.0 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 5.4 |
21.5 |
GO:0003360 |
brainstem development(GO:0003360) |
| 5.3 |
5.3 |
GO:2000546 |
positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 5.2 |
10.4 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 4.8 |
19.2 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 4.6 |
27.8 |
GO:0072049 |
comma-shaped body morphogenesis(GO:0072049) |
| 4.4 |
13.1 |
GO:0061075 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 4.2 |
12.6 |
GO:0060364 |
frontal suture morphogenesis(GO:0060364) |
| 4.1 |
12.4 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 4.1 |
12.3 |
GO:0014834 |
skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 3.7 |
18.7 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 3.7 |
14.6 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 3.6 |
14.4 |
GO:1904393 |
regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) |
| 3.6 |
14.2 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 3.5 |
10.6 |
GO:0035604 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
| 3.5 |
10.5 |
GO:0086047 |
membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 3.3 |
10.0 |
GO:0097477 |
lateral motor column neuron migration(GO:0097477) |
| 3.3 |
10.0 |
GO:0051892 |
negative regulation of cardioblast differentiation(GO:0051892) |
| 3.3 |
9.9 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 3.3 |
29.6 |
GO:0070874 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 3.3 |
9.8 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 3.1 |
3.1 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 3.0 |
5.9 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 2.9 |
8.8 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 2.7 |
2.7 |
GO:0090194 |
negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 2.7 |
21.4 |
GO:0003149 |
membranous septum morphogenesis(GO:0003149) |
| 2.6 |
5.3 |
GO:2001027 |
negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 2.6 |
10.5 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 2.6 |
20.7 |
GO:0044027 |
hypermethylation of CpG island(GO:0044027) |
| 2.5 |
7.5 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 2.5 |
9.8 |
GO:0072191 |
ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
| 2.4 |
9.8 |
GO:2000705 |
regulation of dense core granule biogenesis(GO:2000705) |
| 2.4 |
7.3 |
GO:0098974 |
postsynaptic actin cytoskeleton organization(GO:0098974) |
| 2.4 |
7.2 |
GO:0045819 |
plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 2.4 |
14.4 |
GO:0000320 |
re-entry into mitotic cell cycle(GO:0000320) |
| 2.4 |
12.0 |
GO:1903527 |
positive regulation of membrane tubulation(GO:1903527) |
| 2.3 |
2.3 |
GO:0061762 |
CAMKK-AMPK signaling cascade(GO:0061762) |
| 2.3 |
25.6 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 2.3 |
2.3 |
GO:0033563 |
dorsal/ventral axon guidance(GO:0033563) |
| 2.3 |
9.2 |
GO:0072103 |
glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 2.3 |
2.3 |
GO:2000170 |
positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 2.3 |
9.1 |
GO:0060032 |
notochord regression(GO:0060032) |
| 2.3 |
6.8 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 2.2 |
2.2 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 2.2 |
6.7 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 2.2 |
21.9 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 2.2 |
12.9 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 2.1 |
4.3 |
GO:0072180 |
mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
| 2.1 |
10.6 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 2.1 |
18.9 |
GO:0003263 |
cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) |
| 2.1 |
8.3 |
GO:0051902 |
negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 2.1 |
12.4 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 2.0 |
2.0 |
GO:0060167 |
regulation of adenosine receptor signaling pathway(GO:0060167) |
| 2.0 |
12.2 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 2.0 |
6.0 |
GO:0045004 |
DNA replication proofreading(GO:0045004) |
| 2.0 |
5.9 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 2.0 |
5.9 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 2.0 |
2.0 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 2.0 |
2.0 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 1.9 |
5.8 |
GO:0097402 |
neuroblast migration(GO:0097402) |
| 1.9 |
1.9 |
GO:0097491 |
trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 1.9 |
5.7 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 1.9 |
9.4 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.9 |
3.8 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 1.8 |
1.8 |
GO:0003274 |
endocardial cushion fusion(GO:0003274) |
| 1.8 |
1.8 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 1.8 |
3.6 |
GO:0044413 |
evasion or tolerance of host defenses by virus(GO:0019049) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) |
| 1.8 |
1.8 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 1.8 |
5.3 |
GO:0097401 |
synaptic vesicle lumen acidification(GO:0097401) |
| 1.8 |
5.3 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 1.8 |
7.1 |
GO:2000382 |
positive regulation of mesoderm development(GO:2000382) |
| 1.8 |
1.8 |
GO:0042323 |
negative regulation of circadian sleep/wake cycle, non-REM sleep(GO:0042323) negative regulation of mucus secretion(GO:0070256) |
| 1.8 |
5.3 |
GO:0038044 |
transforming growth factor-beta secretion(GO:0038044) |
| 1.7 |
7.0 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.7 |
5.2 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 1.7 |
1.7 |
GO:0003338 |
metanephros morphogenesis(GO:0003338) |
| 1.7 |
5.1 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 1.7 |
10.2 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.7 |
5.0 |
GO:1901355 |
response to rapamycin(GO:1901355) |
| 1.7 |
24.9 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 1.7 |
1.7 |
GO:0000212 |
meiotic spindle organization(GO:0000212) |
| 1.7 |
8.3 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 1.6 |
6.6 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 1.6 |
3.3 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.6 |
4.9 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 1.6 |
6.5 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.6 |
6.4 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 1.6 |
4.7 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 1.6 |
7.8 |
GO:0038031 |
non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 1.5 |
1.5 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 1.5 |
3.1 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 1.5 |
4.6 |
GO:0031660 |
regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
| 1.5 |
4.5 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 1.5 |
2.9 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 1.5 |
7.3 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 1.5 |
1.5 |
GO:0033122 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 1.4 |
5.8 |
GO:0061188 |
regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 1.4 |
2.9 |
GO:0023016 |
signal transduction by trans-phosphorylation(GO:0023016) |
| 1.4 |
4.3 |
GO:0006226 |
dUMP biosynthetic process(GO:0006226) |
| 1.4 |
8.4 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 1.4 |
4.2 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 1.4 |
4.2 |
GO:1902162 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 1.4 |
2.8 |
GO:0009826 |
unidimensional cell growth(GO:0009826) |
| 1.4 |
5.5 |
GO:0030860 |
regulation of polarized epithelial cell differentiation(GO:0030860) |
| 1.4 |
5.5 |
GO:0003342 |
proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
| 1.4 |
10.8 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 1.3 |
1.3 |
GO:0032747 |
positive regulation of interleukin-23 production(GO:0032747) |
| 1.3 |
2.7 |
GO:0002725 |
negative regulation of T cell cytokine production(GO:0002725) |
| 1.3 |
9.3 |
GO:1990416 |
cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 1.3 |
12.0 |
GO:0050882 |
voluntary musculoskeletal movement(GO:0050882) |
| 1.3 |
1.3 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 1.3 |
2.6 |
GO:0061343 |
cell adhesion involved in heart morphogenesis(GO:0061343) |
| 1.3 |
2.6 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 1.3 |
3.9 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 1.3 |
3.8 |
GO:0031133 |
regulation of axon diameter(GO:0031133) |
| 1.3 |
7.6 |
GO:0060666 |
dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 1.3 |
1.3 |
GO:0009786 |
regulation of asymmetric cell division(GO:0009786) |
| 1.3 |
3.8 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 1.3 |
3.8 |
GO:0070346 |
positive regulation of fat cell proliferation(GO:0070346) |
| 1.3 |
22.6 |
GO:0021889 |
olfactory bulb interneuron differentiation(GO:0021889) |
| 1.3 |
3.8 |
GO:0014028 |
notochord formation(GO:0014028) |
| 1.2 |
7.5 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 1.2 |
4.9 |
GO:2001271 |
negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 1.2 |
8.6 |
GO:0009449 |
gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 1.2 |
9.7 |
GO:0098700 |
neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 1.2 |
2.4 |
GO:0035905 |
ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 1.2 |
3.6 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 1.2 |
3.6 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 1.2 |
4.8 |
GO:0030091 |
protein repair(GO:0030091) |
| 1.2 |
7.2 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 1.2 |
4.8 |
GO:0097374 |
sensory neuron axon guidance(GO:0097374) |
| 1.2 |
14.3 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 1.2 |
2.4 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 1.2 |
8.3 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 1.2 |
1.2 |
GO:1904672 |
regulation of somatic stem cell population maintenance(GO:1904672) |
| 1.2 |
10.5 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 1.2 |
8.1 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 1.1 |
3.4 |
GO:0072382 |
minus-end-directed vesicle transport along microtubule(GO:0072382) |
| 1.1 |
3.4 |
GO:0016132 |
brassinosteroid metabolic process(GO:0016131) brassinosteroid biosynthetic process(GO:0016132) |
| 1.1 |
2.3 |
GO:1900133 |
renin secretion into blood stream(GO:0002001) regulation of renin secretion into blood stream(GO:1900133) |
| 1.1 |
3.4 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 1.1 |
1.1 |
GO:0001973 |
adenosine receptor signaling pathway(GO:0001973) |
| 1.1 |
3.4 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 1.1 |
3.4 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 1.1 |
12.3 |
GO:1900121 |
negative regulation of receptor binding(GO:1900121) |
| 1.1 |
10.0 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 1.1 |
8.8 |
GO:0033564 |
anterior/posterior axon guidance(GO:0033564) |
| 1.1 |
4.4 |
GO:0065001 |
negative regulation of histone H3-K36 methylation(GO:0000415) specification of axis polarity(GO:0065001) |
| 1.1 |
2.2 |
GO:0060849 |
regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 1.1 |
6.5 |
GO:0002072 |
optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 1.1 |
3.2 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 1.1 |
1.1 |
GO:0061110 |
dense core granule biogenesis(GO:0061110) |
| 1.1 |
5.4 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 1.1 |
3.2 |
GO:0070602 |
regulation of chondrocyte development(GO:0061181) regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 1.1 |
7.5 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 1.1 |
5.3 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 1.1 |
1.1 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 1.1 |
1.1 |
GO:0045976 |
negative regulation of mitotic cell cycle, embryonic(GO:0045976) |
| 1.1 |
4.2 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 1.1 |
4.2 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 1.0 |
3.1 |
GO:0032817 |
regulation of natural killer cell proliferation(GO:0032817) positive regulation of natural killer cell proliferation(GO:0032819) |
| 1.0 |
4.2 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 1.0 |
3.1 |
GO:1904719 |
excitatory chemical synaptic transmission(GO:0098976) positive regulation of receptor clustering(GO:1903911) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 1.0 |
1.0 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 1.0 |
4.1 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 1.0 |
1.0 |
GO:0010934 |
macrophage cytokine production(GO:0010934) |
| 1.0 |
3.1 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 1.0 |
1.0 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 1.0 |
1.0 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 1.0 |
2.0 |
GO:0007403 |
glial cell fate determination(GO:0007403) |
| 1.0 |
5.1 |
GO:0003431 |
growth plate cartilage chondrocyte development(GO:0003431) |
| 1.0 |
10.1 |
GO:0032625 |
interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 1.0 |
2.0 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 1.0 |
1.0 |
GO:0048538 |
thymus development(GO:0048538) |
| 1.0 |
1.0 |
GO:1900141 |
regulation of oligodendrocyte apoptotic process(GO:1900141) negative regulation of oligodendrocyte apoptotic process(GO:1900142) |
| 1.0 |
3.0 |
GO:0010814 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 1.0 |
5.9 |
GO:0032796 |
uropod organization(GO:0032796) |
| 1.0 |
2.9 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 1.0 |
2.9 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 1.0 |
4.9 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 1.0 |
2.9 |
GO:2000304 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 1.0 |
1.9 |
GO:0006272 |
leading strand elongation(GO:0006272) |
| 1.0 |
7.7 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 1.0 |
10.5 |
GO:0048484 |
enteric nervous system development(GO:0048484) |
| 0.9 |
0.9 |
GO:0001709 |
cell fate determination(GO:0001709) |
| 0.9 |
5.6 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.9 |
4.7 |
GO:0035878 |
nail development(GO:0035878) |
| 0.9 |
0.9 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.9 |
2.8 |
GO:0071163 |
DNA replication preinitiation complex assembly(GO:0071163) |
| 0.9 |
6.4 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.9 |
2.7 |
GO:1904975 |
response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.9 |
20.9 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.9 |
4.5 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.9 |
1.8 |
GO:2000373 |
regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.9 |
0.9 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.9 |
1.8 |
GO:0097350 |
neutrophil clearance(GO:0097350) |
| 0.9 |
2.7 |
GO:0097212 |
lysosomal membrane organization(GO:0097212) |
| 0.9 |
5.4 |
GO:0042473 |
outer ear morphogenesis(GO:0042473) |
| 0.9 |
0.9 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 0.9 |
0.9 |
GO:2000338 |
chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 0.9 |
4.4 |
GO:0090521 |
glomerular visceral epithelial cell migration(GO:0090521) |
| 0.9 |
1.8 |
GO:0009405 |
pathogenesis(GO:0009405) |
| 0.9 |
2.6 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.9 |
1.8 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.9 |
0.9 |
GO:2000054 |
negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 0.9 |
3.5 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.9 |
6.0 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.9 |
4.3 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.9 |
1.7 |
GO:0010701 |
positive regulation of norepinephrine secretion(GO:0010701) |
| 0.8 |
4.2 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.8 |
5.9 |
GO:1905214 |
regulation of RNA binding(GO:1905214) |
| 0.8 |
4.2 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.8 |
3.3 |
GO:0015705 |
iodide transport(GO:0015705) |
| 0.8 |
0.8 |
GO:0060423 |
foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.8 |
0.8 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.8 |
1.6 |
GO:2000832 |
negative regulation of steroid hormone secretion(GO:2000832) |
| 0.8 |
0.8 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.8 |
5.7 |
GO:0042754 |
negative regulation of circadian rhythm(GO:0042754) |
| 0.8 |
2.4 |
GO:0061312 |
BMP signaling pathway involved in heart development(GO:0061312) |
| 0.8 |
2.4 |
GO:2000297 |
negative regulation of synapse maturation(GO:2000297) |
| 0.8 |
4.8 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.8 |
5.6 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 0.8 |
0.8 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 0.8 |
10.4 |
GO:0046599 |
regulation of centriole replication(GO:0046599) |
| 0.8 |
2.4 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.8 |
0.8 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 0.8 |
0.8 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.8 |
3.2 |
GO:0099527 |
postsynapse to nucleus signaling pathway(GO:0099527) |
| 0.8 |
0.8 |
GO:0060221 |
retinal rod cell differentiation(GO:0060221) |
| 0.8 |
3.2 |
GO:0051643 |
endoplasmic reticulum localization(GO:0051643) |
| 0.8 |
0.8 |
GO:0061511 |
centriole elongation(GO:0061511) |
| 0.8 |
3.9 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.8 |
2.3 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.8 |
2.3 |
GO:0010626 |
negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.8 |
2.3 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.8 |
6.2 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.8 |
4.6 |
GO:1900026 |
positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
| 0.8 |
3.0 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.8 |
0.8 |
GO:0009153 |
purine deoxyribonucleotide biosynthetic process(GO:0009153) |
| 0.8 |
0.8 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.8 |
2.3 |
GO:0051105 |
regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.7 |
5.2 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.7 |
1.5 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 0.7 |
2.2 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.7 |
0.7 |
GO:1904192 |
cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.7 |
2.2 |
GO:0001827 |
inner cell mass cell fate commitment(GO:0001827) |
| 0.7 |
5.9 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.7 |
2.2 |
GO:0014809 |
regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.7 |
0.7 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.7 |
3.6 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 0.7 |
4.3 |
GO:0002681 |
somatic diversification of T cell receptor genes(GO:0002568) somatic recombination of T cell receptor gene segments(GO:0002681) T cell receptor V(D)J recombination(GO:0033153) |
| 0.7 |
0.7 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.7 |
2.2 |
GO:0002432 |
granuloma formation(GO:0002432) |
| 0.7 |
1.4 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.7 |
4.3 |
GO:0033031 |
positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.7 |
1.4 |
GO:1902174 |
positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.7 |
0.7 |
GO:0060484 |
lung-associated mesenchyme development(GO:0060484) |
| 0.7 |
2.8 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.7 |
2.1 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.7 |
0.7 |
GO:0097151 |
positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.7 |
1.4 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.7 |
7.0 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.7 |
0.7 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.7 |
2.8 |
GO:1902969 |
mitotic DNA replication(GO:1902969) |
| 0.7 |
1.4 |
GO:0045041 |
protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.7 |
2.1 |
GO:1902396 |
protein localization to bicellular tight junction(GO:1902396) |
| 0.7 |
1.4 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 0.7 |
3.5 |
GO:1902309 |
negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.7 |
2.8 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.7 |
3.5 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.7 |
2.1 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.7 |
4.8 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 0.7 |
1.4 |
GO:0071707 |
immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 0.7 |
2.1 |
GO:2000501 |
natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.7 |
2.8 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.7 |
1.4 |
GO:0097168 |
mesenchymal stem cell proliferation(GO:0097168) |
| 0.7 |
4.8 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.7 |
8.2 |
GO:2000392 |
regulation of lamellipodium morphogenesis(GO:2000392) |
| 0.7 |
2.0 |
GO:0019659 |
fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.7 |
0.7 |
GO:0010519 |
negative regulation of phospholipase activity(GO:0010519) |
| 0.7 |
4.7 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.7 |
8.8 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.7 |
2.7 |
GO:1900147 |
Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.7 |
2.0 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.7 |
2.0 |
GO:0045091 |
regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
| 0.7 |
4.0 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 0.7 |
6.0 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.7 |
3.3 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.7 |
0.7 |
GO:2000269 |
regulation of fibroblast apoptotic process(GO:2000269) |
| 0.7 |
11.3 |
GO:0007530 |
sex determination(GO:0007530) |
| 0.7 |
6.6 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.7 |
4.6 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.7 |
22.2 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.7 |
0.7 |
GO:0031161 |
phosphatidylinositol catabolic process(GO:0031161) |
| 0.7 |
3.3 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.6 |
5.8 |
GO:0090394 |
negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.6 |
2.6 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.6 |
0.6 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.6 |
0.6 |
GO:2000969 |
positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.6 |
1.9 |
GO:0051135 |
positive regulation of NK T cell activation(GO:0051135) |
| 0.6 |
1.9 |
GO:1902410 |
mitotic cytokinetic process(GO:1902410) |
| 0.6 |
1.3 |
GO:0071649 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.6 |
1.9 |
GO:0030214 |
hyaluronan catabolic process(GO:0030214) |
| 0.6 |
1.9 |
GO:0090235 |
regulation of metaphase plate congression(GO:0090235) |
| 0.6 |
5.1 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.6 |
1.3 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.6 |
2.5 |
GO:0002924 |
negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.6 |
5.7 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.6 |
1.3 |
GO:0061156 |
pulmonary artery morphogenesis(GO:0061156) |
| 0.6 |
1.3 |
GO:0009174 |
UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.6 |
6.9 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.6 |
2.5 |
GO:0001977 |
renal system process involved in regulation of blood volume(GO:0001977) |
| 0.6 |
2.5 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.6 |
1.2 |
GO:0019401 |
alditol biosynthetic process(GO:0019401) |
| 0.6 |
1.2 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.6 |
0.6 |
GO:0034724 |
DNA replication-independent nucleosome organization(GO:0034724) |
| 0.6 |
1.2 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.6 |
1.8 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.6 |
1.2 |
GO:0090135 |
actin filament branching(GO:0090135) |
| 0.6 |
0.6 |
GO:0060601 |
lateral sprouting from an epithelium(GO:0060601) |
| 0.6 |
11.0 |
GO:2000574 |
regulation of microtubule motor activity(GO:2000574) |
| 0.6 |
3.6 |
GO:1901673 |
regulation of mitotic spindle assembly(GO:1901673) |
| 0.6 |
1.8 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.6 |
18.7 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.6 |
3.6 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.6 |
1.2 |
GO:0098908 |
regulation of neuronal action potential(GO:0098908) |
| 0.6 |
1.8 |
GO:0034473 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.6 |
7.8 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.6 |
1.8 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.6 |
1.2 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.6 |
1.8 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.6 |
11.3 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.6 |
7.7 |
GO:0007190 |
activation of adenylate cyclase activity(GO:0007190) |
| 0.6 |
1.2 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.6 |
3.0 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.6 |
1.2 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.6 |
6.4 |
GO:0060732 |
positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.6 |
8.2 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.6 |
1.7 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.6 |
5.8 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.6 |
2.3 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.6 |
1.7 |
GO:0001830 |
trophectodermal cell fate commitment(GO:0001830) |
| 0.6 |
3.4 |
GO:0046490 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.6 |
1.1 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.6 |
1.7 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.6 |
1.1 |
GO:0036363 |
transforming growth factor beta activation(GO:0036363) |
| 0.6 |
5.7 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.6 |
3.4 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.6 |
1.7 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.6 |
6.2 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.6 |
1.1 |
GO:1904580 |
regulation of intracellular mRNA localization(GO:1904580) |
| 0.6 |
2.8 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) regulation of parathyroid hormone secretion(GO:2000828) |
| 0.6 |
0.6 |
GO:0007213 |
G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.6 |
3.4 |
GO:0071476 |
cellular hypotonic response(GO:0071476) |
| 0.6 |
6.2 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.6 |
0.6 |
GO:2000644 |
low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) regulation of receptor catabolic process(GO:2000644) |
| 0.6 |
2.8 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.6 |
5.0 |
GO:0048875 |
chemical homeostasis within a tissue(GO:0048875) |
| 0.6 |
2.8 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.6 |
5.0 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.6 |
1.7 |
GO:1990927 |
calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.6 |
1.1 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.5 |
7.1 |
GO:0071392 |
cellular response to estradiol stimulus(GO:0071392) |
| 0.5 |
0.5 |
GO:0071285 |
cellular response to lithium ion(GO:0071285) |
| 0.5 |
3.2 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.5 |
3.2 |
GO:1902715 |
positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.5 |
1.1 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.5 |
1.1 |
GO:0035523 |
protein K29-linked deubiquitination(GO:0035523) |
| 0.5 |
1.6 |
GO:2000312 |
regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.5 |
0.5 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.5 |
1.1 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.5 |
3.7 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.5 |
1.6 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.5 |
1.6 |
GO:0046381 |
CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.5 |
4.2 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.5 |
2.1 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.5 |
3.1 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 0.5 |
1.6 |
GO:1904207 |
chemokine (C-C motif) ligand 2 secretion(GO:0035926) regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 0.5 |
1.0 |
GO:0010360 |
negative regulation of anion channel activity(GO:0010360) |
| 0.5 |
16.5 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.5 |
2.6 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.5 |
0.5 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.5 |
1.0 |
GO:0090232 |
positive regulation of spindle checkpoint(GO:0090232) |
| 0.5 |
1.5 |
GO:1990859 |
cellular response to endothelin(GO:1990859) |
| 0.5 |
7.1 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.5 |
19.2 |
GO:1902808 |
positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.5 |
1.5 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.5 |
3.5 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.5 |
1.5 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.5 |
3.0 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 0.5 |
2.0 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.5 |
1.5 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.5 |
4.0 |
GO:1902570 |
protein localization to nucleolus(GO:1902570) |
| 0.5 |
3.0 |
GO:0060837 |
blood vessel endothelial cell differentiation(GO:0060837) |
| 0.5 |
2.0 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.5 |
6.0 |
GO:0045780 |
positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
| 0.5 |
1.0 |
GO:0000448 |
cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
| 0.5 |
1.0 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.5 |
0.5 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.5 |
5.4 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.5 |
3.0 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.5 |
3.0 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.5 |
1.5 |
GO:0021826 |
substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
| 0.5 |
0.5 |
GO:0042118 |
endothelial cell activation(GO:0042118) |
| 0.5 |
2.0 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.5 |
1.5 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.5 |
9.2 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.5 |
1.4 |
GO:1902255 |
positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.5 |
1.4 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.5 |
1.9 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 0.5 |
0.5 |
GO:2000510 |
positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.5 |
2.4 |
GO:0034436 |
glycoprotein transport(GO:0034436) |
| 0.5 |
1.9 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) |
| 0.5 |
0.5 |
GO:0014735 |
regulation of muscle atrophy(GO:0014735) |
| 0.5 |
0.5 |
GO:0071963 |
establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.5 |
0.5 |
GO:0090370 |
negative regulation of sterol transport(GO:0032372) negative regulation of cholesterol transport(GO:0032375) negative regulation of cholesterol efflux(GO:0090370) |
| 0.5 |
3.8 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.5 |
1.9 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.5 |
0.9 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.5 |
0.9 |
GO:0035793 |
regulation of phosphatidylinositol biosynthetic process(GO:0010511) negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.5 |
0.9 |
GO:0070459 |
prolactin secretion(GO:0070459) |
| 0.5 |
3.7 |
GO:0060068 |
vagina development(GO:0060068) |
| 0.5 |
0.9 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.5 |
0.5 |
GO:0060028 |
convergent extension involved in axis elongation(GO:0060028) |
| 0.5 |
1.4 |
GO:0072643 |
interferon-gamma secretion(GO:0072643) |
| 0.5 |
6.5 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.5 |
0.5 |
GO:0039692 |
single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.5 |
3.2 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.5 |
2.8 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.5 |
0.9 |
GO:0075136 |
response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.5 |
1.4 |
GO:0051754 |
meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.5 |
1.4 |
GO:0030300 |
regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.5 |
2.3 |
GO:2000325 |
regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.5 |
1.4 |
GO:0032462 |
regulation of protein homooligomerization(GO:0032462) |
| 0.5 |
2.7 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.5 |
4.6 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.5 |
6.4 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.5 |
0.5 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.5 |
0.9 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.5 |
0.5 |
GO:0007621 |
negative regulation of female receptivity(GO:0007621) |
| 0.4 |
0.4 |
GO:0030540 |
female genitalia development(GO:0030540) |
| 0.4 |
2.7 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.4 |
0.9 |
GO:0070445 |
oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.4 |
2.7 |
GO:0060164 |
regulation of timing of neuron differentiation(GO:0060164) |
| 0.4 |
3.1 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.4 |
2.7 |
GO:2001269 |
positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.4 |
3.1 |
GO:0098909 |
regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
| 0.4 |
1.3 |
GO:0000414 |
regulation of histone H3-K36 methylation(GO:0000414) |
| 0.4 |
1.8 |
GO:0002175 |
protein localization to paranode region of axon(GO:0002175) |
| 0.4 |
0.4 |
GO:1905049 |
regulation of metallopeptidase activity(GO:1905048) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.4 |
7.9 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.4 |
2.2 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.4 |
3.9 |
GO:0032075 |
positive regulation of nuclease activity(GO:0032075) |
| 0.4 |
3.9 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.4 |
0.9 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.4 |
1.3 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.4 |
0.9 |
GO:0033864 |
positive regulation of NAD(P)H oxidase activity(GO:0033864) |
| 0.4 |
3.8 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.4 |
1.3 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.4 |
6.3 |
GO:0006999 |
nuclear pore organization(GO:0006999) |
| 0.4 |
4.2 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.4 |
3.3 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.4 |
0.8 |
GO:0048636 |
positive regulation of striated muscle tissue development(GO:0045844) positive regulation of muscle organ development(GO:0048636) positive regulation of muscle tissue development(GO:1901863) |
| 0.4 |
1.7 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.4 |
7.9 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.4 |
3.3 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.4 |
1.2 |
GO:0051582 |
positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.4 |
0.8 |
GO:0006538 |
glutamate catabolic process(GO:0006538) |
| 0.4 |
2.9 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.4 |
11.1 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.4 |
1.6 |
GO:2001245 |
regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.4 |
1.2 |
GO:0098968 |
neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.4 |
1.6 |
GO:0045876 |
positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.4 |
1.6 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 0.4 |
1.2 |
GO:2000642 |
negative regulation of vacuolar transport(GO:1903336) negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.4 |
1.2 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.4 |
1.2 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.4 |
1.2 |
GO:2000256 |
positive regulation of male germ cell proliferation(GO:2000256) |
| 0.4 |
1.2 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.4 |
0.4 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.4 |
1.2 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.4 |
0.8 |
GO:0042483 |
negative regulation of odontogenesis(GO:0042483) |
| 0.4 |
0.8 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 0.4 |
1.2 |
GO:0060430 |
lung saccule development(GO:0060430) |
| 0.4 |
1.6 |
GO:0045136 |
development of secondary sexual characteristics(GO:0045136) |
| 0.4 |
1.6 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.4 |
0.4 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.4 |
4.3 |
GO:0046855 |
inositol phosphate dephosphorylation(GO:0046855) |
| 0.4 |
3.5 |
GO:0045947 |
negative regulation of translational initiation(GO:0045947) |
| 0.4 |
1.2 |
GO:0042823 |
pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.4 |
3.1 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.4 |
0.8 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 0.4 |
0.8 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.4 |
15.5 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.4 |
1.2 |
GO:0043686 |
co-translational protein modification(GO:0043686) |
| 0.4 |
5.4 |
GO:0006890 |
retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.4 |
0.8 |
GO:0010579 |
regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.4 |
7.0 |
GO:0031643 |
positive regulation of myelination(GO:0031643) |
| 0.4 |
1.9 |
GO:0043314 |
negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 0.4 |
0.4 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.4 |
8.1 |
GO:0007020 |
microtubule nucleation(GO:0007020) |
| 0.4 |
3.1 |
GO:0031069 |
hair follicle morphogenesis(GO:0031069) |
| 0.4 |
0.4 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.4 |
1.9 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.4 |
3.4 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.4 |
3.4 |
GO:0048170 |
positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.4 |
1.1 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.4 |
0.8 |
GO:0046370 |
fructose biosynthetic process(GO:0046370) |
| 0.4 |
1.5 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.4 |
1.1 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.4 |
1.1 |
GO:0030202 |
heparin metabolic process(GO:0030202) |
| 0.4 |
1.1 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.4 |
4.1 |
GO:0014856 |
skeletal muscle cell proliferation(GO:0014856) regulation of skeletal muscle cell proliferation(GO:0014857) |
| 0.4 |
0.7 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.4 |
3.7 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.4 |
2.6 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.4 |
1.5 |
GO:0001990 |
regulation of systemic arterial blood pressure by hormone(GO:0001990) |
| 0.4 |
3.6 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.4 |
1.1 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.4 |
1.8 |
GO:0007197 |
adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.4 |
1.1 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.4 |
4.0 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.4 |
2.5 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.4 |
1.1 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 0.4 |
1.1 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 0.4 |
3.9 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.4 |
1.4 |
GO:0007182 |
common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.4 |
3.2 |
GO:0001771 |
immunological synapse formation(GO:0001771) |
| 0.3 |
2.8 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.3 |
0.7 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.3 |
1.0 |
GO:0000430 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.3 |
0.7 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.3 |
2.1 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.3 |
1.0 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.3 |
2.1 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.3 |
0.3 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.3 |
0.7 |
GO:0035728 |
response to hepatocyte growth factor(GO:0035728) |
| 0.3 |
0.7 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.3 |
1.0 |
GO:0097274 |
urea homeostasis(GO:0097274) |
| 0.3 |
0.3 |
GO:0072282 |
metanephric nephron tubule morphogenesis(GO:0072282) |
| 0.3 |
3.4 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.3 |
0.7 |
GO:0072033 |
renal vesicle formation(GO:0072033) |
| 0.3 |
1.7 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.3 |
0.3 |
GO:0060003 |
copper ion export(GO:0060003) |
| 0.3 |
0.3 |
GO:0071286 |
cellular response to magnesium ion(GO:0071286) |
| 0.3 |
1.3 |
GO:1903756 |
regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903756) negative regulation of transcription from RNA polymerase II promoter by histone modification(GO:1903758) |
| 0.3 |
3.7 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.3 |
3.3 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.3 |
0.7 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 |
1.3 |
GO:1900028 |
negative regulation of ruffle assembly(GO:1900028) |
| 0.3 |
1.6 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.3 |
0.7 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.3 |
0.3 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.3 |
6.6 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.3 |
0.3 |
GO:0072044 |
collecting duct development(GO:0072044) |
| 0.3 |
0.7 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.3 |
0.7 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.3 |
1.6 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.3 |
1.0 |
GO:1902219 |
negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.3 |
2.6 |
GO:0090043 |
regulation of tubulin deacetylation(GO:0090043) |
| 0.3 |
1.0 |
GO:0044828 |
negative regulation by host of viral genome replication(GO:0044828) |
| 0.3 |
0.6 |
GO:0060623 |
regulation of chromosome condensation(GO:0060623) |
| 0.3 |
3.2 |
GO:0051571 |
positive regulation of histone H3-K4 methylation(GO:0051571) |
| 0.3 |
0.9 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.3 |
0.6 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) |
| 0.3 |
0.9 |
GO:0035937 |
estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
| 0.3 |
1.3 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.3 |
1.6 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.3 |
0.9 |
GO:2000737 |
negative regulation of stem cell differentiation(GO:2000737) |
| 0.3 |
0.6 |
GO:0046073 |
dTMP biosynthetic process(GO:0006231) dTMP metabolic process(GO:0046073) |
| 0.3 |
4.7 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.3 |
2.8 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.3 |
0.3 |
GO:0086016 |
AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) |
| 0.3 |
1.2 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.3 |
0.9 |
GO:1905247 |
positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.3 |
0.9 |
GO:0019323 |
pentose catabolic process(GO:0019323) |
| 0.3 |
0.6 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.3 |
1.2 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.3 |
0.9 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.3 |
1.2 |
GO:0045541 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.3 |
1.2 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.3 |
28.8 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.3 |
0.3 |
GO:0035234 |
ectopic germ cell programmed cell death(GO:0035234) |
| 0.3 |
0.9 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.3 |
0.9 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.3 |
0.9 |
GO:0051388 |
positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.3 |
2.9 |
GO:1900038 |
negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.3 |
3.2 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.3 |
1.2 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.3 |
0.9 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.3 |
9.1 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.3 |
0.3 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.3 |
1.4 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.3 |
0.9 |
GO:0072429 |
response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.3 |
0.6 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 0.3 |
0.3 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.3 |
1.4 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.3 |
0.6 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.3 |
1.1 |
GO:0006884 |
cell volume homeostasis(GO:0006884) |
| 0.3 |
1.1 |
GO:0036499 |
PERK-mediated unfolded protein response(GO:0036499) |
| 0.3 |
1.1 |
GO:0044861 |
protein transport into plasma membrane raft(GO:0044861) |
| 0.3 |
0.8 |
GO:0038165 |
oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.3 |
3.3 |
GO:0006706 |
steroid catabolic process(GO:0006706) |
| 0.3 |
2.2 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.3 |
2.2 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.3 |
1.4 |
GO:0051569 |
regulation of histone H3-K4 methylation(GO:0051569) |
| 0.3 |
0.3 |
GO:2000137 |
negative regulation of cell proliferation involved in heart morphogenesis(GO:2000137) |
| 0.3 |
2.8 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.3 |
0.5 |
GO:0032532 |
regulation of microvillus length(GO:0032532) |
| 0.3 |
0.8 |
GO:0051316 |
attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
| 0.3 |
3.0 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 0.3 |
2.2 |
GO:0061084 |
negative regulation of protein refolding(GO:0061084) negative regulation of protein folding(GO:1903333) |
| 0.3 |
0.3 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.3 |
1.4 |
GO:2000623 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.3 |
0.5 |
GO:0097201 |
negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.3 |
0.8 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.3 |
3.5 |
GO:0071353 |
cellular response to interleukin-4(GO:0071353) |
| 0.3 |
1.1 |
GO:0014043 |
negative regulation of neuron maturation(GO:0014043) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) |
| 0.3 |
0.3 |
GO:0009211 |
pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 0.3 |
1.1 |
GO:0060155 |
platelet dense granule organization(GO:0060155) |
| 0.3 |
0.8 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.3 |
0.8 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.3 |
1.6 |
GO:0090070 |
positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.3 |
3.7 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.3 |
0.3 |
GO:0006667 |
sphinganine metabolic process(GO:0006667) |
| 0.3 |
1.1 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.3 |
1.1 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.3 |
0.5 |
GO:0034372 |
very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.3 |
2.4 |
GO:0050942 |
positive regulation of pigment cell differentiation(GO:0050942) |
| 0.3 |
2.6 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.3 |
1.6 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.3 |
0.3 |
GO:0006264 |
mitochondrial DNA replication(GO:0006264) |
| 0.3 |
2.1 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.3 |
7.2 |
GO:0008631 |
intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.3 |
1.0 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.3 |
0.5 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.3 |
1.0 |
GO:0000098 |
sulfur amino acid catabolic process(GO:0000098) |
| 0.3 |
1.0 |
GO:0000492 |
box C/D snoRNP assembly(GO:0000492) |
| 0.3 |
1.8 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.3 |
0.5 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.3 |
0.8 |
GO:0021691 |
cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.3 |
1.0 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.3 |
0.8 |
GO:1901731 |
positive regulation of platelet aggregation(GO:1901731) |
| 0.2 |
0.5 |
GO:0043323 |
positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.2 |
0.7 |
GO:0042275 |
error-free postreplication DNA repair(GO:0042275) |
| 0.2 |
0.7 |
GO:0032914 |
positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.2 |
0.2 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.2 |
0.2 |
GO:0044340 |
canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.2 |
0.5 |
GO:0098914 |
membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.2 |
2.2 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.2 |
2.7 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.2 |
0.7 |
GO:0070650 |
actin filament bundle distribution(GO:0070650) |
| 0.2 |
0.5 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.2 |
0.7 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.2 |
0.2 |
GO:0070365 |
hepatocyte differentiation(GO:0070365) |
| 0.2 |
1.2 |
GO:2001204 |
regulation of osteoclast development(GO:2001204) |
| 0.2 |
0.5 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 0.2 |
0.2 |
GO:0033045 |
regulation of sister chromatid segregation(GO:0033045) |
| 0.2 |
2.4 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 0.2 |
1.7 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.2 |
1.7 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.2 |
0.2 |
GO:0032056 |
positive regulation of translation in response to stress(GO:0032056) |
| 0.2 |
1.2 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.2 |
2.4 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 0.2 |
1.4 |
GO:1900119 |
positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.2 |
0.7 |
GO:0032310 |
prostaglandin secretion(GO:0032310) |
| 0.2 |
0.9 |
GO:0090231 |
regulation of spindle checkpoint(GO:0090231) |
| 0.2 |
0.9 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.2 |
0.2 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.2 |
3.3 |
GO:0031577 |
spindle checkpoint(GO:0031577) |
| 0.2 |
0.9 |
GO:0015744 |
succinate transport(GO:0015744) |
| 0.2 |
0.9 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.2 |
0.7 |
GO:0033206 |
meiotic cytokinesis(GO:0033206) |
| 0.2 |
3.2 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.2 |
0.2 |
GO:0045472 |
response to ether(GO:0045472) |
| 0.2 |
0.5 |
GO:0000454 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.2 |
0.5 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.2 |
0.7 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.2 |
7.0 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.2 |
2.9 |
GO:0045830 |
positive regulation of isotype switching(GO:0045830) |
| 0.2 |
0.5 |
GO:0042640 |
anagen(GO:0042640) |
| 0.2 |
8.1 |
GO:0007200 |
phospholipase C-activating G-protein coupled receptor signaling pathway(GO:0007200) |
| 0.2 |
0.9 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.2 |
0.4 |
GO:1900025 |
negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.2 |
0.7 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.2 |
1.3 |
GO:0051299 |
mitotic centrosome separation(GO:0007100) centrosome separation(GO:0051299) |
| 0.2 |
0.4 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.2 |
0.4 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 0.2 |
0.2 |
GO:0001711 |
endodermal cell fate commitment(GO:0001711) |
| 0.2 |
2.4 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.2 |
0.4 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.2 |
0.7 |
GO:0098706 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.2 |
0.4 |
GO:0033629 |
negative regulation of cell adhesion mediated by integrin(GO:0033629) negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.2 |
0.2 |
GO:1900368 |
regulation of RNA interference(GO:1900368) |
| 0.2 |
3.3 |
GO:0043277 |
apoptotic cell clearance(GO:0043277) |
| 0.2 |
0.4 |
GO:2000224 |
testosterone biosynthetic process(GO:0061370) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.2 |
1.5 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.2 |
0.4 |
GO:2000987 |
positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.2 |
1.9 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.2 |
0.6 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.2 |
0.6 |
GO:0097264 |
self proteolysis(GO:0097264) |
| 0.2 |
4.5 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.2 |
2.3 |
GO:1902751 |
positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.2 |
0.6 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.2 |
1.1 |
GO:0060297 |
regulation of sarcomere organization(GO:0060297) |
| 0.2 |
0.6 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.2 |
1.3 |
GO:2000736 |
regulation of stem cell differentiation(GO:2000736) |
| 0.2 |
1.7 |
GO:1901201 |
regulation of extracellular matrix assembly(GO:1901201) |
| 0.2 |
1.3 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.2 |
1.3 |
GO:0007080 |
mitotic metaphase plate congression(GO:0007080) |
| 0.2 |
1.3 |
GO:0071494 |
cellular response to UV-C(GO:0071494) |
| 0.2 |
7.5 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.2 |
1.2 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.2 |
0.2 |
GO:2001140 |
regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
| 0.2 |
0.2 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.2 |
0.8 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.2 |
2.4 |
GO:0045540 |
regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.2 |
7.5 |
GO:0033120 |
positive regulation of RNA splicing(GO:0033120) |
| 0.2 |
0.6 |
GO:0051014 |
actin filament severing(GO:0051014) |
| 0.2 |
0.6 |
GO:0002051 |
osteoblast fate commitment(GO:0002051) |
| 0.2 |
1.4 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.2 |
0.6 |
GO:0009071 |
serine family amino acid catabolic process(GO:0009071) |
| 0.2 |
0.2 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.2 |
1.4 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.2 |
1.0 |
GO:0006868 |
glutamine transport(GO:0006868) |
| 0.2 |
0.2 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.2 |
0.4 |
GO:0001539 |
cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 0.2 |
0.2 |
GO:2000047 |
regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
| 0.2 |
7.3 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.2 |
0.8 |
GO:0050667 |
homocysteine metabolic process(GO:0050667) |
| 0.2 |
0.2 |
GO:1902036 |
regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.2 |
0.8 |
GO:0019511 |
peptidyl-proline hydroxylation(GO:0019511) |
| 0.2 |
0.6 |
GO:0031999 |
negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.2 |
0.4 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.2 |
1.4 |
GO:0006415 |
translational termination(GO:0006415) |
| 0.2 |
0.4 |
GO:0010693 |
negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.2 |
2.2 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.2 |
6.4 |
GO:0046039 |
GTP metabolic process(GO:0046039) |
| 0.2 |
1.0 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.2 |
0.6 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.2 |
1.2 |
GO:1990481 |
mRNA pseudouridine synthesis(GO:1990481) |
| 0.2 |
0.2 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.2 |
0.2 |
GO:1904179 |
positive regulation of adipose tissue development(GO:1904179) |
| 0.2 |
0.6 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 0.2 |
0.6 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.2 |
0.6 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.2 |
0.6 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.2 |
0.4 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) glucose 1-phosphate metabolic process(GO:0019255) |
| 0.2 |
1.7 |
GO:1901223 |
negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.2 |
0.6 |
GO:0006121 |
mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.2 |
0.2 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.2 |
0.2 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.2 |
0.8 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.2 |
0.9 |
GO:1903077 |
negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
| 0.2 |
0.9 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.2 |
0.4 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.2 |
0.7 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.2 |
0.6 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.2 |
0.4 |
GO:0030422 |
production of siRNA involved in RNA interference(GO:0030422) |
| 0.2 |
0.7 |
GO:0043201 |
response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.2 |
0.9 |
GO:0044033 |
multi-organism metabolic process(GO:0044033) |
| 0.2 |
0.4 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 0.2 |
0.9 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.2 |
1.3 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.2 |
1.5 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.2 |
1.1 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.2 |
2.2 |
GO:0047497 |
establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.2 |
0.7 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.2 |
0.4 |
GO:0045590 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.2 |
0.7 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.2 |
0.4 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.2 |
0.9 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 |
0.2 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.2 |
0.5 |
GO:0001180 |
transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.2 |
0.2 |
GO:2000036 |
regulation of stem cell population maintenance(GO:2000036) |
| 0.2 |
0.5 |
GO:0061092 |
regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.2 |
0.2 |
GO:0097680 |
double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.2 |
2.5 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.2 |
1.2 |
GO:0098885 |
modification of postsynaptic actin cytoskeleton(GO:0098885) |
| 0.2 |
0.2 |
GO:1903244 |
positive regulation of cardiac muscle adaptation(GO:0010615) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.2 |
0.7 |
GO:0070423 |
nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.2 |
0.7 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.2 |
0.9 |
GO:1901552 |
positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.2 |
1.6 |
GO:0009263 |
deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.2 |
0.5 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.2 |
1.2 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.2 |
0.7 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.2 |
1.7 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.2 |
0.7 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.2 |
1.2 |
GO:0001912 |
positive regulation of leukocyte mediated cytotoxicity(GO:0001912) |
| 0.2 |
0.7 |
GO:0014029 |
neural crest formation(GO:0014029) |
| 0.2 |
1.4 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.2 |
0.3 |
GO:0099550 |
trans-synaptic signalling, modulating synaptic transmission(GO:0099550) |
| 0.2 |
7.5 |
GO:0070613 |
regulation of protein processing(GO:0070613) |
| 0.2 |
2.2 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.2 |
0.3 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.2 |
0.3 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.2 |
1.0 |
GO:1901911 |
diphosphoinositol polyphosphate metabolic process(GO:0071543) diadenosine pentaphosphate metabolic process(GO:1901906) diadenosine pentaphosphate catabolic process(GO:1901907) diadenosine hexaphosphate metabolic process(GO:1901908) diadenosine hexaphosphate catabolic process(GO:1901909) adenosine 5'-(hexahydrogen pentaphosphate) metabolic process(GO:1901910) adenosine 5'-(hexahydrogen pentaphosphate) catabolic process(GO:1901911) |
| 0.2 |
0.8 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.2 |
0.3 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.2 |
0.2 |
GO:1901989 |
positive regulation of cell cycle phase transition(GO:1901989) |
| 0.2 |
0.2 |
GO:0090035 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.2 |
1.0 |
GO:0042534 |
tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.2 |
0.8 |
GO:0046688 |
response to copper ion(GO:0046688) |
| 0.2 |
0.8 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.2 |
0.7 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.2 |
0.3 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.2 |
0.2 |
GO:0072720 |
response to dithiothreitol(GO:0072720) |
| 0.2 |
2.8 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.2 |
0.7 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.2 |
1.9 |
GO:1902850 |
microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.2 |
1.1 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.2 |
0.3 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.2 |
1.8 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.2 |
0.6 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.2 |
1.7 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 0.2 |
0.5 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.2 |
1.6 |
GO:0008053 |
mitochondrial fusion(GO:0008053) |
| 0.2 |
1.3 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.2 |
0.2 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.2 |
0.2 |
GO:0070827 |
chromatin maintenance(GO:0070827) |
| 0.2 |
0.6 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.2 |
0.6 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.2 |
0.2 |
GO:1904959 |
regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
| 0.2 |
0.5 |
GO:0002946 |
tRNA C5-cytosine methylation(GO:0002946) |
| 0.2 |
1.4 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.2 |
0.6 |
GO:0032471 |
negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.2 |
0.2 |
GO:0051665 |
membrane raft localization(GO:0051665) |
| 0.2 |
0.5 |
GO:0060368 |
regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
| 0.2 |
0.5 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.2 |
0.8 |
GO:0019673 |
GDP-mannose metabolic process(GO:0019673) |
| 0.2 |
0.2 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.2 |
0.5 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.2 |
0.8 |
GO:0008630 |
intrinsic apoptotic signaling pathway in response to DNA damage(GO:0008630) |
| 0.2 |
0.5 |
GO:0046726 |
positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.2 |
0.5 |
GO:0034115 |
negative regulation of heterotypic cell-cell adhesion(GO:0034115) cell-cell adhesion involved in gastrulation(GO:0070586) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
| 0.2 |
0.8 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.2 |
0.2 |
GO:0035561 |
regulation of chromatin binding(GO:0035561) |
| 0.2 |
4.3 |
GO:0006911 |
phagocytosis, engulfment(GO:0006911) |
| 0.2 |
0.8 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.2 |
4.1 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.2 |
2.4 |
GO:0045760 |
positive regulation of action potential(GO:0045760) |
| 0.2 |
0.5 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.2 |
0.6 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.2 |
0.5 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.2 |
1.4 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 |
0.3 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.1 |
0.6 |
GO:0043470 |
regulation of carbohydrate catabolic process(GO:0043470) regulation of cellular carbohydrate catabolic process(GO:0043471) |
| 0.1 |
0.4 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 |
4.8 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
0.7 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.1 |
0.1 |
GO:1902534 |
single-organism membrane invagination(GO:1902534) |
| 0.1 |
1.3 |
GO:0045048 |
protein insertion into ER membrane(GO:0045048) |
| 0.1 |
0.6 |
GO:0070162 |
adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 |
0.3 |
GO:0007196 |
adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.1 |
0.4 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.1 |
0.6 |
GO:0035457 |
cellular response to interferon-alpha(GO:0035457) |
| 0.1 |
0.3 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 0.1 |
0.7 |
GO:0090666 |
scaRNA localization to Cajal body(GO:0090666) |
| 0.1 |
3.9 |
GO:0048791 |
calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.1 |
1.5 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.1 |
1.9 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.1 |
0.3 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 |
0.7 |
GO:0042711 |
maternal behavior(GO:0042711) |
| 0.1 |
2.4 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.1 |
0.4 |
GO:0097309 |
cap1 mRNA methylation(GO:0097309) |
| 0.1 |
2.9 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.1 |
0.1 |
GO:0007227 |
signal transduction downstream of smoothened(GO:0007227) |
| 0.1 |
1.4 |
GO:2000291 |
regulation of myoblast proliferation(GO:2000291) |
| 0.1 |
0.4 |
GO:0016256 |
N-glycan processing to lysosome(GO:0016256) |
| 0.1 |
0.9 |
GO:1990845 |
adaptive thermogenesis(GO:1990845) |
| 0.1 |
0.1 |
GO:0001922 |
B-1 B cell homeostasis(GO:0001922) |
| 0.1 |
0.4 |
GO:0055118 |
negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.1 |
0.3 |
GO:0090306 |
spindle assembly involved in meiosis(GO:0090306) |
| 0.1 |
0.7 |
GO:0009303 |
rRNA transcription(GO:0009303) |
| 0.1 |
0.7 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.1 |
0.7 |
GO:0002888 |
positive regulation of myeloid leukocyte mediated immunity(GO:0002888) positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of leukocyte degranulation(GO:0043302) positive regulation of mast cell degranulation(GO:0043306) |
| 0.1 |
0.4 |
GO:0070476 |
rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.1 |
0.8 |
GO:0032693 |
negative regulation of interleukin-10 production(GO:0032693) |
| 0.1 |
0.8 |
GO:0006561 |
proline biosynthetic process(GO:0006561) |
| 0.1 |
0.1 |
GO:0090184 |
positive regulation of kidney development(GO:0090184) |
| 0.1 |
0.7 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.1 |
7.0 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.1 |
0.4 |
GO:0002014 |
vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
| 0.1 |
0.8 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.1 |
0.7 |
GO:0071380 |
cellular response to prostaglandin stimulus(GO:0071379) cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.1 |
0.5 |
GO:0006221 |
pyrimidine nucleotide biosynthetic process(GO:0006221) |
| 0.1 |
0.5 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
| 0.1 |
0.1 |
GO:2000767 |
positive regulation of cytoplasmic translation(GO:2000767) |
| 0.1 |
0.7 |
GO:0033184 |
positive regulation of histone ubiquitination(GO:0033184) |
| 0.1 |
0.4 |
GO:1990000 |
amyloid fibril formation(GO:1990000) |
| 0.1 |
1.0 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.1 |
0.5 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 |
0.1 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.1 |
1.1 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.1 |
0.4 |
GO:0051533 |
positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.1 |
0.5 |
GO:1902047 |
polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 |
0.5 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 |
2.4 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.1 |
0.9 |
GO:1903421 |
regulation of synaptic vesicle recycling(GO:1903421) |
| 0.1 |
0.3 |
GO:0000019 |
regulation of mitotic recombination(GO:0000019) |
| 0.1 |
0.4 |
GO:0051315 |
attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.1 |
0.4 |
GO:1901490 |
regulation of lymphangiogenesis(GO:1901490) negative regulation of lymphangiogenesis(GO:1901491) |
| 0.1 |
0.4 |
GO:0046135 |
pyrimidine ribonucleoside metabolic process(GO:0046131) pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.1 |
0.1 |
GO:0003419 |
growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.1 |
0.3 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.1 |
0.4 |
GO:0046952 |
ketone body catabolic process(GO:0046952) |
| 0.1 |
0.5 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.1 |
1.0 |
GO:0018342 |
protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.1 |
0.1 |
GO:0030913 |
paranodal junction assembly(GO:0030913) |
| 0.1 |
0.8 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.1 |
0.9 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
0.3 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.1 |
1.4 |
GO:0048194 |
Golgi vesicle budding(GO:0048194) |
| 0.1 |
0.3 |
GO:0021562 |
vestibulocochlear nerve development(GO:0021562) |
| 0.1 |
0.8 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.1 |
0.5 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.1 |
0.1 |
GO:0010890 |
positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.1 |
0.2 |
GO:0070922 |
small RNA loading onto RISC(GO:0070922) |
| 0.1 |
0.2 |
GO:0060287 |
epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.1 |
0.7 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.1 |
0.4 |
GO:0035617 |
stress granule disassembly(GO:0035617) |
| 0.1 |
1.2 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.1 |
0.5 |
GO:0090200 |
positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.1 |
1.5 |
GO:0090022 |
regulation of neutrophil chemotaxis(GO:0090022) |
| 0.1 |
0.4 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.1 |
0.1 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
0.4 |
GO:0034143 |
regulation of toll-like receptor 4 signaling pathway(GO:0034143) |
| 0.1 |
0.2 |
GO:0070213 |
protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 |
1.3 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.1 |
0.1 |
GO:0000963 |
mitochondrial RNA processing(GO:0000963) |
| 0.1 |
0.4 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.1 |
0.4 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.1 |
0.1 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.1 |
1.3 |
GO:0021884 |
forebrain neuron development(GO:0021884) |
| 0.1 |
0.4 |
GO:1903624 |
regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
| 0.1 |
3.3 |
GO:0042771 |
intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 |
1.1 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.1 |
0.2 |
GO:0031145 |
anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 |
0.5 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 |
0.5 |
GO:0034982 |
mitochondrial protein processing(GO:0034982) |
| 0.1 |
0.1 |
GO:0060174 |
limb bud formation(GO:0060174) |
| 0.1 |
0.5 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.1 |
1.3 |
GO:0046856 |
phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 |
0.8 |
GO:0014823 |
response to activity(GO:0014823) |
| 0.1 |
0.2 |
GO:0021539 |
subthalamus development(GO:0021539) |
| 0.1 |
0.5 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.1 |
1.9 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.1 |
0.1 |
GO:0010155 |
regulation of proton transport(GO:0010155) |
| 0.1 |
0.6 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 |
0.6 |
GO:0046349 |
amino sugar biosynthetic process(GO:0046349) |
| 0.1 |
0.4 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
0.6 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.1 |
0.2 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.1 |
0.6 |
GO:0038032 |
termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.1 |
0.3 |
GO:0015882 |
L-ascorbic acid transport(GO:0015882) transepithelial L-ascorbic acid transport(GO:0070904) |
| 0.1 |
0.3 |
GO:0072734 |
response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.1 |
0.2 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.1 |
2.5 |
GO:0007026 |
negative regulation of microtubule depolymerization(GO:0007026) |
| 0.1 |
0.8 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.1 |
0.8 |
GO:1903779 |
regulation of cardiac conduction(GO:1903779) |
| 0.1 |
0.4 |
GO:0045721 |
negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 |
0.1 |
GO:0000469 |
cleavage involved in rRNA processing(GO:0000469) |
| 0.1 |
1.1 |
GO:0005980 |
polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.1 |
0.8 |
GO:0035414 |
negative regulation of catenin import into nucleus(GO:0035414) |
| 0.1 |
0.3 |
GO:0043921 |
modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.1 |
1.1 |
GO:0000070 |
mitotic sister chromatid segregation(GO:0000070) |
| 0.1 |
0.5 |
GO:0022028 |
tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
| 0.1 |
2.3 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.1 |
0.3 |
GO:0070535 |
histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.1 |
0.3 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.1 |
0.6 |
GO:0050771 |
negative regulation of axonogenesis(GO:0050771) |
| 0.1 |
0.4 |
GO:1904528 |
positive regulation of microtubule binding(GO:1904528) |
| 0.1 |
0.4 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
0.3 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.1 |
0.5 |
GO:0070266 |
necroptotic process(GO:0070266) |
| 0.1 |
4.5 |
GO:0045814 |
negative regulation of gene expression, epigenetic(GO:0045814) |
| 0.1 |
1.3 |
GO:0046460 |
triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 0.1 |
0.2 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 |
0.3 |
GO:1904251 |
regulation of bile acid metabolic process(GO:1904251) |
| 0.1 |
0.3 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 |
1.7 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.1 |
GO:0003094 |
glomerular filtration(GO:0003094) |
| 0.1 |
0.1 |
GO:0021855 |
hypothalamus cell migration(GO:0021855) |
| 0.1 |
0.9 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.1 |
0.4 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 |
1.8 |
GO:0048261 |
negative regulation of receptor-mediated endocytosis(GO:0048261) |
| 0.1 |
2.7 |
GO:0071230 |
cellular response to amino acid stimulus(GO:0071230) |
| 0.1 |
0.3 |
GO:0031125 |
rRNA 3'-end processing(GO:0031125) |
| 0.1 |
0.4 |
GO:0072272 |
proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 0.1 |
0.5 |
GO:1900364 |
regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 |
2.2 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.1 |
0.9 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.1 |
0.1 |
GO:1904814 |
regulation of protein localization to chromosome, telomeric region(GO:1904814) |
| 0.1 |
0.3 |
GO:0016240 |
autophagosome docking(GO:0016240) |
| 0.1 |
0.7 |
GO:0006337 |
nucleosome disassembly(GO:0006337) |
| 0.1 |
0.2 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 |
0.6 |
GO:0046835 |
carbohydrate phosphorylation(GO:0046835) |
| 0.1 |
0.4 |
GO:0043117 |
positive regulation of vascular permeability(GO:0043117) |
| 0.1 |
1.5 |
GO:0006099 |
tricarboxylic acid cycle(GO:0006099) |
| 0.1 |
0.5 |
GO:0051352 |
negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.1 |
0.3 |
GO:0060051 |
negative regulation of protein ADP-ribosylation(GO:0010836) negative regulation of protein glycosylation(GO:0060051) |
| 0.1 |
0.7 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.1 |
0.8 |
GO:0046512 |
sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.1 |
0.2 |
GO:0036509 |
trimming of terminal mannose on B branch(GO:0036509) endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.1 |
0.3 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.1 |
0.5 |
GO:0034142 |
toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.1 |
0.2 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.1 |
1.2 |
GO:0006474 |
N-terminal protein amino acid acetylation(GO:0006474) |
| 0.1 |
0.1 |
GO:0000821 |
regulation of arginine metabolic process(GO:0000821) |
| 0.1 |
0.3 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 |
2.1 |
GO:0001841 |
neural tube formation(GO:0001841) |
| 0.1 |
0.1 |
GO:0036072 |
intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.1 |
0.2 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.1 |
0.6 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.1 |
0.2 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.1 |
0.2 |
GO:1903337 |
positive regulation of vacuolar transport(GO:1903337) |
| 0.1 |
0.5 |
GO:0036112 |
medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.1 |
1.3 |
GO:0051290 |
protein heterotetramerization(GO:0051290) |
| 0.1 |
0.4 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.1 |
0.6 |
GO:0031086 |
nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 |
0.7 |
GO:0046085 |
adenosine metabolic process(GO:0046085) |
| 0.1 |
0.3 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.1 |
0.2 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.1 |
0.3 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.1 |
0.1 |
GO:0046684 |
response to pyrethroid(GO:0046684) |
| 0.1 |
0.2 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.1 |
1.0 |
GO:0042044 |
fluid transport(GO:0042044) |
| 0.1 |
0.3 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.1 |
0.6 |
GO:0009410 |
response to xenobiotic stimulus(GO:0009410) |
| 0.1 |
1.2 |
GO:0008340 |
determination of adult lifespan(GO:0008340) |
| 0.1 |
0.1 |
GO:0060830 |
ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 |
5.0 |
GO:1903955 |
positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.1 |
0.3 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.1 |
2.3 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.2 |
GO:0006409 |
tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 |
0.4 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 |
0.2 |
GO:0002940 |
tRNA N2-guanine methylation(GO:0002940) |
| 0.1 |
0.3 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.1 |
0.6 |
GO:0048736 |
appendage development(GO:0048736) limb development(GO:0060173) |
| 0.1 |
0.8 |
GO:0001921 |
positive regulation of receptor recycling(GO:0001921) |
| 0.1 |
1.2 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 |
0.2 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.1 |
0.4 |
GO:0071391 |
cellular response to estrogen stimulus(GO:0071391) |
| 0.1 |
5.9 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.1 |
0.6 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.1 |
0.2 |
GO:0046032 |
ADP catabolic process(GO:0046032) IDP metabolic process(GO:0046707) IDP catabolic process(GO:0046709) |
| 0.1 |
0.2 |
GO:0090160 |
Golgi to lysosome transport(GO:0090160) |
| 0.1 |
0.7 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
1.6 |
GO:0007212 |
dopamine receptor signaling pathway(GO:0007212) |
| 0.1 |
0.5 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 |
0.2 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 |
0.1 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.1 |
0.2 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.1 |
0.3 |
GO:0001821 |
histamine secretion(GO:0001821) |
| 0.1 |
0.1 |
GO:0071166 |
ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.1 |
0.7 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.1 |
0.5 |
GO:0051958 |
methotrexate transport(GO:0051958) |
| 0.1 |
0.5 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.1 |
0.4 |
GO:0051968 |
positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
| 0.1 |
0.4 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.1 |
1.2 |
GO:0033194 |
response to hydroperoxide(GO:0033194) |
| 0.1 |
0.1 |
GO:0045112 |
integrin biosynthetic process(GO:0045112) |
| 0.1 |
1.2 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.1 |
0.1 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.1 |
0.1 |
GO:0072081 |
proximal/distal pattern formation involved in nephron development(GO:0072047) specification of nephron tubule identity(GO:0072081) specification of loop of Henle identity(GO:0072086) |
| 0.1 |
0.1 |
GO:0045657 |
positive regulation of monocyte differentiation(GO:0045657) |
| 0.1 |
0.7 |
GO:0030259 |
lipid glycosylation(GO:0030259) |
| 0.1 |
0.2 |
GO:0001927 |
exocyst assembly(GO:0001927) |
| 0.1 |
0.6 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 |
0.6 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.1 |
0.2 |
GO:0086045 |
membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.1 |
0.4 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 |
1.0 |
GO:1904353 |
regulation of telomere capping(GO:1904353) |
| 0.1 |
2.7 |
GO:0006414 |
translational elongation(GO:0006414) |
| 0.1 |
0.1 |
GO:0061724 |
lipophagy(GO:0061724) |
| 0.1 |
0.6 |
GO:0002455 |
humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
| 0.1 |
0.1 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.1 |
0.6 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.1 |
0.7 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.1 |
1.7 |
GO:0000462 |
maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.1 |
0.5 |
GO:0050832 |
defense response to fungus(GO:0050832) |
| 0.1 |
1.5 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.1 |
0.1 |
GO:0043634 |
polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
| 0.1 |
0.1 |
GO:0046541 |
saliva secretion(GO:0046541) |
| 0.1 |
0.1 |
GO:1990182 |
exosomal secretion(GO:1990182) |
| 0.1 |
0.1 |
GO:0036466 |
synaptic vesicle recycling via endosome(GO:0036466) |
| 0.1 |
0.7 |
GO:0003351 |
epithelial cilium movement(GO:0003351) |
| 0.1 |
0.1 |
GO:0035963 |
response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.1 |
0.3 |
GO:0097298 |
regulation of nucleus size(GO:0097298) |
| 0.1 |
0.3 |
GO:0006655 |
phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
| 0.1 |
0.5 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.1 |
1.2 |
GO:0035690 |
cellular response to drug(GO:0035690) |
| 0.1 |
0.1 |
GO:0060025 |
regulation of synaptic activity(GO:0060025) |
| 0.1 |
0.1 |
GO:0009162 |
deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.1 |
0.1 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.1 |
0.2 |
GO:0034969 |
histone arginine methylation(GO:0034969) |
| 0.1 |
0.3 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.1 |
0.1 |
GO:0032988 |
ribonucleoprotein complex disassembly(GO:0032988) |
| 0.1 |
0.1 |
GO:0070508 |
sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.1 |
0.4 |
GO:0051481 |
negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.1 |
0.4 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.1 |
0.2 |
GO:0014819 |
regulation of skeletal muscle contraction(GO:0014819) |
| 0.1 |
0.1 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.1 |
0.2 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.1 |
0.8 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.1 |
0.8 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.1 |
0.3 |
GO:1902775 |
mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 |
0.1 |
GO:0032527 |
protein exit from endoplasmic reticulum(GO:0032527) |
| 0.1 |
0.5 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.1 |
0.1 |
GO:0007181 |
transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.1 |
0.4 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
0.1 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.1 |
0.2 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.1 |
0.2 |
GO:0033273 |
response to vitamin(GO:0033273) |
| 0.1 |
0.2 |
GO:0006878 |
cellular copper ion homeostasis(GO:0006878) |
| 0.1 |
0.2 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) |
| 0.1 |
0.1 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.1 |
0.9 |
GO:0086036 |
regulation of cardiac muscle cell membrane potential(GO:0086036) |
| 0.1 |
0.9 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
0.1 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 |
0.1 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.1 |
0.1 |
GO:0045945 |
positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 |
0.1 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.1 |
0.3 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.1 |
0.2 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 |
0.1 |
GO:0060440 |
trachea formation(GO:0060440) regulation of Golgi inheritance(GO:0090170) |
| 0.1 |
0.1 |
GO:0071340 |
skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 |
0.1 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.1 |
0.2 |
GO:0070127 |
tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 |
0.2 |
GO:0048102 |
autophagic cell death(GO:0048102) |
| 0.1 |
0.1 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) fatty-acyl-CoA catabolic process(GO:0036115) |
| 0.1 |
0.2 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 |
0.1 |
GO:2000157 |
regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.1 |
0.1 |
GO:0016074 |
snoRNA metabolic process(GO:0016074) snoRNA processing(GO:0043144) |
| 0.1 |
2.7 |
GO:0022900 |
electron transport chain(GO:0022900) |
| 0.1 |
0.7 |
GO:0033173 |
calcineurin-NFAT signaling cascade(GO:0033173) inositol phosphate-mediated signaling(GO:0048016) |
| 0.1 |
0.3 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 |
0.2 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 |
0.2 |
GO:0014003 |
oligodendrocyte development(GO:0014003) |
| 0.0 |
0.3 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.0 |
0.0 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.0 |
0.5 |
GO:0035307 |
positive regulation of dephosphorylation(GO:0035306) positive regulation of protein dephosphorylation(GO:0035307) |
| 0.0 |
0.2 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 |
0.1 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.0 |
0.3 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 |
0.2 |
GO:0072318 |
clathrin coat disassembly(GO:0072318) |
| 0.0 |
0.1 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 |
0.2 |
GO:0007602 |
phototransduction(GO:0007602) |
| 0.0 |
0.0 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.0 |
0.3 |
GO:0002693 |
positive regulation of cellular extravasation(GO:0002693) |
| 0.0 |
0.1 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.0 |
0.1 |
GO:0035928 |
rRNA import into mitochondrion(GO:0035928) |
| 0.0 |
0.4 |
GO:0015937 |
coenzyme A biosynthetic process(GO:0015937) |
| 0.0 |
0.2 |
GO:0006071 |
glycerol metabolic process(GO:0006071) |
| 0.0 |
0.2 |
GO:0090282 |
positive regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071931) positive regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0090282) |
| 0.0 |
0.6 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 |
0.6 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 |
0.7 |
GO:0001825 |
blastocyst formation(GO:0001825) |
| 0.0 |
0.8 |
GO:0006418 |
tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 |
0.0 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.0 |
0.1 |
GO:0009814 |
defense response, incompatible interaction(GO:0009814) |
| 0.0 |
0.2 |
GO:1990022 |
RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 |
0.1 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 |
0.0 |
GO:0002070 |
epithelial cell maturation(GO:0002070) |
| 0.0 |
0.1 |
GO:0033326 |
cerebrospinal fluid secretion(GO:0033326) |
| 0.0 |
0.1 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.0 |
0.2 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 |
0.1 |
GO:1905244 |
neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) endosome to plasma membrane protein transport(GO:0099638) neurotransmitter receptor transport, endosome to plasma membrane(GO:0099639) regulation of modification of synaptic structure(GO:1905244) |
| 0.0 |
0.1 |
GO:0010958 |
regulation of amino acid import(GO:0010958) |
| 0.0 |
0.1 |
GO:0035774 |
positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.0 |
0.3 |
GO:0051306 |
mitotic sister chromatid separation(GO:0051306) |
| 0.0 |
0.2 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.0 |
0.3 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.0 |
0.1 |
GO:0043457 |
regulation of cellular respiration(GO:0043457) |
| 0.0 |
0.3 |
GO:0051281 |
positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
| 0.0 |
0.0 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.0 |
0.2 |
GO:0048013 |
ephrin receptor signaling pathway(GO:0048013) |
| 0.0 |
0.4 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 |
0.2 |
GO:0009988 |
cell-cell recognition(GO:0009988) |
| 0.0 |
0.2 |
GO:0035455 |
response to interferon-alpha(GO:0035455) |
| 0.0 |
0.2 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.0 |
0.1 |
GO:0033260 |
nuclear DNA replication(GO:0033260) |
| 0.0 |
0.3 |
GO:0006614 |
SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 |
0.4 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 |
0.2 |
GO:0061615 |
glycolytic process through fructose-6-phosphate(GO:0061615) |
| 0.0 |
0.0 |
GO:1901301 |
regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.0 |
0.1 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 |
0.1 |
GO:0007031 |
peroxisome organization(GO:0007031) |
| 0.0 |
0.1 |
GO:2000303 |
regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
| 0.0 |
0.1 |
GO:1903800 |
positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 |
0.2 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.0 |
0.1 |
GO:0002639 |
positive regulation of immunoglobulin production(GO:0002639) |
| 0.0 |
0.1 |
GO:0002118 |
aggressive behavior(GO:0002118) |
| 0.0 |
0.1 |
GO:0032026 |
response to magnesium ion(GO:0032026) |
| 0.0 |
0.1 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.0 |
0.1 |
GO:0045954 |
positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.0 |
0.0 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.0 |
0.2 |
GO:0050850 |
positive regulation of calcium-mediated signaling(GO:0050850) |
| 0.0 |
0.1 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.0 |
1.0 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.0 |
0.0 |
GO:1903321 |
negative regulation of protein modification by small protein conjugation or removal(GO:1903321) |
| 0.0 |
0.0 |
GO:0045059 |
positive thymic T cell selection(GO:0045059) |
| 0.0 |
0.4 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.0 |
0.5 |
GO:0035458 |
cellular response to interferon-beta(GO:0035458) |
| 0.0 |
0.2 |
GO:2000178 |
negative regulation of neural precursor cell proliferation(GO:2000178) |
| 0.0 |
0.1 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.0 |
1.6 |
GO:0006888 |
ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.0 |
0.1 |
GO:0060125 |
negative regulation of growth hormone secretion(GO:0060125) |
| 0.0 |
0.3 |
GO:1902749 |
regulation of cell cycle G2/M phase transition(GO:1902749) |
| 0.0 |
0.0 |
GO:1903630 |
regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
| 0.0 |
0.1 |
GO:0061450 |
trophoblast cell migration(GO:0061450) regulation of trophoblast cell migration(GO:1901163) |
| 0.0 |
0.0 |
GO:0008300 |
isoprenoid catabolic process(GO:0008300) |
| 0.0 |
0.1 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.0 |
0.3 |
GO:2000311 |
regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.0 |
0.1 |
GO:0001780 |
neutrophil homeostasis(GO:0001780) |
| 0.0 |
0.0 |
GO:0072610 |
interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.0 |
0.1 |
GO:0031065 |
positive regulation of histone deacetylation(GO:0031065) |
| 0.0 |
0.1 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 |
0.7 |
GO:1902017 |
regulation of cilium assembly(GO:1902017) |
| 0.0 |
0.1 |
GO:0021670 |
lateral ventricle development(GO:0021670) |
| 0.0 |
0.0 |
GO:0007288 |
sperm axoneme assembly(GO:0007288) |
| 0.0 |
0.0 |
GO:0097501 |
stress response to metal ion(GO:0097501) |
| 0.0 |
0.0 |
GO:0014054 |
positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.0 |
0.1 |
GO:0032438 |
melanosome organization(GO:0032438) pigment granule organization(GO:0048753) |
| 0.0 |
0.1 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 |
0.0 |
GO:0071034 |
CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.0 |
0.1 |
GO:0048745 |
smooth muscle tissue development(GO:0048745) |
| 0.0 |
0.3 |
GO:1902652 |
cholesterol metabolic process(GO:0008203) secondary alcohol metabolic process(GO:1902652) |
| 0.0 |
0.0 |
GO:0032309 |
icosanoid secretion(GO:0032309) icosanoid transport(GO:0071715) fatty acid derivative transport(GO:1901571) |
| 0.0 |
0.3 |
GO:0043407 |
negative regulation of MAP kinase activity(GO:0043407) |
| 0.0 |
0.3 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.0 |
0.0 |
GO:0071971 |
extracellular exosome assembly(GO:0071971) |
| 0.0 |
0.1 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 |
0.0 |
GO:0098501 |
polynucleotide dephosphorylation(GO:0098501) |
| 0.0 |
0.0 |
GO:0000117 |
regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0000117) |
| 0.0 |
0.1 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 |
0.0 |
GO:0007635 |
chemosensory behavior(GO:0007635) olfactory behavior(GO:0042048) |
| 0.0 |
0.1 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 |
0.0 |
GO:0099563 |
modification of synaptic structure(GO:0099563) |
| 0.0 |
0.0 |
GO:0031645 |
negative regulation of neurological system process(GO:0031645) |
| 0.0 |
0.2 |
GO:0009081 |
branched-chain amino acid metabolic process(GO:0009081) |
