| 4.7 |
14.0 |
GO:0097402 |
neuroblast migration(GO:0097402) |
| 4.3 |
12.8 |
GO:0035934 |
corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 4.2 |
12.5 |
GO:0050975 |
sensory perception of touch(GO:0050975) |
| 3.5 |
10.6 |
GO:0061075 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) positive regulation of neural retina development(GO:0061075) positive regulation of retina development in camera-type eye(GO:1902868) positive regulation of amacrine cell differentiation(GO:1902871) |
| 3.4 |
10.3 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 3.4 |
10.2 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 3.4 |
10.2 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 3.2 |
12.7 |
GO:0051902 |
negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 3.0 |
8.9 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 3.0 |
8.9 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 2.8 |
11.3 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 2.8 |
2.8 |
GO:0098712 |
L-glutamate import across plasma membrane(GO:0098712) |
| 2.8 |
8.4 |
GO:0060478 |
acrosomal vesicle exocytosis(GO:0060478) |
| 2.7 |
8.1 |
GO:0051892 |
negative regulation of cardioblast differentiation(GO:0051892) |
| 2.7 |
8.0 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 2.6 |
7.9 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 2.6 |
10.3 |
GO:1904936 |
cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 2.6 |
7.7 |
GO:0035585 |
calcium-mediated signaling using extracellular calcium source(GO:0035585) |
| 2.5 |
2.5 |
GO:1905072 |
cardiac jelly development(GO:1905072) |
| 2.5 |
10.1 |
GO:0044330 |
canonical Wnt signaling pathway involved in positive regulation of wound healing(GO:0044330) lactic acid secretion(GO:0046722) regulation of metanephric cap mesenchymal cell proliferation(GO:0090095) positive regulation of metanephric cap mesenchymal cell proliferation(GO:0090096) |
| 2.5 |
9.9 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 2.5 |
9.8 |
GO:0031133 |
regulation of axon diameter(GO:0031133) |
| 2.4 |
9.8 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 2.4 |
7.3 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 2.3 |
9.2 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 2.3 |
11.3 |
GO:0043314 |
negative regulation of neutrophil degranulation(GO:0043314) negative regulation of blood vessel remodeling(GO:0060313) |
| 2.3 |
9.0 |
GO:2000832 |
negative regulation of steroid hormone secretion(GO:2000832) |
| 2.3 |
6.8 |
GO:0010512 |
negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 2.2 |
8.9 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 2.2 |
11.1 |
GO:1900109 |
regulation of histone H3-K9 dimethylation(GO:1900109) |
| 2.2 |
6.6 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 2.2 |
6.6 |
GO:0072180 |
mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
| 2.1 |
6.4 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 2.1 |
6.3 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 2.1 |
2.1 |
GO:1901490 |
regulation of lymphangiogenesis(GO:1901490) |
| 2.1 |
18.7 |
GO:1990845 |
adaptive thermogenesis(GO:1990845) |
| 2.1 |
4.1 |
GO:1901731 |
positive regulation of platelet aggregation(GO:1901731) |
| 2.0 |
2.0 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 2.0 |
11.8 |
GO:1901979 |
regulation of inward rectifier potassium channel activity(GO:1901979) |
| 2.0 |
2.0 |
GO:0060167 |
regulation of adenosine receptor signaling pathway(GO:0060167) |
| 2.0 |
2.0 |
GO:0031055 |
chromatin remodeling at centromere(GO:0031055) |
| 1.9 |
1.9 |
GO:0072076 |
nephrogenic mesenchyme development(GO:0072076) |
| 1.9 |
1.9 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) |
| 1.9 |
9.6 |
GO:0070327 |
thyroid hormone transport(GO:0070327) |
| 1.9 |
5.7 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 1.9 |
5.7 |
GO:0072049 |
comma-shaped body morphogenesis(GO:0072049) |
| 1.9 |
3.8 |
GO:0071336 |
regulation of hair follicle cell proliferation(GO:0071336) positive regulation of hair follicle cell proliferation(GO:0071338) |
| 1.9 |
5.7 |
GO:0051582 |
positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 1.9 |
13.2 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.9 |
5.6 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 1.9 |
1.9 |
GO:0072199 |
mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) |
| 1.9 |
5.6 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 1.9 |
7.4 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 1.8 |
1.8 |
GO:0031638 |
zymogen activation(GO:0031638) |
| 1.8 |
3.6 |
GO:0032804 |
negative regulation of low-density lipoprotein particle receptor catabolic process(GO:0032804) negative regulation of receptor catabolic process(GO:2000645) |
| 1.7 |
1.7 |
GO:0000212 |
meiotic spindle organization(GO:0000212) |
| 1.7 |
1.7 |
GO:1902869 |
regulation of amacrine cell differentiation(GO:1902869) |
| 1.7 |
1.7 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 1.7 |
5.0 |
GO:0090274 |
positive regulation of somatostatin secretion(GO:0090274) |
| 1.7 |
18.3 |
GO:1900121 |
negative regulation of receptor binding(GO:1900121) |
| 1.7 |
5.0 |
GO:0007621 |
negative regulation of female receptivity(GO:0007621) |
| 1.6 |
4.9 |
GO:0051866 |
general adaptation syndrome(GO:0051866) |
| 1.6 |
11.5 |
GO:0060666 |
dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 1.6 |
6.6 |
GO:2000304 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 1.6 |
6.6 |
GO:0002924 |
negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 1.6 |
9.8 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 1.6 |
8.1 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 1.6 |
4.8 |
GO:0003360 |
brainstem development(GO:0003360) |
| 1.6 |
3.2 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 1.6 |
4.8 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 1.6 |
3.2 |
GO:0014028 |
notochord formation(GO:0014028) |
| 1.6 |
6.2 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 1.6 |
1.6 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 1.6 |
7.8 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.6 |
6.2 |
GO:0070346 |
positive regulation of fat cell proliferation(GO:0070346) |
| 1.5 |
7.7 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 1.5 |
10.6 |
GO:2001199 |
negative regulation of dendritic cell differentiation(GO:2001199) |
| 1.5 |
4.5 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 1.5 |
4.5 |
GO:0061526 |
acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) acetylcholine secretion(GO:0061526) |
| 1.5 |
7.5 |
GO:1904798 |
positive regulation of core promoter binding(GO:1904798) |
| 1.5 |
5.9 |
GO:0090238 |
positive regulation of arachidonic acid secretion(GO:0090238) |
| 1.5 |
2.9 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.5 |
8.8 |
GO:1901552 |
positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 1.5 |
1.5 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 1.5 |
4.4 |
GO:0097477 |
lateral motor column neuron migration(GO:0097477) |
| 1.4 |
4.3 |
GO:0021894 |
cerebral cortex GABAergic interneuron differentiation(GO:0021892) cerebral cortex GABAergic interneuron development(GO:0021894) |
| 1.4 |
1.4 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 1.4 |
7.2 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) |
| 1.4 |
4.3 |
GO:1902162 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 1.4 |
2.8 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 1.4 |
5.7 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 1.4 |
7.1 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 1.4 |
5.6 |
GO:0072369 |
regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 1.4 |
7.0 |
GO:1902683 |
regulation of receptor localization to synapse(GO:1902683) |
| 1.4 |
8.4 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 1.4 |
4.2 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 1.4 |
4.2 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 1.4 |
4.1 |
GO:0010248 |
B cell negative selection(GO:0002352) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 1.4 |
6.9 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 1.4 |
4.1 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 1.4 |
4.1 |
GO:1902219 |
negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 1.4 |
1.4 |
GO:1905065 |
positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 1.4 |
1.4 |
GO:0001661 |
conditioned taste aversion(GO:0001661) |
| 1.4 |
5.5 |
GO:0060265 |
positive regulation of respiratory burst involved in inflammatory response(GO:0060265) |
| 1.4 |
2.7 |
GO:0030860 |
regulation of polarized epithelial cell differentiation(GO:0030860) |
| 1.4 |
2.7 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 1.3 |
1.3 |
GO:0007494 |
midgut development(GO:0007494) |
| 1.3 |
2.7 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 1.3 |
2.7 |
GO:0033128 |
negative regulation of histone phosphorylation(GO:0033128) |
| 1.3 |
4.0 |
GO:0001830 |
trophectodermal cell fate commitment(GO:0001830) |
| 1.3 |
4.0 |
GO:0097350 |
neutrophil clearance(GO:0097350) |
| 1.3 |
7.9 |
GO:1902255 |
positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 1.3 |
1.3 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 1.3 |
14.4 |
GO:0031645 |
negative regulation of neurological system process(GO:0031645) |
| 1.3 |
3.9 |
GO:0086047 |
membrane depolarization during Purkinje myocyte cell action potential(GO:0086047) |
| 1.3 |
2.6 |
GO:0038044 |
transforming growth factor-beta secretion(GO:0038044) |
| 1.3 |
3.9 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 1.3 |
6.5 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 1.3 |
5.2 |
GO:1904008 |
response to monosodium glutamate(GO:1904008) cellular response to monosodium glutamate(GO:1904009) |
| 1.3 |
6.5 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 1.3 |
5.2 |
GO:0006244 |
pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 1.3 |
2.6 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 1.3 |
3.9 |
GO:1902218 |
regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) positive regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902220) |
| 1.3 |
7.7 |
GO:0032439 |
endosome localization(GO:0032439) |
| 1.3 |
3.8 |
GO:0060684 |
epithelial-mesenchymal cell signaling(GO:0060684) |
| 1.3 |
3.8 |
GO:0097374 |
sensory neuron axon guidance(GO:0097374) |
| 1.3 |
1.3 |
GO:0003104 |
positive regulation of glomerular filtration(GO:0003104) |
| 1.3 |
2.5 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 1.3 |
12.6 |
GO:0023041 |
neuronal signal transduction(GO:0023041) |
| 1.3 |
5.0 |
GO:0003340 |
negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 1.3 |
5.0 |
GO:0075136 |
response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 1.2 |
3.7 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 1.2 |
6.2 |
GO:0015705 |
iodide transport(GO:0015705) |
| 1.2 |
1.2 |
GO:0097491 |
trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 1.2 |
6.2 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 1.2 |
2.5 |
GO:0006848 |
pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 1.2 |
2.5 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 1.2 |
7.3 |
GO:0060164 |
regulation of timing of neuron differentiation(GO:0060164) |
| 1.2 |
7.3 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 1.2 |
1.2 |
GO:0061762 |
CAMKK-AMPK signaling cascade(GO:0061762) |
| 1.2 |
8.5 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 1.2 |
9.7 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 1.2 |
3.6 |
GO:2000501 |
natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
| 1.2 |
1.2 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 1.2 |
2.4 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 1.2 |
2.4 |
GO:0021539 |
subthalamus development(GO:0021539) |
| 1.2 |
2.4 |
GO:1904580 |
regulation of intracellular mRNA localization(GO:1904580) |
| 1.2 |
8.3 |
GO:0003263 |
cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) |
| 1.2 |
1.2 |
GO:0019401 |
alditol biosynthetic process(GO:0019401) |
| 1.2 |
2.4 |
GO:0060750 |
epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) branch elongation involved in mammary gland duct branching(GO:0060751) |
| 1.2 |
3.5 |
GO:1903538 |
meiotic cell cycle process involved in oocyte maturation(GO:1903537) regulation of meiotic cell cycle process involved in oocyte maturation(GO:1903538) |
| 1.2 |
1.2 |
GO:0071374 |
cellular response to parathyroid hormone stimulus(GO:0071374) |
| 1.2 |
2.3 |
GO:0002725 |
negative regulation of T cell cytokine production(GO:0002725) |
| 1.2 |
3.5 |
GO:0006097 |
glyoxylate cycle(GO:0006097) |
| 1.2 |
9.3 |
GO:0038042 |
dimeric G-protein coupled receptor signaling pathway(GO:0038042) |
| 1.2 |
3.5 |
GO:0030070 |
insulin processing(GO:0030070) |
| 1.2 |
8.1 |
GO:1990416 |
cellular response to brain-derived neurotrophic factor stimulus(GO:1990416) |
| 1.2 |
2.3 |
GO:2001027 |
negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 1.2 |
6.9 |
GO:0032796 |
uropod organization(GO:0032796) |
| 1.1 |
3.4 |
GO:0072734 |
response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 1.1 |
3.4 |
GO:0045658 |
regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 1.1 |
1.1 |
GO:0032489 |
regulation of Cdc42 protein signal transduction(GO:0032489) |
| 1.1 |
10.2 |
GO:0048170 |
positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 1.1 |
2.2 |
GO:0072061 |
inner medullary collecting duct development(GO:0072061) |
| 1.1 |
14.5 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 1.1 |
5.6 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 1.1 |
20.1 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 1.1 |
8.9 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 1.1 |
6.7 |
GO:0032725 |
positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
| 1.1 |
2.2 |
GO:0072205 |
metanephric collecting duct development(GO:0072205) |
| 1.1 |
4.4 |
GO:0046967 |
cytosol to ER transport(GO:0046967) |
| 1.1 |
6.6 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 1.1 |
3.3 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 1.1 |
4.4 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 1.1 |
3.2 |
GO:2000468 |
regulation of peroxidase activity(GO:2000468) |
| 1.1 |
1.1 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 1.1 |
3.2 |
GO:0032914 |
positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 1.1 |
3.2 |
GO:1900740 |
regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 1.1 |
4.3 |
GO:0046543 |
development of secondary sexual characteristics(GO:0045136) development of secondary female sexual characteristics(GO:0046543) |
| 1.1 |
4.2 |
GO:1904672 |
regulation of somatic stem cell population maintenance(GO:1904672) |
| 1.1 |
5.3 |
GO:0002121 |
inter-male aggressive behavior(GO:0002121) |
| 1.1 |
3.2 |
GO:0036090 |
cleavage furrow ingression(GO:0036090) |
| 1.1 |
1.1 |
GO:0033092 |
positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 1.0 |
1.0 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 1.0 |
8.4 |
GO:0015669 |
gas transport(GO:0015669) carbon dioxide transport(GO:0015670) |
| 1.0 |
1.0 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 1.0 |
1.0 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 1.0 |
4.2 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 1.0 |
11.3 |
GO:2000580 |
positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 1.0 |
1.0 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 1.0 |
1.0 |
GO:0050930 |
induction of positive chemotaxis(GO:0050930) |
| 1.0 |
3.1 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 1.0 |
4.1 |
GO:0030091 |
protein repair(GO:0030091) |
| 1.0 |
1.0 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 1.0 |
6.1 |
GO:0090394 |
negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 1.0 |
3.1 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 1.0 |
11.2 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 1.0 |
6.1 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 1.0 |
19.3 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 1.0 |
3.0 |
GO:0051342 |
regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 1.0 |
9.1 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 1.0 |
3.0 |
GO:2000812 |
regulation of barbed-end actin filament capping(GO:2000812) |
| 1.0 |
1.0 |
GO:1902534 |
single-organism membrane invagination(GO:1902534) |
| 1.0 |
4.0 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 1.0 |
1.0 |
GO:0035787 |
cell migration involved in kidney development(GO:0035787) |
| 1.0 |
1.0 |
GO:0001922 |
B-1 B cell homeostasis(GO:0001922) |
| 1.0 |
5.0 |
GO:2000325 |
regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 1.0 |
3.0 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 1.0 |
1.0 |
GO:2001239 |
regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001239) |
| 1.0 |
3.0 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 1.0 |
9.9 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 1.0 |
3.9 |
GO:1900224 |
positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 1.0 |
3.9 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 1.0 |
4.9 |
GO:1900747 |
negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 1.0 |
8.8 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 1.0 |
4.9 |
GO:1900748 |
positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 1.0 |
2.0 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 1.0 |
2.9 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 1.0 |
3.9 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 1.0 |
1.0 |
GO:1902938 |
regulation of intracellular calcium activated chloride channel activity(GO:1902938) |
| 1.0 |
2.9 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 1.0 |
1.0 |
GO:0090327 |
negative regulation of locomotion involved in locomotory behavior(GO:0090327) |
| 1.0 |
1.0 |
GO:0008078 |
mesodermal cell migration(GO:0008078) |
| 1.0 |
1.0 |
GO:0098908 |
regulation of neuronal action potential(GO:0098908) |
| 1.0 |
1.0 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 1.0 |
1.0 |
GO:0048715 |
negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 1.0 |
9.7 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 1.0 |
6.8 |
GO:0036072 |
intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 1.0 |
1.9 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 1.0 |
1.0 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 1.0 |
10.5 |
GO:1990173 |
protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 1.0 |
3.8 |
GO:0010890 |
positive regulation of sequestering of triglyceride(GO:0010890) |
| 1.0 |
6.7 |
GO:0016185 |
synaptic vesicle budding from presynaptic endocytic zone membrane(GO:0016185) |
| 0.9 |
0.9 |
GO:0001865 |
NK T cell differentiation(GO:0001865) regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.9 |
2.8 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.9 |
3.8 |
GO:0015786 |
UDP-glucose transport(GO:0015786) |
| 0.9 |
9.4 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.9 |
2.8 |
GO:0002940 |
tRNA N2-guanine methylation(GO:0002940) |
| 0.9 |
4.7 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.9 |
4.7 |
GO:0007197 |
adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.9 |
6.5 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.9 |
9.3 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.9 |
11.1 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.9 |
5.6 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.9 |
1.9 |
GO:0007196 |
adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.9 |
3.7 |
GO:0010986 |
positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.9 |
16.7 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.9 |
2.8 |
GO:0009153 |
purine deoxyribonucleotide biosynthetic process(GO:0009153) |
| 0.9 |
5.5 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.9 |
2.8 |
GO:0001193 |
maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 0.9 |
3.7 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.9 |
0.9 |
GO:0051004 |
regulation of lipoprotein lipase activity(GO:0051004) |
| 0.9 |
0.9 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.9 |
2.7 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.9 |
1.8 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.9 |
5.5 |
GO:1900028 |
negative regulation of ruffle assembly(GO:1900028) |
| 0.9 |
0.9 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.9 |
2.7 |
GO:0071163 |
DNA replication preinitiation complex assembly(GO:0071163) |
| 0.9 |
3.6 |
GO:0001692 |
histamine metabolic process(GO:0001692) |
| 0.9 |
2.7 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.9 |
2.7 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.9 |
6.3 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.9 |
0.9 |
GO:0060120 |
auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.9 |
1.8 |
GO:0009826 |
unidimensional cell growth(GO:0009826) |
| 0.9 |
4.5 |
GO:0019244 |
lactate biosynthetic process from pyruvate(GO:0019244) |
| 0.9 |
11.7 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.9 |
3.6 |
GO:1900107 |
regulation of nodal signaling pathway(GO:1900107) |
| 0.9 |
2.7 |
GO:0030300 |
regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.9 |
3.6 |
GO:2000987 |
positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.9 |
4.5 |
GO:0003253 |
cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
| 0.9 |
1.8 |
GO:0003032 |
detection of oxygen(GO:0003032) |
| 0.9 |
8.1 |
GO:0098700 |
neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.9 |
5.4 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.9 |
4.5 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.9 |
2.7 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.9 |
6.2 |
GO:0060613 |
fat pad development(GO:0060613) |
| 0.9 |
2.7 |
GO:0003195 |
tricuspid valve formation(GO:0003195) |
| 0.9 |
0.9 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.9 |
2.6 |
GO:0002538 |
arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.9 |
9.7 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.9 |
4.4 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.9 |
5.3 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.9 |
0.9 |
GO:1904959 |
regulation of electron carrier activity(GO:1904732) regulation of cytochrome-c oxidase activity(GO:1904959) |
| 0.9 |
2.6 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.9 |
6.1 |
GO:0098909 |
regulation of cardiac muscle cell action potential involved in regulation of contraction(GO:0098909) |
| 0.9 |
2.6 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.9 |
0.9 |
GO:0071072 |
negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.9 |
8.7 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.9 |
1.7 |
GO:0071864 |
positive regulation of cell proliferation in bone marrow(GO:0071864) |
| 0.9 |
10.3 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.9 |
2.6 |
GO:0071707 |
immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 0.9 |
1.7 |
GO:0045671 |
negative regulation of osteoclast differentiation(GO:0045671) |
| 0.9 |
2.6 |
GO:0008631 |
intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.9 |
2.6 |
GO:1904046 |
negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.9 |
1.7 |
GO:0042304 |
regulation of fatty acid biosynthetic process(GO:0042304) negative regulation of fatty acid metabolic process(GO:0045922) |
| 0.9 |
0.9 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.9 |
2.6 |
GO:0045819 |
plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 0.9 |
10.2 |
GO:0007190 |
activation of adenylate cyclase activity(GO:0007190) |
| 0.9 |
3.4 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 0.8 |
2.5 |
GO:1901536 |
regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.8 |
7.6 |
GO:0007213 |
G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.8 |
2.5 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.8 |
1.7 |
GO:0035963 |
response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.8 |
3.3 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 0.8 |
0.8 |
GO:0061043 |
regulation of vascular wound healing(GO:0061043) |
| 0.8 |
0.8 |
GO:0045581 |
negative regulation of T cell differentiation(GO:0045581) |
| 0.8 |
3.3 |
GO:0007412 |
axon target recognition(GO:0007412) |
| 0.8 |
5.0 |
GO:0072318 |
clathrin coat disassembly(GO:0072318) |
| 0.8 |
2.5 |
GO:0002922 |
positive regulation of humoral immune response(GO:0002922) |
| 0.8 |
0.8 |
GO:0045113 |
integrin biosynthetic process(GO:0045112) regulation of integrin biosynthetic process(GO:0045113) |
| 0.8 |
5.0 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 0.8 |
3.3 |
GO:0031580 |
membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
| 0.8 |
7.4 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 0.8 |
2.5 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) |
| 0.8 |
9.0 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.8 |
3.3 |
GO:0010993 |
regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.8 |
3.3 |
GO:1902340 |
telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
| 0.8 |
4.9 |
GO:0032493 |
response to bacterial lipoprotein(GO:0032493) |
| 0.8 |
2.5 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.8 |
0.8 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.8 |
4.1 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.8 |
0.8 |
GO:0032847 |
regulation of cellular pH reduction(GO:0032847) |
| 0.8 |
4.1 |
GO:1901837 |
negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.8 |
4.9 |
GO:0070447 |
positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.8 |
1.6 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.8 |
0.8 |
GO:0035799 |
ureter maturation(GO:0035799) |
| 0.8 |
0.8 |
GO:0003418 |
growth plate cartilage chondrocyte differentiation(GO:0003418) |
| 0.8 |
0.8 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.8 |
10.5 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 0.8 |
3.2 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.8 |
1.6 |
GO:0016082 |
synaptic vesicle priming(GO:0016082) |
| 0.8 |
0.8 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.8 |
3.2 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.8 |
0.8 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.8 |
0.8 |
GO:0033024 |
mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.8 |
4.0 |
GO:0003105 |
negative regulation of glomerular filtration(GO:0003105) |
| 0.8 |
0.8 |
GO:0060003 |
copper ion export(GO:0060003) |
| 0.8 |
0.8 |
GO:0046689 |
response to mercury ion(GO:0046689) |
| 0.8 |
8.8 |
GO:0048484 |
enteric nervous system development(GO:0048484) |
| 0.8 |
1.6 |
GO:2000435 |
regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.8 |
2.4 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.8 |
0.8 |
GO:0048793 |
pronephros development(GO:0048793) |
| 0.8 |
3.2 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 0.8 |
5.6 |
GO:0035902 |
response to immobilization stress(GO:0035902) |
| 0.8 |
0.8 |
GO:0061014 |
positive regulation of mRNA catabolic process(GO:0061014) |
| 0.8 |
3.2 |
GO:0019673 |
GDP-mannose metabolic process(GO:0019673) |
| 0.8 |
1.6 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.8 |
4.0 |
GO:0000492 |
box C/D snoRNP assembly(GO:0000492) |
| 0.8 |
2.4 |
GO:0015747 |
urate transport(GO:0015747) |
| 0.8 |
1.6 |
GO:0060068 |
vagina development(GO:0060068) |
| 0.8 |
4.7 |
GO:0072081 |
proximal/distal pattern formation involved in nephron development(GO:0072047) specification of nephron tubule identity(GO:0072081) |
| 0.8 |
1.6 |
GO:1903596 |
regulation of gap junction assembly(GO:1903596) |
| 0.8 |
3.9 |
GO:0042364 |
water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.8 |
3.9 |
GO:0001834 |
trophectodermal cell proliferation(GO:0001834) |
| 0.8 |
5.5 |
GO:0060440 |
trachea formation(GO:0060440) regulation of Golgi inheritance(GO:0090170) |
| 0.8 |
11.0 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.8 |
5.5 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.8 |
0.8 |
GO:0046166 |
glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.8 |
2.3 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.8 |
1.6 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.8 |
9.3 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 0.8 |
2.3 |
GO:0032241 |
positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.8 |
11.6 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.8 |
2.3 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.8 |
0.8 |
GO:0051835 |
positive regulation of synapse structural plasticity(GO:0051835) |
| 0.8 |
1.5 |
GO:0072014 |
proximal tubule development(GO:0072014) |
| 0.8 |
2.3 |
GO:0034035 |
sulfate assimilation(GO:0000103) purine ribonucleoside bisphosphate metabolic process(GO:0034035) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.8 |
2.3 |
GO:2000312 |
regulation of kainate selective glutamate receptor activity(GO:2000312) |
| 0.8 |
6.9 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.8 |
1.5 |
GO:0010838 |
positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.8 |
3.0 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.8 |
3.0 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.8 |
3.8 |
GO:0060028 |
convergent extension involved in axis elongation(GO:0060028) |
| 0.8 |
3.0 |
GO:0002741 |
positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.8 |
1.5 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 0.8 |
2.3 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.8 |
2.3 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.8 |
3.0 |
GO:1900533 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.8 |
0.8 |
GO:1902338 |
negative regulation of apoptotic process involved in morphogenesis(GO:1902338) negative regulation of apoptotic process involved in development(GO:1904746) |
| 0.7 |
0.7 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.7 |
7.5 |
GO:1901070 |
GTP biosynthetic process(GO:0006183) guanosine-containing compound biosynthetic process(GO:1901070) |
| 0.7 |
0.7 |
GO:0032650 |
regulation of interleukin-1 alpha production(GO:0032650) positive regulation of interleukin-1 alpha production(GO:0032730) |
| 0.7 |
3.7 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.7 |
2.2 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.7 |
1.5 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 0.7 |
6.6 |
GO:0031340 |
positive regulation of vesicle fusion(GO:0031340) |
| 0.7 |
4.4 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.7 |
5.9 |
GO:0060732 |
positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.7 |
1.5 |
GO:0009264 |
deoxyribonucleotide catabolic process(GO:0009264) |
| 0.7 |
2.2 |
GO:1903348 |
positive regulation of bicellular tight junction assembly(GO:1903348) |
| 0.7 |
0.7 |
GO:0030168 |
platelet activation(GO:0030168) |
| 0.7 |
2.9 |
GO:0072717 |
cellular response to actinomycin D(GO:0072717) |
| 0.7 |
1.5 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.7 |
3.6 |
GO:0060065 |
uterus development(GO:0060065) |
| 0.7 |
2.2 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.7 |
0.7 |
GO:1901069 |
guanosine-containing compound catabolic process(GO:1901069) |
| 0.7 |
3.6 |
GO:1902309 |
regulation of peptidyl-serine dephosphorylation(GO:1902308) negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.7 |
5.8 |
GO:0030578 |
PML body organization(GO:0030578) |
| 0.7 |
5.1 |
GO:0034969 |
histone arginine methylation(GO:0034969) |
| 0.7 |
2.2 |
GO:0060956 |
stem cell fate specification(GO:0048866) endocardial cell differentiation(GO:0060956) |
| 0.7 |
2.9 |
GO:0031584 |
activation of phospholipase D activity(GO:0031584) |
| 0.7 |
1.4 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.7 |
4.3 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.7 |
2.2 |
GO:0051715 |
cytolysis in other organism(GO:0051715) |
| 0.7 |
2.9 |
GO:0007023 |
post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.7 |
2.1 |
GO:0003150 |
muscular septum morphogenesis(GO:0003150) |
| 0.7 |
0.7 |
GO:1903630 |
regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
| 0.7 |
2.8 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.7 |
2.1 |
GO:0046952 |
ketone body catabolic process(GO:0046952) |
| 0.7 |
2.1 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 0.7 |
2.1 |
GO:0019043 |
establishment of viral latency(GO:0019043) |
| 0.7 |
4.9 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) |
| 0.7 |
2.1 |
GO:0010958 |
regulation of amino acid import(GO:0010958) |
| 0.7 |
1.4 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.7 |
2.8 |
GO:0006121 |
mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
| 0.7 |
1.4 |
GO:2000484 |
positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.7 |
4.9 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.7 |
3.5 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 0.7 |
4.9 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.7 |
2.1 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.7 |
0.7 |
GO:0016114 |
terpenoid biosynthetic process(GO:0016114) |
| 0.7 |
0.7 |
GO:0003139 |
secondary heart field specification(GO:0003139) |
| 0.7 |
1.4 |
GO:0000448 |
cleavage in ITS2 between 5.8S rRNA and LSU-rRNA of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000448) |
| 0.7 |
4.1 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.7 |
2.1 |
GO:1903244 |
positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.7 |
2.7 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.7 |
1.4 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.7 |
2.1 |
GO:0008535 |
respiratory chain complex IV assembly(GO:0008535) |
| 0.7 |
2.7 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 0.7 |
2.7 |
GO:0070317 |
negative regulation of G0 to G1 transition(GO:0070317) |
| 0.7 |
2.7 |
GO:1904529 |
regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.7 |
1.4 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.7 |
2.0 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.7 |
1.4 |
GO:1904058 |
positive regulation of sensory perception of pain(GO:1904058) |
| 0.7 |
1.4 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.7 |
4.7 |
GO:0015961 |
diadenosine polyphosphate metabolic process(GO:0015959) diadenosine polyphosphate catabolic process(GO:0015961) |
| 0.7 |
2.0 |
GO:0046605 |
regulation of centrosome cycle(GO:0046605) |
| 0.7 |
2.0 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.7 |
3.4 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.7 |
3.4 |
GO:0051012 |
microtubule sliding(GO:0051012) |
| 0.7 |
0.7 |
GO:2000510 |
positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.7 |
2.0 |
GO:0008612 |
peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.7 |
2.7 |
GO:1901164 |
negative regulation of trophoblast cell migration(GO:1901164) |
| 0.7 |
1.3 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.7 |
0.7 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.7 |
0.7 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.7 |
4.0 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 0.7 |
2.6 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.7 |
15.8 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.7 |
1.3 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.7 |
1.3 |
GO:0033030 |
negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.7 |
4.6 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.7 |
0.7 |
GO:0007006 |
mitochondrial membrane organization(GO:0007006) |
| 0.7 |
3.3 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 0.7 |
2.0 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.7 |
5.2 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.7 |
3.3 |
GO:2001181 |
positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.7 |
3.3 |
GO:0050965 |
detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.7 |
2.0 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.6 |
3.9 |
GO:0032471 |
negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.6 |
0.6 |
GO:0032070 |
regulation of deoxyribonuclease activity(GO:0032070) |
| 0.6 |
3.2 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.6 |
1.9 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.6 |
5.8 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.6 |
3.2 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.6 |
0.6 |
GO:0046685 |
response to arsenic-containing substance(GO:0046685) |
| 0.6 |
2.6 |
GO:0022417 |
protein maturation by protein folding(GO:0022417) |
| 0.6 |
5.1 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.6 |
0.6 |
GO:0050951 |
sensory perception of temperature stimulus(GO:0050951) |
| 0.6 |
0.6 |
GO:0010936 |
negative regulation of macrophage cytokine production(GO:0010936) |
| 0.6 |
5.7 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.6 |
4.5 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.6 |
3.2 |
GO:0060373 |
regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.6 |
2.5 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.6 |
1.9 |
GO:0002014 |
vasoconstriction of artery involved in ischemic response to lowering of systemic arterial blood pressure(GO:0002014) |
| 0.6 |
0.6 |
GO:0051024 |
positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.6 |
1.9 |
GO:0097201 |
negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.6 |
6.3 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.6 |
1.3 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.6 |
0.6 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.6 |
0.6 |
GO:1905206 |
positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.6 |
3.8 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.6 |
0.6 |
GO:0014826 |
vein smooth muscle contraction(GO:0014826) |
| 0.6 |
3.7 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.6 |
5.6 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.6 |
1.2 |
GO:0010693 |
negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.6 |
1.9 |
GO:0072382 |
minus-end-directed vesicle transport along microtubule(GO:0072382) |
| 0.6 |
4.4 |
GO:0014824 |
artery smooth muscle contraction(GO:0014824) |
| 0.6 |
1.9 |
GO:0070423 |
nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.6 |
5.6 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.6 |
13.6 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.6 |
9.3 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.6 |
2.5 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.6 |
11.7 |
GO:0031115 |
negative regulation of microtubule polymerization(GO:0031115) |
| 0.6 |
0.6 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.6 |
6.1 |
GO:0030220 |
platelet formation(GO:0030220) |
| 0.6 |
12.3 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.6 |
1.8 |
GO:0045618 |
positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.6 |
0.6 |
GO:0015870 |
acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
| 0.6 |
3.7 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.6 |
2.4 |
GO:0042534 |
tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.6 |
0.6 |
GO:0071166 |
ribonucleoprotein complex localization(GO:0071166) |
| 0.6 |
1.2 |
GO:1903898 |
negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.6 |
1.2 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.6 |
5.5 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.6 |
2.4 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.6 |
3.0 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.6 |
1.8 |
GO:0046462 |
monoacylglycerol metabolic process(GO:0046462) |
| 0.6 |
1.8 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.6 |
0.6 |
GO:0034116 |
positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.6 |
1.2 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.6 |
10.3 |
GO:0032287 |
peripheral nervous system myelin maintenance(GO:0032287) |
| 0.6 |
1.8 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.6 |
0.6 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.6 |
0.6 |
GO:0070488 |
neutrophil aggregation(GO:0070488) |
| 0.6 |
1.2 |
GO:0002586 |
regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) detection of peptidoglycan(GO:0032499) |
| 0.6 |
0.6 |
GO:1904809 |
dense core granule localization(GO:0032253) dense core granule transport(GO:1901950) regulation of dense core granule transport(GO:1904809) positive regulation of dense core granule transport(GO:1904811) |
| 0.6 |
0.6 |
GO:0007181 |
transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.6 |
6.0 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.6 |
0.6 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.6 |
3.0 |
GO:0002283 |
neutrophil activation involved in immune response(GO:0002283) |
| 0.6 |
0.6 |
GO:1902074 |
response to salt(GO:1902074) |
| 0.6 |
1.2 |
GO:0043117 |
positive regulation of vascular permeability(GO:0043117) |
| 0.6 |
16.0 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.6 |
0.6 |
GO:0055095 |
lipoprotein particle mediated signaling(GO:0055095) low-density lipoprotein particle mediated signaling(GO:0055096) |
| 0.6 |
8.3 |
GO:0050832 |
defense response to fungus(GO:0050832) |
| 0.6 |
1.8 |
GO:0010454 |
negative regulation of cell fate commitment(GO:0010454) |
| 0.6 |
0.6 |
GO:0034141 |
positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.6 |
10.6 |
GO:0050650 |
chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.6 |
3.5 |
GO:0009146 |
purine nucleoside triphosphate catabolic process(GO:0009146) |
| 0.6 |
1.2 |
GO:0021812 |
neuronal-glial interaction involved in cerebral cortex radial glia guided migration(GO:0021812) |
| 0.6 |
1.8 |
GO:0051388 |
positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.6 |
1.2 |
GO:0051754 |
meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.6 |
2.3 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.6 |
1.2 |
GO:0043928 |
exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.6 |
4.1 |
GO:0060124 |
positive regulation of growth hormone secretion(GO:0060124) |
| 0.6 |
5.8 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.6 |
1.7 |
GO:0072103 |
renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.6 |
4.6 |
GO:0090043 |
regulation of tubulin deacetylation(GO:0090043) |
| 0.6 |
2.9 |
GO:0060528 |
secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.6 |
4.0 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 0.6 |
1.2 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 0.6 |
1.7 |
GO:0051006 |
positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.6 |
4.6 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.6 |
6.9 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.6 |
7.4 |
GO:1900038 |
negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.6 |
1.1 |
GO:0046101 |
hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.6 |
3.4 |
GO:0098887 |
neurotransmitter receptor transport, endosome to postsynaptic membrane(GO:0098887) |
| 0.6 |
1.1 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.6 |
3.4 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.6 |
4.0 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.6 |
0.6 |
GO:0000469 |
cleavage involved in rRNA processing(GO:0000469) |
| 0.6 |
1.7 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.6 |
0.6 |
GO:0097476 |
spinal cord motor neuron migration(GO:0097476) |
| 0.6 |
0.6 |
GO:0002455 |
humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
| 0.6 |
2.8 |
GO:0045650 |
negative regulation of macrophage differentiation(GO:0045650) |
| 0.6 |
1.1 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.6 |
1.7 |
GO:0016132 |
brassinosteroid metabolic process(GO:0016131) brassinosteroid biosynthetic process(GO:0016132) |
| 0.6 |
2.3 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.6 |
23.1 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.6 |
9.0 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.6 |
4.5 |
GO:0070262 |
peptidyl-serine dephosphorylation(GO:0070262) |
| 0.6 |
0.6 |
GO:0072008 |
glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
| 0.6 |
1.1 |
GO:0046671 |
negative regulation of retinal cell programmed cell death(GO:0046671) |
| 0.6 |
9.5 |
GO:0071353 |
response to interleukin-4(GO:0070670) cellular response to interleukin-4(GO:0071353) |
| 0.6 |
1.7 |
GO:0046726 |
positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.6 |
8.4 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.6 |
21.2 |
GO:0045806 |
negative regulation of endocytosis(GO:0045806) |
| 0.6 |
1.1 |
GO:0045414 |
regulation of interleukin-8 biosynthetic process(GO:0045414) |
| 0.6 |
1.7 |
GO:0044313 |
protein K6-linked deubiquitination(GO:0044313) |
| 0.6 |
1.1 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.6 |
2.2 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.6 |
0.6 |
GO:0001803 |
type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
| 0.6 |
1.7 |
GO:2001225 |
regulation of chloride transport(GO:2001225) |
| 0.6 |
1.1 |
GO:0006226 |
dUMP biosynthetic process(GO:0006226) |
| 0.6 |
1.1 |
GO:1902172 |
keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.5 |
0.5 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 0.5 |
4.9 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.5 |
4.4 |
GO:0035414 |
negative regulation of catenin import into nucleus(GO:0035414) |
| 0.5 |
1.6 |
GO:0034124 |
regulation of MyD88-dependent toll-like receptor signaling pathway(GO:0034124) |
| 0.5 |
2.2 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.5 |
1.6 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.5 |
4.9 |
GO:0009312 |
oligosaccharide biosynthetic process(GO:0009312) |
| 0.5 |
2.2 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.5 |
0.5 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 0.5 |
1.6 |
GO:1901421 |
positive regulation of response to alcohol(GO:1901421) |
| 0.5 |
0.5 |
GO:2000170 |
positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.5 |
2.1 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.5 |
1.1 |
GO:0071550 |
death-inducing signaling complex assembly(GO:0071550) |
| 0.5 |
3.8 |
GO:0071493 |
cellular response to UV-B(GO:0071493) |
| 0.5 |
1.6 |
GO:0032077 |
positive regulation of deoxyribonuclease activity(GO:0032077) |
| 0.5 |
1.6 |
GO:0090235 |
regulation of metaphase plate congression(GO:0090235) |
| 0.5 |
3.2 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 0.5 |
1.6 |
GO:0034473 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.5 |
9.6 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.5 |
0.5 |
GO:0051643 |
endoplasmic reticulum localization(GO:0051643) |
| 0.5 |
2.1 |
GO:0045624 |
positive regulation of T-helper cell differentiation(GO:0045624) |
| 0.5 |
3.2 |
GO:0033206 |
meiotic cytokinesis(GO:0033206) |
| 0.5 |
0.5 |
GO:0033240 |
positive regulation of cellular amine metabolic process(GO:0033240) |
| 0.5 |
2.1 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.5 |
13.7 |
GO:0033108 |
mitochondrial respiratory chain complex assembly(GO:0033108) |
| 0.5 |
0.5 |
GO:0061744 |
motor behavior(GO:0061744) |
| 0.5 |
1.6 |
GO:0021586 |
pons maturation(GO:0021586) |
| 0.5 |
0.5 |
GO:0018916 |
nitrobenzene metabolic process(GO:0018916) |
| 0.5 |
4.7 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.5 |
0.5 |
GO:0034242 |
negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.5 |
5.8 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.5 |
0.5 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.5 |
3.1 |
GO:0042104 |
positive regulation of activated T cell proliferation(GO:0042104) |
| 0.5 |
1.6 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.5 |
1.6 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.5 |
4.1 |
GO:0032776 |
DNA methylation on cytosine(GO:0032776) |
| 0.5 |
1.0 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.5 |
3.1 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.5 |
1.5 |
GO:0035617 |
stress granule disassembly(GO:0035617) |
| 0.5 |
2.1 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.5 |
0.5 |
GO:0043555 |
regulation of translation in response to stress(GO:0043555) |
| 0.5 |
1.0 |
GO:0019530 |
taurine metabolic process(GO:0019530) |
| 0.5 |
0.5 |
GO:0097154 |
GABAergic neuron differentiation(GO:0097154) |
| 0.5 |
1.0 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.5 |
1.5 |
GO:0010911 |
regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.5 |
1.5 |
GO:0043686 |
co-translational protein modification(GO:0043686) |
| 0.5 |
1.5 |
GO:0042822 |
pyridoxal phosphate metabolic process(GO:0042822) |
| 0.5 |
1.0 |
GO:1901491 |
negative regulation of lymphangiogenesis(GO:1901491) |
| 0.5 |
13.2 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.5 |
3.0 |
GO:0071494 |
cellular response to UV-C(GO:0071494) |
| 0.5 |
0.5 |
GO:1903975 |
regulation of glial cell migration(GO:1903975) |
| 0.5 |
2.0 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.5 |
0.5 |
GO:0018307 |
enzyme active site formation(GO:0018307) |
| 0.5 |
1.0 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.5 |
2.0 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.5 |
2.5 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 0.5 |
7.5 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.5 |
0.5 |
GO:0045575 |
basophil activation involved in immune response(GO:0002276) basophil activation(GO:0045575) |
| 0.5 |
4.5 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.5 |
2.0 |
GO:0042403 |
thyroid hormone metabolic process(GO:0042403) |
| 0.5 |
0.5 |
GO:1902592 |
viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
| 0.5 |
1.0 |
GO:1900244 |
positive regulation of synaptic vesicle endocytosis(GO:1900244) |
| 0.5 |
5.5 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.5 |
0.5 |
GO:0006538 |
glutamate catabolic process(GO:0006538) |
| 0.5 |
1.5 |
GO:0090241 |
negative regulation of histone H4 acetylation(GO:0090241) |
| 0.5 |
1.5 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.5 |
2.5 |
GO:0070294 |
renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.5 |
1.0 |
GO:0033634 |
positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.5 |
1.0 |
GO:2000774 |
positive regulation of cellular senescence(GO:2000774) |
| 0.5 |
3.0 |
GO:0001765 |
membrane raft assembly(GO:0001765) |
| 0.5 |
2.0 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.5 |
9.9 |
GO:0099517 |
anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.5 |
2.0 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.5 |
5.3 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.5 |
0.5 |
GO:1904861 |
excitatory synapse assembly(GO:1904861) |
| 0.5 |
3.9 |
GO:0022615 |
protein to membrane docking(GO:0022615) |
| 0.5 |
0.5 |
GO:0002719 |
negative regulation of cytokine production involved in immune response(GO:0002719) |
| 0.5 |
1.4 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.5 |
0.5 |
GO:0045716 |
positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.5 |
1.0 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.5 |
3.4 |
GO:0031069 |
hair follicle morphogenesis(GO:0031069) |
| 0.5 |
26.9 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.5 |
1.4 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.5 |
0.5 |
GO:0046013 |
T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.5 |
1.4 |
GO:0015803 |
branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.5 |
1.4 |
GO:0006669 |
sphinganine-1-phosphate biosynthetic process(GO:0006669) |
| 0.5 |
4.3 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.5 |
1.4 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.5 |
2.9 |
GO:0043585 |
nose morphogenesis(GO:0043585) |
| 0.5 |
2.4 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.5 |
1.4 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.5 |
3.8 |
GO:0070874 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.5 |
0.5 |
GO:0010626 |
negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.5 |
0.5 |
GO:0003376 |
sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.5 |
6.1 |
GO:0019835 |
cytolysis(GO:0019835) |
| 0.5 |
1.4 |
GO:0071918 |
urea transmembrane transport(GO:0071918) |
| 0.5 |
0.9 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.5 |
1.4 |
GO:0090160 |
Golgi to lysosome transport(GO:0090160) |
| 0.5 |
1.4 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.5 |
2.3 |
GO:0018364 |
peptidyl-glutamine methylation(GO:0018364) |
| 0.5 |
1.9 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.5 |
0.5 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.5 |
1.4 |
GO:0036509 |
trimming of terminal mannose on B branch(GO:0036509) |
| 0.5 |
1.4 |
GO:2000542 |
negative regulation of gastrulation(GO:2000542) |
| 0.5 |
1.4 |
GO:0008050 |
courtship behavior(GO:0007619) female courtship behavior(GO:0008050) negative regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0017055) |
| 0.5 |
1.4 |
GO:0072720 |
response to dithiothreitol(GO:0072720) |
| 0.5 |
3.2 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.5 |
5.1 |
GO:0001990 |
regulation of systemic arterial blood pressure by hormone(GO:0001990) |
| 0.5 |
2.3 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.5 |
0.5 |
GO:0019731 |
antibacterial humoral response(GO:0019731) |
| 0.5 |
0.5 |
GO:2000275 |
regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.5 |
6.5 |
GO:0007530 |
sex determination(GO:0007530) |
| 0.5 |
0.9 |
GO:2001160 |
regulation of histone H3-K79 methylation(GO:2001160) |
| 0.5 |
3.2 |
GO:0043589 |
skin morphogenesis(GO:0043589) |
| 0.5 |
0.9 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.5 |
2.3 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.5 |
1.4 |
GO:0033572 |
transferrin transport(GO:0033572) |
| 0.5 |
0.9 |
GO:0042267 |
natural killer cell mediated immunity(GO:0002228) natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.5 |
1.4 |
GO:0003214 |
cardiac left ventricle morphogenesis(GO:0003214) |
| 0.5 |
1.4 |
GO:0038003 |
opioid receptor signaling pathway(GO:0038003) regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.5 |
7.3 |
GO:0035774 |
positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.5 |
0.9 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.5 |
2.7 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.5 |
0.9 |
GO:0021933 |
radial glia guided migration of cerebellar granule cell(GO:0021933) |
| 0.5 |
5.0 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.5 |
2.3 |
GO:1903378 |
positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.5 |
9.9 |
GO:0006879 |
cellular iron ion homeostasis(GO:0006879) |
| 0.5 |
1.4 |
GO:1904207 |
chemokine (C-C motif) ligand 2 secretion(GO:0035926) regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 0.5 |
1.4 |
GO:0061588 |
calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylserine scrambling(GO:0061589) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.4 |
1.3 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.4 |
0.9 |
GO:0014823 |
response to activity(GO:0014823) |
| 0.4 |
4.0 |
GO:1900025 |
negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.4 |
0.4 |
GO:0008209 |
androgen metabolic process(GO:0008209) |
| 0.4 |
0.4 |
GO:1903422 |
negative regulation of synaptic vesicle recycling(GO:1903422) |
| 0.4 |
2.2 |
GO:0030859 |
polarized epithelial cell differentiation(GO:0030859) |
| 0.4 |
3.1 |
GO:0042487 |
regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.4 |
0.4 |
GO:0010725 |
regulation of primitive erythrocyte differentiation(GO:0010725) |
| 0.4 |
4.5 |
GO:1905216 |
positive regulation of RNA binding(GO:1905216) |
| 0.4 |
0.4 |
GO:0033262 |
regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.4 |
1.8 |
GO:0006780 |
uroporphyrinogen III biosynthetic process(GO:0006780) |
| 0.4 |
3.6 |
GO:0032225 |
regulation of synaptic transmission, dopaminergic(GO:0032225) |
| 0.4 |
0.9 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.4 |
0.9 |
GO:1901526 |
positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.4 |
1.3 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.4 |
0.4 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.4 |
2.2 |
GO:0019348 |
dolichol metabolic process(GO:0019348) |
| 0.4 |
2.2 |
GO:0036438 |
maintenance of lens transparency(GO:0036438) |
| 0.4 |
0.4 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.4 |
1.8 |
GO:0098915 |
membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.4 |
0.4 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.4 |
0.4 |
GO:1902474 |
positive regulation of protein localization to synapse(GO:1902474) |
| 0.4 |
1.3 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.4 |
4.0 |
GO:0030049 |
muscle filament sliding(GO:0030049) |
| 0.4 |
1.3 |
GO:0098974 |
postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.4 |
1.8 |
GO:0002082 |
regulation of oxidative phosphorylation(GO:0002082) |
| 0.4 |
2.6 |
GO:0046103 |
inosine metabolic process(GO:0046102) inosine biosynthetic process(GO:0046103) |
| 0.4 |
1.8 |
GO:0042416 |
dopamine biosynthetic process(GO:0042416) |
| 0.4 |
0.4 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.4 |
1.3 |
GO:1904717 |
excitatory chemical synaptic transmission(GO:0098976) regulation of AMPA glutamate receptor clustering(GO:1904717) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
| 0.4 |
0.9 |
GO:0060012 |
synaptic transmission, glycinergic(GO:0060012) |
| 0.4 |
1.7 |
GO:0099527 |
postsynapse to nucleus signaling pathway(GO:0099527) |
| 0.4 |
2.2 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.4 |
0.9 |
GO:0042097 |
interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.4 |
4.3 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.4 |
0.4 |
GO:0071649 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.4 |
0.4 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.4 |
1.7 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.4 |
4.8 |
GO:0001780 |
neutrophil homeostasis(GO:0001780) |
| 0.4 |
1.7 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.4 |
0.4 |
GO:0031646 |
positive regulation of neurological system process(GO:0031646) |
| 0.4 |
0.9 |
GO:0032960 |
regulation of inositol trisphosphate biosynthetic process(GO:0032960) |
| 0.4 |
1.7 |
GO:0006119 |
oxidative phosphorylation(GO:0006119) |
| 0.4 |
0.9 |
GO:1903874 |
ferrous iron transmembrane transport(GO:1903874) |
| 0.4 |
1.3 |
GO:0030974 |
thiamine pyrophosphate transport(GO:0030974) |
| 0.4 |
9.4 |
GO:1902230 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.4 |
0.9 |
GO:0045657 |
positive regulation of monocyte differentiation(GO:0045657) |
| 0.4 |
1.3 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 0.4 |
2.1 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.4 |
1.3 |
GO:2000002 |
negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.4 |
0.4 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.4 |
2.9 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.4 |
2.1 |
GO:0016081 |
synaptic vesicle docking(GO:0016081) |
| 0.4 |
0.4 |
GO:0010871 |
negative regulation of receptor biosynthetic process(GO:0010871) |
| 0.4 |
3.3 |
GO:0006465 |
signal peptide processing(GO:0006465) |
| 0.4 |
4.2 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.4 |
5.8 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
| 0.4 |
0.4 |
GO:0030214 |
hyaluronan catabolic process(GO:0030214) |
| 0.4 |
0.4 |
GO:1900034 |
regulation of cellular response to heat(GO:1900034) |
| 0.4 |
2.1 |
GO:0009134 |
nucleoside diphosphate catabolic process(GO:0009134) |
| 0.4 |
0.8 |
GO:0060055 |
angiogenesis involved in wound healing(GO:0060055) |
| 0.4 |
0.8 |
GO:0047484 |
regulation of response to osmotic stress(GO:0047484) |
| 0.4 |
0.4 |
GO:0021847 |
ventricular zone neuroblast division(GO:0021847) |
| 0.4 |
0.8 |
GO:0072378 |
blood coagulation, fibrin clot formation(GO:0072378) |
| 0.4 |
0.8 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.4 |
2.1 |
GO:0046085 |
adenosine metabolic process(GO:0046085) |
| 0.4 |
8.3 |
GO:0048011 |
neurotrophin TRK receptor signaling pathway(GO:0048011) |
| 0.4 |
0.4 |
GO:0036499 |
PERK-mediated unfolded protein response(GO:0036499) |
| 0.4 |
1.6 |
GO:0051881 |
regulation of mitochondrial membrane potential(GO:0051881) |
| 0.4 |
10.7 |
GO:0006779 |
porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.4 |
5.3 |
GO:0015988 |
energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) |
| 0.4 |
1.2 |
GO:0009838 |
abscission(GO:0009838) |
| 0.4 |
2.0 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.4 |
2.8 |
GO:0001914 |
regulation of T cell mediated cytotoxicity(GO:0001914) |
| 0.4 |
0.4 |
GO:0072321 |
chaperone-mediated protein transport(GO:0072321) |
| 0.4 |
1.2 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.4 |
1.6 |
GO:0034390 |
smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
| 0.4 |
6.1 |
GO:0060261 |
positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.4 |
1.2 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.4 |
0.8 |
GO:0009814 |
defense response, incompatible interaction(GO:0009814) |
| 0.4 |
16.0 |
GO:0022900 |
electron transport chain(GO:0022900) |
| 0.4 |
0.8 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.4 |
6.8 |
GO:0001893 |
maternal placenta development(GO:0001893) |
| 0.4 |
0.4 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.4 |
2.0 |
GO:0050774 |
negative regulation of dendrite morphogenesis(GO:0050774) |
| 0.4 |
3.6 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.4 |
0.8 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.4 |
1.2 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.4 |
2.0 |
GO:0042745 |
circadian sleep/wake cycle(GO:0042745) |
| 0.4 |
2.0 |
GO:0033631 |
cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.4 |
2.4 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.4 |
1.6 |
GO:0046855 |
phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) inositol phosphate catabolic process(GO:0071545) |
| 0.4 |
0.4 |
GO:0015684 |
ferrous iron transport(GO:0015684) |
| 0.4 |
0.8 |
GO:1990504 |
dense core granule exocytosis(GO:1990504) |
| 0.4 |
0.4 |
GO:0000320 |
re-entry into mitotic cell cycle(GO:0000320) |
| 0.4 |
1.2 |
GO:0071035 |
nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.4 |
0.8 |
GO:0035696 |
monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.4 |
2.0 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 0.4 |
2.0 |
GO:0031145 |
anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.4 |
10.9 |
GO:0006414 |
translational elongation(GO:0006414) |
| 0.4 |
1.2 |
GO:1900060 |
negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.4 |
2.7 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.4 |
0.4 |
GO:0032289 |
central nervous system myelin formation(GO:0032289) |
| 0.4 |
1.2 |
GO:0002692 |
negative regulation of cellular extravasation(GO:0002692) |
| 0.4 |
0.8 |
GO:1903279 |
regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.4 |
1.2 |
GO:0045004 |
DNA replication proofreading(GO:0045004) |
| 0.4 |
0.4 |
GO:0043217 |
myelin maintenance(GO:0043217) |
| 0.4 |
0.4 |
GO:0046835 |
carbohydrate phosphorylation(GO:0046835) |
| 0.4 |
1.5 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.4 |
3.9 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.4 |
0.4 |
GO:0051665 |
membrane raft localization(GO:0051665) |
| 0.4 |
0.4 |
GO:0035624 |
receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.4 |
0.4 |
GO:0032703 |
negative regulation of interleukin-2 production(GO:0032703) |
| 0.4 |
1.2 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.4 |
0.8 |
GO:0042982 |
amyloid precursor protein metabolic process(GO:0042982) |
| 0.4 |
1.2 |
GO:0070314 |
G1 to G0 transition(GO:0070314) |
| 0.4 |
3.5 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.4 |
0.8 |
GO:0006659 |
phosphatidylserine biosynthetic process(GO:0006659) |
| 0.4 |
0.4 |
GO:0016093 |
polyprenol metabolic process(GO:0016093) |
| 0.4 |
1.1 |
GO:0042226 |
interleukin-6 biosynthetic process(GO:0042226) regulation of interleukin-6 biosynthetic process(GO:0045408) |
| 0.4 |
1.1 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.4 |
0.4 |
GO:0061154 |
endothelial tube morphogenesis(GO:0061154) |
| 0.4 |
0.8 |
GO:0035089 |
establishment of apical/basal cell polarity(GO:0035089) |
| 0.4 |
0.4 |
GO:1902856 |
negative regulation of nonmotile primary cilium assembly(GO:1902856) |
| 0.4 |
1.1 |
GO:0051901 |
positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.4 |
0.8 |
GO:0071638 |
negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.4 |
0.4 |
GO:0071680 |
response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.4 |
0.8 |
GO:0006680 |
glucosylceramide catabolic process(GO:0006680) |
| 0.4 |
0.4 |
GO:0034142 |
toll-like receptor 4 signaling pathway(GO:0034142) |
| 0.4 |
3.8 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.4 |
1.1 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.4 |
1.9 |
GO:0098914 |
membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.4 |
7.1 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.4 |
0.8 |
GO:0071963 |
establishment or maintenance of cell polarity regulating cell shape(GO:0071963) |
| 0.4 |
0.4 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.4 |
1.5 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.4 |
3.4 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.4 |
1.1 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.4 |
0.7 |
GO:0006625 |
protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
| 0.4 |
9.3 |
GO:0000462 |
maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.4 |
0.4 |
GO:0048069 |
eye pigmentation(GO:0048069) |
| 0.4 |
5.9 |
GO:1902235 |
regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
| 0.4 |
16.6 |
GO:0032543 |
mitochondrial translation(GO:0032543) |
| 0.4 |
0.7 |
GO:2000157 |
negative regulation of protein deubiquitination(GO:0090086) regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.4 |
3.7 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.4 |
0.4 |
GO:1990927 |
calcium ion regulated lysosome exocytosis(GO:1990927) |
| 0.4 |
1.8 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.4 |
3.7 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.4 |
1.1 |
GO:1905169 |
protein localization to phagocytic vesicle(GO:1905161) regulation of protein localization to phagocytic vesicle(GO:1905169) positive regulation of protein localization to phagocytic vesicle(GO:1905171) |
| 0.4 |
2.2 |
GO:2000310 |
regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.4 |
1.8 |
GO:0060837 |
blood vessel endothelial cell differentiation(GO:0060837) |
| 0.4 |
2.6 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.4 |
0.4 |
GO:2000822 |
regulation of fear response(GO:1903365) regulation of behavioral fear response(GO:2000822) |
| 0.4 |
1.1 |
GO:2000630 |
positive regulation of miRNA metabolic process(GO:2000630) |
| 0.4 |
1.4 |
GO:0042373 |
vitamin K metabolic process(GO:0042373) |
| 0.4 |
0.7 |
GO:0035461 |
vitamin transmembrane transport(GO:0035461) |
| 0.4 |
3.3 |
GO:1990000 |
amyloid fibril formation(GO:1990000) |
| 0.4 |
4.3 |
GO:0098926 |
postsynaptic signal transduction(GO:0098926) |
| 0.4 |
1.4 |
GO:0080184 |
response to stilbenoid(GO:0035634) response to phenylpropanoid(GO:0080184) |
| 0.4 |
0.4 |
GO:0090035 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.4 |
4.3 |
GO:0060481 |
lobar bronchus epithelium development(GO:0060481) |
| 0.4 |
0.7 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.4 |
11.1 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.4 |
0.4 |
GO:0002931 |
response to ischemia(GO:0002931) |
| 0.4 |
0.4 |
GO:0032055 |
negative regulation of translation in response to stress(GO:0032055) |
| 0.4 |
0.4 |
GO:0036324 |
vascular endothelial growth factor receptor-2 signaling pathway(GO:0036324) |
| 0.4 |
0.7 |
GO:0000973 |
posttranscriptional tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000973) |
| 0.4 |
1.8 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.4 |
1.1 |
GO:0097105 |
presynaptic membrane assembly(GO:0097105) |
| 0.4 |
1.4 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.4 |
5.7 |
GO:0071625 |
vocalization behavior(GO:0071625) |
| 0.4 |
1.4 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.4 |
0.4 |
GO:0032829 |
regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.4 |
5.3 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.4 |
6.7 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.4 |
2.1 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.3 |
1.7 |
GO:0043416 |
regulation of skeletal muscle tissue regeneration(GO:0043416) |
| 0.3 |
0.7 |
GO:1903772 |
regulation of viral budding via host ESCRT complex(GO:1903772) |
| 0.3 |
0.3 |
GO:1903431 |
positive regulation of cell maturation(GO:1903431) |
| 0.3 |
0.7 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.3 |
0.3 |
GO:0071816 |
tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.3 |
1.0 |
GO:0035928 |
RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
| 0.3 |
0.3 |
GO:0050703 |
interleukin-1 alpha production(GO:0032610) interleukin-1 alpha secretion(GO:0050703) |
| 0.3 |
0.3 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.3 |
1.7 |
GO:0035584 |
calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.3 |
3.4 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.3 |
1.4 |
GO:0015744 |
succinate transport(GO:0015744) |
| 0.3 |
1.7 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.3 |
1.4 |
GO:0036035 |
osteoclast development(GO:0036035) |
| 0.3 |
1.7 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.3 |
0.3 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.3 |
1.0 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.3 |
0.7 |
GO:0099550 |
trans-synaptic signalling, modulating synaptic transmission(GO:0099550) |
| 0.3 |
0.3 |
GO:1902730 |
positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.3 |
4.7 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.3 |
1.0 |
GO:0032691 |
negative regulation of interleukin-1 beta production(GO:0032691) |
| 0.3 |
0.3 |
GO:0016128 |
phytosteroid metabolic process(GO:0016128) phytosteroid biosynthetic process(GO:0016129) |
| 0.3 |
0.3 |
GO:0044805 |
late nucleophagy(GO:0044805) |
| 0.3 |
4.3 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.3 |
0.7 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 0.3 |
0.3 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.3 |
1.3 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.3 |
1.6 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.3 |
0.6 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.3 |
13.6 |
GO:0006890 |
retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.3 |
0.3 |
GO:0046719 |
regulation by virus of viral protein levels in host cell(GO:0046719) |
| 0.3 |
8.7 |
GO:0009060 |
aerobic respiration(GO:0009060) |
| 0.3 |
0.6 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.3 |
0.6 |
GO:1905247 |
positive regulation of aspartic-type endopeptidase activity involved in amyloid precursor protein catabolic process(GO:1902961) positive regulation of aspartic-type peptidase activity(GO:1905247) |
| 0.3 |
0.6 |
GO:0007585 |
respiratory gaseous exchange(GO:0007585) |
| 0.3 |
1.6 |
GO:0051016 |
barbed-end actin filament capping(GO:0051016) |
| 0.3 |
2.9 |
GO:0031065 |
positive regulation of histone deacetylation(GO:0031065) |
| 0.3 |
1.3 |
GO:0015825 |
L-serine transport(GO:0015825) |
| 0.3 |
0.3 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.3 |
1.0 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.3 |
0.3 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.3 |
1.0 |
GO:0034436 |
glycoprotein transport(GO:0034436) |
| 0.3 |
3.8 |
GO:0007007 |
inner mitochondrial membrane organization(GO:0007007) |
| 0.3 |
0.6 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.3 |
1.9 |
GO:0090201 |
negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.3 |
5.7 |
GO:0007080 |
mitotic metaphase plate congression(GO:0007080) |
| 0.3 |
1.3 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.3 |
0.6 |
GO:0015886 |
heme transport(GO:0015886) |
| 0.3 |
3.1 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.3 |
0.3 |
GO:0031498 |
chromatin disassembly(GO:0031498) |
| 0.3 |
0.3 |
GO:0014820 |
tonic smooth muscle contraction(GO:0014820) |
| 0.3 |
1.6 |
GO:0031034 |
myosin filament assembly(GO:0031034) striated muscle myosin thick filament assembly(GO:0071688) |
| 0.3 |
0.3 |
GO:0008300 |
isoprenoid catabolic process(GO:0008300) |
| 0.3 |
2.8 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.3 |
2.5 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.3 |
3.4 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.3 |
3.7 |
GO:0045063 |
T-helper 1 cell differentiation(GO:0045063) |
| 0.3 |
3.7 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.3 |
0.3 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) |
| 0.3 |
1.2 |
GO:0061188 |
regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.3 |
0.3 |
GO:0032785 |
negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.3 |
0.6 |
GO:0000237 |
leptotene(GO:0000237) |
| 0.3 |
1.2 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.3 |
0.9 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.3 |
0.6 |
GO:0010885 |
regulation of cholesterol storage(GO:0010885) |
| 0.3 |
0.9 |
GO:0002716 |
negative regulation of natural killer cell mediated immunity(GO:0002716) negative regulation of natural killer cell mediated cytotoxicity(GO:0045953) |
| 0.3 |
0.6 |
GO:2000209 |
regulation of anoikis(GO:2000209) |
| 0.3 |
2.1 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.3 |
2.1 |
GO:2000858 |
mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) positive regulation of mineralocorticoid secretion(GO:2000857) regulation of aldosterone secretion(GO:2000858) positive regulation of aldosterone secretion(GO:2000860) |
| 0.3 |
0.9 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.3 |
0.6 |
GO:0030423 |
targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.3 |
1.2 |
GO:0016191 |
synaptic vesicle uncoating(GO:0016191) vesicle uncoating(GO:0072319) |
| 0.3 |
0.6 |
GO:0032611 |
interleukin-1 beta production(GO:0032611) |
| 0.3 |
1.2 |
GO:0044539 |
long-chain fatty acid import(GO:0044539) |
| 0.3 |
0.9 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.3 |
0.6 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.3 |
0.3 |
GO:0018125 |
peptidyl-cysteine methylation(GO:0018125) |
| 0.3 |
0.6 |
GO:0016264 |
gap junction assembly(GO:0016264) |
| 0.3 |
0.6 |
GO:0044241 |
lipid digestion(GO:0044241) |
| 0.3 |
0.3 |
GO:0060586 |
multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.3 |
0.6 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 0.3 |
1.2 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.3 |
0.6 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.3 |
0.6 |
GO:2000035 |
regulation of stem cell division(GO:2000035) |
| 0.3 |
0.3 |
GO:0042640 |
anagen(GO:0042640) |
| 0.3 |
0.9 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.3 |
0.3 |
GO:1902732 |
positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.3 |
0.6 |
GO:0034123 |
positive regulation of toll-like receptor signaling pathway(GO:0034123) |
| 0.3 |
1.4 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.3 |
0.9 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.3 |
0.9 |
GO:2000628 |
regulation of miRNA metabolic process(GO:2000628) |
| 0.3 |
1.4 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 0.3 |
0.3 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.3 |
3.7 |
GO:0009145 |
ATP biosynthetic process(GO:0006754) purine nucleoside triphosphate biosynthetic process(GO:0009145) |
| 0.3 |
1.4 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.3 |
0.3 |
GO:0071873 |
response to norepinephrine(GO:0071873) |
| 0.3 |
0.6 |
GO:0051014 |
actin filament severing(GO:0051014) |
| 0.3 |
0.8 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.3 |
0.3 |
GO:1904637 |
response to ionomycin(GO:1904636) cellular response to ionomycin(GO:1904637) |
| 0.3 |
1.1 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.3 |
0.6 |
GO:0048820 |
hair follicle maturation(GO:0048820) |
| 0.3 |
3.3 |
GO:0009142 |
nucleoside triphosphate biosynthetic process(GO:0009142) |
| 0.3 |
1.1 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 0.3 |
2.5 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.3 |
2.7 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.3 |
0.8 |
GO:0071929 |
alpha-tubulin acetylation(GO:0071929) |
| 0.3 |
4.1 |
GO:0099601 |
regulation of neurotransmitter receptor activity(GO:0099601) |
| 0.3 |
0.8 |
GO:0032202 |
telomere assembly(GO:0032202) |
| 0.3 |
0.8 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.3 |
1.4 |
GO:0032463 |
negative regulation of protein homooligomerization(GO:0032463) |
| 0.3 |
0.5 |
GO:0021852 |
pyramidal neuron migration(GO:0021852) |
| 0.3 |
0.5 |
GO:1900037 |
regulation of cellular response to hypoxia(GO:1900037) |
| 0.3 |
1.9 |
GO:0009226 |
nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.3 |
0.8 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.3 |
0.5 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.3 |
1.6 |
GO:0060046 |
regulation of acrosome reaction(GO:0060046) |
| 0.3 |
14.8 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.3 |
0.8 |
GO:0006788 |
heme oxidation(GO:0006788) |
| 0.3 |
0.3 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.3 |
1.1 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.3 |
0.5 |
GO:0036376 |
sodium ion export from cell(GO:0036376) |
| 0.3 |
1.3 |
GO:0034227 |
tRNA thio-modification(GO:0034227) |
| 0.3 |
0.8 |
GO:0046902 |
regulation of mitochondrial membrane permeability(GO:0046902) |
| 0.3 |
1.6 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 0.3 |
1.1 |
GO:1903527 |
regulation of membrane tubulation(GO:1903525) positive regulation of membrane tubulation(GO:1903527) |
| 0.3 |
0.3 |
GO:0036344 |
platelet morphogenesis(GO:0036344) |
| 0.3 |
0.5 |
GO:0071158 |
positive regulation of cell cycle arrest(GO:0071158) |
| 0.3 |
0.8 |
GO:0072182 |
regulation of nephron tubule epithelial cell differentiation(GO:0072182) |
| 0.3 |
0.3 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 0.3 |
0.5 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.3 |
1.3 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.3 |
0.5 |
GO:0002946 |
tRNA C5-cytosine methylation(GO:0002946) |
| 0.3 |
0.3 |
GO:0045606 |
positive regulation of epidermal cell differentiation(GO:0045606) |
| 0.3 |
0.5 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.3 |
0.3 |
GO:0034638 |
phosphatidylcholine catabolic process(GO:0034638) |
| 0.3 |
0.3 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.3 |
0.3 |
GO:0098705 |
copper ion import across plasma membrane(GO:0098705) copper ion import into cell(GO:1902861) |
| 0.3 |
0.3 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.3 |
0.5 |
GO:0040010 |
positive regulation of growth rate(GO:0040010) |
| 0.3 |
4.1 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.3 |
1.5 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.3 |
0.5 |
GO:0002363 |
alpha-beta T cell lineage commitment(GO:0002363) |
| 0.3 |
0.5 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.3 |
0.5 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.3 |
0.5 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.3 |
1.5 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.3 |
1.0 |
GO:0090521 |
glomerular visceral epithelial cell migration(GO:0090521) |
| 0.3 |
0.8 |
GO:0015817 |
histidine transport(GO:0015817) |
| 0.3 |
1.5 |
GO:0002888 |
positive regulation of myeloid leukocyte mediated immunity(GO:0002888) |
| 0.3 |
0.8 |
GO:0039532 |
negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
| 0.3 |
1.0 |
GO:0021506 |
anterior neuropore closure(GO:0021506) neuropore closure(GO:0021995) |
| 0.3 |
2.0 |
GO:0033564 |
anterior/posterior axon guidance(GO:0033564) |
| 0.3 |
1.5 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.3 |
1.0 |
GO:0044068 |
modulation by symbiont of host cellular process(GO:0044068) |
| 0.2 |
0.2 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) embryonic hindgut morphogenesis(GO:0048619) |
| 0.2 |
2.2 |
GO:0051974 |
negative regulation of telomerase activity(GO:0051974) |
| 0.2 |
3.5 |
GO:1904377 |
positive regulation of protein localization to cell periphery(GO:1904377) |
| 0.2 |
0.7 |
GO:1990414 |
replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.2 |
1.2 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 |
0.5 |
GO:0006842 |
tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.2 |
0.2 |
GO:0014809 |
regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.2 |
1.5 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.2 |
0.2 |
GO:0003199 |
endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.2 |
1.2 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.2 |
0.7 |
GO:0042275 |
error-free postreplication DNA repair(GO:0042275) |
| 0.2 |
0.7 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.2 |
0.5 |
GO:0002347 |
response to tumor cell(GO:0002347) |
| 0.2 |
0.2 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.2 |
0.5 |
GO:1903026 |
negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.2 |
0.5 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.2 |
0.7 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.2 |
0.7 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.2 |
0.7 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.2 |
0.2 |
GO:0035937 |
estrogen secretion(GO:0035937) estradiol secretion(GO:0035938) regulation of estrogen secretion(GO:2000861) regulation of estradiol secretion(GO:2000864) |
| 0.2 |
0.5 |
GO:1903071 |
positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.2 |
0.9 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.2 |
0.5 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.2 |
0.2 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.2 |
0.2 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.2 |
0.2 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.2 |
0.5 |
GO:0010870 |
positive regulation of receptor biosynthetic process(GO:0010870) |
| 0.2 |
0.7 |
GO:0032651 |
regulation of interleukin-1 beta production(GO:0032651) regulation of interleukin-1 production(GO:0032652) |
| 0.2 |
0.5 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.2 |
0.5 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.2 |
0.7 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.2 |
0.2 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.2 |
1.1 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.2 |
0.9 |
GO:2000574 |
regulation of microtubule motor activity(GO:2000574) |
| 0.2 |
2.3 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) |
| 0.2 |
0.2 |
GO:0021562 |
vestibulocochlear nerve development(GO:0021562) |
| 0.2 |
0.5 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.2 |
0.2 |
GO:1902742 |
apoptotic process involved in development(GO:1902742) |
| 0.2 |
0.9 |
GO:0018202 |
peptidyl-histidine modification(GO:0018202) |
| 0.2 |
0.7 |
GO:0000972 |
transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.2 |
2.0 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.2 |
0.2 |
GO:0071774 |
response to fibroblast growth factor(GO:0071774) |
| 0.2 |
0.4 |
GO:0032693 |
negative regulation of interleukin-10 production(GO:0032693) |
| 0.2 |
0.4 |
GO:1904139 |
microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.2 |
0.2 |
GO:0043307 |
eosinophil activation(GO:0043307) |
| 0.2 |
3.1 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.2 |
0.2 |
GO:0051798 |
positive regulation of hair follicle development(GO:0051798) |
| 0.2 |
3.3 |
GO:0048026 |
positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.2 |
2.0 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.2 |
1.1 |
GO:0006488 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.2 |
1.5 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.2 |
0.4 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 0.2 |
2.4 |
GO:0015804 |
neutral amino acid transport(GO:0015804) |
| 0.2 |
0.7 |
GO:0051969 |
regulation of transmission of nerve impulse(GO:0051969) |
| 0.2 |
0.2 |
GO:0051036 |
regulation of endosome size(GO:0051036) |
| 0.2 |
0.6 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.2 |
1.3 |
GO:0023021 |
termination of signal transduction(GO:0023021) |
| 0.2 |
0.9 |
GO:0033540 |
fatty acid beta-oxidation using acyl-CoA oxidase(GO:0033540) |
| 0.2 |
0.2 |
GO:0071603 |
endothelial cell-cell adhesion(GO:0071603) |
| 0.2 |
0.6 |
GO:0060715 |
syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.2 |
1.3 |
GO:0060134 |
prepulse inhibition(GO:0060134) |
| 0.2 |
0.6 |
GO:0090315 |
negative regulation of protein targeting to membrane(GO:0090315) |
| 0.2 |
2.3 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.2 |
1.7 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.2 |
0.4 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 0.2 |
0.2 |
GO:1903224 |
regulation of endodermal cell differentiation(GO:1903224) |
| 0.2 |
0.2 |
GO:0000727 |
double-strand break repair via break-induced replication(GO:0000727) |
| 0.2 |
0.2 |
GO:0016559 |
peroxisome fission(GO:0016559) |
| 0.2 |
1.5 |
GO:0033623 |
regulation of integrin activation(GO:0033623) |
| 0.2 |
2.1 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.2 |
0.2 |
GO:0035810 |
positive regulation of urine volume(GO:0035810) |
| 0.2 |
0.4 |
GO:2000348 |
regulation of CD40 signaling pathway(GO:2000348) |
| 0.2 |
0.2 |
GO:0046070 |
dGTP metabolic process(GO:0046070) |
| 0.2 |
1.3 |
GO:0006363 |
termination of RNA polymerase I transcription(GO:0006363) |
| 0.2 |
0.4 |
GO:0051132 |
NK T cell activation(GO:0051132) |
| 0.2 |
0.2 |
GO:0006532 |
aspartate biosynthetic process(GO:0006532) |
| 0.2 |
0.8 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.2 |
0.6 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.2 |
0.6 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
| 0.2 |
0.4 |
GO:0090051 |
negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.2 |
0.6 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.2 |
0.2 |
GO:0046007 |
negative regulation of activated T cell proliferation(GO:0046007) |
| 0.2 |
3.1 |
GO:0060074 |
synapse maturation(GO:0060074) |
| 0.2 |
5.6 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.2 |
1.6 |
GO:0006750 |
glutathione biosynthetic process(GO:0006750) |
| 0.2 |
0.8 |
GO:0035372 |
protein localization to microtubule(GO:0035372) |
| 0.2 |
0.8 |
GO:1901301 |
regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.2 |
0.8 |
GO:1904526 |
regulation of microtubule binding(GO:1904526) |
| 0.2 |
0.4 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.2 |
2.2 |
GO:0060236 |
regulation of mitotic spindle organization(GO:0060236) |
| 0.2 |
1.6 |
GO:2000269 |
regulation of fibroblast apoptotic process(GO:2000269) |
| 0.2 |
4.2 |
GO:0048013 |
ephrin receptor signaling pathway(GO:0048013) |
| 0.2 |
4.8 |
GO:2000785 |
regulation of autophagosome assembly(GO:2000785) |
| 0.2 |
1.2 |
GO:0032098 |
regulation of appetite(GO:0032098) |
| 0.2 |
0.8 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.2 |
0.8 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.2 |
1.0 |
GO:0000042 |
protein targeting to Golgi(GO:0000042) |
| 0.2 |
1.6 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.2 |
0.6 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.2 |
1.8 |
GO:2000171 |
negative regulation of dendrite development(GO:2000171) |
| 0.2 |
1.2 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.2 |
0.4 |
GO:0072610 |
interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.2 |
0.8 |
GO:0006878 |
cellular copper ion homeostasis(GO:0006878) |
| 0.2 |
0.8 |
GO:0051205 |
protein insertion into membrane(GO:0051205) |
| 0.2 |
0.2 |
GO:0030656 |
regulation of vitamin metabolic process(GO:0030656) |
| 0.2 |
1.0 |
GO:0006356 |
regulation of transcription from RNA polymerase I promoter(GO:0006356) |
| 0.2 |
1.0 |
GO:0042473 |
outer ear morphogenesis(GO:0042473) |
| 0.2 |
0.4 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.2 |
1.0 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.2 |
0.8 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.2 |
1.0 |
GO:0006047 |
UDP-N-acetylglucosamine metabolic process(GO:0006047) |
| 0.2 |
1.1 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.2 |
0.6 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.2 |
0.6 |
GO:0035878 |
nail development(GO:0035878) |
| 0.2 |
0.2 |
GO:0001714 |
endodermal cell fate specification(GO:0001714) |
| 0.2 |
0.2 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.2 |
0.4 |
GO:0034427 |
nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.2 |
0.2 |
GO:0035633 |
maintenance of blood-brain barrier(GO:0035633) |
| 0.2 |
0.4 |
GO:1903069 |
regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
| 0.2 |
2.6 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.2 |
1.5 |
GO:0006614 |
SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.2 |
0.7 |
GO:0046604 |
positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.2 |
4.8 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.2 |
11.3 |
GO:1903955 |
positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.2 |
0.4 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.2 |
0.7 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 |
0.4 |
GO:0046322 |
negative regulation of fatty acid oxidation(GO:0046322) |
| 0.2 |
1.3 |
GO:0019884 |
antigen processing and presentation of exogenous antigen(GO:0019884) |
| 0.2 |
0.9 |
GO:0010832 |
negative regulation of myotube differentiation(GO:0010832) |
| 0.2 |
1.6 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.2 |
0.5 |
GO:0006449 |
regulation of translational termination(GO:0006449) |
| 0.2 |
0.9 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 |
0.5 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.2 |
0.5 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 0.2 |
0.2 |
GO:0006596 |
polyamine biosynthetic process(GO:0006596) |
| 0.2 |
0.4 |
GO:0002176 |
male germ cell proliferation(GO:0002176) |
| 0.2 |
1.2 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.2 |
0.7 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 0.2 |
1.9 |
GO:2000279 |
negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.2 |
1.2 |
GO:0042126 |
nitrate metabolic process(GO:0042126) |
| 0.2 |
0.4 |
GO:2000659 |
regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.2 |
3.2 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.2 |
1.2 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.2 |
0.3 |
GO:2000392 |
regulation of lamellipodium morphogenesis(GO:2000392) |
| 0.2 |
0.2 |
GO:0060312 |
regulation of blood vessel remodeling(GO:0060312) |
| 0.2 |
1.4 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.2 |
0.3 |
GO:1904778 |
regulation of protein localization to cell cortex(GO:1904776) positive regulation of protein localization to cell cortex(GO:1904778) |
| 0.2 |
1.7 |
GO:0051352 |
negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.2 |
0.9 |
GO:0042092 |
type 2 immune response(GO:0042092) |
| 0.2 |
0.2 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.2 |
0.7 |
GO:0031343 |
positive regulation of cell killing(GO:0031343) |
| 0.2 |
2.7 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.2 |
0.7 |
GO:0048208 |
vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.2 |
1.0 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 0.2 |
0.7 |
GO:1900119 |
positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.2 |
0.8 |
GO:0048308 |
organelle inheritance(GO:0048308) Golgi inheritance(GO:0048313) |
| 0.2 |
1.0 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.2 |
0.7 |
GO:0046688 |
response to copper ion(GO:0046688) |
| 0.2 |
0.2 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.2 |
1.5 |
GO:0051123 |
RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.2 |
1.6 |
GO:0033235 |
positive regulation of protein sumoylation(GO:0033235) |
| 0.2 |
0.2 |
GO:0046471 |
cardiolipin metabolic process(GO:0032048) phosphatidylglycerol metabolic process(GO:0046471) |
| 0.2 |
2.9 |
GO:0043039 |
tRNA aminoacylation for protein translation(GO:0006418) tRNA aminoacylation(GO:0043039) |
| 0.2 |
0.5 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
| 0.2 |
0.2 |
GO:0035547 |
interferon-beta secretion(GO:0035546) regulation of interferon-beta secretion(GO:0035547) positive regulation of interferon-beta secretion(GO:0035549) |
| 0.2 |
0.8 |
GO:0060856 |
establishment of blood-brain barrier(GO:0060856) |
| 0.2 |
0.2 |
GO:0019511 |
peptidyl-proline hydroxylation(GO:0019511) |
| 0.2 |
0.8 |
GO:1902036 |
regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.2 |
1.0 |
GO:0031507 |
heterochromatin assembly(GO:0031507) |
| 0.2 |
0.3 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.2 |
0.6 |
GO:0006598 |
polyamine catabolic process(GO:0006598) spermine catabolic process(GO:0046208) |
| 0.2 |
0.5 |
GO:0043144 |
snoRNA processing(GO:0043144) |
| 0.2 |
1.3 |
GO:0010669 |
epithelial structure maintenance(GO:0010669) |
| 0.2 |
1.9 |
GO:0045722 |
positive regulation of gluconeogenesis(GO:0045722) |
| 0.2 |
0.3 |
GO:1902969 |
mitotic DNA replication(GO:1902969) |
| 0.2 |
0.2 |
GO:0044154 |
histone H3-K14 acetylation(GO:0044154) |
| 0.2 |
0.5 |
GO:0051560 |
mitochondrial calcium ion homeostasis(GO:0051560) |
| 0.2 |
1.1 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.2 |
0.5 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.2 |
0.9 |
GO:0021555 |
midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.2 |
1.4 |
GO:0010324 |
membrane invagination(GO:0010324) |
| 0.2 |
0.2 |
GO:0050746 |
regulation of lipoprotein metabolic process(GO:0050746) |
| 0.2 |
0.6 |
GO:0051309 |
female meiosis chromosome separation(GO:0051309) |
| 0.2 |
0.2 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.2 |
0.5 |
GO:0071803 |
positive regulation of podosome assembly(GO:0071803) |
| 0.2 |
0.8 |
GO:0045026 |
plasma membrane fusion(GO:0045026) |
| 0.2 |
0.2 |
GO:0046636 |
negative regulation of alpha-beta T cell activation(GO:0046636) |
| 0.2 |
0.8 |
GO:0032402 |
establishment of melanosome localization(GO:0032401) melanosome transport(GO:0032402) |
| 0.2 |
0.2 |
GO:0000375 |
RNA splicing, via transesterification reactions(GO:0000375) |
| 0.2 |
2.4 |
GO:0034260 |
negative regulation of GTPase activity(GO:0034260) |
| 0.2 |
1.1 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.1 |
0.1 |
GO:0060754 |
regulation of mast cell chemotaxis(GO:0060753) positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.1 |
2.1 |
GO:0019933 |
cAMP-mediated signaling(GO:0019933) |
| 0.1 |
0.1 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.1 |
0.1 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.1 |
0.3 |
GO:0060267 |
positive regulation of respiratory burst(GO:0060267) |
| 0.1 |
2.4 |
GO:0045103 |
intermediate filament-based process(GO:0045103) |
| 0.1 |
3.1 |
GO:0035456 |
response to interferon-beta(GO:0035456) |
| 0.1 |
0.1 |
GO:0072537 |
fibroblast activation(GO:0072537) |
| 0.1 |
0.1 |
GO:0048239 |
negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.1 |
1.3 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.1 |
0.4 |
GO:0042754 |
negative regulation of circadian rhythm(GO:0042754) |
| 0.1 |
0.4 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 |
0.1 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 |
1.7 |
GO:0031573 |
intra-S DNA damage checkpoint(GO:0031573) |
| 0.1 |
2.6 |
GO:0048268 |
clathrin coat assembly(GO:0048268) |
| 0.1 |
0.1 |
GO:0019042 |
viral latency(GO:0019042) |
| 0.1 |
2.2 |
GO:0045333 |
cellular respiration(GO:0045333) |
| 0.1 |
0.6 |
GO:0051290 |
protein heterotetramerization(GO:0051290) |
| 0.1 |
0.7 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.1 |
0.7 |
GO:0032715 |
negative regulation of interleukin-6 production(GO:0032715) |
| 0.1 |
0.4 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 |
2.3 |
GO:0048701 |
embryonic cranial skeleton morphogenesis(GO:0048701) |
| 0.1 |
0.6 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.1 |
0.4 |
GO:0010807 |
regulation of synaptic vesicle priming(GO:0010807) |
| 0.1 |
0.3 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.1 |
0.4 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.1 |
2.6 |
GO:0035058 |
nonmotile primary cilium assembly(GO:0035058) regulation of nonmotile primary cilium assembly(GO:1902855) |
| 0.1 |
0.4 |
GO:0016240 |
autophagosome docking(GO:0016240) |
| 0.1 |
1.1 |
GO:1903317 |
regulation of protein maturation(GO:1903317) |
| 0.1 |
0.5 |
GO:0043983 |
histone H4-K12 acetylation(GO:0043983) |
| 0.1 |
0.3 |
GO:0046512 |
sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.1 |
1.5 |
GO:2000480 |
negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.1 |
0.1 |
GO:0060029 |
neural plate morphogenesis(GO:0001839) convergent extension involved in organogenesis(GO:0060029) |
| 0.1 |
2.7 |
GO:0050830 |
defense response to Gram-positive bacterium(GO:0050830) |
| 0.1 |
2.4 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.1 |
1.5 |
GO:0008340 |
determination of adult lifespan(GO:0008340) |
| 0.1 |
0.4 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.1 |
0.1 |
GO:0090670 |
RNA localization to Cajal body(GO:0090670) telomerase RNA localization to Cajal body(GO:0090671) telomerase RNA localization(GO:0090672) |
| 0.1 |
0.3 |
GO:0072719 |
cellular response to cisplatin(GO:0072719) |
| 0.1 |
0.1 |
GO:1901096 |
regulation of autophagosome maturation(GO:1901096) |
| 0.1 |
0.3 |
GO:0060830 |
ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 |
0.3 |
GO:0070625 |
zymogen granule exocytosis(GO:0070625) |
| 0.1 |
0.3 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.1 |
0.1 |
GO:0046098 |
guanine metabolic process(GO:0046098) |
| 0.1 |
0.4 |
GO:0045648 |
positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.1 |
0.8 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.1 |
1.0 |
GO:0001921 |
positive regulation of receptor recycling(GO:0001921) |
| 0.1 |
1.1 |
GO:0043486 |
histone exchange(GO:0043486) |
| 0.1 |
0.9 |
GO:2001135 |
regulation of endocytic recycling(GO:2001135) |
| 0.1 |
0.4 |
GO:0006361 |
transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.1 |
0.3 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.1 |
0.9 |
GO:0005980 |
polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.1 |
0.1 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.1 |
0.2 |
GO:0019852 |
L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 |
1.2 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.1 |
0.7 |
GO:0043173 |
nucleotide salvage(GO:0043173) |
| 0.1 |
0.2 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 |
0.4 |
GO:0046133 |
pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.1 |
0.5 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 |
0.1 |
GO:0009133 |
nucleoside diphosphate biosynthetic process(GO:0009133) ribonucleoside diphosphate biosynthetic process(GO:0009188) |
| 0.1 |
0.5 |
GO:0006586 |
tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
| 0.1 |
1.5 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.1 |
0.8 |
GO:0043484 |
regulation of RNA splicing(GO:0043484) |
| 0.1 |
0.1 |
GO:0006551 |
leucine metabolic process(GO:0006551) |
| 0.1 |
1.0 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.1 |
1.1 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.1 |
0.2 |
GO:0030431 |
sleep(GO:0030431) |
| 0.1 |
0.1 |
GO:1902177 |
positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.1 |
0.1 |
GO:0019389 |
glucuronoside metabolic process(GO:0019389) |
| 0.1 |
0.1 |
GO:0021895 |
cerebral cortex neuron differentiation(GO:0021895) |
| 0.1 |
1.2 |
GO:0051693 |
actin filament capping(GO:0051693) |
| 0.1 |
0.1 |
GO:0007343 |
egg activation(GO:0007343) |
| 0.1 |
0.2 |
GO:0030202 |
heparin metabolic process(GO:0030202) |
| 0.1 |
0.2 |
GO:0019919 |
peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.1 |
0.2 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.1 |
0.2 |
GO:1903307 |
positive regulation of regulated secretory pathway(GO:1903307) |
| 0.1 |
0.2 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.1 |
0.3 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.1 |
7.6 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.1 |
0.9 |
GO:0006044 |
N-acetylglucosamine metabolic process(GO:0006044) |
| 0.1 |
1.1 |
GO:0003016 |
respiratory system process(GO:0003016) |
| 0.1 |
3.5 |
GO:0008637 |
apoptotic mitochondrial changes(GO:0008637) |
| 0.1 |
1.2 |
GO:0061178 |
regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
| 0.1 |
0.1 |
GO:0048262 |
determination of dorsal/ventral asymmetry(GO:0048262) determination of dorsal identity(GO:0048263) |
| 0.1 |
3.7 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.1 |
0.7 |
GO:0098877 |
neurotransmitter receptor transport to plasma membrane(GO:0098877) |
| 0.1 |
0.4 |
GO:0042249 |
establishment of planar polarity of embryonic epithelium(GO:0042249) |
| 0.1 |
0.7 |
GO:0001516 |
prostaglandin biosynthetic process(GO:0001516) icosanoid biosynthetic process(GO:0046456) prostanoid biosynthetic process(GO:0046457) fatty acid derivative biosynthetic process(GO:1901570) |
| 0.1 |
0.2 |
GO:0043031 |
negative regulation of macrophage activation(GO:0043031) |
| 0.1 |
0.9 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.1 |
0.2 |
GO:0010447 |
response to acidic pH(GO:0010447) |
| 0.1 |
0.3 |
GO:0006667 |
sphinganine metabolic process(GO:0006667) |
| 0.1 |
1.9 |
GO:0048791 |
calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.1 |
0.4 |
GO:0097298 |
regulation of nucleus size(GO:0097298) |
| 0.1 |
0.2 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.1 |
0.6 |
GO:0008053 |
mitochondrial fusion(GO:0008053) |
| 0.1 |
0.4 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 0.1 |
1.3 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.1 |
0.3 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.1 |
0.2 |
GO:0051299 |
centrosome separation(GO:0051299) |
| 0.1 |
0.6 |
GO:0006561 |
proline biosynthetic process(GO:0006561) |
| 0.1 |
4.0 |
GO:0051865 |
protein autoubiquitination(GO:0051865) |
| 0.1 |
0.2 |
GO:1990839 |
response to endothelin(GO:1990839) |
| 0.1 |
2.2 |
GO:0007051 |
spindle organization(GO:0007051) |
| 0.1 |
0.3 |
GO:0043496 |
regulation of protein homodimerization activity(GO:0043496) |
| 0.1 |
0.3 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.1 |
0.2 |
GO:0009405 |
pathogenesis(GO:0009405) |
| 0.1 |
0.1 |
GO:0050665 |
regulation of hydrogen peroxide metabolic process(GO:0010310) regulation of hydrogen peroxide biosynthetic process(GO:0010728) hydrogen peroxide biosynthetic process(GO:0050665) |
| 0.1 |
0.1 |
GO:0030223 |
neutrophil differentiation(GO:0030223) |
| 0.1 |
1.2 |
GO:1902751 |
positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.1 |
0.1 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 |
0.4 |
GO:0000098 |
sulfur amino acid catabolic process(GO:0000098) |
| 0.1 |
2.9 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.1 |
4.0 |
GO:0030838 |
positive regulation of actin filament polymerization(GO:0030838) |
| 0.1 |
0.5 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 0.1 |
0.4 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.1 |
0.2 |
GO:0045349 |
interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.1 |
1.9 |
GO:0045727 |
positive regulation of translation(GO:0045727) |
| 0.1 |
0.4 |
GO:0045945 |
positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.1 |
0.4 |
GO:1902579 |
multi-organism transport(GO:0044766) multi-organism localization(GO:1902579) |
| 0.1 |
0.2 |
GO:2000144 |
positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.1 |
0.4 |
GO:0050819 |
negative regulation of coagulation(GO:0050819) |
| 0.1 |
0.4 |
GO:0061684 |
chaperone-mediated autophagy(GO:0061684) |
| 0.1 |
0.3 |
GO:1903897 |
regulation of PERK-mediated unfolded protein response(GO:1903897) |
| 0.1 |
0.5 |
GO:2001256 |
regulation of store-operated calcium entry(GO:2001256) |
| 0.1 |
1.5 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 |
0.1 |
GO:0070255 |
mucus secretion(GO:0070254) regulation of mucus secretion(GO:0070255) |
| 0.1 |
0.4 |
GO:0032469 |
endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
| 0.1 |
0.2 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 0.1 |
0.4 |
GO:0035635 |
entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.1 |
0.5 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.1 |
0.5 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 0.1 |
0.5 |
GO:0002097 |
tRNA wobble base modification(GO:0002097) |
| 0.1 |
0.2 |
GO:0070243 |
regulation of thymocyte apoptotic process(GO:0070243) |
| 0.1 |
0.5 |
GO:0051958 |
methotrexate transport(GO:0051958) reduced folate transmembrane transport(GO:0098838) |
| 0.1 |
0.2 |
GO:0032815 |
negative regulation of natural killer cell activation(GO:0032815) |
| 0.1 |
0.5 |
GO:1990564 |
protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 |
1.6 |
GO:0035335 |
peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.1 |
0.2 |
GO:0042264 |
peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.1 |
0.2 |
GO:0016322 |
neuron remodeling(GO:0016322) |
| 0.1 |
0.1 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.1 |
0.9 |
GO:0070265 |
necrotic cell death(GO:0070265) |
| 0.1 |
0.4 |
GO:0006308 |
DNA catabolic process(GO:0006308) |
| 0.1 |
0.4 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.1 |
0.3 |
GO:0006689 |
ganglioside catabolic process(GO:0006689) |
| 0.1 |
1.1 |
GO:0045668 |
negative regulation of osteoblast differentiation(GO:0045668) |
| 0.1 |
0.1 |
GO:0035092 |
sperm chromatin condensation(GO:0035092) |
| 0.1 |
0.2 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.1 |
0.8 |
GO:0033539 |
fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 |
0.1 |
GO:0002322 |
B cell proliferation involved in immune response(GO:0002322) |
| 0.1 |
0.2 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.1 |
0.8 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 |
0.2 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.1 |
0.8 |
GO:0071300 |
cellular response to retinoic acid(GO:0071300) |
| 0.1 |
0.2 |
GO:0099590 |
neurotransmitter receptor internalization(GO:0099590) |
| 0.1 |
0.1 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 0.1 |
0.3 |
GO:1990022 |
RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.1 |
0.1 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.1 |
0.1 |
GO:0060253 |
negative regulation of glial cell proliferation(GO:0060253) |
| 0.1 |
0.1 |
GO:0051905 |
pigment granule transport(GO:0051904) establishment of pigment granule localization(GO:0051905) |
| 0.1 |
0.3 |
GO:1903028 |
asymmetric Golgi ribbon formation(GO:0090164) regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
| 0.1 |
0.5 |
GO:1901223 |
negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
| 0.1 |
0.4 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.1 |
0.1 |
GO:0098792 |
xenophagy(GO:0098792) |
| 0.1 |
0.3 |
GO:0070989 |
oxidative demethylation(GO:0070989) |
| 0.1 |
5.6 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.1 |
0.4 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.1 |
0.8 |
GO:0006744 |
ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.1 |
0.2 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.1 |
0.7 |
GO:0045747 |
positive regulation of Notch signaling pathway(GO:0045747) |
| 0.1 |
0.1 |
GO:1990748 |
cellular detoxification(GO:1990748) |
| 0.1 |
0.2 |
GO:0097186 |
amelogenesis(GO:0097186) |
| 0.1 |
0.2 |
GO:0060050 |
positive regulation of protein glycosylation(GO:0060050) |
| 0.1 |
0.4 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 |
1.2 |
GO:0007020 |
microtubule nucleation(GO:0007020) |
| 0.1 |
0.1 |
GO:0071801 |
regulation of podosome assembly(GO:0071801) |
| 0.1 |
0.3 |
GO:0061615 |
glycolytic process through fructose-6-phosphate(GO:0061615) |
| 0.1 |
0.2 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 |
0.1 |
GO:2000193 |
positive regulation of fatty acid transport(GO:2000193) |
| 0.1 |
0.3 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.1 |
0.2 |
GO:0071243 |
cellular response to arsenic-containing substance(GO:0071243) |
| 0.1 |
0.7 |
GO:0072376 |
protein activation cascade(GO:0072376) |
| 0.1 |
0.2 |
GO:0097309 |
cap1 mRNA methylation(GO:0097309) |
| 0.1 |
0.1 |
GO:0006409 |
tRNA export from nucleus(GO:0006409) tRNA transport(GO:0051031) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.1 |
0.9 |
GO:0006626 |
protein targeting to mitochondrion(GO:0006626) |
| 0.1 |
1.1 |
GO:0032008 |
positive regulation of TOR signaling(GO:0032008) |
| 0.1 |
0.1 |
GO:2000114 |
regulation of establishment of cell polarity(GO:2000114) |
| 0.1 |
0.5 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.1 |
0.1 |
GO:0044803 |
multi-organism membrane organization(GO:0044803) |
| 0.1 |
0.1 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.1 |
1.1 |
GO:0032091 |
negative regulation of protein binding(GO:0032091) |
| 0.1 |
0.2 |
GO:0006563 |
L-serine metabolic process(GO:0006563) |
| 0.1 |
0.1 |
GO:0006359 |
regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.1 |
1.7 |
GO:0007052 |
mitotic spindle organization(GO:0007052) |
| 0.1 |
0.2 |
GO:0002052 |
positive regulation of neuroblast proliferation(GO:0002052) |
| 0.1 |
0.4 |
GO:0060314 |
regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.1 |
0.1 |
GO:0016188 |
synaptic vesicle maturation(GO:0016188) |
| 0.1 |
0.2 |
GO:0070571 |
negative regulation of neuron projection regeneration(GO:0070571) |
| 0.1 |
1.4 |
GO:0007157 |
heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.1 |
0.1 |
GO:0006987 |
activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 |
0.2 |
GO:0001696 |
gastric acid secretion(GO:0001696) |
| 0.1 |
0.2 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 |
1.0 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.1 |
0.2 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 0.0 |
0.5 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.0 |
0.1 |
GO:0045324 |
late endosome to vacuole transport(GO:0045324) |
| 0.0 |
0.1 |
GO:0042891 |
antibiotic transport(GO:0042891) |
| 0.0 |
0.2 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.0 |
0.2 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.0 |
0.4 |
GO:0045540 |
regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.0 |
0.2 |
GO:0006049 |
UDP-N-acetylglucosamine catabolic process(GO:0006049) |
| 0.0 |
0.0 |
GO:0051182 |
coenzyme transport(GO:0051182) |
| 0.0 |
0.2 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.0 |
0.1 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.0 |
0.7 |
GO:0031641 |
regulation of myelination(GO:0031641) |
| 0.0 |
0.1 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.0 |
0.2 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.0 |
0.1 |
GO:0070200 |
establishment of protein localization to telomere(GO:0070200) |
| 0.0 |
0.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 |
0.3 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.0 |
0.4 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.0 |
0.3 |
GO:0072112 |
renal filtration cell differentiation(GO:0061318) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
| 0.0 |
0.1 |
GO:0060025 |
regulation of synaptic activity(GO:0060025) |
| 0.0 |
0.1 |
GO:0006002 |
fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 |
0.1 |
GO:0051316 |
attachment of spindle microtubules to kinetochore involved in meiotic chromosome segregation(GO:0051316) |
| 0.0 |
0.3 |
GO:0045123 |
cellular extravasation(GO:0045123) |
| 0.0 |
0.4 |
GO:0015858 |
nucleoside transport(GO:0015858) |
| 0.0 |
0.1 |
GO:0019585 |
uronic acid metabolic process(GO:0006063) glucuronate metabolic process(GO:0019585) |
| 0.0 |
0.1 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.0 |
0.0 |
GO:0035990 |
tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.0 |
0.8 |
GO:0008543 |
fibroblast growth factor receptor signaling pathway(GO:0008543) |
| 0.0 |
0.2 |
GO:0031047 |
gene silencing by RNA(GO:0031047) |
| 0.0 |
0.2 |
GO:0006024 |
glycosaminoglycan biosynthetic process(GO:0006024) |
| 0.0 |
0.1 |
GO:0048311 |
mitochondrion distribution(GO:0048311) |
| 0.0 |
0.1 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.0 |
0.4 |
GO:0071806 |
intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
| 0.0 |
0.5 |
GO:0051293 |
establishment of spindle localization(GO:0051293) |
| 0.0 |
0.1 |
GO:0032310 |
prostaglandin secretion(GO:0032310) |
| 0.0 |
0.1 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 |
0.1 |
GO:0060690 |
epithelial cell differentiation involved in salivary gland development(GO:0060690) |
| 0.0 |
0.3 |
GO:0060972 |
left/right pattern formation(GO:0060972) |
| 0.0 |
0.0 |
GO:1901798 |
positive regulation of signal transduction by p53 class mediator(GO:1901798) |
| 0.0 |
0.1 |
GO:0090280 |
positive regulation of calcium ion import(GO:0090280) |
| 0.0 |
0.1 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.0 |
0.3 |
GO:0009303 |
rRNA transcription(GO:0009303) |
| 0.0 |
0.0 |
GO:0002314 |
germinal center B cell differentiation(GO:0002314) |
| 0.0 |
0.2 |
GO:0001706 |
endoderm formation(GO:0001706) |
| 0.0 |
1.2 |
GO:0006342 |
chromatin silencing(GO:0006342) |
| 0.0 |
0.0 |
GO:0045741 |
positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.0 |
0.1 |
GO:1904294 |
positive regulation of ERAD pathway(GO:1904294) |
| 0.0 |
0.1 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.0 |
0.2 |
GO:0006884 |
cell volume homeostasis(GO:0006884) |
| 0.0 |
0.0 |
GO:0090646 |
mitochondrial tRNA processing(GO:0090646) |
| 0.0 |
0.5 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.0 |
0.1 |
GO:2001223 |
negative regulation of neuron migration(GO:2001223) |
| 0.0 |
0.1 |
GO:0060711 |
labyrinthine layer development(GO:0060711) |
| 0.0 |
0.0 |
GO:0010884 |
positive regulation of lipid storage(GO:0010884) |
| 0.0 |
0.0 |
GO:0002430 |
complement receptor mediated signaling pathway(GO:0002430) |
| 0.0 |
0.2 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 0.0 |
0.8 |
GO:0042147 |
retrograde transport, endosome to Golgi(GO:0042147) |
| 0.0 |
0.1 |
GO:0034497 |
protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.0 |
0.1 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.0 |
0.1 |
GO:0034472 |
snRNA 3'-end processing(GO:0034472) |
| 0.0 |
0.1 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.0 |
0.1 |
GO:0006370 |
7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 |
0.0 |
GO:1902276 |
pancreatic amylase secretion(GO:0036395) regulation of pancreatic amylase secretion(GO:1902276) |
| 0.0 |
0.0 |
GO:0072531 |
pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.0 |
0.2 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.0 |
0.1 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.0 |
0.3 |
GO:0052548 |
regulation of endopeptidase activity(GO:0052548) |
| 0.0 |
0.0 |
GO:0048662 |
negative regulation of smooth muscle cell proliferation(GO:0048662) |
| 0.0 |
0.1 |
GO:0009083 |
branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 |
0.0 |
GO:1903301 |
positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.0 |
0.0 |
GO:0006701 |
progesterone biosynthetic process(GO:0006701) progesterone metabolic process(GO:0042448) |
| 0.0 |
0.0 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 |
0.1 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.0 |
0.1 |
GO:0071346 |
cellular response to interferon-gamma(GO:0071346) |
| 0.0 |
0.1 |
GO:0033866 |
coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.0 |
0.1 |
GO:2001244 |
positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
| 0.0 |
0.5 |
GO:1904893 |
negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
