Motif ID: Zbtb3
Z-value: 0.833
Transcription factors associated with Zbtb3:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Zbtb3 | ENSMUSG00000071661.6 | Zbtb3 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Zbtb3 | mm10_v2_chr19_+_8802486_8802530 | 0.33 | 3.4e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 2.7 | GO:0001978 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.8 | 1.5 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.5 | 1.5 | GO:1900275 | negative regulation of phospholipase C activity(GO:1900275) |
| 0.4 | 1.5 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.4 | 1.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.3 | 3.4 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.3 | 1.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.3 | 1.6 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.3 | 1.3 | GO:0050904 | diapedesis(GO:0050904) |
| 0.3 | 0.9 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
| 0.2 | 0.9 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.2 | 0.6 | GO:0035621 | ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.2 | 0.5 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.1 | 0.4 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 1.9 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
| 0.1 | 0.3 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.1 | 1.0 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.1 | 1.2 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.1 | 0.5 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 1.1 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.1 | 0.7 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.1 | 0.8 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.1 | 0.3 | GO:0009838 | abscission(GO:0009838) |
| 0.1 | 1.1 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 | 1.3 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.1 | 0.5 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.1 | 0.8 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 0.2 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.1 | 0.4 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.1 | 1.7 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.1 | 0.5 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.1 | 0.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 2.6 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 0.2 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 1.4 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.3 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
| 0.0 | 0.5 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
| 0.0 | 3.8 | GO:0014065 | phosphatidylinositol 3-kinase signaling(GO:0014065) |
| 0.0 | 0.8 | GO:0030262 | apoptotic nuclear changes(GO:0030262) |
| 0.0 | 0.4 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 | 0.4 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.0 | 0.4 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.0 | 0.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 1.1 | GO:0007193 | adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
| 0.0 | 0.3 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 | 1.2 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 | 0.5 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.2 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.0 | 0.3 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.0 | 0.9 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.0 | 1.4 | GO:1901607 | alpha-amino acid biosynthetic process(GO:1901607) |
| 0.0 | 0.1 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.2 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.7 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.2 | 1.9 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.2 | 1.6 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.2 | 1.5 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.1 | 1.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.1 | 1.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 0.5 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 1.3 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.1 | 3.9 | GO:0016459 | myosin complex(GO:0016459) |
| 0.1 | 0.7 | GO:0098845 | postsynaptic endosome(GO:0098845) |
| 0.0 | 1.1 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.2 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
| 0.0 | 1.7 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 1.5 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.3 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 3.3 | GO:0036126 | sperm flagellum(GO:0036126) |
| 0.0 | 1.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.3 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.2 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.0 | 0.5 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.0 | 0.4 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 2.0 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 3.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 3.8 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 1.2 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 1.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.0 | 0.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 0.9 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 1.2 | GO:0016234 | inclusion body(GO:0016234) |
| 0.0 | 0.8 | GO:0005844 | polysome(GO:0005844) |
| 0.0 | 0.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.5 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.4 | 1.6 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 0.4 | 1.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.3 | 3.4 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.3 | 2.7 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.3 | 1.3 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.2 | 0.6 | GO:0047179 | platelet-activating factor acetyltransferase activity(GO:0047179) |
| 0.2 | 0.7 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.2 | 1.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.1 | 0.4 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.1 | 0.4 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.1 | 0.8 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.1 | 1.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.1 | 1.0 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.1 | 1.5 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 1.1 | GO:0035005 | lipid kinase activity(GO:0001727) 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 0.6 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.4 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.1 | 1.5 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 0.7 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 1.2 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.1 | 0.8 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.2 | GO:0001888 | glucuronyl-galactosyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0001888) |
| 0.1 | 1.6 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.1 | 1.4 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.0 | 0.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.4 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.0 | 1.7 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 1.1 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 4.2 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 1.5 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.5 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 2.2 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.0 | 0.5 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 3.9 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.0 | 2.9 | GO:0035091 | phosphatidylinositol binding(GO:0035091) |
| 0.0 | 1.1 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 3.0 | GO:0003924 | GTPase activity(GO:0003924) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.4 | PID_THROMBIN_PAR4_PATHWAY | PAR4-mediated thrombin signaling events |
| 0.1 | 1.1 | PID_S1P_S1P4_PATHWAY | S1P4 pathway |
| 0.1 | 1.3 | PID_INTEGRIN5_PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 1.5 | PID_BETA_CATENIN_DEG_PATHWAY | Degradation of beta catenin |
| 0.0 | 1.1 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.0 | 1.2 | PID_INSULIN_GLUCOSE_PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.3 | ST_INTERFERON_GAMMA_PATHWAY | Interferon gamma pathway. |
| 0.0 | 1.1 | PID_KIT_PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 1.1 | PID_RET_PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.6 | PID_LIS1_PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 2.1 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.7 | PID_TRKR_PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 2.1 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 3.4 | REACTOME_TANDEM_PORE_DOMAIN_POTASSIUM_CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.3 | 2.7 | REACTOME_ACETYLCHOLINE_BINDING_AND_DOWNSTREAM_EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
| 0.1 | 1.4 | REACTOME_TERMINATION_OF_O_GLYCAN_BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 0.7 | REACTOME_ORGANIC_CATION_ANION_ZWITTERION_TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 1.6 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 1.2 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_EARLY_ENDOSOME_MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 1.5 | REACTOME_CTNNB1_PHOSPHORYLATION_CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 1.0 | REACTOME_CYTOCHROME_P450_ARRANGED_BY_SUBSTRATE_TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.1 | 1.5 | REACTOME_CRMPS_IN_SEMA3A_SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.1 | 2.7 | REACTOME_INHIBITION_OF_VOLTAGE_GATED_CA2_CHANNELS_VIA_GBETA_GAMMA_SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.1 | 1.2 | REACTOME_DESTABILIZATION_OF_MRNA_BY_KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 1.1 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_PLASMA_MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 1.1 | REACTOME_NCAM1_INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 1.1 | REACTOME_PLC_BETA_MEDIATED_EVENTS | Genes involved in PLC beta mediated events |
| 0.0 | 0.3 | REACTOME_RETROGRADE_NEUROTROPHIN_SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.4 | REACTOME_INSULIN_SYNTHESIS_AND_PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 1.2 | REACTOME_GLUCOSE_METABOLISM | Genes involved in Glucose metabolism |
| 0.0 | 0.3 | REACTOME_ABORTIVE_ELONGATION_OF_HIV1_TRANSCRIPT_IN_THE_ABSENCE_OF_TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.0 | 0.2 | REACTOME_PRE_NOTCH_PROCESSING_IN_GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.0 | 0.6 | REACTOME_SPHINGOLIPID_DE_NOVO_BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.2 | REACTOME_REGULATION_OF_INSULIN_LIKE_GROWTH_FACTOR_IGF_ACTIVITY_BY_INSULIN_LIKE_GROWTH_FACTOR_BINDING_PROTEINS_IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.1 | REACTOME_COPI_MEDIATED_TRANSPORT | Genes involved in COPI Mediated Transport |


