| 2.3 |
6.9 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 1.1 |
5.7 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 0.9 |
4.6 |
GO:0046864 |
retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) alveolar primary septum development(GO:0061143) |
| 0.9 |
2.6 |
GO:0002314 |
germinal center B cell differentiation(GO:0002314) |
| 0.8 |
4.1 |
GO:0015705 |
iodide transport(GO:0015705) |
| 0.8 |
3.1 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.8 |
2.3 |
GO:0060129 |
thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 0.7 |
4.8 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 0.7 |
2.1 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.7 |
1.4 |
GO:0060535 |
trachea cartilage morphogenesis(GO:0060535) |
| 0.6 |
1.3 |
GO:0072138 |
mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 0.6 |
1.9 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 0.6 |
2.3 |
GO:0042414 |
epinephrine metabolic process(GO:0042414) |
| 0.6 |
2.3 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.6 |
1.7 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
| 0.5 |
1.6 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.5 |
1.6 |
GO:0000087 |
mitotic M phase(GO:0000087) |
| 0.5 |
1.6 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.5 |
2.0 |
GO:0048682 |
axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.5 |
1.0 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.5 |
1.4 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.5 |
1.4 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.5 |
4.2 |
GO:1902715 |
positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.5 |
1.8 |
GO:0061626 |
pharyngeal arch artery morphogenesis(GO:0061626) |
| 0.5 |
1.4 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.5 |
1.8 |
GO:0048819 |
regulation of hair follicle maturation(GO:0048819) regulation of catagen(GO:0051794) |
| 0.4 |
1.3 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 0.4 |
1.3 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.4 |
2.5 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.4 |
1.7 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.4 |
2.9 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.4 |
0.8 |
GO:0061074 |
regulation of neural retina development(GO:0061074) |
| 0.4 |
1.2 |
GO:0042822 |
vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.4 |
1.2 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.4 |
1.5 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.4 |
1.8 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 0.4 |
1.4 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.4 |
1.1 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.3 |
1.4 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 0.3 |
1.4 |
GO:0042905 |
9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.3 |
1.0 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.3 |
1.0 |
GO:2000562 |
negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.3 |
0.7 |
GO:1900426 |
positive regulation of defense response to bacterium(GO:1900426) |
| 0.3 |
1.3 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.3 |
0.7 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 0.3 |
1.9 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.3 |
2.6 |
GO:2001198 |
regulation of dendritic cell differentiation(GO:2001198) |
| 0.3 |
0.3 |
GO:0035771 |
interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.3 |
1.3 |
GO:0006842 |
tricarboxylic acid transport(GO:0006842) succinate transport(GO:0015744) citrate transport(GO:0015746) |
| 0.3 |
1.3 |
GO:0060753 |
regulation of mast cell chemotaxis(GO:0060753) |
| 0.3 |
0.9 |
GO:0044413 |
evasion or tolerance of host defenses by virus(GO:0019049) positive regulation of transforming growth factor beta3 production(GO:0032916) avoidance of host defenses(GO:0044413) evasion or tolerance of host defenses(GO:0044415) avoidance of defenses of other organism involved in symbiotic interaction(GO:0051832) evasion or tolerance of defenses of other organism involved in symbiotic interaction(GO:0051834) activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.3 |
1.2 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.3 |
0.9 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.3 |
0.9 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.3 |
1.2 |
GO:0032914 |
positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.3 |
1.2 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.3 |
0.9 |
GO:0035696 |
monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.3 |
0.6 |
GO:0038091 |
VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) |
| 0.3 |
0.6 |
GO:2000224 |
testosterone biosynthetic process(GO:0061370) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.3 |
0.6 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.3 |
1.1 |
GO:0060032 |
notochord regression(GO:0060032) |
| 0.3 |
0.9 |
GO:0035633 |
maintenance of blood-brain barrier(GO:0035633) |
| 0.3 |
0.8 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.3 |
1.7 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.3 |
1.7 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.3 |
2.2 |
GO:0030174 |
regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.3 |
0.8 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.3 |
0.8 |
GO:0070672 |
response to interleukin-15(GO:0070672) |
| 0.3 |
1.1 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.3 |
0.8 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.3 |
0.8 |
GO:0033024 |
mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.3 |
0.8 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.3 |
1.1 |
GO:0033632 |
regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.3 |
1.6 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.3 |
1.5 |
GO:0098838 |
reduced folate transmembrane transport(GO:0098838) |
| 0.3 |
1.0 |
GO:0038145 |
macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.3 |
1.3 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) |
| 0.3 |
0.5 |
GO:0010046 |
response to mycotoxin(GO:0010046) |
| 0.3 |
1.0 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.2 |
0.7 |
GO:2000418 |
positive regulation of eosinophil migration(GO:2000418) |
| 0.2 |
1.2 |
GO:0098543 |
detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.2 |
1.2 |
GO:0032237 |
activation of store-operated calcium channel activity(GO:0032237) |
| 0.2 |
1.2 |
GO:0021905 |
pancreatic A cell development(GO:0003322) forebrain-midbrain boundary formation(GO:0021905) somatic motor neuron fate commitment(GO:0021917) regulation of transcription from RNA polymerase II promoter involved in somatic motor neuron fate commitment(GO:0021918) |
| 0.2 |
0.7 |
GO:0030300 |
regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.2 |
0.7 |
GO:2000620 |
positive regulation of histone H4-K16 acetylation(GO:2000620) |
| 0.2 |
1.2 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 0.2 |
1.2 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.2 |
1.6 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.2 |
0.5 |
GO:0002606 |
positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 0.2 |
0.2 |
GO:1900020 |
regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.2 |
0.2 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.2 |
0.9 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.2 |
1.1 |
GO:0010359 |
regulation of anion channel activity(GO:0010359) |
| 0.2 |
0.7 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.2 |
0.7 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.2 |
0.4 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 0.2 |
1.6 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.2 |
1.3 |
GO:0043137 |
DNA replication, removal of RNA primer(GO:0043137) |
| 0.2 |
0.9 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.2 |
1.1 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.2 |
0.6 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 |
0.6 |
GO:0015920 |
regulation of phosphatidylcholine catabolic process(GO:0010899) lipopolysaccharide transport(GO:0015920) |
| 0.2 |
1.1 |
GO:0034372 |
very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.2 |
0.9 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.2 |
0.4 |
GO:0072061 |
inner medullary collecting duct development(GO:0072061) |
| 0.2 |
0.2 |
GO:0034370 |
triglyceride-rich lipoprotein particle remodeling(GO:0034370) |
| 0.2 |
0.6 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.2 |
0.6 |
GO:1900158 |
negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 0.2 |
0.6 |
GO:0001866 |
NK T cell proliferation(GO:0001866) |
| 0.2 |
0.2 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.2 |
0.6 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.2 |
0.6 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 0.2 |
0.6 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.2 |
0.4 |
GO:0035793 |
negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.2 |
1.0 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 0.2 |
0.2 |
GO:0071316 |
cellular response to nicotine(GO:0071316) |
| 0.2 |
2.2 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.2 |
1.2 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.2 |
0.6 |
GO:1902044 |
regulation of Fas signaling pathway(GO:1902044) negative regulation of Fas signaling pathway(GO:1902045) |
| 0.2 |
0.8 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 0.2 |
1.7 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.2 |
0.8 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.2 |
0.4 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 0.2 |
0.6 |
GO:0016056 |
rhodopsin mediated signaling pathway(GO:0016056) post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.2 |
0.2 |
GO:0035878 |
nail development(GO:0035878) |
| 0.2 |
0.8 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.2 |
2.3 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.2 |
0.2 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.2 |
0.8 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.2 |
0.4 |
GO:1904058 |
positive regulation of sensory perception of pain(GO:1904058) |
| 0.2 |
0.9 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.2 |
0.9 |
GO:0019249 |
lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.2 |
0.7 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 0.2 |
0.5 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.2 |
0.7 |
GO:0097531 |
mast cell migration(GO:0097531) |
| 0.2 |
0.9 |
GO:0060158 |
phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.2 |
0.7 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.2 |
0.5 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.2 |
0.3 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.2 |
0.9 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.2 |
0.7 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.2 |
1.7 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.2 |
0.8 |
GO:1990928 |
response to amino acid starvation(GO:1990928) |
| 0.2 |
0.2 |
GO:1903244 |
positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.2 |
0.5 |
GO:0072139 |
glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.2 |
0.5 |
GO:2000256 |
positive regulation of male germ cell proliferation(GO:2000256) |
| 0.2 |
0.3 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.2 |
0.3 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.2 |
0.5 |
GO:2000192 |
negative regulation of fatty acid transport(GO:2000192) |
| 0.2 |
0.5 |
GO:0046013 |
T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.2 |
0.8 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.2 |
1.5 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.2 |
0.8 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 0.2 |
0.7 |
GO:2000343 |
positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
| 0.2 |
0.5 |
GO:0010814 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.2 |
0.3 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 0.2 |
0.5 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.2 |
0.6 |
GO:0048143 |
astrocyte activation(GO:0048143) |
| 0.2 |
0.6 |
GO:0035752 |
lysosomal lumen pH elevation(GO:0035752) |
| 0.2 |
0.8 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.2 |
1.8 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.2 |
0.9 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.2 |
0.5 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) |
| 0.2 |
0.8 |
GO:0042758 |
long-chain fatty acid catabolic process(GO:0042758) |
| 0.2 |
1.4 |
GO:1903975 |
regulation of glial cell migration(GO:1903975) |
| 0.1 |
0.6 |
GO:0044336 |
canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.1 |
3.1 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 |
0.7 |
GO:0072488 |
ammonium transmembrane transport(GO:0072488) |
| 0.1 |
0.1 |
GO:1990035 |
calcium ion import into cell(GO:1990035) |
| 0.1 |
0.4 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.1 |
2.5 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 |
0.7 |
GO:0070474 |
positive regulation of uterine smooth muscle contraction(GO:0070474) |
| 0.1 |
1.3 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.1 |
0.6 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.1 |
0.7 |
GO:0090272 |
negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.1 |
0.4 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.1 |
0.6 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 0.1 |
1.4 |
GO:0001977 |
renal system process involved in regulation of blood volume(GO:0001977) |
| 0.1 |
2.1 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 |
0.4 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.1 |
0.3 |
GO:1901228 |
positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.1 |
0.1 |
GO:0038161 |
prolactin signaling pathway(GO:0038161) |
| 0.1 |
1.1 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.1 |
0.1 |
GO:0045472 |
response to ether(GO:0045472) |
| 0.1 |
0.7 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.1 |
0.1 |
GO:0070317 |
negative regulation of G0 to G1 transition(GO:0070317) |
| 0.1 |
0.3 |
GO:0010519 |
negative regulation of phospholipase activity(GO:0010519) |
| 0.1 |
0.6 |
GO:0090309 |
positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.1 |
0.3 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 |
0.5 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.1 |
1.2 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.1 |
0.1 |
GO:0032829 |
regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.1 |
0.8 |
GO:0046339 |
diacylglycerol metabolic process(GO:0046339) |
| 0.1 |
0.8 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 |
0.4 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 0.1 |
0.6 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 |
0.4 |
GO:0019043 |
establishment of viral latency(GO:0019043) |
| 0.1 |
0.1 |
GO:0060681 |
branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.1 |
0.6 |
GO:1903361 |
protein localization to basolateral plasma membrane(GO:1903361) |
| 0.1 |
0.3 |
GO:1904431 |
positive regulation of t-circle formation(GO:1904431) |
| 0.1 |
0.6 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.1 |
0.6 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.1 |
0.4 |
GO:0071649 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.1 |
0.4 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.1 |
0.5 |
GO:0098915 |
membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.1 |
0.9 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.1 |
0.7 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.1 |
0.7 |
GO:0003383 |
apical constriction(GO:0003383) |
| 0.1 |
1.2 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.1 |
0.6 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.1 |
0.6 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.1 |
0.4 |
GO:0042196 |
dichloromethane metabolic process(GO:0018900) chlorinated hydrocarbon metabolic process(GO:0042196) halogenated hydrocarbon metabolic process(GO:0042197) |
| 0.1 |
0.4 |
GO:0003094 |
glomerular filtration(GO:0003094) |
| 0.1 |
0.2 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.1 |
1.0 |
GO:0034088 |
maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.1 |
0.6 |
GO:0090666 |
telomere assembly(GO:0032202) scaRNA localization to Cajal body(GO:0090666) |
| 0.1 |
0.6 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 |
0.3 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.1 |
0.7 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 |
0.2 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.1 |
0.3 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 |
0.7 |
GO:0044034 |
negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 |
1.2 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.1 |
0.4 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.1 |
0.1 |
GO:0060744 |
thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 |
2.2 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 |
0.2 |
GO:0051708 |
intracellular transport of viral protein in host cell(GO:0019060) symbiont intracellular protein transport in host(GO:0030581) cytosol to ER transport(GO:0046967) intracellular protein transport in other organism involved in symbiotic interaction(GO:0051708) |
| 0.1 |
0.4 |
GO:0010593 |
negative regulation of lamellipodium assembly(GO:0010593) |
| 0.1 |
0.3 |
GO:2000314 |
negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.1 |
0.1 |
GO:0000454 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.1 |
2.3 |
GO:0046685 |
response to arsenic-containing substance(GO:0046685) |
| 0.1 |
0.4 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 0.1 |
1.1 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.1 |
1.1 |
GO:0090308 |
regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.1 |
2.0 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.1 |
0.1 |
GO:0048850 |
hypophysis morphogenesis(GO:0048850) |
| 0.1 |
0.9 |
GO:0046688 |
response to copper ion(GO:0046688) |
| 0.1 |
0.7 |
GO:0010571 |
positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 |
0.1 |
GO:0034238 |
macrophage fusion(GO:0034238) |
| 0.1 |
0.5 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 |
0.8 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 |
1.7 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.1 |
0.3 |
GO:0033030 |
negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.1 |
1.3 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.1 |
0.6 |
GO:0003065 |
positive regulation of heart rate by epinephrine(GO:0003065) |
| 0.1 |
0.8 |
GO:0032463 |
negative regulation of protein homooligomerization(GO:0032463) |
| 0.1 |
0.2 |
GO:0014873 |
response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 0.1 |
1.9 |
GO:0030033 |
microvillus assembly(GO:0030033) |
| 0.1 |
0.2 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.1 |
0.4 |
GO:0045838 |
positive regulation of membrane potential(GO:0045838) |
| 0.1 |
0.8 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.1 |
0.5 |
GO:0052646 |
alditol phosphate metabolic process(GO:0052646) |
| 0.1 |
0.5 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 0.1 |
0.8 |
GO:0098739 |
import across plasma membrane(GO:0098739) |
| 0.1 |
0.6 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.1 |
0.1 |
GO:1900028 |
negative regulation of ruffle assembly(GO:1900028) |
| 0.1 |
0.5 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 |
0.5 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.1 |
0.6 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.1 |
0.2 |
GO:0042701 |
progesterone secretion(GO:0042701) |
| 0.1 |
1.8 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 |
0.1 |
GO:0060066 |
oviduct development(GO:0060066) |
| 0.1 |
0.2 |
GO:0060696 |
regulation of phospholipid catabolic process(GO:0060696) |
| 0.1 |
0.6 |
GO:0042511 |
positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
| 0.1 |
2.1 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.1 |
0.7 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.1 |
0.1 |
GO:0021523 |
somatic motor neuron differentiation(GO:0021523) |
| 0.1 |
0.2 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.1 |
0.2 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.1 |
1.7 |
GO:0006958 |
complement activation, classical pathway(GO:0006958) |
| 0.1 |
0.5 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 |
0.4 |
GO:0030049 |
muscle filament sliding(GO:0030049) |
| 0.1 |
0.3 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 |
0.1 |
GO:0098528 |
skeletal muscle fiber differentiation(GO:0098528) |
| 0.1 |
0.3 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.1 |
0.3 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 0.1 |
0.7 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.1 |
1.2 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.1 |
0.3 |
GO:0060536 |
cartilage morphogenesis(GO:0060536) |
| 0.1 |
0.5 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.1 |
0.8 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.1 |
0.4 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.1 |
1.4 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.1 |
0.9 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.1 |
0.5 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.1 |
0.3 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.1 |
0.4 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.1 |
0.5 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 |
0.5 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.1 |
0.1 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.1 |
0.5 |
GO:1901970 |
positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 0.1 |
0.5 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.1 |
0.5 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 |
0.4 |
GO:0009074 |
aromatic amino acid family catabolic process(GO:0009074) |
| 0.1 |
0.2 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.1 |
2.3 |
GO:0046039 |
GTP metabolic process(GO:0046039) |
| 0.1 |
0.3 |
GO:1990481 |
mRNA pseudouridine synthesis(GO:1990481) |
| 0.1 |
1.0 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 |
0.4 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.1 |
0.2 |
GO:0014050 |
negative regulation of glutamate secretion(GO:0014050) |
| 0.1 |
0.7 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.1 |
2.1 |
GO:0051497 |
negative regulation of stress fiber assembly(GO:0051497) |
| 0.1 |
0.2 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.1 |
0.2 |
GO:0016114 |
terpenoid biosynthetic process(GO:0016114) |
| 0.1 |
0.7 |
GO:0048821 |
erythrocyte development(GO:0048821) |
| 0.1 |
0.8 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 0.1 |
0.4 |
GO:0072539 |
T-helper 17 cell differentiation(GO:0072539) |
| 0.1 |
0.4 |
GO:2001168 |
regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.1 |
0.3 |
GO:0050812 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.1 |
0.5 |
GO:0048254 |
snoRNA 3'-end processing(GO:0031126) snoRNA localization(GO:0048254) |
| 0.1 |
0.1 |
GO:0060295 |
regulation of cilium movement(GO:0003352) regulation of cilium beat frequency(GO:0003356) regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.1 |
0.1 |
GO:0045656 |
negative regulation of monocyte differentiation(GO:0045656) |
| 0.1 |
0.5 |
GO:0010747 |
positive regulation of plasma membrane long-chain fatty acid transport(GO:0010747) |
| 0.1 |
0.2 |
GO:0051031 |
tRNA transport(GO:0051031) |
| 0.1 |
0.5 |
GO:0021940 |
positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
| 0.1 |
0.5 |
GO:0007042 |
lysosomal lumen acidification(GO:0007042) |
| 0.1 |
0.4 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 |
0.3 |
GO:0070344 |
fat cell proliferation(GO:0070341) regulation of fat cell proliferation(GO:0070344) negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 |
0.8 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 |
1.5 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.1 |
0.2 |
GO:2000157 |
regulation of protein K48-linked deubiquitination(GO:1903093) negative regulation of protein K48-linked deubiquitination(GO:1903094) negative regulation of ubiquitin-specific protease activity(GO:2000157) |
| 0.1 |
0.4 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.1 |
0.3 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.1 |
0.2 |
GO:0045199 |
maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 |
0.2 |
GO:0002517 |
T cell tolerance induction(GO:0002517) regulation of T cell tolerance induction(GO:0002664) |
| 0.1 |
1.1 |
GO:0042541 |
hemoglobin biosynthetic process(GO:0042541) |
| 0.1 |
0.2 |
GO:0030210 |
heparin biosynthetic process(GO:0030210) |
| 0.1 |
1.0 |
GO:0051383 |
kinetochore organization(GO:0051383) |
| 0.1 |
1.0 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.1 |
0.4 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.1 |
0.4 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 |
0.6 |
GO:0060746 |
parental behavior(GO:0060746) |
| 0.1 |
0.2 |
GO:0006097 |
glyoxylate cycle(GO:0006097) |
| 0.1 |
0.1 |
GO:0051958 |
methotrexate transport(GO:0051958) |
| 0.1 |
1.1 |
GO:0042753 |
positive regulation of circadian rhythm(GO:0042753) |
| 0.1 |
0.2 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 |
0.3 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 |
0.2 |
GO:0044849 |
estrous cycle(GO:0044849) |
| 0.1 |
0.5 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 |
0.2 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 |
0.6 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 |
0.5 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.1 |
0.1 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.1 |
0.2 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.1 |
0.3 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 |
0.3 |
GO:0045187 |
regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.1 |
0.5 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.1 |
0.5 |
GO:0043983 |
histone H4-K12 acetylation(GO:0043983) |
| 0.1 |
0.2 |
GO:1903800 |
positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.1 |
0.5 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.1 |
1.0 |
GO:0032287 |
peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 |
0.2 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 |
0.7 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.1 |
0.1 |
GO:0002924 |
negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) regulation of B cell receptor signaling pathway(GO:0050855) negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 |
0.3 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.1 |
0.3 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 |
0.1 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.1 |
0.5 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.1 |
0.1 |
GO:0006549 |
isoleucine metabolic process(GO:0006549) |
| 0.1 |
1.3 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.1 |
0.5 |
GO:0060623 |
regulation of chromosome condensation(GO:0060623) |
| 0.1 |
0.3 |
GO:0035188 |
blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.1 |
0.1 |
GO:0043144 |
snoRNA processing(GO:0043144) |
| 0.1 |
0.1 |
GO:0003096 |
renal sodium ion transport(GO:0003096) |
| 0.1 |
0.7 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.1 |
0.1 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.1 |
0.1 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) |
| 0.1 |
0.2 |
GO:2000334 |
response to linoleic acid(GO:0070543) blood microparticle formation(GO:0072564) regulation of blood microparticle formation(GO:2000332) positive regulation of blood microparticle formation(GO:2000334) |
| 0.1 |
0.4 |
GO:0032891 |
negative regulation of organic acid transport(GO:0032891) |
| 0.1 |
0.2 |
GO:1902410 |
mitotic cytokinetic process(GO:1902410) |
| 0.1 |
0.4 |
GO:1903887 |
motile primary cilium assembly(GO:1903887) |
| 0.1 |
0.2 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.1 |
0.4 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 0.1 |
0.7 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.1 |
0.1 |
GO:0021984 |
adenohypophysis development(GO:0021984) |
| 0.1 |
0.2 |
GO:0070200 |
establishment of protein localization to telomere(GO:0070200) |
| 0.1 |
0.5 |
GO:0030813 |
positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.1 |
0.2 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 |
0.7 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.1 |
0.3 |
GO:0002313 |
mature B cell differentiation involved in immune response(GO:0002313) |
| 0.1 |
0.2 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.1 |
1.0 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.1 |
0.2 |
GO:0017183 |
peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 |
0.4 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.1 |
0.2 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.1 |
0.7 |
GO:0000059 |
protein import into nucleus, docking(GO:0000059) |
| 0.1 |
0.2 |
GO:2000054 |
regulation of centromeric sister chromatid cohesion(GO:0070602) regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 0.1 |
0.2 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.1 |
0.3 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.1 |
1.5 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.1 |
0.5 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 0.1 |
0.2 |
GO:0060339 |
negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.1 |
0.2 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.1 |
2.4 |
GO:0005978 |
glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.1 |
0.9 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.1 |
0.3 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.1 |
0.1 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.1 |
0.2 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.1 |
0.3 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 0.1 |
0.2 |
GO:0006072 |
glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.1 |
0.1 |
GO:0010040 |
response to iron(II) ion(GO:0010040) |
| 0.1 |
0.2 |
GO:0046599 |
regulation of centriole replication(GO:0046599) |
| 0.1 |
0.6 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
| 0.1 |
0.6 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.1 |
0.3 |
GO:0061052 |
negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.1 |
0.1 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.1 |
0.1 |
GO:0071072 |
negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.1 |
1.2 |
GO:0060445 |
branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.1 |
0.2 |
GO:0042998 |
positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 |
0.1 |
GO:0050847 |
progesterone receptor signaling pathway(GO:0050847) |
| 0.1 |
0.6 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.1 |
0.5 |
GO:2000381 |
negative regulation of mesoderm development(GO:2000381) |
| 0.1 |
0.5 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 |
0.3 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.1 |
0.5 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
0.3 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.1 |
0.3 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.1 |
0.1 |
GO:0060426 |
lung vasculature development(GO:0060426) |
| 0.1 |
0.4 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.1 |
0.6 |
GO:0019243 |
methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 |
0.2 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 |
0.1 |
GO:0086045 |
membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.1 |
0.4 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.1 |
0.3 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 0.1 |
0.2 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 |
0.3 |
GO:0036093 |
germ cell proliferation(GO:0036093) |
| 0.1 |
0.2 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.1 |
0.3 |
GO:0051694 |
pointed-end actin filament capping(GO:0051694) |
| 0.1 |
0.3 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 |
1.4 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.0 |
0.1 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.0 |
1.3 |
GO:0097320 |
membrane tubulation(GO:0097320) |
| 0.0 |
1.0 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.0 |
0.0 |
GO:0034382 |
chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 |
0.2 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.0 |
0.6 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.0 |
0.2 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 |
0.4 |
GO:0014883 |
transition between fast and slow fiber(GO:0014883) |
| 0.0 |
0.6 |
GO:0007175 |
negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 |
1.1 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 |
0.5 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.0 |
0.1 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 |
0.4 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 |
0.6 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.0 |
0.1 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.0 |
0.7 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.0 |
1.2 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.0 |
0.3 |
GO:0060770 |
negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 |
0.1 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.0 |
0.5 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 |
0.0 |
GO:0090024 |
negative regulation of granulocyte chemotaxis(GO:0071623) negative regulation of neutrophil chemotaxis(GO:0090024) negative regulation of neutrophil migration(GO:1902623) |
| 0.0 |
0.1 |
GO:1901386 |
negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.0 |
1.4 |
GO:0045494 |
photoreceptor cell maintenance(GO:0045494) |
| 0.0 |
0.3 |
GO:0000479 |
endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.0 |
0.4 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 |
0.3 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 |
0.2 |
GO:0030968 |
endoplasmic reticulum unfolded protein response(GO:0030968) cellular response to unfolded protein(GO:0034620) |
| 0.0 |
0.3 |
GO:0042135 |
neurotransmitter catabolic process(GO:0042135) |
| 0.0 |
0.4 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.0 |
0.8 |
GO:0045475 |
locomotor rhythm(GO:0045475) |
| 0.0 |
0.3 |
GO:0061002 |
negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 |
0.1 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.0 |
0.7 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.0 |
0.7 |
GO:0045063 |
T-helper 1 cell differentiation(GO:0045063) |
| 0.0 |
0.2 |
GO:0007039 |
protein catabolic process in the vacuole(GO:0007039) |
| 0.0 |
0.1 |
GO:0048703 |
embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.0 |
0.3 |
GO:0060510 |
Type II pneumocyte differentiation(GO:0060510) |
| 0.0 |
0.3 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 0.0 |
0.4 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 |
0.1 |
GO:2001286 |
regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.0 |
0.4 |
GO:0071801 |
regulation of podosome assembly(GO:0071801) |
| 0.0 |
0.3 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 |
0.1 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.0 |
0.2 |
GO:0060049 |
regulation of protein glycosylation(GO:0060049) |
| 0.0 |
0.2 |
GO:0007197 |
adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 |
0.3 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.0 |
0.2 |
GO:0007131 |
reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.0 |
0.0 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.0 |
0.1 |
GO:1901642 |
purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
| 0.0 |
0.1 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 |
0.2 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.0 |
0.2 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.0 |
0.2 |
GO:0071360 |
cellular response to exogenous dsRNA(GO:0071360) |
| 0.0 |
0.3 |
GO:0045840 |
positive regulation of mitotic nuclear division(GO:0045840) |
| 0.0 |
0.1 |
GO:0044650 |
virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
| 0.0 |
1.5 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.0 |
0.3 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.0 |
0.4 |
GO:0033129 |
positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 |
0.6 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.0 |
0.2 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 |
0.2 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.0 |
0.4 |
GO:0042772 |
DNA damage response, signal transduction resulting in transcription(GO:0042772) |
| 0.0 |
0.2 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.0 |
0.6 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 |
0.2 |
GO:0038089 |
positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.0 |
0.3 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 |
0.1 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.0 |
0.1 |
GO:1904380 |
endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 |
0.8 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 |
0.1 |
GO:0043921 |
modulation by host of viral transcription(GO:0043921) positive regulation by host of viral transcription(GO:0043923) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.0 |
0.1 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.0 |
0.3 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.0 |
0.1 |
GO:0019732 |
antifungal humoral response(GO:0019732) |
| 0.0 |
0.1 |
GO:0045987 |
positive regulation of smooth muscle contraction(GO:0045987) |
| 0.0 |
0.1 |
GO:2000852 |
regulation of corticosterone secretion(GO:2000852) |
| 0.0 |
0.1 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.0 |
0.2 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.0 |
0.1 |
GO:0060405 |
regulation of penile erection(GO:0060405) |
| 0.0 |
0.3 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 |
0.1 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 |
0.3 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.0 |
0.6 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.0 |
0.2 |
GO:0033160 |
positive regulation of protein import into nucleus, translocation(GO:0033160) |
| 0.0 |
0.3 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.0 |
0.2 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.0 |
0.3 |
GO:0043312 |
neutrophil degranulation(GO:0043312) |
| 0.0 |
0.3 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 |
0.1 |
GO:0032200 |
telomere maintenance(GO:0000723) telomere organization(GO:0032200) |
| 0.0 |
0.1 |
GO:0071340 |
skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.0 |
0.9 |
GO:2001244 |
positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
| 0.0 |
0.1 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 |
0.3 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.0 |
0.1 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.0 |
0.3 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.0 |
0.4 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 |
0.1 |
GO:0003376 |
sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 |
0.4 |
GO:0014002 |
astrocyte development(GO:0014002) |
| 0.0 |
0.2 |
GO:0042795 |
snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 |
0.1 |
GO:0006662 |
glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
| 0.0 |
0.5 |
GO:0007080 |
mitotic metaphase plate congression(GO:0007080) |
| 0.0 |
0.1 |
GO:0000393 |
spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
| 0.0 |
0.1 |
GO:0090336 |
positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.0 |
0.1 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.0 |
0.1 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 0.0 |
0.4 |
GO:0031954 |
positive regulation of protein autophosphorylation(GO:0031954) |
| 0.0 |
0.5 |
GO:0007588 |
excretion(GO:0007588) |
| 0.0 |
0.5 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.0 |
0.1 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.0 |
0.3 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 |
0.4 |
GO:0009134 |
nucleoside diphosphate catabolic process(GO:0009134) ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.0 |
0.5 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.0 |
0.5 |
GO:0070527 |
platelet aggregation(GO:0070527) |
| 0.0 |
0.2 |
GO:0048149 |
behavioral response to ethanol(GO:0048149) |
| 0.0 |
0.3 |
GO:0098534 |
centriole assembly(GO:0098534) |
| 0.0 |
0.3 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.0 |
0.2 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 |
0.6 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.0 |
0.6 |
GO:0048701 |
embryonic cranial skeleton morphogenesis(GO:0048701) |
| 0.0 |
0.1 |
GO:1990253 |
cellular response to leucine starvation(GO:1990253) |
| 0.0 |
0.1 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 |
0.4 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.0 |
0.1 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.0 |
0.1 |
GO:0045072 |
interferon-gamma biosynthetic process(GO:0042095) regulation of interferon-gamma biosynthetic process(GO:0045072) positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.0 |
0.1 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.0 |
0.4 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.0 |
0.2 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.0 |
0.0 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 |
0.6 |
GO:0051642 |
centrosome localization(GO:0051642) |
| 0.0 |
0.3 |
GO:1990126 |
retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 |
0.5 |
GO:0014009 |
glial cell proliferation(GO:0014009) |
| 0.0 |
0.1 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.0 |
0.5 |
GO:0009299 |
mRNA transcription(GO:0009299) |
| 0.0 |
0.1 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.0 |
0.1 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.0 |
0.4 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.0 |
0.2 |
GO:0042416 |
dopamine biosynthetic process(GO:0042416) |
| 0.0 |
0.4 |
GO:0051875 |
pigment granule localization(GO:0051875) |
| 0.0 |
0.3 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 |
0.2 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.0 |
0.2 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 |
0.2 |
GO:0033623 |
regulation of integrin activation(GO:0033623) |
| 0.0 |
0.4 |
GO:0071392 |
cellular response to estradiol stimulus(GO:0071392) |
| 0.0 |
0.6 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.0 |
0.3 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.0 |
0.1 |
GO:0030277 |
maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.0 |
0.2 |
GO:0007213 |
G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.0 |
0.2 |
GO:0034315 |
regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 |
0.0 |
GO:0090296 |
regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.0 |
0.1 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.0 |
0.2 |
GO:0006488 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 |
0.3 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.0 |
0.4 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.0 |
0.2 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.0 |
0.1 |
GO:0032693 |
negative regulation of interleukin-10 production(GO:0032693) |
| 0.0 |
0.1 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.0 |
0.4 |
GO:0002448 |
mast cell activation involved in immune response(GO:0002279) mast cell mediated immunity(GO:0002448) mast cell degranulation(GO:0043303) |
| 0.0 |
0.2 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 |
0.2 |
GO:0048875 |
chemical homeostasis within a tissue(GO:0048875) |
| 0.0 |
0.0 |
GO:0030168 |
platelet activation(GO:0030168) |
| 0.0 |
0.2 |
GO:0042790 |
transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.0 |
0.1 |
GO:0010713 |
negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.0 |
0.1 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 |
0.2 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 0.0 |
0.1 |
GO:0046016 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
| 0.0 |
0.4 |
GO:0042832 |
response to protozoan(GO:0001562) defense response to protozoan(GO:0042832) |
| 0.0 |
0.1 |
GO:0043970 |
histone H3-K9 acetylation(GO:0043970) |
| 0.0 |
0.0 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.0 |
0.2 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.0 |
0.1 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.0 |
0.1 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.0 |
0.1 |
GO:0002566 |
somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 |
0.1 |
GO:0033299 |
secretion of lysosomal enzymes(GO:0033299) |
| 0.0 |
0.2 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.0 |
0.1 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 |
0.0 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.0 |
0.2 |
GO:0000469 |
cleavage involved in rRNA processing(GO:0000469) |
| 0.0 |
0.1 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.0 |
0.1 |
GO:0090263 |
positive regulation of canonical Wnt signaling pathway(GO:0090263) |
| 0.0 |
0.1 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.0 |
0.7 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.0 |
0.1 |
GO:0043928 |
exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 |
0.4 |
GO:0032008 |
positive regulation of TOR signaling(GO:0032008) |
| 0.0 |
0.1 |
GO:0010566 |
regulation of ketone biosynthetic process(GO:0010566) |
| 0.0 |
0.3 |
GO:0005980 |
polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 |
0.5 |
GO:0070301 |
cellular response to hydrogen peroxide(GO:0070301) |
| 0.0 |
0.4 |
GO:0045540 |
regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.0 |
1.5 |
GO:0006302 |
double-strand break repair(GO:0006302) |
| 0.0 |
0.2 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.0 |
0.5 |
GO:0045739 |
positive regulation of DNA repair(GO:0045739) |
| 0.0 |
0.3 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.0 |
0.0 |
GO:0006027 |
glycosaminoglycan catabolic process(GO:0006027) |
| 0.0 |
0.2 |
GO:0050995 |
negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 |
0.1 |
GO:0071539 |
protein localization to centrosome(GO:0071539) |
| 0.0 |
0.1 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
0.2 |
GO:0015858 |
nucleoside transport(GO:0015858) |
| 0.0 |
0.1 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.0 |
0.2 |
GO:0042552 |
ensheathment of neurons(GO:0007272) axon ensheathment(GO:0008366) myelination(GO:0042552) |
| 0.0 |
0.3 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.0 |
0.1 |
GO:0015886 |
heme transport(GO:0015886) |
| 0.0 |
0.0 |
GO:0050857 |
positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) |
| 0.0 |
0.1 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.0 |
0.2 |
GO:0007190 |
activation of adenylate cyclase activity(GO:0007190) |
| 0.0 |
0.2 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.0 |
0.1 |
GO:0045661 |
regulation of myoblast differentiation(GO:0045661) |
| 0.0 |
0.4 |
GO:1902653 |
cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
| 0.0 |
0.1 |
GO:0001895 |
retina homeostasis(GO:0001895) |
| 0.0 |
0.2 |
GO:0060765 |
regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.0 |
0.4 |
GO:0048636 |
positive regulation of striated muscle tissue development(GO:0045844) positive regulation of muscle organ development(GO:0048636) positive regulation of muscle tissue development(GO:1901863) |
| 0.0 |
0.5 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 |
0.2 |
GO:0032613 |
interleukin-10 production(GO:0032613) |
| 0.0 |
0.3 |
GO:0006744 |
ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
| 0.0 |
0.3 |
GO:0035774 |
positive regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0035774) |
| 0.0 |
0.1 |
GO:0042138 |
meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 |
0.1 |
GO:0002526 |
acute inflammatory response(GO:0002526) |
| 0.0 |
0.3 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 |
0.1 |
GO:0010793 |
regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.0 |
0.4 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 |
0.6 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.0 |
0.9 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.0 |
0.0 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 |
0.0 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 |
0.2 |
GO:0051156 |
glucose 6-phosphate metabolic process(GO:0051156) |
| 0.0 |
0.0 |
GO:0045655 |
regulation of monocyte differentiation(GO:0045655) |
| 0.0 |
0.1 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 0.0 |
0.1 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 0.0 |
0.1 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.0 |
1.5 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.0 |
0.1 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 |
0.1 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.0 |
0.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 |
0.0 |
GO:0051571 |
positive regulation of histone H3-K4 methylation(GO:0051571) |
| 0.0 |
0.1 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.0 |
0.3 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 |
0.2 |
GO:0036037 |
CD8-positive, alpha-beta T cell activation(GO:0036037) |
| 0.0 |
0.3 |
GO:0003016 |
respiratory system process(GO:0003016) |
| 0.0 |
0.6 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.0 |
0.1 |
GO:0033209 |
tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.0 |
0.0 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.0 |
0.1 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.0 |
0.2 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.0 |
0.1 |
GO:2001014 |
regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.0 |
0.7 |
GO:0000245 |
spliceosomal complex assembly(GO:0000245) |
| 0.0 |
0.5 |
GO:0003382 |
epithelial cell morphogenesis(GO:0003382) |
| 0.0 |
0.3 |
GO:0032981 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 |
0.1 |
GO:0021678 |
third ventricle development(GO:0021678) |
| 0.0 |
0.2 |
GO:0031065 |
positive regulation of histone deacetylation(GO:0031065) |
| 0.0 |
0.1 |
GO:1903298 |
negative regulation of cellular response to hypoxia(GO:1900038) regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.0 |
0.1 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.0 |
0.3 |
GO:0006739 |
NADP metabolic process(GO:0006739) |
| 0.0 |
0.1 |
GO:0008340 |
determination of adult lifespan(GO:0008340) |
| 0.0 |
0.2 |
GO:0007200 |
phospholipase C-activating G-protein coupled receptor signaling pathway(GO:0007200) |
| 0.0 |
0.1 |
GO:0097494 |
regulation of vesicle size(GO:0097494) |
| 0.0 |
0.0 |
GO:0031339 |
negative regulation of vesicle fusion(GO:0031339) |
| 0.0 |
0.1 |
GO:1902035 |
positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 |
0.2 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.0 |
0.1 |
GO:0043982 |
histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 |
0.1 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 |
0.4 |
GO:0045071 |
negative regulation of viral genome replication(GO:0045071) |
| 0.0 |
0.1 |
GO:0060297 |
regulation of sarcomere organization(GO:0060297) |
| 0.0 |
0.1 |
GO:0003009 |
skeletal muscle contraction(GO:0003009) |
| 0.0 |
0.1 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 |
0.0 |
GO:0070253 |
somatostatin secretion(GO:0070253) |
| 0.0 |
0.0 |
GO:0070305 |
response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
| 0.0 |
0.0 |
GO:0098789 |
pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 |
0.1 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.0 |
0.1 |
GO:1902414 |
protein localization to cell junction(GO:1902414) |
| 0.0 |
0.6 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.0 |
0.1 |
GO:0070050 |
neuron cellular homeostasis(GO:0070050) |
| 0.0 |
0.1 |
GO:0032485 |
regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 |
0.1 |
GO:0006532 |
aspartate biosynthetic process(GO:0006532) |
| 0.0 |
0.1 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.0 |
0.1 |
GO:0032760 |
positive regulation of tumor necrosis factor production(GO:0032760) positive regulation of tumor necrosis factor superfamily cytokine production(GO:1903557) |
| 0.0 |
0.1 |
GO:0003215 |
cardiac right ventricle morphogenesis(GO:0003215) |
| 0.0 |
0.4 |
GO:0070534 |
protein K63-linked ubiquitination(GO:0070534) |
| 0.0 |
0.1 |
GO:0010226 |
response to lithium ion(GO:0010226) |
| 0.0 |
0.2 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.0 |
0.1 |
GO:0007274 |
neuromuscular synaptic transmission(GO:0007274) |
| 0.0 |
0.0 |
GO:0034334 |
adherens junction maintenance(GO:0034334) |
| 0.0 |
0.4 |
GO:0032755 |
positive regulation of interleukin-6 production(GO:0032755) |
| 0.0 |
0.2 |
GO:0042255 |
ribosome assembly(GO:0042255) |
| 0.0 |
0.2 |
GO:0035914 |
skeletal muscle cell differentiation(GO:0035914) |
| 0.0 |
0.1 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 |
0.1 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.0 |
0.1 |
GO:0015825 |
L-serine transport(GO:0015825) |
| 0.0 |
0.0 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.0 |
0.6 |
GO:0032543 |
mitochondrial translation(GO:0032543) |
| 0.0 |
0.0 |
GO:0048007 |
antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.0 |
0.5 |
GO:0007405 |
neuroblast proliferation(GO:0007405) |
| 0.0 |
0.3 |
GO:1902017 |
regulation of cilium assembly(GO:1902017) |
| 0.0 |
0.3 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.0 |
0.1 |
GO:0010971 |
positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.0 |
0.1 |
GO:2000767 |
positive regulation of cytoplasmic translation(GO:2000767) |
| 0.0 |
0.0 |
GO:0042699 |
follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.0 |
0.2 |
GO:0048025 |
negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.0 |
0.0 |
GO:0001991 |
regulation of systemic arterial blood pressure by circulatory renin-angiotensin(GO:0001991) |
| 0.0 |
0.1 |
GO:0001945 |
lymph vessel development(GO:0001945) |
| 0.0 |
0.2 |
GO:0048247 |
lymphocyte chemotaxis(GO:0048247) |
| 0.0 |
0.5 |
GO:0043039 |
tRNA aminoacylation for protein translation(GO:0006418) tRNA aminoacylation(GO:0043039) |
| 0.0 |
0.7 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.0 |
0.2 |
GO:0035518 |
histone H2A monoubiquitination(GO:0035518) |
| 0.0 |
0.0 |
GO:0010591 |
regulation of lamellipodium assembly(GO:0010591) |
| 0.0 |
0.2 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.0 |
0.1 |
GO:0051788 |
response to misfolded protein(GO:0051788) cellular response to misfolded protein(GO:0071218) |
| 0.0 |
0.1 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.0 |
0.1 |
GO:0030199 |
collagen fibril organization(GO:0030199) |
| 0.0 |
0.0 |
GO:0010735 |
positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 |
0.1 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) |
| 0.0 |
0.1 |
GO:0031571 |
mitotic G1 DNA damage checkpoint(GO:0031571) |