| 1.3 |
4.0 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 1.2 |
4.9 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.9 |
4.6 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.9 |
2.7 |
GO:0097402 |
neuroblast migration(GO:0097402) |
| 0.9 |
3.5 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.9 |
1.7 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.9 |
3.5 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.8 |
3.3 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.8 |
2.4 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.8 |
4.0 |
GO:0051315 |
attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.8 |
4.0 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 0.7 |
3.7 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 0.7 |
1.5 |
GO:0060842 |
arterial endothelial cell differentiation(GO:0060842) |
| 0.7 |
4.4 |
GO:1903887 |
motile primary cilium assembly(GO:1903887) |
| 0.7 |
2.2 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 0.7 |
2.1 |
GO:1904956 |
regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.7 |
0.7 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 0.7 |
2.7 |
GO:1902990 |
mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.7 |
0.7 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.7 |
2.0 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.7 |
5.3 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.7 |
3.3 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.6 |
1.9 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.6 |
1.9 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 0.6 |
1.8 |
GO:0035790 |
platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.6 |
1.8 |
GO:0010986 |
positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.6 |
3.0 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 0.6 |
1.8 |
GO:0036388 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.6 |
5.4 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.6 |
1.8 |
GO:0045938 |
positive regulation of circadian sleep/wake cycle, sleep(GO:0045938) |
| 0.6 |
0.6 |
GO:0003245 |
cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
| 0.6 |
1.2 |
GO:1902071 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.6 |
8.2 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 0.6 |
4.6 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.6 |
1.7 |
GO:0035910 |
ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 0.6 |
1.1 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.6 |
3.3 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.6 |
2.2 |
GO:1903899 |
positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.6 |
2.8 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.6 |
1.1 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.6 |
2.2 |
GO:0090024 |
negative regulation of granulocyte chemotaxis(GO:0071623) negative regulation of neutrophil chemotaxis(GO:0090024) negative regulation of neutrophil migration(GO:1902623) |
| 0.6 |
0.6 |
GO:0048850 |
hypophysis morphogenesis(GO:0048850) |
| 0.6 |
2.2 |
GO:0060032 |
notochord regression(GO:0060032) |
| 0.5 |
3.8 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.5 |
5.4 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.5 |
1.6 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.5 |
1.6 |
GO:0001951 |
intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 0.5 |
2.6 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.5 |
2.0 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.5 |
2.5 |
GO:2000042 |
negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.5 |
4.9 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.5 |
1.9 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.5 |
0.9 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.5 |
6.6 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.5 |
1.4 |
GO:0048352 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) |
| 0.5 |
1.4 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.5 |
5.6 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.5 |
1.9 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.5 |
1.4 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.5 |
1.8 |
GO:0036493 |
positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.5 |
0.5 |
GO:0019395 |
fatty acid oxidation(GO:0019395) |
| 0.4 |
1.3 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.4 |
3.6 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.4 |
1.3 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.4 |
1.3 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.4 |
3.5 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.4 |
0.9 |
GO:0090100 |
positive regulation of transmembrane receptor protein serine/threonine kinase signaling pathway(GO:0090100) |
| 0.4 |
1.7 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.4 |
1.3 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.4 |
1.3 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.4 |
1.3 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.4 |
1.7 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.4 |
0.4 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.4 |
1.7 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.4 |
1.2 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.4 |
1.2 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.4 |
1.2 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.4 |
0.8 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.4 |
2.0 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.4 |
3.7 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.4 |
2.0 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.4 |
4.0 |
GO:0042447 |
hormone catabolic process(GO:0042447) |
| 0.4 |
1.2 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.4 |
3.2 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.4 |
1.2 |
GO:0045349 |
interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.4 |
1.6 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.4 |
1.5 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.4 |
1.9 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.4 |
1.2 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.4 |
1.2 |
GO:0008594 |
photoreceptor cell morphogenesis(GO:0008594) |
| 0.4 |
3.1 |
GO:0090244 |
Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.4 |
0.4 |
GO:0090365 |
regulation of mRNA modification(GO:0090365) |
| 0.4 |
1.1 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.4 |
0.4 |
GO:1903351 |
response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
| 0.4 |
1.1 |
GO:0003349 |
epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.4 |
1.9 |
GO:0072015 |
glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 0.4 |
1.1 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 0.4 |
1.8 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.4 |
1.5 |
GO:0071475 |
cellular hyperosmotic salinity response(GO:0071475) |
| 0.4 |
2.9 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.4 |
1.1 |
GO:0030421 |
defecation(GO:0030421) |
| 0.4 |
0.4 |
GO:0003347 |
epicardial cell to mesenchymal cell transition(GO:0003347) |
| 0.4 |
1.1 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.4 |
2.2 |
GO:0061643 |
chemorepulsion of axon(GO:0061643) |
| 0.4 |
3.2 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.4 |
3.6 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.4 |
5.7 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.4 |
1.1 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.3 |
1.0 |
GO:0060662 |
tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.3 |
0.3 |
GO:0060297 |
regulation of sarcomere organization(GO:0060297) |
| 0.3 |
0.7 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.3 |
1.0 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 0.3 |
1.4 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.3 |
1.4 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.3 |
1.0 |
GO:0072139 |
glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.3 |
1.0 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.3 |
1.0 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.3 |
3.6 |
GO:0051307 |
meiotic chromosome separation(GO:0051307) |
| 0.3 |
1.6 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 0.3 |
2.9 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.3 |
1.0 |
GO:0006601 |
creatine biosynthetic process(GO:0006601) |
| 0.3 |
1.6 |
GO:0031915 |
positive regulation of synaptic plasticity(GO:0031915) |
| 0.3 |
1.0 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.3 |
1.9 |
GO:0010528 |
regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.3 |
1.9 |
GO:0089711 |
L-glutamate transmembrane transport(GO:0089711) |
| 0.3 |
1.3 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.3 |
0.6 |
GO:0006760 |
folic acid-containing compound metabolic process(GO:0006760) |
| 0.3 |
0.6 |
GO:0042663 |
regulation of endodermal cell fate specification(GO:0042663) |
| 0.3 |
1.6 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.3 |
0.3 |
GO:0045974 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.3 |
1.6 |
GO:0072526 |
pyridine-containing compound catabolic process(GO:0072526) |
| 0.3 |
1.5 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.3 |
0.3 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.3 |
1.2 |
GO:0021861 |
forebrain radial glial cell differentiation(GO:0021861) |
| 0.3 |
1.2 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.3 |
3.1 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.3 |
1.5 |
GO:0015788 |
UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.3 |
3.4 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 0.3 |
0.9 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.3 |
1.2 |
GO:2000795 |
regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) negative regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000795) |
| 0.3 |
0.9 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.3 |
0.9 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.3 |
1.5 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.3 |
0.3 |
GO:0002331 |
pre-B cell allelic exclusion(GO:0002331) |
| 0.3 |
0.3 |
GO:0035457 |
cellular response to interferon-alpha(GO:0035457) |
| 0.3 |
3.8 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.3 |
1.5 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.3 |
0.3 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.3 |
0.3 |
GO:0006449 |
regulation of translational termination(GO:0006449) |
| 0.3 |
1.7 |
GO:0090594 |
wound healing involved in inflammatory response(GO:0002246) inflammatory response to wounding(GO:0090594) |
| 0.3 |
1.2 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.3 |
0.9 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.3 |
0.3 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.3 |
4.3 |
GO:0038065 |
collagen-activated signaling pathway(GO:0038065) |
| 0.3 |
2.0 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.3 |
0.9 |
GO:0034035 |
purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.3 |
0.9 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.3 |
3.1 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.3 |
1.7 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.3 |
1.4 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.3 |
0.8 |
GO:0007525 |
somatic muscle development(GO:0007525) |
| 0.3 |
3.1 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.3 |
3.1 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.3 |
1.4 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.3 |
0.3 |
GO:0002765 |
immune response-inhibiting signal transduction(GO:0002765) |
| 0.3 |
1.1 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.3 |
0.8 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.3 |
2.2 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.3 |
0.8 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.3 |
1.6 |
GO:1903690 |
negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.3 |
0.3 |
GO:0060266 |
negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 0.3 |
0.5 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.3 |
1.1 |
GO:0071047 |
nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.3 |
0.8 |
GO:0033860 |
regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.3 |
0.8 |
GO:2000314 |
negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.3 |
2.7 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.3 |
1.3 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 0.3 |
1.3 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.3 |
2.4 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.3 |
2.6 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.3 |
1.8 |
GO:2000348 |
regulation of CD40 signaling pathway(GO:2000348) |
| 0.3 |
1.3 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 0.3 |
0.8 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.3 |
1.3 |
GO:1901860 |
positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.3 |
1.0 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.3 |
0.8 |
GO:1905005 |
regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
| 0.3 |
0.3 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.3 |
0.3 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.3 |
2.8 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.3 |
0.3 |
GO:1902524 |
positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 0.3 |
1.5 |
GO:0072539 |
T-helper 17 cell differentiation(GO:0072539) |
| 0.2 |
1.5 |
GO:0060027 |
convergent extension involved in gastrulation(GO:0060027) |
| 0.2 |
0.7 |
GO:0030862 |
neuroblast division in subventricular zone(GO:0021849) regulation of polarized epithelial cell differentiation(GO:0030860) positive regulation of polarized epithelial cell differentiation(GO:0030862) |
| 0.2 |
0.5 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.2 |
1.0 |
GO:0035878 |
nail development(GO:0035878) |
| 0.2 |
2.2 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.2 |
0.7 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 0.2 |
1.2 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.2 |
0.5 |
GO:0014826 |
vein smooth muscle contraction(GO:0014826) |
| 0.2 |
0.7 |
GO:2000977 |
regulation of forebrain neuron differentiation(GO:2000977) |
| 0.2 |
0.7 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.2 |
0.7 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.2 |
1.0 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.2 |
0.7 |
GO:0006883 |
cellular sodium ion homeostasis(GO:0006883) |
| 0.2 |
0.5 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.2 |
2.1 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.2 |
0.7 |
GO:0050713 |
negative regulation of interleukin-1 beta secretion(GO:0050713) |
| 0.2 |
0.9 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.2 |
0.2 |
GO:0045404 |
positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.2 |
0.9 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.2 |
2.1 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.2 |
1.4 |
GO:0032367 |
intracellular cholesterol transport(GO:0032367) |
| 0.2 |
1.9 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.2 |
0.7 |
GO:0032488 |
Cdc42 protein signal transduction(GO:0032488) |
| 0.2 |
7.2 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 |
0.7 |
GO:0007066 |
female meiosis sister chromatid cohesion(GO:0007066) |
| 0.2 |
0.7 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.2 |
0.9 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.2 |
0.5 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.2 |
1.6 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.2 |
0.9 |
GO:0098763 |
mitotic cell cycle phase(GO:0098763) |
| 0.2 |
0.2 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.2 |
0.4 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.2 |
2.5 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 |
0.9 |
GO:0006570 |
tyrosine metabolic process(GO:0006570) |
| 0.2 |
0.7 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.2 |
0.4 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 |
0.7 |
GO:0034241 |
positive regulation of macrophage fusion(GO:0034241) regulation of osteoclast proliferation(GO:0090289) |
| 0.2 |
0.7 |
GO:2001245 |
regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.2 |
0.7 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.2 |
0.7 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.2 |
0.2 |
GO:0042117 |
monocyte activation(GO:0042117) |
| 0.2 |
0.9 |
GO:0055071 |
cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.2 |
6.4 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.2 |
1.8 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.2 |
2.8 |
GO:0031297 |
replication fork processing(GO:0031297) DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.2 |
0.9 |
GO:0010957 |
negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
| 0.2 |
0.7 |
GO:0019255 |
glucose 1-phosphate metabolic process(GO:0019255) |
| 0.2 |
0.4 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.2 |
1.9 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.2 |
1.3 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.2 |
1.5 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.2 |
0.4 |
GO:0070309 |
lens fiber cell morphogenesis(GO:0070309) |
| 0.2 |
0.9 |
GO:0019249 |
lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.2 |
1.5 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.2 |
0.6 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.2 |
0.2 |
GO:0031590 |
wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.2 |
0.8 |
GO:0001711 |
endodermal cell fate commitment(GO:0001711) |
| 0.2 |
0.6 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.2 |
0.4 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.2 |
0.6 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.2 |
1.5 |
GO:0031293 |
membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.2 |
0.2 |
GO:0014719 |
skeletal muscle satellite cell activation(GO:0014719) |
| 0.2 |
0.8 |
GO:0032382 |
positive regulation of intracellular lipid transport(GO:0032379) positive regulation of intracellular sterol transport(GO:0032382) positive regulation of intracellular cholesterol transport(GO:0032385) lipid hydroperoxide transport(GO:1901373) positive regulation of cholesterol import(GO:1904109) positive regulation of sterol import(GO:2000911) |
| 0.2 |
0.4 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.2 |
1.2 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.2 |
0.6 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.2 |
0.4 |
GO:0070671 |
response to interleukin-12(GO:0070671) |
| 0.2 |
0.4 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.2 |
0.4 |
GO:0006278 |
RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
| 0.2 |
0.8 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.2 |
0.2 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.2 |
0.6 |
GO:0047484 |
regulation of response to osmotic stress(GO:0047484) |
| 0.2 |
0.4 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.2 |
0.6 |
GO:1904996 |
positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.2 |
1.0 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.2 |
2.2 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.2 |
1.0 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.2 |
0.6 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.2 |
0.8 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.2 |
0.2 |
GO:0097167 |
circadian regulation of translation(GO:0097167) |
| 0.2 |
0.2 |
GO:0033087 |
negative regulation of immature T cell proliferation(GO:0033087) |
| 0.2 |
1.2 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.2 |
0.6 |
GO:0002578 |
negative regulation of antigen processing and presentation(GO:0002578) |
| 0.2 |
0.8 |
GO:1903800 |
astrocyte activation(GO:0048143) positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.2 |
0.2 |
GO:0032497 |
detection of lipopolysaccharide(GO:0032497) |
| 0.2 |
0.4 |
GO:0021965 |
spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.2 |
1.9 |
GO:0070986 |
left/right axis specification(GO:0070986) |
| 0.2 |
0.2 |
GO:0090382 |
phagosome maturation(GO:0090382) |
| 0.2 |
0.8 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.2 |
2.1 |
GO:0032211 |
negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.2 |
1.5 |
GO:0035871 |
protein K11-linked deubiquitination(GO:0035871) |
| 0.2 |
0.9 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.2 |
0.6 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.2 |
1.9 |
GO:1901409 |
regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.2 |
3.0 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.2 |
1.1 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.2 |
0.2 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.2 |
1.7 |
GO:0006183 |
GTP biosynthetic process(GO:0006183) |
| 0.2 |
0.7 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.2 |
0.6 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.2 |
4.5 |
GO:0002089 |
lens morphogenesis in camera-type eye(GO:0002089) |
| 0.2 |
0.6 |
GO:0007063 |
regulation of sister chromatid cohesion(GO:0007063) |
| 0.2 |
4.4 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.2 |
2.0 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.2 |
1.8 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.2 |
0.4 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.2 |
0.5 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.2 |
1.3 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.2 |
0.4 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.2 |
0.2 |
GO:1901856 |
negative regulation of cellular respiration(GO:1901856) |
| 0.2 |
1.3 |
GO:0015791 |
polyol transport(GO:0015791) |
| 0.2 |
5.2 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.2 |
0.9 |
GO:0050651 |
dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.2 |
0.5 |
GO:0097461 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.2 |
0.9 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.2 |
1.3 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.2 |
0.5 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.2 |
0.4 |
GO:0003406 |
retinal pigment epithelium development(GO:0003406) |
| 0.2 |
1.2 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 0.2 |
0.7 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.2 |
0.2 |
GO:1903748 |
negative regulation of protein targeting to mitochondrion(GO:1903215) negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.2 |
0.5 |
GO:0046168 |
glycerol-3-phosphate catabolic process(GO:0046168) |
| 0.2 |
0.5 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.2 |
1.2 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.2 |
0.3 |
GO:0046666 |
retinal cell programmed cell death(GO:0046666) |
| 0.2 |
0.2 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.2 |
1.0 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.2 |
0.3 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 0.2 |
0.5 |
GO:0002302 |
CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) mesodermal to mesenchymal transition involved in gastrulation(GO:0060809) |
| 0.2 |
0.5 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.2 |
0.3 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.2 |
0.2 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.2 |
1.4 |
GO:1900364 |
negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.2 |
0.5 |
GO:1900275 |
negative regulation of phospholipase C activity(GO:1900275) |
| 0.2 |
0.9 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.2 |
1.2 |
GO:0002328 |
pro-B cell differentiation(GO:0002328) |
| 0.2 |
0.3 |
GO:1901563 |
response to camptothecin(GO:1901563) negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.2 |
0.8 |
GO:0042246 |
tissue regeneration(GO:0042246) |
| 0.2 |
0.7 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 |
1.9 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.2 |
0.2 |
GO:0030214 |
hyaluronan catabolic process(GO:0030214) |
| 0.2 |
0.2 |
GO:0018027 |
peptidyl-lysine dimethylation(GO:0018027) |
| 0.2 |
0.8 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.2 |
0.5 |
GO:0061386 |
closure of optic fissure(GO:0061386) |
| 0.2 |
0.7 |
GO:1900147 |
Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.2 |
0.3 |
GO:0010838 |
positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.2 |
1.7 |
GO:0051292 |
nuclear pore complex assembly(GO:0051292) |
| 0.2 |
1.0 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.2 |
0.3 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.2 |
0.2 |
GO:0033091 |
regulation of immature T cell proliferation(GO:0033083) positive regulation of immature T cell proliferation(GO:0033091) |
| 0.2 |
0.6 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.2 |
1.1 |
GO:0042095 |
interferon-gamma biosynthetic process(GO:0042095) |
| 0.2 |
0.3 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 0.2 |
0.8 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.2 |
1.8 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.2 |
1.8 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.2 |
1.0 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.2 |
0.8 |
GO:1903596 |
angiotensin-activated signaling pathway involved in heart process(GO:0086098) negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) regulation of gap junction assembly(GO:1903596) positive regulation of gap junction assembly(GO:1903598) |
| 0.2 |
1.0 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.2 |
0.2 |
GO:0071034 |
CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.2 |
1.3 |
GO:2000381 |
negative regulation of mesoderm development(GO:2000381) |
| 0.2 |
1.0 |
GO:0048549 |
positive regulation of pinocytosis(GO:0048549) |
| 0.2 |
0.2 |
GO:0034238 |
macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) |
| 0.2 |
1.0 |
GO:1990564 |
protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.2 |
0.3 |
GO:2001137 |
positive regulation of endocytic recycling(GO:2001137) |
| 0.2 |
0.3 |
GO:0090325 |
regulation of locomotion involved in locomotory behavior(GO:0090325) negative regulation of locomotion involved in locomotory behavior(GO:0090327) |
| 0.2 |
1.0 |
GO:0046909 |
intermembrane transport(GO:0046909) |
| 0.2 |
0.6 |
GO:0010510 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.2 |
0.6 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.2 |
0.8 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.2 |
2.5 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.2 |
0.6 |
GO:0032055 |
negative regulation of translation in response to stress(GO:0032055) |
| 0.2 |
1.7 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.2 |
2.4 |
GO:0042753 |
positive regulation of circadian rhythm(GO:0042753) |
| 0.2 |
2.2 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.2 |
0.2 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 0.2 |
0.6 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.2 |
0.2 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.2 |
0.8 |
GO:0009396 |
folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.2 |
2.0 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.2 |
0.2 |
GO:0034285 |
response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.2 |
0.9 |
GO:0006046 |
N-acetylglucosamine catabolic process(GO:0006046) |
| 0.2 |
0.3 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.2 |
1.5 |
GO:0043101 |
purine-containing compound salvage(GO:0043101) |
| 0.2 |
3.2 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.2 |
0.5 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.2 |
2.0 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.2 |
1.4 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.2 |
0.8 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.2 |
0.5 |
GO:0097341 |
inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.2 |
0.6 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.1 |
1.5 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.1 |
0.9 |
GO:0008611 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.1 |
0.1 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.1 |
0.7 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.1 |
0.3 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.1 |
1.0 |
GO:0006685 |
sphingomyelin catabolic process(GO:0006685) |
| 0.1 |
0.3 |
GO:0043366 |
beta selection(GO:0043366) |
| 0.1 |
0.4 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.1 |
0.3 |
GO:0070213 |
protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 |
0.9 |
GO:0032725 |
positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
| 0.1 |
1.2 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 |
0.3 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.1 |
1.2 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 |
0.1 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.1 |
0.3 |
GO:0003190 |
atrioventricular valve formation(GO:0003190) mitral valve formation(GO:0003192) |
| 0.1 |
0.3 |
GO:1902965 |
regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 |
0.3 |
GO:1901858 |
regulation of mitochondrial DNA metabolic process(GO:1901858) |
| 0.1 |
1.1 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.1 |
0.1 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 |
0.7 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.1 |
0.1 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.1 |
0.7 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 |
0.9 |
GO:0042511 |
positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
| 0.1 |
0.1 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.1 |
0.6 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.1 |
2.1 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 |
0.4 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 |
0.4 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 0.1 |
0.4 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.1 |
1.1 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 0.1 |
0.3 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.1 |
0.3 |
GO:2001187 |
positive regulation of alpha-beta T cell proliferation(GO:0046641) positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
| 0.1 |
1.1 |
GO:0035881 |
amacrine cell differentiation(GO:0035881) |
| 0.1 |
0.3 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
0.1 |
GO:0072012 |
glomerulus vasculature development(GO:0072012) |
| 0.1 |
2.1 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.1 |
0.7 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.1 |
4.1 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.1 |
0.1 |
GO:0003091 |
renal water homeostasis(GO:0003091) |
| 0.1 |
0.7 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 0.1 |
0.8 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 |
0.4 |
GO:0070562 |
regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.1 |
0.4 |
GO:1902037 |
negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.1 |
0.3 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.1 |
1.9 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 |
0.1 |
GO:0060693 |
regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.1 |
0.8 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.1 |
1.7 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.1 |
1.7 |
GO:0045663 |
positive regulation of myoblast differentiation(GO:0045663) |
| 0.1 |
0.4 |
GO:0016598 |
protein arginylation(GO:0016598) |
| 0.1 |
0.3 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
0.7 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.1 |
0.4 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.1 |
0.5 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.1 |
0.3 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.1 |
1.3 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 |
0.6 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.1 |
0.1 |
GO:0021852 |
pyramidal neuron migration(GO:0021852) |
| 0.1 |
1.7 |
GO:0060134 |
prepulse inhibition(GO:0060134) |
| 0.1 |
0.4 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.1 |
1.3 |
GO:2000009 |
negative regulation of protein localization to cell surface(GO:2000009) |
| 0.1 |
1.2 |
GO:0046033 |
AMP metabolic process(GO:0046033) |
| 0.1 |
0.6 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.1 |
0.3 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.1 |
0.3 |
GO:0071472 |
cellular response to salt stress(GO:0071472) |
| 0.1 |
0.1 |
GO:2000173 |
negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.1 |
0.4 |
GO:0035864 |
response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 |
0.9 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.1 |
2.4 |
GO:0007638 |
mechanosensory behavior(GO:0007638) |
| 0.1 |
0.5 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.1 |
0.2 |
GO:0006538 |
glutamate catabolic process(GO:0006538) |
| 0.1 |
1.4 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.1 |
2.7 |
GO:0000038 |
very long-chain fatty acid metabolic process(GO:0000038) |
| 0.1 |
0.4 |
GO:2000779 |
negative regulation of DNA repair(GO:0045738) regulation of double-strand break repair(GO:2000779) |
| 0.1 |
2.9 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 |
0.4 |
GO:0033030 |
negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.1 |
0.1 |
GO:0009996 |
negative regulation of cell fate specification(GO:0009996) |
| 0.1 |
2.9 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.1 |
0.2 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.1 |
0.1 |
GO:0036490 |
regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) |
| 0.1 |
0.5 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.1 |
4.4 |
GO:0000725 |
double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.1 |
0.5 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.1 |
0.2 |
GO:0035166 |
post-embryonic hemopoiesis(GO:0035166) |
| 0.1 |
0.4 |
GO:0035330 |
regulation of hippo signaling(GO:0035330) |
| 0.1 |
0.7 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.1 |
0.4 |
GO:0050915 |
sensory perception of sour taste(GO:0050915) |
| 0.1 |
0.6 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 |
0.7 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.1 |
0.4 |
GO:0046544 |
development of secondary male sexual characteristics(GO:0046544) |
| 0.1 |
1.2 |
GO:2000678 |
negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.1 |
0.2 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.1 |
1.2 |
GO:0008105 |
asymmetric protein localization(GO:0008105) |
| 0.1 |
0.3 |
GO:0071539 |
protein localization to centrosome(GO:0071539) |
| 0.1 |
0.2 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.1 |
0.8 |
GO:0042094 |
interleukin-2 biosynthetic process(GO:0042094) |
| 0.1 |
5.2 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.1 |
0.2 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.1 |
0.3 |
GO:1903061 |
regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.1 |
0.2 |
GO:0051004 |
regulation of lipoprotein lipase activity(GO:0051004) |
| 0.1 |
0.3 |
GO:0045794 |
negative regulation of cell volume(GO:0045794) |
| 0.1 |
0.2 |
GO:1902229 |
regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902229) negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.1 |
0.6 |
GO:2000258 |
negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.1 |
0.7 |
GO:0008334 |
histone mRNA metabolic process(GO:0008334) histone mRNA catabolic process(GO:0071044) |
| 0.1 |
1.8 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.1 |
0.5 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 |
0.9 |
GO:0009191 |
ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.1 |
0.6 |
GO:0003263 |
cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) regulation of secondary heart field cardioblast proliferation(GO:0003266) |
| 0.1 |
0.2 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 0.1 |
0.9 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.1 |
0.6 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
0.4 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 |
7.3 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.1 |
0.8 |
GO:0042640 |
anagen(GO:0042640) |
| 0.1 |
0.2 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.1 |
0.9 |
GO:0072234 |
metanephric nephron tubule development(GO:0072234) metanephric nephron epithelium development(GO:0072243) |
| 0.1 |
0.6 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.1 |
0.4 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.1 |
0.3 |
GO:2000574 |
regulation of microtubule motor activity(GO:2000574) |
| 0.1 |
0.7 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.1 |
0.4 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
0.2 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 |
0.7 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.1 |
0.3 |
GO:0021764 |
amygdala development(GO:0021764) |
| 0.1 |
0.7 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 |
0.1 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 0.1 |
0.5 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.1 |
0.4 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 0.1 |
0.5 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.1 |
0.5 |
GO:0090074 |
negative regulation of protein homodimerization activity(GO:0090074) |
| 0.1 |
0.6 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.1 |
0.6 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 |
1.5 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.1 |
0.3 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 |
1.4 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 |
2.4 |
GO:0046827 |
positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 |
0.4 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.1 |
0.2 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 |
0.3 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.1 |
1.7 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.1 |
0.4 |
GO:2000047 |
regulation of cell-cell adhesion mediated by cadherin(GO:2000047) positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.1 |
0.4 |
GO:0050872 |
white fat cell differentiation(GO:0050872) |
| 0.1 |
0.2 |
GO:0030240 |
skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 |
0.2 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 0.1 |
1.2 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.1 |
0.3 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.1 |
0.5 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.1 |
1.4 |
GO:0042059 |
negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.1 |
0.4 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.1 |
0.3 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.1 |
0.5 |
GO:0043137 |
DNA replication, Okazaki fragment processing(GO:0033567) DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 |
0.7 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.1 |
0.1 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.1 |
0.1 |
GO:0010046 |
response to mycotoxin(GO:0010046) |
| 0.1 |
14.0 |
GO:0007059 |
chromosome segregation(GO:0007059) |
| 0.1 |
1.0 |
GO:0006152 |
purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.1 |
0.2 |
GO:0030210 |
heparin biosynthetic process(GO:0030210) |
| 0.1 |
1.6 |
GO:0097150 |
neuronal stem cell population maintenance(GO:0097150) |
| 0.1 |
0.2 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) formin-nucleated actin cable assembly(GO:0070649) |
| 0.1 |
0.3 |
GO:0044028 |
DNA hypomethylation(GO:0044028) hypomethylation of CpG island(GO:0044029) |
| 0.1 |
0.5 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.1 |
0.9 |
GO:0036376 |
sodium ion export from cell(GO:0036376) |
| 0.1 |
0.3 |
GO:0070120 |
brainstem development(GO:0003360) ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.1 |
0.8 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 0.1 |
0.6 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.1 |
0.6 |
GO:0034433 |
steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.1 |
0.3 |
GO:0045409 |
negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.1 |
0.1 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.1 |
0.5 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 |
0.6 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.1 |
0.7 |
GO:0003148 |
outflow tract septum morphogenesis(GO:0003148) |
| 0.1 |
0.4 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 |
0.5 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.1 |
0.4 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.1 |
0.1 |
GO:0097475 |
motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 0.1 |
1.0 |
GO:0051570 |
regulation of histone H3-K9 methylation(GO:0051570) |
| 0.1 |
0.2 |
GO:0006544 |
glycine metabolic process(GO:0006544) |
| 0.1 |
0.4 |
GO:1902177 |
positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.1 |
0.1 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.1 |
0.3 |
GO:0045187 |
regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.1 |
0.3 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.1 |
0.4 |
GO:0010713 |
negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) |
| 0.1 |
0.6 |
GO:0098789 |
pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.1 |
0.6 |
GO:0015669 |
gas transport(GO:0015669) carbon dioxide transport(GO:0015670) |
| 0.1 |
0.3 |
GO:0009130 |
pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) |
| 0.1 |
0.5 |
GO:0044854 |
plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
| 0.1 |
0.6 |
GO:0031642 |
negative regulation of myelination(GO:0031642) |
| 0.1 |
0.4 |
GO:0034374 |
low-density lipoprotein particle remodeling(GO:0034374) |
| 0.1 |
0.5 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.1 |
0.3 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.1 |
1.4 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.1 |
2.9 |
GO:0042491 |
auditory receptor cell differentiation(GO:0042491) |
| 0.1 |
0.8 |
GO:0015838 |
amino-acid betaine transport(GO:0015838) |
| 0.1 |
1.1 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 0.1 |
0.4 |
GO:0001709 |
cell fate determination(GO:0001709) |
| 0.1 |
0.6 |
GO:1904031 |
positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
| 0.1 |
0.3 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.1 |
0.1 |
GO:2000812 |
regulation of barbed-end actin filament capping(GO:2000812) |
| 0.1 |
0.4 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.1 |
2.3 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.1 |
0.2 |
GO:0098543 |
detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.1 |
0.3 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.1 |
1.0 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.1 |
0.1 |
GO:0060279 |
regulation of ovulation(GO:0060278) positive regulation of ovulation(GO:0060279) |
| 0.1 |
0.1 |
GO:0060948 |
zygotic specification of dorsal/ventral axis(GO:0007352) cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.1 |
0.3 |
GO:0009068 |
aspartate family amino acid catabolic process(GO:0009068) |
| 0.1 |
0.8 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.1 |
1.1 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.1 |
1.0 |
GO:0048712 |
negative regulation of astrocyte differentiation(GO:0048712) |
| 0.1 |
0.5 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 |
0.2 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.1 |
0.2 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.1 |
0.4 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.1 |
0.4 |
GO:0070303 |
negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of JNK cascade(GO:0046329) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.1 |
0.7 |
GO:0071801 |
regulation of podosome assembly(GO:0071801) |
| 0.1 |
0.4 |
GO:0006895 |
Golgi to endosome transport(GO:0006895) |
| 0.1 |
0.2 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 |
0.2 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.1 |
0.2 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) |
| 0.1 |
0.2 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.1 |
0.2 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.1 |
0.4 |
GO:0033136 |
serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.1 |
1.2 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 0.1 |
0.9 |
GO:0044030 |
regulation of DNA methylation(GO:0044030) |
| 0.1 |
0.4 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.1 |
0.6 |
GO:0030033 |
microvillus assembly(GO:0030033) |
| 0.1 |
0.2 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 |
0.6 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
0.2 |
GO:0045359 |
positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.1 |
2.4 |
GO:1901799 |
negative regulation of proteasomal protein catabolic process(GO:1901799) |
| 0.1 |
0.2 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.1 |
0.1 |
GO:0002361 |
CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.1 |
0.5 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 |
0.4 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.1 |
0.1 |
GO:0060700 |
regulation of ribonuclease activity(GO:0060700) |
| 0.1 |
0.3 |
GO:0007440 |
foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.1 |
0.2 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.1 |
0.3 |
GO:0006071 |
glycerol metabolic process(GO:0006071) |
| 0.1 |
0.3 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.1 |
0.2 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 |
0.2 |
GO:0003413 |
chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
| 0.1 |
0.5 |
GO:0034773 |
histone H4-K20 methylation(GO:0034770) histone H4-K20 trimethylation(GO:0034773) |
| 0.1 |
0.1 |
GO:2000807 |
regulation of synaptic vesicle clustering(GO:2000807) |
| 0.1 |
0.4 |
GO:0061365 |
positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.1 |
3.6 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
1.9 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 |
0.3 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.1 |
0.1 |
GO:0021593 |
rhombomere morphogenesis(GO:0021593) |
| 0.1 |
0.3 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.1 |
0.3 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.1 |
0.3 |
GO:0015819 |
lysine transport(GO:0015819) |
| 0.1 |
0.3 |
GO:0014842 |
skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
| 0.1 |
0.2 |
GO:0050854 |
regulation of antigen receptor-mediated signaling pathway(GO:0050854) |
| 0.1 |
0.9 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.1 |
0.4 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.1 |
0.3 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
0.1 |
GO:1902630 |
regulation of membrane hyperpolarization(GO:1902630) |
| 0.1 |
0.9 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.1 |
0.1 |
GO:0061085 |
regulation of histone H3-K27 methylation(GO:0061085) |
| 0.1 |
0.1 |
GO:0043619 |
regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.1 |
1.8 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.1 |
0.7 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.1 |
0.2 |
GO:0070498 |
interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.1 |
0.1 |
GO:0048630 |
skeletal muscle tissue growth(GO:0048630) |
| 0.1 |
0.9 |
GO:0035329 |
hippo signaling(GO:0035329) |
| 0.1 |
0.4 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.1 |
0.4 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.1 |
0.7 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.1 |
0.1 |
GO:0071467 |
cellular response to pH(GO:0071467) |
| 0.1 |
1.5 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.1 |
0.7 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 |
0.1 |
GO:2000298 |
regulation of Rho-dependent protein serine/threonine kinase activity(GO:2000298) |
| 0.1 |
0.2 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.1 |
0.9 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.1 |
0.2 |
GO:0038108 |
negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.1 |
0.1 |
GO:0097105 |
presynaptic membrane assembly(GO:0097105) |
| 0.1 |
1.0 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.3 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.1 |
0.6 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
1.2 |
GO:0051351 |
positive regulation of ligase activity(GO:0051351) |
| 0.1 |
0.3 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 0.1 |
0.5 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.1 |
0.4 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.1 |
0.1 |
GO:0006558 |
L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
| 0.1 |
0.7 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.1 |
0.1 |
GO:0043201 |
response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.1 |
0.2 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.1 |
0.2 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.1 |
0.1 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.1 |
0.1 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 0.1 |
0.1 |
GO:0034334 |
adherens junction maintenance(GO:0034334) maintenance of organ identity(GO:0048496) |
| 0.1 |
0.3 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.1 |
1.9 |
GO:0035196 |
production of miRNAs involved in gene silencing by miRNA(GO:0035196) |
| 0.1 |
0.1 |
GO:0036480 |
neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
| 0.1 |
1.1 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.1 |
0.1 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.1 |
0.9 |
GO:0042462 |
eye photoreceptor cell development(GO:0042462) |
| 0.1 |
0.4 |
GO:2001198 |
regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 |
0.2 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 |
0.5 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.1 |
0.2 |
GO:0002483 |
antigen processing and presentation of endogenous peptide antigen(GO:0002483) |
| 0.1 |
0.2 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.1 |
2.0 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
0.6 |
GO:0010883 |
regulation of lipid storage(GO:0010883) |
| 0.1 |
0.6 |
GO:0009263 |
deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.1 |
0.2 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 0.1 |
0.3 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
0.5 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.1 |
0.2 |
GO:0006361 |
transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.1 |
0.4 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.1 |
0.3 |
GO:1902775 |
mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.1 |
0.6 |
GO:0001892 |
embryonic placenta development(GO:0001892) |
| 0.1 |
0.1 |
GO:0090500 |
endocardial cushion to mesenchymal transition(GO:0090500) |
| 0.1 |
0.2 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 |
0.2 |
GO:0015867 |
ATP transport(GO:0015867) |
| 0.1 |
0.2 |
GO:2000834 |
androgen secretion(GO:0035935) testosterone secretion(GO:0035936) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 0.1 |
0.3 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.1 |
0.2 |
GO:0043651 |
linoleic acid metabolic process(GO:0043651) |
| 0.1 |
0.7 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.1 |
0.3 |
GO:0060350 |
endochondral bone morphogenesis(GO:0060350) |
| 0.1 |
1.2 |
GO:0032784 |
regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.1 |
0.1 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 |
0.8 |
GO:0045494 |
photoreceptor cell maintenance(GO:0045494) |
| 0.1 |
0.3 |
GO:2000392 |
regulation of lamellipodium morphogenesis(GO:2000392) positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.1 |
0.4 |
GO:0032688 |
negative regulation of interferon-beta production(GO:0032688) |
| 0.1 |
0.1 |
GO:0002437 |
inflammatory response to antigenic stimulus(GO:0002437) |
| 0.1 |
0.1 |
GO:1904468 |
negative regulation of tumor necrosis factor secretion(GO:1904468) |
| 0.1 |
0.3 |
GO:0001773 |
myeloid dendritic cell activation(GO:0001773) myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 |
0.4 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.1 |
0.3 |
GO:1990928 |
response to amino acid starvation(GO:1990928) |
| 0.1 |
0.3 |
GO:0007190 |
activation of adenylate cyclase activity(GO:0007190) |
| 0.1 |
0.9 |
GO:0008631 |
intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.1 |
1.1 |
GO:0008589 |
regulation of smoothened signaling pathway(GO:0008589) |
| 0.1 |
0.2 |
GO:0030718 |
germ-line stem cell population maintenance(GO:0030718) |
| 0.1 |
0.3 |
GO:0051084 |
'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.1 |
0.3 |
GO:0040036 |
regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.1 |
0.1 |
GO:1903525 |
regulation of membrane tubulation(GO:1903525) |
| 0.1 |
0.2 |
GO:0035194 |
posttranscriptional gene silencing(GO:0016441) posttranscriptional gene silencing by RNA(GO:0035194) gene silencing by miRNA(GO:0035195) |
| 0.1 |
0.2 |
GO:0015840 |
urea transport(GO:0015840) urea transmembrane transport(GO:0071918) |
| 0.1 |
0.5 |
GO:0010452 |
histone H3-K36 methylation(GO:0010452) |
| 0.1 |
0.1 |
GO:0060681 |
branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.1 |
0.4 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.1 |
0.2 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.1 |
0.2 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.1 |
0.2 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.1 |
0.1 |
GO:0033089 |
positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
| 0.1 |
0.3 |
GO:0006298 |
mismatch repair(GO:0006298) |
| 0.1 |
0.5 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 |
0.5 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 |
0.6 |
GO:0015825 |
L-serine transport(GO:0015825) |
| 0.0 |
0.5 |
GO:1990748 |
cellular detoxification(GO:1990748) |
| 0.0 |
0.2 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.0 |
0.2 |
GO:0035093 |
spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 |
0.2 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.0 |
0.2 |
GO:0045579 |
positive regulation of B cell differentiation(GO:0045579) |
| 0.0 |
0.1 |
GO:0090169 |
regulation of spindle assembly(GO:0090169) |
| 0.0 |
0.2 |
GO:0001895 |
retina homeostasis(GO:0001895) |
| 0.0 |
0.2 |
GO:0072176 |
nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
| 0.0 |
0.5 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.0 |
1.0 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.0 |
0.3 |
GO:0035561 |
regulation of chromatin binding(GO:0035561) |
| 0.0 |
0.5 |
GO:0046825 |
regulation of protein export from nucleus(GO:0046825) |
| 0.0 |
0.1 |
GO:0042501 |
serine phosphorylation of STAT protein(GO:0042501) |
| 0.0 |
0.0 |
GO:0046689 |
response to mercury ion(GO:0046689) |
| 0.0 |
0.7 |
GO:0019369 |
arachidonic acid metabolic process(GO:0019369) |
| 0.0 |
0.0 |
GO:0045656 |
negative regulation of monocyte differentiation(GO:0045656) |
| 0.0 |
1.0 |
GO:0035567 |
non-canonical Wnt signaling pathway(GO:0035567) |
| 0.0 |
0.5 |
GO:0070536 |
protein K63-linked deubiquitination(GO:0070536) |
| 0.0 |
0.8 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.0 |
0.7 |
GO:0090200 |
positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 |
0.3 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 |
0.6 |
GO:0035855 |
megakaryocyte development(GO:0035855) |
| 0.0 |
0.2 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.0 |
0.1 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 |
0.1 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.0 |
0.3 |
GO:0006620 |
posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 |
0.3 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 |
0.2 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.0 |
0.4 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.0 |
0.3 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.0 |
0.1 |
GO:0036093 |
male germ cell proliferation(GO:0002176) germ cell proliferation(GO:0036093) |
| 0.0 |
1.7 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.0 |
0.1 |
GO:0051712 |
positive regulation of killing of cells of other organism(GO:0051712) |
| 0.0 |
0.1 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.0 |
0.4 |
GO:0017145 |
stem cell division(GO:0017145) |
| 0.0 |
0.1 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 0.0 |
0.2 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 0.0 |
0.1 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.0 |
0.2 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
1.9 |
GO:0006342 |
chromatin silencing(GO:0006342) |
| 0.0 |
0.2 |
GO:0006842 |
tricarboxylic acid transport(GO:0006842) succinate transport(GO:0015744) citrate transport(GO:0015746) |
| 0.0 |
0.1 |
GO:0006971 |
hypotonic response(GO:0006971) |
| 0.0 |
0.5 |
GO:0014009 |
glial cell proliferation(GO:0014009) |
| 0.0 |
0.2 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.0 |
0.2 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.0 |
0.6 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.0 |
0.1 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.0 |
0.8 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.0 |
1.0 |
GO:0032011 |
ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 |
0.2 |
GO:0042559 |
pteridine-containing compound biosynthetic process(GO:0042559) |
| 0.0 |
0.1 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.0 |
0.1 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 |
0.1 |
GO:0046881 |
positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.0 |
0.1 |
GO:0008228 |
opsonization(GO:0008228) |
| 0.0 |
0.2 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 |
0.3 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.0 |
3.2 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.0 |
0.0 |
GO:1900452 |
regulation of long term synaptic depression(GO:1900452) |
| 0.0 |
0.1 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.0 |
0.8 |
GO:0002066 |
columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.0 |
0.8 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.0 |
0.1 |
GO:0006999 |
nuclear pore organization(GO:0006999) |
| 0.0 |
0.2 |
GO:0021869 |
forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 |
0.2 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.0 |
0.1 |
GO:0035696 |
monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.0 |
1.5 |
GO:0043488 |
regulation of mRNA stability(GO:0043488) |
| 0.0 |
0.2 |
GO:0009081 |
branched-chain amino acid metabolic process(GO:0009081) |
| 0.0 |
0.3 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.0 |
0.0 |
GO:0038091 |
VEGF-activated platelet-derived growth factor receptor signaling pathway(GO:0038086) positive regulation of cell proliferation by VEGF-activated platelet derived growth factor receptor signaling pathway(GO:0038091) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.0 |
0.4 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.0 |
0.4 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.0 |
0.2 |
GO:0070475 |
rRNA base methylation(GO:0070475) |
| 0.0 |
0.3 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 |
0.5 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 |
0.7 |
GO:0005978 |
glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 |
1.2 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.0 |
0.1 |
GO:0006048 |
UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 |
0.2 |
GO:0002577 |
regulation of antigen processing and presentation(GO:0002577) |
| 0.0 |
0.0 |
GO:0051133 |
regulation of NK T cell activation(GO:0051133) |
| 0.0 |
0.2 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 |
0.2 |
GO:0060178 |
regulation of exocyst localization(GO:0060178) |
| 0.0 |
0.1 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.0 |
0.2 |
GO:0033572 |
transferrin transport(GO:0033572) |
| 0.0 |
0.1 |
GO:0001676 |
long-chain fatty acid metabolic process(GO:0001676) |
| 0.0 |
0.2 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 |
0.2 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.0 |
0.2 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.0 |
0.1 |
GO:1903298 |
regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.0 |
0.3 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.0 |
0.3 |
GO:0031442 |
positive regulation of mRNA 3'-end processing(GO:0031442) |
| 0.0 |
0.1 |
GO:0051790 |
short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.0 |
0.2 |
GO:2001238 |
positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.0 |
0.2 |
GO:0031498 |
nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
| 0.0 |
0.1 |
GO:0009071 |
serine family amino acid catabolic process(GO:0009071) |
| 0.0 |
0.2 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.0 |
0.4 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.0 |
0.2 |
GO:1900086 |
positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.0 |
0.2 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.0 |
0.1 |
GO:0060594 |
mammary gland specification(GO:0060594) |
| 0.0 |
1.3 |
GO:0006749 |
glutathione metabolic process(GO:0006749) |
| 0.0 |
0.5 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.0 |
0.0 |
GO:0006984 |
ER-nucleus signaling pathway(GO:0006984) |
| 0.0 |
0.6 |
GO:0000184 |
nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 |
0.1 |
GO:0006354 |
DNA-templated transcription, elongation(GO:0006354) |
| 0.0 |
0.3 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 |
0.3 |
GO:0060765 |
regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.0 |
0.3 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 |
0.3 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
| 0.0 |
0.1 |
GO:0000289 |
nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 |
0.6 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.0 |
0.1 |
GO:0048162 |
preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.0 |
0.1 |
GO:0045047 |
protein targeting to ER(GO:0045047) |
| 0.0 |
1.0 |
GO:0032608 |
interferon-beta production(GO:0032608) |
| 0.0 |
0.3 |
GO:0032291 |
central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
| 0.0 |
0.4 |
GO:0072528 |
pyrimidine-containing compound biosynthetic process(GO:0072528) |
| 0.0 |
0.1 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.0 |
0.4 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 |
0.1 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 |
0.0 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.0 |
0.1 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.0 |
0.4 |
GO:0014829 |
vascular smooth muscle contraction(GO:0014829) |
| 0.0 |
0.1 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.0 |
0.1 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 |
0.8 |
GO:0031146 |
SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 |
0.2 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.0 |
0.1 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.0 |
0.0 |
GO:0006295 |
nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.0 |
0.3 |
GO:0006085 |
acetyl-CoA biosynthetic process(GO:0006085) |
| 0.0 |
0.5 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.0 |
0.3 |
GO:0048806 |
genitalia development(GO:0048806) |
| 0.0 |
0.0 |
GO:0002322 |
B cell proliferation involved in immune response(GO:0002322) |
| 0.0 |
0.1 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 |
0.1 |
GO:0010730 |
negative regulation of hydrogen peroxide metabolic process(GO:0010727) negative regulation of hydrogen peroxide biosynthetic process(GO:0010730) |
| 0.0 |
0.2 |
GO:0045671 |
negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 |
0.6 |
GO:0031123 |
RNA 3'-end processing(GO:0031123) |
| 0.0 |
0.2 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 |
0.3 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 |
0.3 |
GO:0035115 |
embryonic forelimb morphogenesis(GO:0035115) |
| 0.0 |
0.2 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 |
0.1 |
GO:1903895 |
negative regulation of IRE1-mediated unfolded protein response(GO:1903895) |
| 0.0 |
0.2 |
GO:0090208 |
positive regulation of triglyceride metabolic process(GO:0090208) |
| 0.0 |
0.1 |
GO:0060903 |
regulation of meiosis I(GO:0060631) positive regulation of meiosis I(GO:0060903) |
| 0.0 |
0.2 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 |
0.1 |
GO:0009948 |
anterior/posterior axis specification(GO:0009948) |
| 0.0 |
0.2 |
GO:0006622 |
protein targeting to lysosome(GO:0006622) |
| 0.0 |
0.1 |
GO:0019432 |
triglyceride biosynthetic process(GO:0019432) |
| 0.0 |
0.3 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.0 |
0.0 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.0 |
0.1 |
GO:0035405 |
histone-threonine phosphorylation(GO:0035405) |
| 0.0 |
0.3 |
GO:0046513 |
ceramide biosynthetic process(GO:0046513) |
| 0.0 |
0.1 |
GO:1902035 |
positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 |
0.1 |
GO:1901341 |
activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.0 |
0.2 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.0 |
0.0 |
GO:0090274 |
positive regulation of somatostatin secretion(GO:0090274) |
| 0.0 |
0.2 |
GO:0034629 |
cellular protein complex localization(GO:0034629) |
| 0.0 |
0.2 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.0 |
0.1 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.0 |
0.2 |
GO:0036037 |
CD8-positive, alpha-beta T cell activation(GO:0036037) |
| 0.0 |
0.1 |
GO:0090529 |
barrier septum assembly(GO:0000917) cell septum assembly(GO:0090529) mitotic cytokinetic process(GO:1902410) |
| 0.0 |
0.9 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
0.1 |
GO:0045056 |
transcytosis(GO:0045056) |
| 0.0 |
0.1 |
GO:0046950 |
cellular ketone body metabolic process(GO:0046950) |
| 0.0 |
0.2 |
GO:0031272 |
regulation of pseudopodium assembly(GO:0031272) |
| 0.0 |
0.1 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.0 |
0.1 |
GO:0090005 |
negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.0 |
0.3 |
GO:0005980 |
polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 |
0.0 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.0 |
0.2 |
GO:1902850 |
mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.0 |
0.1 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.0 |
0.3 |
GO:0006073 |
glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.0 |
0.1 |
GO:0043687 |
post-translational protein modification(GO:0043687) |
| 0.0 |
0.1 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.0 |
0.1 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.0 |
0.1 |
GO:0031022 |
nuclear migration along microfilament(GO:0031022) |
| 0.0 |
0.1 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 |
0.1 |
GO:0010719 |
negative regulation of epithelial to mesenchymal transition(GO:0010719) |
| 0.0 |
0.4 |
GO:0045669 |
positive regulation of osteoblast differentiation(GO:0045669) |
| 0.0 |
0.0 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 |
0.1 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.0 |
0.1 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.0 |
0.1 |
GO:0030220 |
platelet formation(GO:0030220) platelet morphogenesis(GO:0036344) |
| 0.0 |
0.2 |
GO:0006656 |
phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.0 |
0.1 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 |
0.5 |
GO:0007368 |
determination of left/right symmetry(GO:0007368) |
| 0.0 |
0.0 |
GO:0032328 |
L-alanine transport(GO:0015808) alanine transport(GO:0032328) |
| 0.0 |
0.0 |
GO:0000076 |
DNA replication checkpoint(GO:0000076) |
| 0.0 |
0.1 |
GO:0051189 |
Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 |
0.1 |
GO:0043323 |
positive regulation of natural killer cell degranulation(GO:0043323) |
| 0.0 |
0.1 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 |
0.0 |
GO:0030656 |
regulation of vitamin metabolic process(GO:0030656) |
| 0.0 |
0.2 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.0 |
0.0 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 |
0.1 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 |
0.1 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 |
0.1 |
GO:0071971 |
extracellular exosome assembly(GO:0071971) |
| 0.0 |
0.1 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 |
0.0 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.0 |
0.1 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.0 |
0.0 |
GO:0070286 |
axonemal dynein complex assembly(GO:0070286) |
| 0.0 |
0.0 |
GO:0033127 |
regulation of histone phosphorylation(GO:0033127) positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 |
0.2 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.0 |
0.0 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.0 |
0.1 |
GO:2000641 |
regulation of early endosome to late endosome transport(GO:2000641) |
| 0.0 |
0.0 |
GO:0003215 |
cardiac right ventricle morphogenesis(GO:0003215) |
| 0.0 |
0.0 |
GO:0019433 |
triglyceride catabolic process(GO:0019433) |
| 0.0 |
0.0 |
GO:2000773 |
negative regulation of cellular senescence(GO:2000773) |
| 0.0 |
0.1 |
GO:0045604 |
regulation of epidermal cell differentiation(GO:0045604) |
| 0.0 |
0.1 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.0 |
0.0 |
GO:0048736 |
appendage development(GO:0048736) limb development(GO:0060173) |
| 0.0 |
0.1 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 |
0.0 |
GO:0072033 |
renal vesicle formation(GO:0072033) |
| 0.0 |
0.0 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.0 |
0.3 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 |
0.1 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.0 |
0.1 |
GO:0009649 |
entrainment of circadian clock(GO:0009649) |
| 0.0 |
0.1 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.0 |
0.1 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.0 |
0.0 |
GO:0070126 |
mitochondrial translational termination(GO:0070126) |
| 0.0 |
3.0 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.0 |
0.2 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.0 |
0.1 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.0 |
0.2 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.0 |
0.3 |
GO:0007608 |
sensory perception of smell(GO:0007608) |
| 0.0 |
0.0 |
GO:0046325 |
negative regulation of glucose import(GO:0046325) |
| 0.0 |
0.1 |
GO:0006857 |
oligopeptide transport(GO:0006857) |
| 0.0 |
0.1 |
GO:0045580 |
regulation of T cell differentiation(GO:0045580) |
| 0.0 |
0.0 |
GO:0016925 |
protein sumoylation(GO:0016925) |
