| 2.9 |
8.7 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 2.8 |
8.3 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 2.3 |
15.8 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 2.2 |
4.4 |
GO:1902913 |
positive regulation of melanocyte differentiation(GO:0045636) positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 2.1 |
2.1 |
GO:0014009 |
glial cell proliferation(GO:0014009) |
| 2.0 |
6.0 |
GO:0086017 |
Purkinje myocyte action potential(GO:0086017) |
| 1.9 |
7.6 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 1.9 |
5.7 |
GO:0060364 |
frontal suture morphogenesis(GO:0060364) |
| 1.7 |
8.4 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 1.6 |
4.9 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 1.6 |
6.2 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 1.5 |
6.1 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 1.5 |
4.4 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 1.4 |
5.7 |
GO:0003360 |
brainstem development(GO:0003360) |
| 1.4 |
4.2 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 1.3 |
5.2 |
GO:0060032 |
notochord regression(GO:0060032) |
| 1.3 |
6.3 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 1.3 |
3.8 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 1.3 |
3.8 |
GO:0030421 |
defecation(GO:0030421) |
| 1.3 |
1.3 |
GO:0042117 |
monocyte activation(GO:0042117) |
| 1.3 |
3.8 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 1.2 |
6.2 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.2 |
16.0 |
GO:0032252 |
secretory granule localization(GO:0032252) |
| 1.2 |
4.9 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 1.2 |
6.1 |
GO:0015705 |
iodide transport(GO:0015705) |
| 1.2 |
6.0 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 1.2 |
3.6 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 1.2 |
1.2 |
GO:2000382 |
positive regulation of mesoderm development(GO:2000382) |
| 1.2 |
3.6 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 1.1 |
3.4 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 1.1 |
5.6 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 1.1 |
3.4 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 1.1 |
3.3 |
GO:0060217 |
hemangioblast cell differentiation(GO:0060217) |
| 1.1 |
1.1 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 1.1 |
3.3 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 1.1 |
4.3 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 1.1 |
3.2 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 1.1 |
2.1 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 1.1 |
3.2 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 1.1 |
3.2 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 1.1 |
4.2 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 1.1 |
4.2 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 1.0 |
1.0 |
GO:1905065 |
positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 1.0 |
3.1 |
GO:0002636 |
positive regulation of germinal center formation(GO:0002636) |
| 1.0 |
5.1 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.0 |
4.0 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 1.0 |
5.0 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 1.0 |
6.0 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.0 |
5.0 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 1.0 |
4.9 |
GO:2000065 |
negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 1.0 |
9.9 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 1.0 |
1.0 |
GO:0048619 |
embryonic hindgut morphogenesis(GO:0048619) |
| 1.0 |
2.9 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 1.0 |
3.9 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 1.0 |
3.8 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.9 |
5.6 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.9 |
6.6 |
GO:0000320 |
re-entry into mitotic cell cycle(GO:0000320) |
| 0.9 |
0.9 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 0.9 |
2.8 |
GO:0044332 |
Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 0.9 |
2.7 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.9 |
2.7 |
GO:0072204 |
cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.9 |
0.9 |
GO:0008582 |
regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.9 |
0.9 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 0.9 |
4.3 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.9 |
0.9 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 0.8 |
17.0 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.8 |
1.7 |
GO:0051124 |
synaptic growth at neuromuscular junction(GO:0051124) |
| 0.8 |
6.7 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.8 |
2.5 |
GO:0014028 |
notochord formation(GO:0014028) |
| 0.8 |
9.9 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.8 |
6.6 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.8 |
2.5 |
GO:0046655 |
glycine biosynthetic process(GO:0006545) folic acid metabolic process(GO:0046655) |
| 0.8 |
2.5 |
GO:0032058 |
positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.8 |
3.3 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.8 |
3.3 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.8 |
3.3 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) |
| 0.8 |
0.8 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.8 |
0.8 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 0.8 |
1.6 |
GO:0090272 |
negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.8 |
7.0 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.8 |
2.3 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.8 |
5.4 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 0.8 |
4.6 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.8 |
2.3 |
GO:0060021 |
palate development(GO:0060021) |
| 0.8 |
0.8 |
GO:1903011 |
negative regulation of bone development(GO:1903011) |
| 0.8 |
2.3 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.7 |
0.7 |
GO:1900157 |
regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.7 |
1.5 |
GO:0072076 |
nephrogenic mesenchyme development(GO:0072076) kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
| 0.7 |
3.7 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.7 |
2.2 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.7 |
2.2 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.7 |
11.7 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.7 |
2.2 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.7 |
2.9 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) |
| 0.7 |
2.1 |
GO:0042505 |
tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.7 |
3.5 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.7 |
2.1 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.7 |
4.2 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.7 |
2.1 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.7 |
0.7 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.7 |
4.1 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.7 |
0.7 |
GO:0045137 |
development of primary sexual characteristics(GO:0045137) |
| 0.7 |
6.1 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.7 |
1.4 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 0.7 |
2.0 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.7 |
2.7 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.7 |
2.0 |
GO:0045656 |
negative regulation of monocyte differentiation(GO:0045656) |
| 0.7 |
2.0 |
GO:0072172 |
ureteric bud formation(GO:0060676) mesonephric tubule formation(GO:0072172) |
| 0.7 |
2.0 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.7 |
4.7 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.7 |
0.7 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.7 |
5.2 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.7 |
2.0 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.7 |
2.0 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.6 |
6.5 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.6 |
0.6 |
GO:0035089 |
establishment of apical/basal cell polarity(GO:0035089) |
| 0.6 |
1.9 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.6 |
8.4 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.6 |
3.2 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.6 |
1.9 |
GO:0010519 |
negative regulation of phospholipase activity(GO:0010519) |
| 0.6 |
1.9 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.6 |
8.9 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.6 |
0.6 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.6 |
1.3 |
GO:0035188 |
blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.6 |
1.9 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.6 |
1.9 |
GO:1903519 |
apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.6 |
3.1 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.6 |
2.5 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.6 |
2.5 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.6 |
1.9 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.6 |
1.2 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.6 |
5.6 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.6 |
4.3 |
GO:0050882 |
voluntary musculoskeletal movement(GO:0050882) |
| 0.6 |
1.8 |
GO:0009880 |
embryonic pattern specification(GO:0009880) |
| 0.6 |
1.2 |
GO:0003223 |
ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.6 |
4.3 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 0.6 |
2.4 |
GO:1902969 |
mitotic DNA replication(GO:1902969) |
| 0.6 |
1.8 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.6 |
1.8 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.6 |
1.2 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.6 |
1.2 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.6 |
2.4 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.6 |
1.2 |
GO:0010911 |
regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.6 |
1.8 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.6 |
2.4 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.6 |
1.8 |
GO:0032459 |
regulation of protein oligomerization(GO:0032459) regulation of protein homooligomerization(GO:0032462) |
| 0.6 |
1.8 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.6 |
5.9 |
GO:0061299 |
retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.6 |
3.5 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.6 |
5.2 |
GO:0048368 |
lateral mesoderm development(GO:0048368) |
| 0.6 |
6.3 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.6 |
2.3 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.6 |
2.3 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 0.6 |
2.8 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.6 |
3.9 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.6 |
1.1 |
GO:0097709 |
connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
| 0.6 |
7.8 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.6 |
1.7 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 0.6 |
2.8 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.6 |
2.2 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.6 |
2.8 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.6 |
2.2 |
GO:0060459 |
extraocular skeletal muscle development(GO:0002074) pulmonary myocardium development(GO:0003350) subthalamus development(GO:0021539) subthalamic nucleus development(GO:0021763) left lung development(GO:0060459) left lung morphogenesis(GO:0060460) pulmonary vein morphogenesis(GO:0060577) superior vena cava morphogenesis(GO:0060578) |
| 0.5 |
2.7 |
GO:0019249 |
lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.5 |
0.5 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.5 |
1.1 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.5 |
1.6 |
GO:0000710 |
meiotic mismatch repair(GO:0000710) |
| 0.5 |
1.6 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.5 |
1.6 |
GO:0035878 |
nail development(GO:0035878) |
| 0.5 |
0.5 |
GO:0031944 |
negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
| 0.5 |
1.6 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.5 |
5.4 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.5 |
1.6 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.5 |
0.5 |
GO:0060744 |
thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.5 |
3.2 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.5 |
2.6 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.5 |
2.1 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.5 |
3.1 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.5 |
2.6 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.5 |
1.0 |
GO:0045472 |
response to ether(GO:0045472) |
| 0.5 |
2.1 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.5 |
2.1 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.5 |
3.1 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.5 |
0.5 |
GO:0000060 |
protein import into nucleus, translocation(GO:0000060) |
| 0.5 |
2.5 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.5 |
0.5 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.5 |
2.0 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.5 |
9.0 |
GO:0006978 |
DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 0.5 |
2.0 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.5 |
5.9 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.5 |
2.5 |
GO:0051971 |
positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.5 |
3.9 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.5 |
0.5 |
GO:0003100 |
regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.5 |
2.0 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.5 |
1.0 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.5 |
1.5 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.5 |
1.5 |
GO:0003150 |
muscular septum morphogenesis(GO:0003150) |
| 0.5 |
1.0 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.5 |
0.5 |
GO:0043101 |
purine-containing compound salvage(GO:0043101) |
| 0.5 |
14.6 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.5 |
1.5 |
GO:0010899 |
regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 0.5 |
1.0 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 0.5 |
2.4 |
GO:0072539 |
T-helper 17 cell differentiation(GO:0072539) |
| 0.5 |
1.0 |
GO:2001206 |
positive regulation of osteoclast development(GO:2001206) |
| 0.5 |
2.4 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.5 |
1.9 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.5 |
1.9 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.5 |
1.4 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.5 |
1.4 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.5 |
3.3 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.5 |
1.9 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.5 |
1.9 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.5 |
1.4 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.5 |
1.4 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.5 |
1.4 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.5 |
1.8 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.5 |
1.4 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.5 |
0.5 |
GO:0010847 |
regulation of chromatin assembly(GO:0010847) |
| 0.5 |
0.5 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) |
| 0.5 |
2.3 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.5 |
1.4 |
GO:0034287 |
detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.5 |
1.8 |
GO:0065001 |
negative regulation of histone H3-K36 methylation(GO:0000415) specification of axis polarity(GO:0065001) |
| 0.5 |
1.8 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.5 |
0.5 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.5 |
0.9 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.4 |
1.3 |
GO:0097623 |
potassium ion export across plasma membrane(GO:0097623) |
| 0.4 |
0.9 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.4 |
0.9 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.4 |
2.7 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.4 |
0.4 |
GO:0060693 |
regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.4 |
1.8 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.4 |
2.7 |
GO:0071883 |
activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.4 |
2.2 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.4 |
4.4 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.4 |
1.3 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.4 |
2.6 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.4 |
0.9 |
GO:0072180 |
mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
| 0.4 |
6.2 |
GO:0033260 |
nuclear DNA replication(GO:0033260) |
| 0.4 |
0.4 |
GO:0051024 |
positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.4 |
1.7 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.4 |
0.4 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.4 |
2.2 |
GO:0048549 |
positive regulation of pinocytosis(GO:0048549) |
| 0.4 |
2.6 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) |
| 0.4 |
1.7 |
GO:2001271 |
negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.4 |
1.3 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 0.4 |
12.9 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.4 |
0.4 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.4 |
1.3 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.4 |
3.0 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.4 |
1.3 |
GO:0000087 |
mitotic M phase(GO:0000087) mitotic cell cycle phase(GO:0098763) |
| 0.4 |
2.1 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.4 |
2.1 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.4 |
1.7 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.4 |
1.7 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 0.4 |
2.1 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.4 |
3.7 |
GO:0060252 |
positive regulation of glial cell proliferation(GO:0060252) |
| 0.4 |
0.8 |
GO:0002765 |
immune response-inhibiting signal transduction(GO:0002765) |
| 0.4 |
7.0 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.4 |
1.7 |
GO:0010510 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.4 |
1.6 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.4 |
0.4 |
GO:0032760 |
positive regulation of tumor necrosis factor production(GO:0032760) positive regulation of tumor necrosis factor superfamily cytokine production(GO:1903557) |
| 0.4 |
4.9 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.4 |
2.5 |
GO:0060026 |
convergent extension(GO:0060026) |
| 0.4 |
0.8 |
GO:2000780 |
negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 0.4 |
4.9 |
GO:0043923 |
positive regulation by host of viral transcription(GO:0043923) |
| 0.4 |
1.2 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.4 |
0.4 |
GO:0033278 |
cell proliferation in midbrain(GO:0033278) |
| 0.4 |
0.8 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 0.4 |
1.6 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.4 |
1.6 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.4 |
0.4 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.4 |
2.4 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.4 |
0.8 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 0.4 |
0.8 |
GO:0046084 |
adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.4 |
0.8 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.4 |
1.6 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.4 |
1.6 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.4 |
2.0 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.4 |
2.4 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.4 |
0.4 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.4 |
0.4 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 0.4 |
1.2 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.4 |
3.5 |
GO:0009396 |
folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.4 |
2.3 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.4 |
2.7 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.4 |
3.1 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.4 |
0.4 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.4 |
1.1 |
GO:1901563 |
response to camptothecin(GO:1901563) |
| 0.4 |
1.9 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.4 |
0.8 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.4 |
1.1 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 0.4 |
0.8 |
GO:0045590 |
negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.4 |
1.5 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.4 |
1.5 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.4 |
1.1 |
GO:0048752 |
semicircular canal morphogenesis(GO:0048752) |
| 0.4 |
0.8 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.4 |
3.4 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.4 |
1.1 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.4 |
3.7 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.4 |
0.4 |
GO:0014045 |
establishment of endothelial blood-brain barrier(GO:0014045) central nervous system vasculogenesis(GO:0022009) |
| 0.4 |
1.1 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.4 |
4.1 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.4 |
1.9 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) |
| 0.4 |
0.7 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.4 |
1.1 |
GO:0014891 |
striated muscle atrophy(GO:0014891) |
| 0.4 |
3.7 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.4 |
1.1 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.4 |
1.5 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) |
| 0.4 |
2.2 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.4 |
0.4 |
GO:2000637 |
positive regulation of posttranscriptional gene silencing(GO:0060148) positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.4 |
0.4 |
GO:0009583 |
detection of light stimulus(GO:0009583) |
| 0.4 |
1.1 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.4 |
0.7 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.4 |
2.6 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.4 |
2.2 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.4 |
2.9 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.4 |
1.4 |
GO:0060264 |
regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 0.4 |
0.7 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.4 |
1.1 |
GO:0010814 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.4 |
1.1 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.4 |
1.1 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 0.4 |
0.4 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.4 |
4.3 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.4 |
0.7 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.4 |
1.1 |
GO:0031627 |
telomeric loop formation(GO:0031627) |
| 0.4 |
1.1 |
GO:0045404 |
positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.4 |
1.1 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.4 |
0.7 |
GO:0070346 |
positive regulation of fat cell proliferation(GO:0070346) |
| 0.4 |
1.8 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.4 |
2.8 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.4 |
1.8 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.4 |
1.1 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.4 |
1.4 |
GO:0051305 |
chromosome movement towards spindle pole(GO:0051305) |
| 0.3 |
2.8 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.3 |
0.3 |
GO:0060455 |
negative regulation of gastric acid secretion(GO:0060455) |
| 0.3 |
0.3 |
GO:0010878 |
cholesterol storage(GO:0010878) |
| 0.3 |
0.3 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.3 |
0.3 |
GO:0051572 |
negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.3 |
1.0 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.3 |
7.6 |
GO:0007140 |
male meiosis(GO:0007140) |
| 0.3 |
3.1 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.3 |
1.0 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.3 |
3.8 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.3 |
0.7 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.3 |
4.8 |
GO:0060236 |
regulation of mitotic spindle organization(GO:0060236) |
| 0.3 |
2.7 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 0.3 |
2.4 |
GO:0060836 |
lymphatic endothelial cell differentiation(GO:0060836) |
| 0.3 |
0.3 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.3 |
1.7 |
GO:0007351 |
tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.3 |
1.4 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.3 |
2.0 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.3 |
0.3 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.3 |
0.7 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) negative regulation of lymphocyte differentiation(GO:0045620) |
| 0.3 |
1.3 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.3 |
1.7 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.3 |
1.7 |
GO:0060068 |
vagina development(GO:0060068) |
| 0.3 |
1.0 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.3 |
1.0 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.3 |
1.0 |
GO:0071649 |
regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.3 |
0.7 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.3 |
0.3 |
GO:0048239 |
negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.3 |
0.3 |
GO:0002086 |
diaphragm contraction(GO:0002086) |
| 0.3 |
1.0 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.3 |
2.6 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.3 |
1.0 |
GO:0072176 |
nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
| 0.3 |
1.3 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.3 |
7.3 |
GO:0072698 |
protein localization to microtubule cytoskeleton(GO:0072698) |
| 0.3 |
0.3 |
GO:1901796 |
regulation of signal transduction by p53 class mediator(GO:1901796) |
| 0.3 |
1.3 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.3 |
0.6 |
GO:0045659 |
regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
| 0.3 |
2.8 |
GO:0032310 |
prostaglandin secretion(GO:0032310) |
| 0.3 |
1.6 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 0.3 |
0.3 |
GO:0035330 |
regulation of hippo signaling(GO:0035330) |
| 0.3 |
2.5 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.3 |
1.3 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.3 |
1.6 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.3 |
1.9 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.3 |
1.3 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.3 |
0.3 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.3 |
0.6 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.3 |
0.9 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.3 |
0.9 |
GO:2000042 |
negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.3 |
1.6 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.3 |
1.5 |
GO:0000972 |
transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.3 |
0.9 |
GO:0042362 |
fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.3 |
0.9 |
GO:0072595 |
maintenance of protein localization in organelle(GO:0072595) |
| 0.3 |
1.8 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.3 |
3.3 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.3 |
3.9 |
GO:0051383 |
kinetochore assembly(GO:0051382) kinetochore organization(GO:0051383) |
| 0.3 |
1.8 |
GO:1904666 |
regulation of ubiquitin protein ligase activity(GO:1904666) |
| 0.3 |
0.9 |
GO:2000304 |
positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.3 |
0.9 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.3 |
0.6 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.3 |
1.2 |
GO:0035987 |
endodermal cell differentiation(GO:0035987) |
| 0.3 |
3.0 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.3 |
0.3 |
GO:0060066 |
oviduct development(GO:0060066) |
| 0.3 |
0.3 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.3 |
0.6 |
GO:0048162 |
preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.3 |
0.3 |
GO:0099515 |
actin filament-based transport(GO:0099515) |
| 0.3 |
1.5 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.3 |
5.6 |
GO:0044819 |
mitotic G1/S transition checkpoint(GO:0044819) |
| 0.3 |
1.2 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
| 0.3 |
0.9 |
GO:0042822 |
vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.3 |
0.9 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.3 |
2.0 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.3 |
0.9 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.3 |
1.2 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.3 |
1.7 |
GO:0097501 |
stress response to metal ion(GO:0097501) |
| 0.3 |
1.4 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.3 |
2.0 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.3 |
0.9 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.3 |
4.2 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.3 |
3.4 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.3 |
0.6 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.3 |
0.3 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.3 |
0.8 |
GO:0035590 |
purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.3 |
0.3 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.3 |
3.6 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.3 |
0.6 |
GO:0002076 |
osteoblast development(GO:0002076) |
| 0.3 |
0.8 |
GO:0048669 |
collateral sprouting in absence of injury(GO:0048669) negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.3 |
0.3 |
GO:0006405 |
RNA export from nucleus(GO:0006405) |
| 0.3 |
0.8 |
GO:0034476 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.3 |
3.6 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.3 |
1.9 |
GO:0009435 |
NAD biosynthetic process(GO:0009435) |
| 0.3 |
1.1 |
GO:0051660 |
cortical microtubule organization(GO:0043622) establishment of centrosome localization(GO:0051660) |
| 0.3 |
1.9 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.3 |
0.3 |
GO:0001553 |
luteinization(GO:0001553) |
| 0.3 |
0.8 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.3 |
1.4 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 |
0.3 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.3 |
1.1 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.3 |
1.9 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.3 |
0.8 |
GO:0097461 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.3 |
1.1 |
GO:0042790 |
transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.3 |
1.9 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.3 |
0.8 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.3 |
1.1 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.3 |
0.3 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.3 |
1.9 |
GO:0045005 |
DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.3 |
0.8 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.3 |
1.1 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.3 |
1.1 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 0.3 |
0.3 |
GO:0048146 |
positive regulation of fibroblast proliferation(GO:0048146) |
| 0.3 |
2.6 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.3 |
0.8 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.3 |
3.7 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.3 |
1.8 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.3 |
1.3 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.3 |
0.5 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.3 |
0.8 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.3 |
2.6 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.3 |
0.8 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 0.3 |
1.0 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.3 |
0.5 |
GO:0014719 |
skeletal muscle satellite cell activation(GO:0014719) |
| 0.3 |
2.6 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.3 |
0.5 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.3 |
1.5 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 0.3 |
2.3 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.3 |
0.5 |
GO:0035020 |
regulation of Rac protein signal transduction(GO:0035020) |
| 0.3 |
1.3 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.3 |
0.5 |
GO:0060800 |
regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.3 |
0.3 |
GO:0038028 |
insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.3 |
9.0 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.3 |
0.5 |
GO:0000076 |
DNA replication checkpoint(GO:0000076) |
| 0.2 |
1.5 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.2 |
1.0 |
GO:2000483 |
negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.2 |
7.7 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.2 |
0.2 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.2 |
4.9 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.2 |
0.2 |
GO:1901660 |
calcium ion export(GO:1901660) |
| 0.2 |
0.2 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.2 |
0.2 |
GO:0021847 |
ventricular zone neuroblast division(GO:0021847) |
| 0.2 |
4.6 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.2 |
1.0 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.2 |
0.5 |
GO:0071673 |
positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.2 |
1.9 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.2 |
1.7 |
GO:0035881 |
amacrine cell differentiation(GO:0035881) |
| 0.2 |
1.9 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 |
1.7 |
GO:2000258 |
negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.2 |
0.2 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.2 |
1.2 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.2 |
1.7 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.2 |
0.7 |
GO:0042264 |
peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.2 |
1.4 |
GO:1902514 |
regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.2 |
5.0 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.2 |
0.2 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.2 |
4.0 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.2 |
1.2 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.2 |
2.4 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.2 |
0.2 |
GO:0045410 |
positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.2 |
0.5 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.2 |
2.3 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 0.2 |
1.9 |
GO:0014823 |
response to activity(GO:0014823) |
| 0.2 |
0.7 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.2 |
0.5 |
GO:0002669 |
positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.2 |
0.9 |
GO:0042795 |
snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.2 |
0.7 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.2 |
0.7 |
GO:2000105 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) positive regulation of mitochondrial DNA metabolic process(GO:1901860) stress-induced mitochondrial fusion(GO:1990046) positive regulation of DNA-dependent DNA replication(GO:2000105) |
| 0.2 |
3.4 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.2 |
0.7 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.2 |
0.7 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.2 |
0.2 |
GO:0042312 |
regulation of vasodilation(GO:0042312) |
| 0.2 |
0.7 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.2 |
1.1 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.2 |
0.4 |
GO:0010871 |
negative regulation of receptor biosynthetic process(GO:0010871) |
| 0.2 |
0.7 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 0.2 |
0.9 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.2 |
0.4 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.2 |
1.3 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.2 |
2.0 |
GO:0003197 |
endocardial cushion development(GO:0003197) |
| 0.2 |
0.7 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.2 |
1.3 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.2 |
3.9 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.2 |
1.5 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.2 |
3.5 |
GO:0042149 |
cellular response to glucose starvation(GO:0042149) |
| 0.2 |
2.4 |
GO:0034383 |
low-density lipoprotein particle clearance(GO:0034383) |
| 0.2 |
1.5 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.2 |
0.9 |
GO:0046688 |
response to copper ion(GO:0046688) |
| 0.2 |
0.6 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.2 |
0.2 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.2 |
1.3 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.2 |
0.9 |
GO:0031069 |
hair follicle morphogenesis(GO:0031069) |
| 0.2 |
0.2 |
GO:0048484 |
enteric nervous system development(GO:0048484) |
| 0.2 |
3.2 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.2 |
2.7 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.2 |
0.2 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.2 |
0.4 |
GO:0002741 |
positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.2 |
2.7 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.2 |
1.0 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.2 |
0.4 |
GO:1900044 |
regulation of protein K63-linked ubiquitination(GO:1900044) |
| 0.2 |
0.8 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.2 |
0.4 |
GO:2000834 |
androgen secretion(GO:0035935) testosterone secretion(GO:0035936) negative regulation of glucagon secretion(GO:0070093) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 0.2 |
0.6 |
GO:0007080 |
mitotic metaphase plate congression(GO:0007080) |
| 0.2 |
0.4 |
GO:0000059 |
protein import into nucleus, docking(GO:0000059) |
| 0.2 |
2.1 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.2 |
0.6 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.2 |
0.4 |
GO:0035280 |
miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.2 |
0.6 |
GO:0072182 |
glomerular parietal epithelial cell differentiation(GO:0072139) regulation of nephron tubule epithelial cell differentiation(GO:0072182) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.2 |
10.5 |
GO:0050830 |
defense response to Gram-positive bacterium(GO:0050830) |
| 0.2 |
0.2 |
GO:0002643 |
regulation of tolerance induction(GO:0002643) |
| 0.2 |
1.2 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.2 |
2.2 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.2 |
0.6 |
GO:0051695 |
actin filament uncapping(GO:0051695) |
| 0.2 |
0.8 |
GO:0033629 |
negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.2 |
0.2 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.2 |
0.8 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.2 |
3.2 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.2 |
0.8 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.2 |
1.0 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.2 |
1.2 |
GO:0010747 |
positive regulation of plasma membrane long-chain fatty acid transport(GO:0010747) |
| 0.2 |
0.2 |
GO:0010944 |
negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.2 |
0.6 |
GO:0010886 |
positive regulation of cholesterol storage(GO:0010886) |
| 0.2 |
1.6 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.2 |
0.2 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.2 |
3.7 |
GO:0048025 |
negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.2 |
0.8 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.2 |
0.6 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.2 |
0.6 |
GO:0071105 |
mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003337) regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003339) negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) response to interleukin-11(GO:0071105) negative regulation of metanephros development(GO:0072217) |
| 0.2 |
0.4 |
GO:0009301 |
snRNA transcription(GO:0009301) |
| 0.2 |
0.6 |
GO:0032025 |
response to cobalt ion(GO:0032025) |
| 0.2 |
1.0 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.2 |
0.2 |
GO:0002922 |
positive regulation of humoral immune response(GO:0002922) positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.2 |
1.1 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.2 |
1.0 |
GO:0035561 |
regulation of chromatin binding(GO:0035561) |
| 0.2 |
0.4 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.2 |
0.6 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.2 |
0.9 |
GO:2000678 |
negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.2 |
1.7 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.2 |
2.3 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.2 |
0.4 |
GO:0045601 |
regulation of endothelial cell differentiation(GO:0045601) |
| 0.2 |
2.8 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.2 |
2.6 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.2 |
0.6 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.2 |
0.4 |
GO:0030422 |
production of siRNA involved in RNA interference(GO:0030422) |
| 0.2 |
0.2 |
GO:0090309 |
positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.2 |
1.1 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.2 |
0.2 |
GO:0098908 |
regulation of neuronal action potential(GO:0098908) |
| 0.2 |
0.4 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.2 |
0.6 |
GO:0009130 |
pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) |
| 0.2 |
0.2 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.2 |
1.5 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.2 |
0.7 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.2 |
0.4 |
GO:0042713 |
sperm ejaculation(GO:0042713) Sertoli cell proliferation(GO:0060011) |
| 0.2 |
1.8 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.2 |
0.6 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.2 |
0.7 |
GO:0071034 |
CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.2 |
0.7 |
GO:2000144 |
positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.2 |
0.2 |
GO:0060536 |
cartilage morphogenesis(GO:0060536) |
| 0.2 |
0.7 |
GO:0046135 |
pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.2 |
1.6 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.2 |
0.2 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.2 |
5.3 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 |
0.4 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.2 |
0.7 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.2 |
0.7 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.2 |
0.7 |
GO:0045606 |
positive regulation of epidermal cell differentiation(GO:0045606) |
| 0.2 |
1.2 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.2 |
0.2 |
GO:0032835 |
glomerulus development(GO:0032835) |
| 0.2 |
1.6 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.2 |
0.5 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.2 |
0.4 |
GO:0002385 |
organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.2 |
1.2 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.2 |
0.2 |
GO:0016571 |
histone methylation(GO:0016571) |
| 0.2 |
0.2 |
GO:0070171 |
negative regulation of tooth mineralization(GO:0070171) |
| 0.2 |
3.1 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.2 |
0.2 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.2 |
0.3 |
GO:0051031 |
tRNA transport(GO:0051031) |
| 0.2 |
0.3 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.2 |
0.5 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.2 |
0.5 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.2 |
1.0 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.2 |
1.0 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.2 |
0.3 |
GO:0019740 |
nitrogen utilization(GO:0019740) |
| 0.2 |
0.3 |
GO:0098543 |
detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.2 |
0.3 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.2 |
1.0 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.2 |
1.0 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.2 |
0.5 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 0.2 |
0.3 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.2 |
1.4 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.2 |
0.7 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.2 |
0.2 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.2 |
0.7 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.2 |
1.0 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.2 |
1.6 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.2 |
0.7 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.2 |
0.2 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.2 |
0.5 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.2 |
0.3 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.2 |
0.3 |
GO:0035441 |
cell migration involved in vasculogenesis(GO:0035441) |
| 0.2 |
7.4 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.2 |
1.9 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.2 |
0.5 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.2 |
3.5 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.2 |
1.8 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.2 |
1.9 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.2 |
0.5 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.2 |
3.2 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.2 |
0.3 |
GO:0060135 |
maternal process involved in female pregnancy(GO:0060135) |
| 0.2 |
0.8 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.2 |
0.3 |
GO:0021965 |
spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.2 |
0.2 |
GO:0045065 |
cytotoxic T cell differentiation(GO:0045065) |
| 0.2 |
0.2 |
GO:0001878 |
response to yeast(GO:0001878) |
| 0.2 |
0.5 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.2 |
0.5 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.2 |
1.0 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.2 |
0.2 |
GO:0090035 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.2 |
1.6 |
GO:0046782 |
regulation of viral transcription(GO:0046782) |
| 0.2 |
0.2 |
GO:0089711 |
L-glutamate transmembrane transport(GO:0089711) |
| 0.2 |
0.8 |
GO:0080111 |
DNA demethylation(GO:0080111) |
| 0.2 |
1.1 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.2 |
0.5 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.2 |
0.3 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.2 |
3.2 |
GO:0007062 |
sister chromatid cohesion(GO:0007062) |
| 0.2 |
0.6 |
GO:0046476 |
glycosylceramide biosynthetic process(GO:0046476) |
| 0.2 |
0.9 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.2 |
0.3 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.2 |
0.5 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.2 |
2.8 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.2 |
0.2 |
GO:0021764 |
amygdala development(GO:0021764) |
| 0.2 |
0.3 |
GO:0090503 |
RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.2 |
1.2 |
GO:0051983 |
regulation of chromosome segregation(GO:0051983) |
| 0.2 |
0.5 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.2 |
0.5 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.2 |
4.7 |
GO:0051304 |
chromosome separation(GO:0051304) |
| 0.1 |
0.1 |
GO:0050869 |
negative regulation of B cell activation(GO:0050869) |
| 0.1 |
0.3 |
GO:0046668 |
regulation of retinal cell programmed cell death(GO:0046668) |
| 0.1 |
13.8 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.1 |
0.4 |
GO:0090269 |
fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.1 |
0.1 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.1 |
1.9 |
GO:0032392 |
DNA geometric change(GO:0032392) |
| 0.1 |
0.1 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 |
0.1 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.1 |
1.5 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.1 |
0.7 |
GO:0030540 |
female genitalia development(GO:0030540) |
| 0.1 |
0.1 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 |
1.6 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 |
2.1 |
GO:1901224 |
positive regulation of NIK/NF-kappaB signaling(GO:1901224) |
| 0.1 |
1.6 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 |
0.7 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 |
0.9 |
GO:0015677 |
copper ion import(GO:0015677) |
| 0.1 |
0.6 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 |
1.9 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
0.3 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 |
0.3 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.1 |
1.5 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.1 |
0.4 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 |
1.3 |
GO:0031643 |
positive regulation of myelination(GO:0031643) |
| 0.1 |
1.8 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.1 |
0.9 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 |
1.0 |
GO:0018195 |
peptidyl-arginine modification(GO:0018195) |
| 0.1 |
0.4 |
GO:0030202 |
heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
| 0.1 |
0.6 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.1 |
0.9 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.1 |
0.7 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.1 |
0.6 |
GO:0038065 |
collagen-activated signaling pathway(GO:0038065) |
| 0.1 |
1.4 |
GO:0046697 |
decidualization(GO:0046697) |
| 0.1 |
2.0 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
2.1 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.1 |
0.1 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 |
0.3 |
GO:0042640 |
anagen(GO:0042640) |
| 0.1 |
0.6 |
GO:0035948 |
positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.1 |
0.3 |
GO:0003148 |
outflow tract septum morphogenesis(GO:0003148) |
| 0.1 |
0.1 |
GO:0045091 |
regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
| 0.1 |
1.1 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 |
0.1 |
GO:0090177 |
establishment of planar polarity involved in neural tube closure(GO:0090177) |
| 0.1 |
0.1 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.1 |
1.3 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.1 |
0.8 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.1 |
0.3 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
0.1 |
GO:0030575 |
nuclear body organization(GO:0030575) |
| 0.1 |
0.7 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.1 |
0.4 |
GO:0003215 |
cardiac right ventricle morphogenesis(GO:0003215) |
| 0.1 |
1.0 |
GO:0098754 |
detoxification(GO:0098754) cellular detoxification(GO:1990748) |
| 0.1 |
0.6 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.1 |
0.4 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 0.1 |
0.4 |
GO:0001827 |
inner cell mass cell fate commitment(GO:0001827) |
| 0.1 |
1.5 |
GO:0007530 |
sex determination(GO:0007530) |
| 0.1 |
0.1 |
GO:0006041 |
glucosamine metabolic process(GO:0006041) |
| 0.1 |
0.4 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 |
0.1 |
GO:0034392 |
negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.1 |
0.7 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.1 |
1.2 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.1 |
0.1 |
GO:0031943 |
regulation of glucocorticoid metabolic process(GO:0031943) |
| 0.1 |
0.1 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.1 |
0.9 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 |
0.5 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.1 |
0.8 |
GO:1902914 |
regulation of protein polyubiquitination(GO:1902914) positive regulation of protein polyubiquitination(GO:1902916) |
| 0.1 |
0.8 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.1 |
2.3 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.1 |
0.8 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.1 |
1.7 |
GO:0007492 |
endoderm development(GO:0007492) |
| 0.1 |
0.9 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.1 |
0.4 |
GO:0009644 |
response to high light intensity(GO:0009644) |
| 0.1 |
0.5 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.1 |
0.8 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.1 |
2.2 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.1 |
0.5 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.1 |
1.0 |
GO:0006490 |
oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.1 |
0.3 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 0.1 |
0.6 |
GO:0044829 |
modulation by host of viral genome replication(GO:0044827) positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 |
0.8 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.1 |
0.4 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.1 |
0.3 |
GO:0035405 |
histone-threonine phosphorylation(GO:0035405) |
| 0.1 |
0.7 |
GO:0090022 |
regulation of neutrophil chemotaxis(GO:0090022) |
| 0.1 |
0.5 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.1 |
1.6 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.1 |
0.7 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.1 |
0.6 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.1 |
0.4 |
GO:0048745 |
smooth muscle tissue development(GO:0048745) |
| 0.1 |
2.6 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.1 |
0.6 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 |
0.4 |
GO:0046689 |
response to mercury ion(GO:0046689) |
| 0.1 |
0.1 |
GO:0002902 |
regulation of B cell apoptotic process(GO:0002902) |
| 0.1 |
0.4 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 |
0.4 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 |
1.8 |
GO:0001658 |
branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.1 |
0.2 |
GO:0016445 |
somatic diversification of immunoglobulins(GO:0016445) |
| 0.1 |
0.4 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.1 |
0.2 |
GO:1901550 |
regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.1 |
0.4 |
GO:1903061 |
regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.1 |
0.4 |
GO:0021592 |
fourth ventricle development(GO:0021592) |
| 0.1 |
1.0 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.1 |
0.6 |
GO:0045187 |
regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.1 |
0.5 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 |
1.1 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.1 |
1.2 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 |
0.5 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 |
1.3 |
GO:0033194 |
response to hydroperoxide(GO:0033194) |
| 0.1 |
0.2 |
GO:0006591 |
ornithine metabolic process(GO:0006591) |
| 0.1 |
0.2 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.1 |
1.1 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.1 |
0.5 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.1 |
0.2 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.1 |
0.1 |
GO:0045989 |
positive regulation of striated muscle contraction(GO:0045989) |
| 0.1 |
0.4 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.1 |
0.6 |
GO:0061029 |
eyelid development in camera-type eye(GO:0061029) |
| 0.1 |
0.3 |
GO:0045616 |
regulation of keratinocyte differentiation(GO:0045616) |
| 0.1 |
0.3 |
GO:2000370 |
positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.1 |
0.5 |
GO:1901301 |
regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 |
1.1 |
GO:0015884 |
folic acid transport(GO:0015884) |
| 0.1 |
0.5 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 |
0.3 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 |
0.1 |
GO:1903204 |
negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.1 |
0.6 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.1 |
0.8 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.1 |
0.5 |
GO:1903288 |
regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
| 0.1 |
3.7 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.1 |
1.0 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.1 |
0.6 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.1 |
0.4 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 |
0.2 |
GO:0060352 |
cell adhesion molecule production(GO:0060352) |
| 0.1 |
0.9 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.1 |
0.1 |
GO:0030950 |
establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 |
1.5 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 |
0.4 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.1 |
0.5 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 |
0.4 |
GO:1900364 |
regulation of mRNA polyadenylation(GO:1900363) negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 |
1.1 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.1 |
0.2 |
GO:0034384 |
high-density lipoprotein particle clearance(GO:0034384) |
| 0.1 |
1.4 |
GO:0010388 |
protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.1 |
0.3 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.1 |
1.4 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.1 |
0.2 |
GO:0007494 |
midgut development(GO:0007494) |
| 0.1 |
0.1 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.1 |
0.1 |
GO:0009193 |
pyrimidine ribonucleoside diphosphate metabolic process(GO:0009193) UDP metabolic process(GO:0046048) |
| 0.1 |
2.8 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.1 |
0.3 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.1 |
0.1 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.1 |
1.4 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.1 |
0.4 |
GO:0071025 |
RNA surveillance(GO:0071025) |
| 0.1 |
0.4 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.1 |
0.2 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.1 |
0.6 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 |
0.3 |
GO:0002532 |
production of molecular mediator involved in inflammatory response(GO:0002532) |
| 0.1 |
1.3 |
GO:0060351 |
cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.1 |
0.5 |
GO:0070126 |
mitochondrial translational termination(GO:0070126) |
| 0.1 |
3.7 |
GO:0007498 |
mesoderm development(GO:0007498) |
| 0.1 |
0.1 |
GO:0070229 |
negative regulation of lymphocyte apoptotic process(GO:0070229) |
| 0.1 |
0.3 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.1 |
0.5 |
GO:0002467 |
germinal center formation(GO:0002467) |
| 0.1 |
2.1 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.1 |
0.1 |
GO:0060147 |
regulation of posttranscriptional gene silencing(GO:0060147) regulation of gene silencing by RNA(GO:0060966) |
| 0.1 |
2.6 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.1 |
0.4 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.1 |
0.2 |
GO:0051897 |
positive regulation of protein kinase B signaling(GO:0051897) |
| 0.1 |
0.2 |
GO:0010890 |
positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.1 |
1.6 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.1 |
0.3 |
GO:0070120 |
ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.1 |
0.9 |
GO:0021670 |
lateral ventricle development(GO:0021670) |
| 0.1 |
0.9 |
GO:0045722 |
positive regulation of gluconeogenesis(GO:0045722) |
| 0.1 |
0.7 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
0.1 |
GO:0033523 |
histone H2B ubiquitination(GO:0033523) |
| 0.1 |
0.8 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.1 |
0.6 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.1 |
0.5 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.1 |
1.9 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.1 |
0.2 |
GO:0045933 |
positive regulation of muscle contraction(GO:0045933) |
| 0.1 |
0.1 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 0.1 |
0.3 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.1 |
0.5 |
GO:0060903 |
regulation of meiosis I(GO:0060631) positive regulation of meiosis I(GO:0060903) |
| 0.1 |
0.6 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.1 |
0.8 |
GO:1900038 |
negative regulation of cellular response to hypoxia(GO:1900038) |
| 0.1 |
1.4 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.1 |
0.4 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.1 |
0.2 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.1 |
0.7 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 |
0.2 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.1 |
0.9 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.1 |
0.7 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 0.1 |
0.3 |
GO:0048730 |
epidermis morphogenesis(GO:0048730) |
| 0.1 |
0.5 |
GO:0003170 |
heart valve development(GO:0003170) |
| 0.1 |
0.2 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.1 |
0.2 |
GO:0035790 |
platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.1 |
0.4 |
GO:0043501 |
skeletal muscle adaptation(GO:0043501) |
| 0.1 |
1.9 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.1 |
0.1 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.1 |
0.3 |
GO:0000070 |
mitotic sister chromatid segregation(GO:0000070) |
| 0.1 |
1.8 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.1 |
0.6 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.1 |
0.5 |
GO:0021559 |
trigeminal nerve development(GO:0021559) |
| 0.1 |
1.0 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.1 |
1.4 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.9 |
GO:0051443 |
positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.1 |
0.6 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.1 |
1.0 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.1 |
1.0 |
GO:0048844 |
artery morphogenesis(GO:0048844) |
| 0.1 |
0.3 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
4.4 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.1 |
0.3 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 |
1.5 |
GO:0045747 |
positive regulation of Notch signaling pathway(GO:0045747) |
| 0.1 |
0.5 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.1 |
0.1 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 |
0.9 |
GO:2001256 |
regulation of store-operated calcium entry(GO:2001256) |
| 0.1 |
0.5 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.1 |
0.5 |
GO:0031954 |
positive regulation of protein autophosphorylation(GO:0031954) |
| 0.1 |
0.2 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.1 |
0.4 |
GO:0060065 |
uterus development(GO:0060065) |
| 0.1 |
2.4 |
GO:0008584 |
male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.1 |
0.8 |
GO:0002329 |
immature B cell differentiation(GO:0002327) pre-B cell differentiation(GO:0002329) |
| 0.1 |
0.2 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.1 |
0.5 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.1 |
0.4 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 |
0.2 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.1 |
2.1 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.3 |
GO:1903975 |
regulation of glial cell migration(GO:1903975) |
| 0.1 |
0.1 |
GO:0045350 |
interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) |
| 0.1 |
0.2 |
GO:0045939 |
negative regulation of steroid biosynthetic process(GO:0010894) negative regulation of hormone metabolic process(GO:0032351) negative regulation of hormone biosynthetic process(GO:0032353) negative regulation of steroid metabolic process(GO:0045939) |
| 0.1 |
5.0 |
GO:0006073 |
glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
| 0.1 |
0.2 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.1 |
0.6 |
GO:0009048 |
dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 |
0.8 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.1 |
0.2 |
GO:0002639 |
positive regulation of immunoglobulin production(GO:0002639) |
| 0.1 |
0.2 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.1 |
2.0 |
GO:0018345 |
protein palmitoylation(GO:0018345) |
| 0.1 |
0.2 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 |
0.2 |
GO:0043486 |
histone exchange(GO:0043486) |
| 0.1 |
0.2 |
GO:0060948 |
cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.1 |
0.2 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.1 |
0.7 |
GO:0071281 |
cellular response to iron ion(GO:0071281) |
| 0.1 |
0.2 |
GO:0015793 |
glycerol transport(GO:0015793) |
| 0.1 |
0.2 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 |
1.0 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.1 |
0.8 |
GO:0044030 |
regulation of DNA methylation(GO:0044030) |
| 0.1 |
0.3 |
GO:0046040 |
IMP metabolic process(GO:0046040) |
| 0.1 |
1.0 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.1 |
0.1 |
GO:0048635 |
negative regulation of muscle organ development(GO:0048635) |
| 0.1 |
0.1 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.1 |
0.1 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.1 |
0.1 |
GO:0030183 |
B cell differentiation(GO:0030183) |
| 0.1 |
0.2 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 |
0.9 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.1 |
0.5 |
GO:0010592 |
positive regulation of lamellipodium assembly(GO:0010592) |
| 0.1 |
0.1 |
GO:0032799 |
low-density lipoprotein receptor particle metabolic process(GO:0032799) low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.1 |
0.1 |
GO:1900117 |
regulation of execution phase of apoptosis(GO:1900117) |
| 0.1 |
0.1 |
GO:0042537 |
benzene-containing compound metabolic process(GO:0042537) |
| 0.1 |
0.1 |
GO:2000646 |
positive regulation of receptor catabolic process(GO:2000646) |
| 0.1 |
0.5 |
GO:0046349 |
amino sugar biosynthetic process(GO:0046349) |
| 0.1 |
0.6 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.1 |
0.2 |
GO:0060339 |
negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.1 |
0.7 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.1 |
0.1 |
GO:0030656 |
regulation of vitamin metabolic process(GO:0030656) |
| 0.1 |
0.1 |
GO:0033692 |
cellular polysaccharide biosynthetic process(GO:0033692) |
| 0.1 |
0.2 |
GO:0021691 |
cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.1 |
1.4 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.1 |
3.1 |
GO:0000245 |
spliceosomal complex assembly(GO:0000245) |
| 0.1 |
0.2 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.1 |
0.1 |
GO:0033206 |
meiotic cytokinesis(GO:0033206) |
| 0.1 |
0.1 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.1 |
0.1 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 |
0.3 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.1 |
1.0 |
GO:0033962 |
cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.1 |
0.1 |
GO:0070944 |
neutrophil mediated killing of bacterium(GO:0070944) |
| 0.1 |
0.2 |
GO:0038089 |
positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) protein kinase D signaling(GO:0089700) |
| 0.1 |
0.2 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 |
0.7 |
GO:0030201 |
heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.1 |
0.3 |
GO:0001946 |
lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 0.1 |
1.5 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.1 |
0.3 |
GO:0055088 |
lipid homeostasis(GO:0055088) |
| 0.1 |
1.0 |
GO:0046855 |
phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 |
0.2 |
GO:0071360 |
cellular response to exogenous dsRNA(GO:0071360) |
| 0.1 |
2.5 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.1 |
0.3 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.1 |
0.2 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 |
0.1 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.1 |
0.1 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 |
0.2 |
GO:0018008 |
N-terminal peptidyl-glycine N-myristoylation(GO:0018008) peptidyl-glycine modification(GO:0018201) |
| 0.1 |
0.3 |
GO:0046487 |
glyoxylate metabolic process(GO:0046487) |
| 0.1 |
0.3 |
GO:0010389 |
regulation of G2/M transition of mitotic cell cycle(GO:0010389) |
| 0.1 |
0.4 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.1 |
3.0 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.1 |
GO:0014012 |
peripheral nervous system axon regeneration(GO:0014012) |
| 0.1 |
1.1 |
GO:0034260 |
negative regulation of GTPase activity(GO:0034260) |
| 0.1 |
0.2 |
GO:0060613 |
fat pad development(GO:0060613) |
| 0.1 |
0.2 |
GO:0071044 |
histone mRNA catabolic process(GO:0071044) |
| 0.1 |
0.6 |
GO:0042542 |
response to hydrogen peroxide(GO:0042542) |
| 0.1 |
0.1 |
GO:0043619 |
regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.1 |
0.4 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 |
3.9 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.1 |
0.1 |
GO:0033860 |
regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.1 |
0.9 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.1 |
1.6 |
GO:0071482 |
cellular response to light stimulus(GO:0071482) |
| 0.1 |
0.1 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 |
0.1 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.1 |
1.3 |
GO:0046660 |
female sex differentiation(GO:0046660) |
| 0.1 |
0.7 |
GO:0032527 |
protein exit from endoplasmic reticulum(GO:0032527) |
| 0.1 |
0.1 |
GO:0072674 |
regulation of macrophage fusion(GO:0034239) positive regulation of macrophage fusion(GO:0034241) multinuclear osteoclast differentiation(GO:0072674) regulation of osteoclast proliferation(GO:0090289) |
| 0.1 |
0.1 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.1 |
0.5 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 |
0.2 |
GO:0031666 |
positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.1 |
0.1 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.1 |
0.2 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.1 |
0.4 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.1 |
0.5 |
GO:0001890 |
placenta development(GO:0001890) |
| 0.1 |
0.1 |
GO:0043278 |
response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.1 |
0.7 |
GO:0006366 |
transcription from RNA polymerase II promoter(GO:0006366) |
| 0.1 |
0.5 |
GO:0046485 |
ether lipid metabolic process(GO:0046485) |
| 0.1 |
0.3 |
GO:0019254 |
carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.1 |
0.2 |
GO:1902950 |
regulation of dendritic spine maintenance(GO:1902950) positive regulation of dendritic spine maintenance(GO:1902952) |
| 0.1 |
0.1 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.1 |
1.2 |
GO:0006101 |
citrate metabolic process(GO:0006101) |
| 0.1 |
0.2 |
GO:0015819 |
lysine transport(GO:0015819) |
| 0.1 |
0.3 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.1 |
0.3 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.1 |
0.5 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 0.1 |
1.6 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.1 |
0.2 |
GO:0060075 |
regulation of resting membrane potential(GO:0060075) |
| 0.1 |
0.8 |
GO:0019216 |
regulation of lipid metabolic process(GO:0019216) |
| 0.1 |
2.0 |
GO:0006505 |
GPI anchor metabolic process(GO:0006505) GPI anchor biosynthetic process(GO:0006506) |
| 0.1 |
0.8 |
GO:0042059 |
negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.1 |
1.4 |
GO:0001895 |
retina homeostasis(GO:0001895) |
| 0.1 |
0.2 |
GO:0055090 |
acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.1 |
0.2 |
GO:0060768 |
epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 |
0.3 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.1 |
0.3 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.1 |
0.9 |
GO:0010171 |
body morphogenesis(GO:0010171) |
| 0.1 |
0.3 |
GO:1903069 |
regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
| 0.1 |
0.2 |
GO:0019731 |
antibacterial humoral response(GO:0019731) |
| 0.1 |
0.2 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.1 |
0.6 |
GO:1990173 |
protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.1 |
0.1 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.1 |
0.1 |
GO:0046618 |
drug export(GO:0046618) |
| 0.1 |
0.3 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.1 |
0.2 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 |
0.1 |
GO:0071356 |
cellular response to tumor necrosis factor(GO:0071356) |
| 0.1 |
0.2 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.1 |
0.9 |
GO:0050818 |
regulation of coagulation(GO:0050818) |
| 0.1 |
0.2 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
0.2 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.1 |
0.1 |
GO:0001866 |
NK T cell proliferation(GO:0001866) |
| 0.1 |
0.4 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.1 |
0.8 |
GO:0031122 |
cytoplasmic microtubule organization(GO:0031122) |
| 0.1 |
0.1 |
GO:0072610 |
interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.1 |
0.4 |
GO:0042136 |
neurotransmitter biosynthetic process(GO:0042136) |
| 0.1 |
0.8 |
GO:0046039 |
GTP metabolic process(GO:0046039) |
| 0.1 |
0.1 |
GO:0010824 |
regulation of centrosome duplication(GO:0010824) |
| 0.0 |
0.4 |
GO:0009299 |
mRNA transcription(GO:0009299) |
| 0.0 |
0.1 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.0 |
0.0 |
GO:0072074 |
kidney mesenchyme development(GO:0072074) |
| 0.0 |
0.3 |
GO:0001996 |
regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) regulation of heart rate by chemical signal(GO:0003062) positive regulation of blood pressure by epinephrine-norepinephrine(GO:0003321) |
| 0.0 |
0.2 |
GO:0014824 |
artery smooth muscle contraction(GO:0014824) |
| 0.0 |
0.9 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.0 |
3.3 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.0 |
0.1 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 0.0 |
0.2 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.0 |
0.3 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 |
0.3 |
GO:0002361 |
CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.0 |
0.3 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 |
0.1 |
GO:0032594 |
protein transport within lipid bilayer(GO:0032594) |
| 0.0 |
0.5 |
GO:1901222 |
regulation of NIK/NF-kappaB signaling(GO:1901222) |
| 0.0 |
0.9 |
GO:2000573 |
positive regulation of DNA biosynthetic process(GO:2000573) |
| 0.0 |
0.0 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.0 |
0.1 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.0 |
1.3 |
GO:0002224 |
toll-like receptor signaling pathway(GO:0002224) |
| 0.0 |
0.4 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.0 |
0.1 |
GO:0033240 |
positive regulation of cellular amine metabolic process(GO:0033240) |
| 0.0 |
0.3 |
GO:0035025 |
positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 |
0.2 |
GO:0019471 |
4-hydroxyproline metabolic process(GO:0019471) |
| 0.0 |
0.1 |
GO:0000291 |
nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.0 |
0.1 |
GO:0046716 |
muscle cell cellular homeostasis(GO:0046716) |
| 0.0 |
0.3 |
GO:0034312 |
diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.0 |
0.1 |
GO:0000466 |
exonucleolytic trimming involved in rRNA processing(GO:0000459) maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) ncRNA 3'-end processing(GO:0043628) |
| 0.0 |
0.1 |
GO:0000271 |
polysaccharide biosynthetic process(GO:0000271) |
| 0.0 |
0.3 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 |
0.6 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.0 |
0.5 |
GO:0043488 |
regulation of mRNA stability(GO:0043488) |
| 0.0 |
0.3 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 |
0.5 |
GO:0006220 |
pyrimidine nucleotide metabolic process(GO:0006220) |
| 0.0 |
0.3 |
GO:0034315 |
regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 |
0.5 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.0 |
0.2 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.0 |
0.2 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 0.0 |
0.1 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.0 |
0.4 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.0 |
0.3 |
GO:0061502 |
early endosome to recycling endosome transport(GO:0061502) |
| 0.0 |
0.0 |
GO:0042100 |
B cell proliferation(GO:0042100) |
| 0.0 |
0.0 |
GO:0032649 |
regulation of interferon-gamma production(GO:0032649) positive regulation of interferon-gamma production(GO:0032729) |
| 0.0 |
0.1 |
GO:0006867 |
asparagine transport(GO:0006867) glutamine transport(GO:0006868) |
| 0.0 |
0.0 |
GO:0016246 |
RNA interference(GO:0016246) |
| 0.0 |
0.1 |
GO:0036233 |
glycine import(GO:0036233) |
| 0.0 |
0.1 |
GO:0046835 |
carbohydrate phosphorylation(GO:0046835) |
| 0.0 |
0.6 |
GO:0032784 |
regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.0 |
0.3 |
GO:0043525 |
positive regulation of neuron apoptotic process(GO:0043525) |
| 0.0 |
0.7 |
GO:0007368 |
determination of left/right symmetry(GO:0007368) |
| 0.0 |
0.2 |
GO:0060055 |
angiogenesis involved in wound healing(GO:0060055) |
| 0.0 |
0.2 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.0 |
0.0 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) |
| 0.0 |
0.1 |
GO:0080182 |
histone H3-K4 trimethylation(GO:0080182) |
| 0.0 |
0.1 |
GO:0033119 |
negative regulation of RNA splicing(GO:0033119) |
| 0.0 |
0.1 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.0 |
0.1 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.0 |
0.8 |
GO:0030835 |
negative regulation of actin filament depolymerization(GO:0030835) |
| 0.0 |
0.1 |
GO:0060338 |
regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.0 |
0.1 |
GO:0042275 |
error-free postreplication DNA repair(GO:0042275) |
| 0.0 |
0.1 |
GO:1903312 |
negative regulation of mRNA metabolic process(GO:1903312) |
| 0.0 |
0.6 |
GO:0006919 |
activation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0006919) |
| 0.0 |
0.1 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.0 |
0.2 |
GO:0035886 |
vascular smooth muscle cell differentiation(GO:0035886) |
| 0.0 |
0.7 |
GO:0030521 |
androgen receptor signaling pathway(GO:0030521) |
| 0.0 |
0.1 |
GO:0001702 |
gastrulation with mouth forming second(GO:0001702) |
| 0.0 |
0.6 |
GO:0016575 |
histone deacetylation(GO:0016575) |
| 0.0 |
0.2 |
GO:0021854 |
hypothalamus development(GO:0021854) |
| 0.0 |
0.0 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.0 |
0.1 |
GO:0071267 |
amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.0 |
0.0 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.0 |
1.5 |
GO:0030097 |
hemopoiesis(GO:0030097) |
| 0.0 |
0.1 |
GO:0033632 |
regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.0 |
0.1 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 |
0.5 |
GO:0042633 |
molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.0 |
0.3 |
GO:0006378 |
mRNA polyadenylation(GO:0006378) |
| 0.0 |
0.1 |
GO:2000680 |
regulation of rubidium ion transport(GO:2000680) |
| 0.0 |
0.1 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.0 |
0.1 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.0 |
0.1 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.0 |
0.1 |
GO:0010800 |
positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 |
0.1 |
GO:0046460 |
triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 0.0 |
0.1 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.0 |
0.1 |
GO:0030262 |
cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
| 0.0 |
0.1 |
GO:0006026 |
aminoglycan catabolic process(GO:0006026) glycosaminoglycan catabolic process(GO:0006027) |
| 0.0 |
0.3 |
GO:0071300 |
cellular response to retinoic acid(GO:0071300) |
| 0.0 |
0.2 |
GO:0030322 |
stabilization of membrane potential(GO:0030322) |
| 0.0 |
0.3 |
GO:0035335 |
peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.0 |
0.1 |
GO:0090005 |
negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.0 |
0.2 |
GO:0046329 |
negative regulation of JNK cascade(GO:0046329) |
| 0.0 |
0.1 |
GO:0090181 |
regulation of cholesterol metabolic process(GO:0090181) |
| 0.0 |
0.1 |
GO:0050884 |
neuromuscular process controlling posture(GO:0050884) |
| 0.0 |
0.1 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 |
0.1 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.0 |
0.1 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.0 |
0.1 |
GO:0030813 |
positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.0 |
0.5 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.0 |
0.2 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.0 |
0.0 |
GO:0019400 |
alditol metabolic process(GO:0019400) |
| 0.0 |
0.0 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.0 |
0.1 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 |
0.1 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.0 |
0.1 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.0 |
0.0 |
GO:2000170 |
positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.0 |
0.0 |
GO:0031077 |
post-embryonic camera-type eye development(GO:0031077) |
| 0.0 |
0.0 |
GO:0031133 |
regulation of axon diameter(GO:0031133) |
| 0.0 |
0.0 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.0 |
3.9 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.0 |
0.0 |
GO:0003351 |
epithelial cilium movement(GO:0003351) |
| 0.0 |
0.1 |
GO:0016446 |
somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 |
0.1 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.0 |
0.1 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 |
0.3 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 |
0.1 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 0.0 |
0.1 |
GO:1903352 |
ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
| 0.0 |
0.1 |
GO:0090151 |
establishment of protein localization to mitochondrial membrane(GO:0090151) |
| 0.0 |
0.1 |
GO:0019886 |
antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.0 |
0.3 |
GO:0015936 |
coenzyme A metabolic process(GO:0015936) |
| 0.0 |
0.1 |
GO:0010761 |
fibroblast migration(GO:0010761) |
| 0.0 |
0.0 |
GO:0014068 |
positive regulation of phosphatidylinositol 3-kinase signaling(GO:0014068) |
| 0.0 |
0.0 |
GO:0044034 |
negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 |
1.6 |
GO:0060271 |
cilium morphogenesis(GO:0060271) |
| 0.0 |
0.1 |
GO:0001516 |
prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.0 |
0.0 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 |
0.1 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.0 |
0.1 |
GO:0090344 |
negative regulation of cell aging(GO:0090344) |
| 0.0 |
0.0 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.0 |
0.1 |
GO:0038032 |
termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.0 |
0.1 |
GO:0009263 |
deoxyribonucleotide biosynthetic process(GO:0009263) |
| 0.0 |
0.1 |
GO:0061083 |
regulation of protein refolding(GO:0061083) |
| 0.0 |
0.0 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 |
0.1 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 |
0.0 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.0 |
0.2 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.0 |
0.1 |
GO:0036037 |
CD8-positive, alpha-beta T cell activation(GO:0036037) |
| 0.0 |
0.9 |
GO:0002244 |
hematopoietic progenitor cell differentiation(GO:0002244) |
| 0.0 |
0.1 |
GO:0042416 |
dopamine biosynthetic process(GO:0042416) |
| 0.0 |
0.1 |
GO:0046628 |
positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.0 |
0.1 |
GO:0006301 |
postreplication repair(GO:0006301) |
| 0.0 |
0.0 |
GO:0046381 |
CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.0 |
0.9 |
GO:0007030 |
Golgi organization(GO:0007030) |
| 0.0 |
0.2 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.0 |
0.5 |
GO:0030032 |
lamellipodium assembly(GO:0030032) |
| 0.0 |
0.4 |
GO:0007286 |
spermatid development(GO:0007286) |
| 0.0 |
0.1 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.0 |
0.2 |
GO:0043550 |
regulation of lipid kinase activity(GO:0043550) |
