| 1.8 |
5.4 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 1.6 |
6.4 |
GO:0048319 |
axial mesoderm morphogenesis(GO:0048319) |
| 1.3 |
3.9 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 1.3 |
5.2 |
GO:0060375 |
regulation of mast cell differentiation(GO:0060375) |
| 1.3 |
3.8 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 1.2 |
5.0 |
GO:0086069 |
bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 1.2 |
3.6 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 1.2 |
3.5 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 1.2 |
2.3 |
GO:0060129 |
thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 1.1 |
2.3 |
GO:0061054 |
dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 1.1 |
3.4 |
GO:0072138 |
mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) |
| 1.0 |
3.0 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 1.0 |
3.0 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.9 |
4.7 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.9 |
3.7 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.9 |
2.8 |
GO:2000744 |
anterior head development(GO:0097065) regulation of anterior head development(GO:2000742) positive regulation of anterior head development(GO:2000744) |
| 0.9 |
7.3 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.9 |
4.4 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 0.9 |
4.3 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.8 |
3.3 |
GO:0090035 |
regulation of chaperone-mediated protein complex assembly(GO:0090034) positive regulation of chaperone-mediated protein complex assembly(GO:0090035) |
| 0.8 |
3.3 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.8 |
2.5 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.8 |
2.5 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.8 |
0.8 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.8 |
3.3 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.8 |
3.2 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.8 |
4.7 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.8 |
3.9 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.8 |
2.3 |
GO:0051902 |
negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.7 |
2.2 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.7 |
3.6 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.7 |
1.4 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 0.7 |
2.1 |
GO:0043096 |
purine nucleobase salvage(GO:0043096) |
| 0.7 |
2.1 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.7 |
0.7 |
GO:0072204 |
cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.7 |
5.5 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
| 0.7 |
2.7 |
GO:0010387 |
COP9 signalosome assembly(GO:0010387) |
| 0.7 |
2.0 |
GO:2001206 |
positive regulation of osteoclast development(GO:2001206) |
| 0.7 |
2.7 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 0.7 |
3.3 |
GO:0015705 |
iodide transport(GO:0015705) |
| 0.7 |
0.7 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.6 |
2.6 |
GO:0051582 |
positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.6 |
6.8 |
GO:0001977 |
renal system process involved in regulation of blood volume(GO:0001977) |
| 0.6 |
0.6 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 0.6 |
3.1 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.6 |
4.3 |
GO:0034969 |
histone arginine methylation(GO:0034969) |
| 0.6 |
0.6 |
GO:0072076 |
pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) nephrogenic mesenchyme development(GO:0072076) |
| 0.6 |
1.8 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.6 |
0.6 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.6 |
4.2 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 0.6 |
1.8 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.6 |
7.0 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.6 |
2.9 |
GO:0003199 |
endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.6 |
1.7 |
GO:0001193 |
maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 0.6 |
0.6 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.6 |
1.7 |
GO:0030421 |
defecation(GO:0030421) |
| 0.6 |
2.2 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.6 |
1.7 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.6 |
4.5 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.6 |
2.2 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.6 |
2.8 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.5 |
1.6 |
GO:0097623 |
potassium ion export across plasma membrane(GO:0097623) |
| 0.5 |
1.6 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.5 |
0.5 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.5 |
2.2 |
GO:0060266 |
negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
| 0.5 |
0.5 |
GO:0072172 |
ureteric bud formation(GO:0060676) mesonephric tubule formation(GO:0072172) |
| 0.5 |
1.6 |
GO:0002176 |
male germ cell proliferation(GO:0002176) |
| 0.5 |
1.6 |
GO:0060364 |
frontal suture morphogenesis(GO:0060364) |
| 0.5 |
3.7 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.5 |
0.5 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.5 |
1.6 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.5 |
1.6 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.5 |
2.6 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.5 |
2.1 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.5 |
1.5 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.5 |
2.0 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.5 |
1.5 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.5 |
1.0 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.5 |
1.5 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.5 |
6.9 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.5 |
2.9 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.5 |
1.5 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.5 |
1.9 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 0.5 |
2.4 |
GO:0019659 |
glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.5 |
1.0 |
GO:0002669 |
positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.5 |
3.3 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 0.5 |
0.9 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.5 |
1.4 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 0.5 |
1.4 |
GO:2000097 |
regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.5 |
0.5 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.5 |
1.4 |
GO:1902396 |
protein localization to bicellular tight junction(GO:1902396) |
| 0.5 |
0.5 |
GO:2000546 |
positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.5 |
0.9 |
GO:0003100 |
regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.5 |
1.4 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 0.5 |
0.9 |
GO:1904058 |
positive regulation of sensory perception of pain(GO:1904058) |
| 0.4 |
1.3 |
GO:0008582 |
regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.4 |
6.7 |
GO:0048387 |
negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.4 |
1.3 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 0.4 |
1.3 |
GO:1901675 |
negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.4 |
1.8 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.4 |
2.6 |
GO:0098838 |
reduced folate transmembrane transport(GO:0098838) |
| 0.4 |
0.4 |
GO:0032275 |
luteinizing hormone secretion(GO:0032275) |
| 0.4 |
0.4 |
GO:1901187 |
regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.4 |
1.3 |
GO:1900158 |
negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 0.4 |
1.3 |
GO:0000087 |
mitotic M phase(GO:0000087) |
| 0.4 |
1.7 |
GO:0072369 |
regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.4 |
1.7 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.4 |
2.1 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.4 |
5.1 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.4 |
2.1 |
GO:0030423 |
targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.4 |
1.7 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.4 |
3.7 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.4 |
1.2 |
GO:0060084 |
synaptic transmission involved in micturition(GO:0060084) |
| 0.4 |
1.2 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.4 |
2.5 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) |
| 0.4 |
0.4 |
GO:0048730 |
epidermis morphogenesis(GO:0048730) |
| 0.4 |
1.7 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.4 |
2.1 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.4 |
0.4 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.4 |
0.4 |
GO:0000821 |
regulation of arginine metabolic process(GO:0000821) |
| 0.4 |
1.2 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.4 |
2.8 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.4 |
0.8 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 0.4 |
1.2 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.4 |
1.2 |
GO:0010989 |
negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.4 |
4.4 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.4 |
3.6 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.4 |
1.2 |
GO:0032747 |
positive regulation of interleukin-23 production(GO:0032747) |
| 0.4 |
0.4 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.4 |
1.2 |
GO:2000484 |
positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.4 |
0.4 |
GO:0010911 |
regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.4 |
0.4 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.4 |
1.5 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.4 |
2.3 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.4 |
2.3 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.4 |
2.3 |
GO:2000392 |
regulation of lamellipodium morphogenesis(GO:2000392) |
| 0.4 |
1.1 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.4 |
0.8 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.4 |
1.5 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.4 |
2.6 |
GO:0090170 |
regulation of Golgi inheritance(GO:0090170) |
| 0.4 |
1.9 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.4 |
1.8 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.4 |
1.1 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.4 |
1.1 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.4 |
1.1 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.4 |
1.1 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.4 |
0.7 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.4 |
2.5 |
GO:0060696 |
regulation of phospholipid catabolic process(GO:0060696) |
| 0.4 |
3.3 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.4 |
1.1 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.4 |
1.4 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.4 |
1.1 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.4 |
1.1 |
GO:0032792 |
negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.4 |
1.1 |
GO:1901536 |
regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.4 |
2.1 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.4 |
1.1 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.4 |
0.4 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.3 |
3.5 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.3 |
0.3 |
GO:2000823 |
regulation of androgen receptor activity(GO:2000823) |
| 0.3 |
0.3 |
GO:0050819 |
negative regulation of coagulation(GO:0050819) |
| 0.3 |
2.4 |
GO:2001199 |
negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.3 |
2.4 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.3 |
3.8 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 0.3 |
0.7 |
GO:0035617 |
ribonucleoprotein complex disassembly(GO:0032988) stress granule disassembly(GO:0035617) |
| 0.3 |
1.4 |
GO:2000774 |
positive regulation of cellular senescence(GO:2000774) |
| 0.3 |
0.3 |
GO:0060744 |
thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.3 |
1.0 |
GO:0010886 |
positive regulation of cholesterol storage(GO:0010886) |
| 0.3 |
1.0 |
GO:1902445 |
regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.3 |
1.0 |
GO:0003273 |
cell migration involved in endocardial cushion formation(GO:0003273) |
| 0.3 |
0.7 |
GO:0043587 |
tongue morphogenesis(GO:0043587) fungiform papilla development(GO:0061196) fungiform papilla morphogenesis(GO:0061197) fungiform papilla formation(GO:0061198) |
| 0.3 |
7.7 |
GO:0006978 |
DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 0.3 |
0.7 |
GO:0014842 |
skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
| 0.3 |
1.3 |
GO:0060709 |
glycogen cell differentiation involved in embryonic placenta development(GO:0060709) |
| 0.3 |
1.0 |
GO:0097278 |
virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) complement-dependent cytotoxicity(GO:0097278) |
| 0.3 |
0.3 |
GO:0010957 |
negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
| 0.3 |
0.3 |
GO:0090305 |
nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
| 0.3 |
1.3 |
GO:0016264 |
gap junction assembly(GO:0016264) |
| 0.3 |
4.6 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.3 |
2.0 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.3 |
0.7 |
GO:0051798 |
positive regulation of hair follicle development(GO:0051798) |
| 0.3 |
1.0 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.3 |
1.6 |
GO:0072539 |
T-helper 17 cell differentiation(GO:0072539) |
| 0.3 |
1.3 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.3 |
0.3 |
GO:1903012 |
positive regulation of bone development(GO:1903012) |
| 0.3 |
1.0 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.3 |
1.0 |
GO:0009153 |
purine deoxyribonucleotide biosynthetic process(GO:0009153) |
| 0.3 |
1.3 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.3 |
1.3 |
GO:0019509 |
L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.3 |
0.6 |
GO:1901492 |
positive regulation of lymphangiogenesis(GO:1901492) |
| 0.3 |
1.3 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.3 |
1.3 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.3 |
1.3 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 0.3 |
1.3 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.3 |
0.3 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.3 |
0.9 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.3 |
2.8 |
GO:2000467 |
positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.3 |
1.6 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 0.3 |
0.9 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.3 |
0.3 |
GO:0042748 |
circadian sleep/wake cycle, non-REM sleep(GO:0042748) |
| 0.3 |
0.9 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) |
| 0.3 |
0.9 |
GO:0042822 |
vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.3 |
0.6 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 0.3 |
0.9 |
GO:0002035 |
brain renin-angiotensin system(GO:0002035) |
| 0.3 |
0.6 |
GO:0009186 |
deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
| 0.3 |
0.6 |
GO:0000050 |
urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.3 |
0.9 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.3 |
0.3 |
GO:0033128 |
negative regulation of histone phosphorylation(GO:0033128) |
| 0.3 |
3.0 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.3 |
1.5 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.3 |
0.9 |
GO:0071680 |
response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.3 |
1.5 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.3 |
1.5 |
GO:0034383 |
low-density lipoprotein particle clearance(GO:0034383) |
| 0.3 |
3.5 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.3 |
1.2 |
GO:0010510 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.3 |
1.2 |
GO:0042447 |
hormone catabolic process(GO:0042447) |
| 0.3 |
1.7 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.3 |
2.0 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.3 |
1.7 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.3 |
3.4 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.3 |
2.3 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.3 |
0.3 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 0.3 |
0.9 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.3 |
0.9 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.3 |
1.1 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.3 |
1.4 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.3 |
1.1 |
GO:0046210 |
nitrate catabolic process(GO:0043602) nitric oxide catabolic process(GO:0046210) cellular organohalogen metabolic process(GO:0090345) cellular organofluorine metabolic process(GO:0090346) |
| 0.3 |
0.3 |
GO:2000468 |
regulation of peroxidase activity(GO:2000468) |
| 0.3 |
0.6 |
GO:0010958 |
regulation of amino acid import(GO:0010958) regulation of L-arginine import(GO:0010963) |
| 0.3 |
0.6 |
GO:0072071 |
mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) pericyte cell differentiation(GO:1904238) |
| 0.3 |
0.6 |
GO:0046668 |
regulation of retinal cell programmed cell death(GO:0046668) |
| 0.3 |
2.5 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.3 |
0.3 |
GO:0072194 |
kidney smooth muscle tissue development(GO:0072194) |
| 0.3 |
0.3 |
GO:0002534 |
cytokine production involved in inflammatory response(GO:0002534) |
| 0.3 |
0.3 |
GO:0006097 |
glyoxylate cycle(GO:0006097) |
| 0.3 |
0.8 |
GO:1901552 |
positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.3 |
1.9 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.3 |
1.6 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.3 |
1.4 |
GO:0016540 |
protein autoprocessing(GO:0016540) |
| 0.3 |
1.9 |
GO:0048050 |
post-embryonic eye morphogenesis(GO:0048050) |
| 0.3 |
2.7 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.3 |
0.8 |
GO:0050779 |
RNA destabilization(GO:0050779) |
| 0.3 |
0.3 |
GO:0002295 |
T-helper cell lineage commitment(GO:0002295) CD4-positive, alpha-beta T cell lineage commitment(GO:0043373) |
| 0.3 |
0.5 |
GO:0002765 |
immune response-inhibiting signal transduction(GO:0002765) |
| 0.3 |
2.4 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.3 |
4.8 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.3 |
1.1 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 0.3 |
0.3 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 0.3 |
1.1 |
GO:0008295 |
spermidine biosynthetic process(GO:0008295) |
| 0.3 |
1.1 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.3 |
0.5 |
GO:1901228 |
positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
| 0.3 |
0.8 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.3 |
0.3 |
GO:0046036 |
CTP biosynthetic process(GO:0006241) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
| 0.3 |
3.4 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.3 |
0.3 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.3 |
0.8 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.3 |
1.0 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.3 |
0.5 |
GO:0009162 |
deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.3 |
0.8 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.3 |
0.8 |
GO:0061620 |
glycolytic process through glucose-6-phosphate(GO:0061620) |
| 0.3 |
1.3 |
GO:0031145 |
anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.3 |
2.3 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.3 |
0.3 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.3 |
0.3 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.3 |
8.4 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.3 |
1.0 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.3 |
0.8 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.3 |
1.3 |
GO:0031944 |
negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
| 0.3 |
0.8 |
GO:2000054 |
regulation of centromeric sister chromatid cohesion(GO:0070602) regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 0.3 |
0.8 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.3 |
1.3 |
GO:2000630 |
positive regulation of miRNA metabolic process(GO:2000630) |
| 0.3 |
1.3 |
GO:0086045 |
membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.3 |
1.5 |
GO:0072610 |
interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.3 |
0.5 |
GO:1902714 |
negative regulation of interferon-gamma secretion(GO:1902714) |
| 0.3 |
1.0 |
GO:0010808 |
positive regulation of synaptic vesicle priming(GO:0010808) |
| 0.3 |
0.3 |
GO:0046101 |
hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.2 |
4.7 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.2 |
1.0 |
GO:0065001 |
negative regulation of histone H3-K36 methylation(GO:0000415) specification of axis polarity(GO:0065001) |
| 0.2 |
1.2 |
GO:0001834 |
trophectodermal cell proliferation(GO:0001834) |
| 0.2 |
7.9 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.2 |
2.7 |
GO:1990173 |
protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.2 |
1.2 |
GO:0002536 |
respiratory burst involved in inflammatory response(GO:0002536) |
| 0.2 |
1.0 |
GO:0019388 |
galactose catabolic process(GO:0019388) |
| 0.2 |
1.5 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.2 |
1.9 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.2 |
1.0 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.2 |
8.4 |
GO:0045747 |
positive regulation of Notch signaling pathway(GO:0045747) |
| 0.2 |
0.7 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.2 |
2.6 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.2 |
0.2 |
GO:0001704 |
formation of primary germ layer(GO:0001704) |
| 0.2 |
0.7 |
GO:0071550 |
death-inducing signaling complex assembly(GO:0071550) |
| 0.2 |
0.5 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.2 |
0.2 |
GO:0060423 |
foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) |
| 0.2 |
0.7 |
GO:0042637 |
catagen(GO:0042637) regulation of hair follicle maturation(GO:0048819) regulation of catagen(GO:0051794) |
| 0.2 |
0.2 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.2 |
0.5 |
GO:0050748 |
negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.2 |
0.2 |
GO:0070627 |
ferrous iron import(GO:0070627) |
| 0.2 |
0.5 |
GO:0045472 |
response to ether(GO:0045472) |
| 0.2 |
0.2 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.2 |
0.5 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.2 |
0.9 |
GO:0031509 |
telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
| 0.2 |
0.7 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.2 |
0.2 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.2 |
0.7 |
GO:0009838 |
abscission(GO:0009838) |
| 0.2 |
0.9 |
GO:1900028 |
negative regulation of ruffle assembly(GO:1900028) |
| 0.2 |
0.5 |
GO:0035771 |
interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.2 |
0.2 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.2 |
1.6 |
GO:0061615 |
glycolytic process through fructose-6-phosphate(GO:0061615) |
| 0.2 |
3.2 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.2 |
0.9 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.2 |
0.9 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.2 |
0.7 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.2 |
3.2 |
GO:0060065 |
uterus development(GO:0060065) |
| 0.2 |
1.1 |
GO:0021775 |
smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.2 |
2.7 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.2 |
0.2 |
GO:1905063 |
regulation of vascular smooth muscle cell differentiation(GO:1905063) |
| 0.2 |
0.7 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.2 |
1.1 |
GO:0046135 |
pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.2 |
0.4 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 |
1.1 |
GO:0038032 |
termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.2 |
1.1 |
GO:0019240 |
citrulline biosynthetic process(GO:0019240) |
| 0.2 |
2.0 |
GO:0090043 |
regulation of tubulin deacetylation(GO:0090043) |
| 0.2 |
2.6 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.2 |
0.7 |
GO:0070682 |
proteasome regulatory particle assembly(GO:0070682) |
| 0.2 |
0.7 |
GO:0097401 |
synaptic vesicle lumen acidification(GO:0097401) |
| 0.2 |
0.2 |
GO:0002820 |
negative regulation of adaptive immune response(GO:0002820) |
| 0.2 |
2.0 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.2 |
0.2 |
GO:0070427 |
nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.2 |
1.7 |
GO:0020027 |
hemoglobin metabolic process(GO:0020027) |
| 0.2 |
1.5 |
GO:0032075 |
positive regulation of nuclease activity(GO:0032075) |
| 0.2 |
1.7 |
GO:0060836 |
lymphatic endothelial cell differentiation(GO:0060836) |
| 0.2 |
0.2 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.2 |
0.9 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.2 |
0.2 |
GO:1901033 |
positive regulation of response to reactive oxygen species(GO:1901033) regulation of hydrogen peroxide-mediated programmed cell death(GO:1901298) |
| 0.2 |
0.2 |
GO:0044003 |
modification by symbiont of host morphology or physiology(GO:0044003) |
| 0.2 |
0.9 |
GO:0021670 |
lateral ventricle development(GO:0021670) |
| 0.2 |
0.6 |
GO:1902174 |
positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.2 |
0.6 |
GO:1901731 |
calcium-mediated signaling using extracellular calcium source(GO:0035585) positive regulation of platelet aggregation(GO:1901731) |
| 0.2 |
0.2 |
GO:0072061 |
inner medullary collecting duct development(GO:0072061) |
| 0.2 |
0.8 |
GO:0061052 |
negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
| 0.2 |
1.3 |
GO:0045630 |
positive regulation of T-helper 2 cell differentiation(GO:0045630) |
| 0.2 |
3.0 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.2 |
0.6 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.2 |
2.7 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.2 |
1.1 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 0.2 |
0.4 |
GO:0035461 |
vitamin transmembrane transport(GO:0035461) |
| 0.2 |
1.1 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.2 |
0.4 |
GO:2000987 |
positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.2 |
0.4 |
GO:0010458 |
exit from mitosis(GO:0010458) |
| 0.2 |
2.3 |
GO:0035510 |
DNA dealkylation(GO:0035510) |
| 0.2 |
2.1 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.2 |
2.7 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.2 |
0.2 |
GO:1902302 |
regulation of potassium ion export(GO:1902302) |
| 0.2 |
0.6 |
GO:0019043 |
establishment of viral latency(GO:0019043) |
| 0.2 |
0.6 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.2 |
2.1 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.2 |
0.4 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.2 |
3.5 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.2 |
0.2 |
GO:0097167 |
circadian regulation of translation(GO:0097167) |
| 0.2 |
0.4 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.2 |
1.0 |
GO:0009396 |
folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.2 |
0.8 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.2 |
0.4 |
GO:0000965 |
mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.2 |
1.2 |
GO:0042795 |
snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.2 |
0.4 |
GO:0035880 |
cell proliferation in midbrain(GO:0033278) embryonic nail plate morphogenesis(GO:0035880) |
| 0.2 |
2.4 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.2 |
0.6 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.2 |
0.8 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.2 |
0.4 |
GO:0009113 |
purine nucleobase biosynthetic process(GO:0009113) |
| 0.2 |
0.4 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.2 |
0.8 |
GO:1904529 |
regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.2 |
0.4 |
GO:0060051 |
negative regulation of protein glycosylation(GO:0060051) |
| 0.2 |
0.6 |
GO:0019478 |
D-amino acid catabolic process(GO:0019478) |
| 0.2 |
0.6 |
GO:0001946 |
lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 0.2 |
2.3 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.2 |
0.8 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.2 |
1.5 |
GO:0018916 |
nitrobenzene metabolic process(GO:0018916) |
| 0.2 |
1.3 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.2 |
0.4 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.2 |
2.1 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.2 |
0.2 |
GO:0034638 |
phosphatidylcholine catabolic process(GO:0034638) |
| 0.2 |
0.6 |
GO:0032493 |
response to bacterial lipoprotein(GO:0032493) |
| 0.2 |
0.2 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.2 |
0.2 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.2 |
0.2 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.2 |
5.1 |
GO:0007566 |
embryo implantation(GO:0007566) |
| 0.2 |
2.1 |
GO:0021785 |
branchiomotor neuron axon guidance(GO:0021785) |
| 0.2 |
0.4 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.2 |
0.2 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.2 |
0.8 |
GO:0030540 |
female genitalia development(GO:0030540) |
| 0.2 |
0.4 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.2 |
0.6 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.2 |
0.7 |
GO:0032899 |
regulation of neurotrophin production(GO:0032899) positive regulation of neurotrophin production(GO:0032901) |
| 0.2 |
1.3 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.2 |
2.4 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.2 |
0.9 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.2 |
3.7 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.2 |
0.6 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.2 |
2.2 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.2 |
0.9 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.2 |
2.4 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.2 |
0.9 |
GO:0010359 |
regulation of anion channel activity(GO:0010359) |
| 0.2 |
1.1 |
GO:0034115 |
negative regulation of heterotypic cell-cell adhesion(GO:0034115) cell-cell adhesion involved in gastrulation(GO:0070586) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
| 0.2 |
0.2 |
GO:0033122 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.2 |
0.9 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.2 |
1.1 |
GO:0043983 |
histone H4-K12 acetylation(GO:0043983) |
| 0.2 |
0.7 |
GO:0070166 |
enamel mineralization(GO:0070166) |
| 0.2 |
2.6 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.2 |
0.6 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 0.2 |
0.4 |
GO:0042473 |
outer ear morphogenesis(GO:0042473) |
| 0.2 |
1.5 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.2 |
0.7 |
GO:0045903 |
positive regulation of translational fidelity(GO:0045903) |
| 0.2 |
0.7 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.2 |
0.9 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.2 |
0.5 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.2 |
0.2 |
GO:0071677 |
positive regulation of mononuclear cell migration(GO:0071677) |
| 0.2 |
0.4 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.2 |
0.2 |
GO:0034310 |
primary alcohol catabolic process(GO:0034310) |
| 0.2 |
0.9 |
GO:2000325 |
regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.2 |
0.5 |
GO:0021562 |
vestibulocochlear nerve development(GO:0021562) |
| 0.2 |
0.2 |
GO:1901979 |
regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.2 |
0.9 |
GO:1901837 |
negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.2 |
0.2 |
GO:0002830 |
positive regulation of type 2 immune response(GO:0002830) |
| 0.2 |
0.2 |
GO:0009757 |
carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.2 |
0.9 |
GO:0072757 |
cellular response to camptothecin(GO:0072757) |
| 0.2 |
0.9 |
GO:0034063 |
stress granule assembly(GO:0034063) |
| 0.2 |
0.2 |
GO:0007369 |
gastrulation(GO:0007369) |
| 0.2 |
0.4 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.2 |
1.4 |
GO:0001779 |
natural killer cell differentiation(GO:0001779) |
| 0.2 |
1.2 |
GO:0042104 |
positive regulation of activated T cell proliferation(GO:0042104) |
| 0.2 |
0.5 |
GO:0002940 |
tRNA N2-guanine methylation(GO:0002940) |
| 0.2 |
1.4 |
GO:0006817 |
phosphate ion transport(GO:0006817) |
| 0.2 |
0.3 |
GO:0009301 |
snRNA transcription(GO:0009301) |
| 0.2 |
0.5 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.2 |
0.5 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.2 |
0.9 |
GO:0051697 |
protein delipidation(GO:0051697) |
| 0.2 |
0.3 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.2 |
1.2 |
GO:0000060 |
protein import into nucleus, translocation(GO:0000060) |
| 0.2 |
1.2 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 |
1.0 |
GO:0010917 |
negative regulation of mitochondrial membrane potential(GO:0010917) |
| 0.2 |
1.4 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.2 |
0.5 |
GO:0021631 |
optic nerve morphogenesis(GO:0021631) |
| 0.2 |
1.7 |
GO:0035115 |
embryonic forelimb morphogenesis(GO:0035115) |
| 0.2 |
0.2 |
GO:0006624 |
vacuolar protein processing(GO:0006624) |
| 0.2 |
0.5 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.2 |
0.5 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.2 |
0.2 |
GO:2000832 |
negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.2 |
0.8 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 0.2 |
4.7 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.2 |
0.8 |
GO:0030539 |
male genitalia development(GO:0030539) |
| 0.2 |
0.2 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.2 |
1.2 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 0.2 |
0.5 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.2 |
0.5 |
GO:0034476 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.2 |
1.7 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.2 |
1.2 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.2 |
1.0 |
GO:0060484 |
lung-associated mesenchyme development(GO:0060484) |
| 0.2 |
0.3 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.2 |
0.7 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.2 |
0.2 |
GO:0019087 |
transformation of host cell by virus(GO:0019087) |
| 0.2 |
0.5 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.2 |
0.5 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.2 |
1.5 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.2 |
0.8 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.2 |
0.3 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.2 |
1.4 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.2 |
0.8 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.2 |
0.9 |
GO:2000767 |
positive regulation of cytoplasmic translation(GO:2000767) |
| 0.2 |
4.6 |
GO:0034260 |
negative regulation of GTPase activity(GO:0034260) |
| 0.2 |
0.9 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.2 |
0.8 |
GO:0060837 |
blood vessel endothelial cell differentiation(GO:0060837) |
| 0.2 |
0.3 |
GO:0015817 |
histidine transport(GO:0015817) |
| 0.2 |
0.3 |
GO:0090298 |
positive regulation of fat cell proliferation(GO:0070346) negative regulation of mitochondrial DNA replication(GO:0090298) |
| 0.2 |
0.9 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.2 |
0.9 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.2 |
1.7 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.2 |
1.1 |
GO:2000124 |
regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.2 |
1.7 |
GO:0042403 |
thyroid hormone metabolic process(GO:0042403) |
| 0.2 |
0.2 |
GO:1902414 |
protein localization to cell junction(GO:1902414) |
| 0.2 |
1.8 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.2 |
0.2 |
GO:0023021 |
termination of signal transduction(GO:0023021) |
| 0.2 |
0.5 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.2 |
1.5 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.2 |
1.1 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.2 |
0.8 |
GO:0009409 |
response to cold(GO:0009409) |
| 0.2 |
0.2 |
GO:0032829 |
regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.2 |
1.7 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.1 |
0.6 |
GO:0022417 |
protein maturation by protein folding(GO:0022417) |
| 0.1 |
0.3 |
GO:0042534 |
tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.1 |
1.8 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.1 |
0.4 |
GO:0071374 |
cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.1 |
1.5 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.1 |
0.1 |
GO:0072038 |
mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
| 0.1 |
0.1 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 0.1 |
0.4 |
GO:0032466 |
negative regulation of cytokinesis(GO:0032466) |
| 0.1 |
0.6 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.1 |
0.6 |
GO:0002086 |
diaphragm contraction(GO:0002086) |
| 0.1 |
0.1 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.1 |
0.7 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.1 |
0.3 |
GO:0090503 |
RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.1 |
0.4 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.1 |
0.3 |
GO:0044849 |
estrous cycle(GO:0044849) |
| 0.1 |
0.4 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.1 |
0.3 |
GO:1904851 |
positive regulation of establishment of protein localization to telomere(GO:1904851) |
| 0.1 |
0.6 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.1 |
1.2 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.1 |
0.3 |
GO:0042726 |
flavin-containing compound metabolic process(GO:0042726) |
| 0.1 |
0.3 |
GO:0045908 |
negative regulation of vasodilation(GO:0045908) |
| 0.1 |
0.4 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.1 |
0.1 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.1 |
1.2 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.1 |
0.1 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 |
0.1 |
GO:0051643 |
endoplasmic reticulum localization(GO:0051643) |
| 0.1 |
0.7 |
GO:0032796 |
uropod organization(GO:0032796) |
| 0.1 |
0.3 |
GO:0007320 |
insemination(GO:0007320) |
| 0.1 |
0.7 |
GO:0002764 |
immune response-regulating signaling pathway(GO:0002764) |
| 0.1 |
2.0 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.1 |
0.6 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 |
2.7 |
GO:0007614 |
short-term memory(GO:0007614) |
| 0.1 |
0.6 |
GO:0046726 |
positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 |
1.1 |
GO:0033631 |
cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.1 |
0.3 |
GO:0002024 |
diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.1 |
0.3 |
GO:0038003 |
opioid receptor signaling pathway(GO:0038003) regulation of opioid receptor signaling pathway(GO:2000474) |
| 0.1 |
0.1 |
GO:1904816 |
positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.1 |
0.6 |
GO:1902570 |
protein localization to nucleolus(GO:1902570) |
| 0.1 |
3.2 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.1 |
0.4 |
GO:0048806 |
genitalia development(GO:0048806) |
| 0.1 |
1.9 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.1 |
0.3 |
GO:0060830 |
ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 |
0.8 |
GO:0070265 |
necrotic cell death(GO:0070265) |
| 0.1 |
2.1 |
GO:0010586 |
miRNA metabolic process(GO:0010586) |
| 0.1 |
0.5 |
GO:0070474 |
positive regulation of uterine smooth muscle contraction(GO:0070474) |
| 0.1 |
0.7 |
GO:0006048 |
UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.1 |
0.1 |
GO:0042482 |
positive regulation of odontogenesis(GO:0042482) |
| 0.1 |
5.6 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.1 |
1.1 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.1 |
0.3 |
GO:0097066 |
response to thyroid hormone(GO:0097066) |
| 0.1 |
0.5 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 |
0.8 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.1 |
1.3 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 |
0.7 |
GO:0014883 |
transition between fast and slow fiber(GO:0014883) |
| 0.1 |
1.5 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 |
0.5 |
GO:0043654 |
recognition of apoptotic cell(GO:0043654) |
| 0.1 |
0.1 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.1 |
1.1 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.1 |
0.3 |
GO:0050847 |
progesterone receptor signaling pathway(GO:0050847) |
| 0.1 |
0.1 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) |
| 0.1 |
0.8 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.1 |
0.3 |
GO:2000489 |
hepatic stellate cell activation(GO:0035733) regulation of hepatic stellate cell activation(GO:2000489) |
| 0.1 |
0.5 |
GO:0016114 |
terpenoid biosynthetic process(GO:0016114) |
| 0.1 |
1.3 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.1 |
0.3 |
GO:0032513 |
negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.1 |
0.4 |
GO:0001553 |
luteinization(GO:0001553) |
| 0.1 |
0.4 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.1 |
0.7 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.1 |
0.7 |
GO:0007175 |
negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.1 |
0.3 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 |
0.1 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.1 |
0.1 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.1 |
0.1 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.1 |
0.5 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 |
0.1 |
GO:0009182 |
purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) GDP metabolic process(GO:0046710) |
| 0.1 |
0.1 |
GO:0051958 |
methotrexate transport(GO:0051958) |
| 0.1 |
0.1 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.1 |
2.6 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 |
0.6 |
GO:0060670 |
branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.1 |
0.1 |
GO:0090400 |
stress-induced premature senescence(GO:0090400) |
| 0.1 |
0.1 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 |
0.1 |
GO:0044340 |
canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.1 |
0.6 |
GO:0071493 |
cellular response to UV-B(GO:0071493) |
| 0.1 |
0.3 |
GO:0070244 |
negative regulation of thymocyte apoptotic process(GO:0070244) |
| 0.1 |
0.6 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 |
0.3 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.1 |
0.5 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.1 |
0.6 |
GO:0042790 |
transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.1 |
0.4 |
GO:0043570 |
maintenance of DNA repeat elements(GO:0043570) |
| 0.1 |
0.1 |
GO:0034382 |
chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.1 |
1.0 |
GO:0007080 |
mitotic metaphase plate congression(GO:0007080) |
| 0.1 |
1.5 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 |
1.3 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) |
| 0.1 |
0.3 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.1 |
0.8 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.1 |
0.1 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.1 |
0.3 |
GO:0031047 |
gene silencing by RNA(GO:0031047) |
| 0.1 |
1.6 |
GO:0033327 |
Leydig cell differentiation(GO:0033327) |
| 0.1 |
0.5 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 0.1 |
0.2 |
GO:0072224 |
metanephric glomerulus development(GO:0072224) |
| 0.1 |
3.2 |
GO:0000462 |
maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.1 |
0.9 |
GO:0008625 |
extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |
| 0.1 |
0.2 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.1 |
0.9 |
GO:0048368 |
lateral mesoderm development(GO:0048368) |
| 0.1 |
1.2 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.1 |
0.4 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.1 |
1.0 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.1 |
0.2 |
GO:0090071 |
regulation of ribosome biogenesis(GO:0090069) negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 |
0.5 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 |
0.4 |
GO:0071107 |
response to parathyroid hormone(GO:0071107) |
| 0.1 |
0.4 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 |
0.4 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 |
0.7 |
GO:0036233 |
glycine import(GO:0036233) |
| 0.1 |
0.8 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.1 |
1.2 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 |
0.5 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.1 |
0.5 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 0.1 |
0.7 |
GO:0007213 |
G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.1 |
0.4 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 0.1 |
0.6 |
GO:0001771 |
immunological synapse formation(GO:0001771) |
| 0.1 |
0.5 |
GO:1900533 |
medium-chain fatty-acyl-CoA catabolic process(GO:0036114) fatty-acyl-CoA catabolic process(GO:0036115) long-chain fatty-acyl-CoA catabolic process(GO:0036116) palmitic acid metabolic process(GO:1900533) palmitic acid biosynthetic process(GO:1900535) |
| 0.1 |
1.2 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.1 |
0.4 |
GO:0071787 |
endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 |
0.2 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.1 |
1.8 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.1 |
0.2 |
GO:0000479 |
endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
| 0.1 |
1.2 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.1 |
0.5 |
GO:0016446 |
somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.1 |
0.2 |
GO:0002313 |
mature B cell differentiation involved in immune response(GO:0002313) |
| 0.1 |
0.3 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 |
0.5 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.1 |
0.3 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.1 |
0.5 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 |
1.2 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
0.9 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.1 |
0.5 |
GO:0042373 |
vitamin K metabolic process(GO:0042373) |
| 0.1 |
0.5 |
GO:0015015 |
heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 |
0.6 |
GO:0098903 |
regulation of membrane repolarization during action potential(GO:0098903) |
| 0.1 |
1.3 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.1 |
0.7 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 |
0.6 |
GO:0000076 |
DNA replication checkpoint(GO:0000076) |
| 0.1 |
0.1 |
GO:0010520 |
regulation of reciprocal meiotic recombination(GO:0010520) positive regulation of reciprocal meiotic recombination(GO:0010845) |
| 0.1 |
0.7 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.1 |
0.7 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
0.5 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.1 |
1.5 |
GO:0051352 |
negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.1 |
1.5 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.1 |
0.9 |
GO:0001773 |
myeloid dendritic cell activation(GO:0001773) myeloid dendritic cell differentiation(GO:0043011) |
| 0.1 |
0.2 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 |
0.8 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
0.3 |
GO:1900747 |
negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.1 |
0.2 |
GO:0043312 |
neutrophil degranulation(GO:0043312) |
| 0.1 |
0.2 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.1 |
0.4 |
GO:0010668 |
ectodermal cell differentiation(GO:0010668) |
| 0.1 |
0.1 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 |
0.1 |
GO:0060525 |
prostate glandular acinus development(GO:0060525) |
| 0.1 |
0.8 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.1 |
0.7 |
GO:0071494 |
cellular response to UV-C(GO:0071494) |
| 0.1 |
0.2 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.1 |
0.6 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 |
0.6 |
GO:0043921 |
modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
| 0.1 |
0.2 |
GO:1902534 |
single-organism membrane invagination(GO:1902534) |
| 0.1 |
0.3 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.1 |
0.1 |
GO:0016479 |
negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
| 0.1 |
0.7 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
0.2 |
GO:0060155 |
platelet dense granule organization(GO:0060155) |
| 0.1 |
2.4 |
GO:0006879 |
cellular iron ion homeostasis(GO:0006879) |
| 0.1 |
1.5 |
GO:0031643 |
positive regulation of myelination(GO:0031643) |
| 0.1 |
0.2 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.1 |
1.2 |
GO:0034311 |
diol metabolic process(GO:0034311) |
| 0.1 |
0.2 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 |
0.5 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.1 |
0.7 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.1 |
0.1 |
GO:1902513 |
regulation of organelle transport along microtubule(GO:1902513) |
| 0.1 |
0.4 |
GO:2000382 |
positive regulation of mesoderm development(GO:2000382) |
| 0.1 |
0.2 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
0.2 |
GO:0035356 |
cellular triglyceride homeostasis(GO:0035356) |
| 0.1 |
0.4 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 |
1.2 |
GO:0070670 |
response to interleukin-4(GO:0070670) |
| 0.1 |
0.4 |
GO:0007023 |
post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 |
1.3 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 |
0.3 |
GO:0008298 |
intracellular mRNA localization(GO:0008298) |
| 0.1 |
0.1 |
GO:1902969 |
mitotic DNA replication(GO:1902969) |
| 0.1 |
0.1 |
GO:0016246 |
RNA interference(GO:0016246) |
| 0.1 |
0.6 |
GO:0014068 |
positive regulation of phosphatidylinositol 3-kinase signaling(GO:0014068) |
| 0.1 |
1.4 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.1 |
0.5 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.1 |
1.1 |
GO:0010388 |
cullin deneddylation(GO:0010388) |
| 0.1 |
0.1 |
GO:0042059 |
negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.1 |
2.4 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.1 |
1.5 |
GO:0016973 |
poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.1 |
0.4 |
GO:0032471 |
negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.1 |
0.5 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.1 |
0.3 |
GO:0039536 |
negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.1 |
0.2 |
GO:0048636 |
positive regulation of striated muscle tissue development(GO:0045844) positive regulation of muscle organ development(GO:0048636) positive regulation of muscle tissue development(GO:1901863) |
| 0.1 |
0.5 |
GO:0072488 |
ammonium transmembrane transport(GO:0072488) |
| 0.1 |
0.1 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.1 |
0.5 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.1 |
0.9 |
GO:0031645 |
negative regulation of neurological system process(GO:0031645) |
| 0.1 |
0.6 |
GO:0042069 |
regulation of catecholamine metabolic process(GO:0042069) |
| 0.1 |
0.1 |
GO:0035405 |
histone-threonine phosphorylation(GO:0035405) |
| 0.1 |
0.9 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 |
0.1 |
GO:0043461 |
proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.1 |
0.3 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.1 |
0.9 |
GO:0032332 |
positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.1 |
0.7 |
GO:0044068 |
modulation by symbiont of host cellular process(GO:0044068) |
| 0.1 |
0.8 |
GO:0038089 |
positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.1 |
0.4 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 |
0.7 |
GO:1990144 |
intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.1 |
0.5 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 0.1 |
0.4 |
GO:0015884 |
folic acid transport(GO:0015884) |
| 0.1 |
0.6 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.1 |
0.1 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 |
0.6 |
GO:0046685 |
response to arsenic-containing substance(GO:0046685) |
| 0.1 |
0.9 |
GO:0001893 |
maternal placenta development(GO:0001893) |
| 0.1 |
0.1 |
GO:0097680 |
double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 |
0.7 |
GO:0007398 |
ectoderm development(GO:0007398) |
| 0.1 |
0.3 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.1 |
0.1 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.1 |
0.2 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.1 |
1.2 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.1 |
0.2 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.1 |
0.3 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 |
0.6 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.1 |
1.9 |
GO:0090200 |
positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.1 |
0.1 |
GO:0014873 |
response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 0.1 |
0.6 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.1 |
0.1 |
GO:0071499 |
response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 0.1 |
0.4 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.1 |
0.3 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.1 |
0.3 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.1 |
0.9 |
GO:1904587 |
glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
| 0.1 |
0.3 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 |
0.3 |
GO:0090296 |
regulation of mitochondrial DNA replication(GO:0090296) positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) positive regulation of mitochondrial DNA metabolic process(GO:1901860) stress-induced mitochondrial fusion(GO:1990046) |
| 0.1 |
0.2 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 |
0.5 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 |
0.8 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.1 |
0.3 |
GO:0055099 |
response to high density lipoprotein particle(GO:0055099) |
| 0.1 |
0.5 |
GO:0007224 |
smoothened signaling pathway(GO:0007224) |
| 0.1 |
0.5 |
GO:0018202 |
peptidyl-histidine modification(GO:0018202) |
| 0.1 |
0.5 |
GO:0032366 |
intracellular sterol transport(GO:0032366) |
| 0.1 |
0.5 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 |
0.4 |
GO:0019355 |
nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.1 |
0.5 |
GO:0036438 |
maintenance of lens transparency(GO:0036438) |
| 0.1 |
0.4 |
GO:0007258 |
JUN phosphorylation(GO:0007258) |
| 0.1 |
3.2 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.1 |
0.2 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.1 |
0.1 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.1 |
0.8 |
GO:0035646 |
endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.1 |
0.3 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.1 |
1.3 |
GO:0035025 |
positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.1 |
0.5 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 0.1 |
0.8 |
GO:0019886 |
antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.1 |
1.4 |
GO:0032981 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 |
0.2 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.1 |
0.1 |
GO:0002865 |
negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
| 0.1 |
0.3 |
GO:0007530 |
sex determination(GO:0007530) |
| 0.1 |
0.3 |
GO:0042073 |
intraciliary transport(GO:0042073) protein transport along microtubule(GO:0098840) |
| 0.1 |
0.4 |
GO:0061188 |
regulation of chromatin silencing at rDNA(GO:0061187) negative regulation of chromatin silencing at rDNA(GO:0061188) |
| 0.1 |
0.3 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.1 |
0.6 |
GO:0034644 |
cellular response to UV(GO:0034644) |
| 0.1 |
2.2 |
GO:1903321 |
negative regulation of protein modification by small protein conjugation or removal(GO:1903321) |
| 0.1 |
0.9 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.1 |
0.5 |
GO:0034227 |
tRNA thio-modification(GO:0034227) |
| 0.1 |
0.1 |
GO:0010884 |
positive regulation of lipid storage(GO:0010884) |
| 0.1 |
0.5 |
GO:0060052 |
neurofilament cytoskeleton organization(GO:0060052) |
| 0.1 |
0.3 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 |
0.2 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.1 |
0.3 |
GO:1902902 |
negative regulation of autophagosome assembly(GO:1902902) |
| 0.1 |
0.1 |
GO:0061154 |
endothelial tube morphogenesis(GO:0061154) |
| 0.1 |
2.9 |
GO:0009060 |
aerobic respiration(GO:0009060) |
| 0.1 |
0.4 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
0.1 |
GO:0030656 |
regulation of vitamin metabolic process(GO:0030656) |
| 0.1 |
0.7 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 |
0.1 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.1 |
0.2 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 |
1.3 |
GO:0042149 |
cellular response to glucose starvation(GO:0042149) |
| 0.1 |
0.1 |
GO:0048388 |
endosomal lumen acidification(GO:0048388) |
| 0.1 |
0.3 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.1 |
0.1 |
GO:0090329 |
regulation of DNA-dependent DNA replication(GO:0090329) |
| 0.1 |
0.3 |
GO:0031086 |
nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 |
0.6 |
GO:0006995 |
cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 |
0.3 |
GO:0072553 |
terminal button organization(GO:0072553) |
| 0.1 |
1.1 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.1 |
2.4 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 |
0.5 |
GO:0043552 |
positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.1 |
0.5 |
GO:0034472 |
snRNA 3'-end processing(GO:0034472) |
| 0.1 |
0.6 |
GO:0006654 |
phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
| 0.1 |
0.1 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.1 |
0.8 |
GO:0021684 |
cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 |
0.5 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 0.1 |
0.8 |
GO:0007595 |
lactation(GO:0007595) |
| 0.1 |
0.1 |
GO:0032464 |
positive regulation of protein homooligomerization(GO:0032464) |
| 0.1 |
0.4 |
GO:0006071 |
glycerol metabolic process(GO:0006071) |
| 0.1 |
0.2 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.1 |
1.8 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
1.5 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.1 |
1.4 |
GO:0042267 |
natural killer cell mediated immunity(GO:0002228) natural killer cell mediated cytotoxicity(GO:0042267) |
| 0.1 |
0.1 |
GO:0032713 |
negative regulation of interleukin-4 production(GO:0032713) |
| 0.1 |
1.4 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.1 |
0.2 |
GO:1902277 |
negative regulation of pancreatic amylase secretion(GO:1902277) |
| 0.1 |
1.7 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.1 |
0.5 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.1 |
0.1 |
GO:0000291 |
nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.1 |
0.1 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 |
0.2 |
GO:0070162 |
adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 |
0.2 |
GO:0008209 |
androgen metabolic process(GO:0008209) |
| 0.1 |
0.2 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 |
0.2 |
GO:0014046 |
dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) dopamine transport(GO:0015872) regulation of catecholamine secretion(GO:0050433) |
| 0.1 |
0.2 |
GO:0046381 |
CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.1 |
0.3 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.1 |
0.6 |
GO:0035871 |
protein K11-linked deubiquitination(GO:0035871) |
| 0.1 |
0.2 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.1 |
0.6 |
GO:0072673 |
lamellipodium morphogenesis(GO:0072673) |
| 0.1 |
0.1 |
GO:0060455 |
regulation of gastric acid secretion(GO:0060453) negative regulation of gastric acid secretion(GO:0060455) |
| 0.1 |
0.2 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.1 |
0.2 |
GO:1904729 |
regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal absorption(GO:1904478) regulation of intestinal lipid absorption(GO:1904729) |
| 0.1 |
0.5 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.1 |
0.4 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.1 |
2.7 |
GO:0006414 |
translational elongation(GO:0006414) |
| 0.1 |
0.3 |
GO:0032310 |
prostaglandin transport(GO:0015732) prostaglandin secretion(GO:0032310) |
| 0.1 |
0.2 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.1 |
0.4 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.1 |
0.5 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 0.1 |
0.5 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.1 |
0.2 |
GO:0051180 |
vitamin transport(GO:0051180) |
| 0.1 |
2.2 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.1 |
1.1 |
GO:0048026 |
positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.1 |
1.0 |
GO:0030201 |
heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.1 |
0.8 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.1 |
0.1 |
GO:2000170 |
positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.1 |
0.1 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.1 |
0.1 |
GO:0071673 |
positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.1 |
0.5 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.1 |
0.4 |
GO:0006098 |
pentose-phosphate shunt(GO:0006098) |
| 0.1 |
0.1 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 0.1 |
0.3 |
GO:0006706 |
steroid catabolic process(GO:0006706) |
| 0.1 |
0.3 |
GO:0030865 |
cortical cytoskeleton organization(GO:0030865) |
| 0.1 |
0.7 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 |
0.1 |
GO:0051220 |
cytoplasmic sequestering of protein(GO:0051220) |
| 0.1 |
0.6 |
GO:0060716 |
labyrinthine layer blood vessel development(GO:0060716) |
| 0.1 |
0.3 |
GO:0090051 |
negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.1 |
0.1 |
GO:0035521 |
monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.1 |
0.6 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.1 |
0.3 |
GO:0019673 |
GDP-mannose metabolic process(GO:0019673) |
| 0.1 |
0.1 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.1 |
1.4 |
GO:0034198 |
cellular response to amino acid starvation(GO:0034198) |
| 0.1 |
0.4 |
GO:0061045 |
negative regulation of wound healing(GO:0061045) |
| 0.1 |
0.2 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 |
1.1 |
GO:0016339 |
calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.1 |
2.0 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.1 |
0.1 |
GO:0002347 |
response to tumor cell(GO:0002347) |
| 0.1 |
0.8 |
GO:0006465 |
signal peptide processing(GO:0006465) |
| 0.1 |
1.2 |
GO:0048844 |
artery morphogenesis(GO:0048844) |
| 0.1 |
0.3 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.1 |
0.2 |
GO:1900060 |
negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 |
0.6 |
GO:0042753 |
positive regulation of circadian rhythm(GO:0042753) |
| 0.1 |
0.2 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.1 |
1.3 |
GO:1902808 |
positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.1 |
0.1 |
GO:0002828 |
regulation of type 2 immune response(GO:0002828) |
| 0.1 |
0.1 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.1 |
0.8 |
GO:0042088 |
T-helper 1 type immune response(GO:0042088) |
| 0.1 |
0.1 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
0.5 |
GO:0046085 |
adenosine metabolic process(GO:0046085) |
| 0.1 |
0.2 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 |
0.3 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 |
0.2 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 |
0.9 |
GO:0033962 |
cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.1 |
1.3 |
GO:0045746 |
negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 |
0.1 |
GO:0010626 |
negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 |
0.1 |
GO:1904417 |
regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.1 |
0.7 |
GO:0002931 |
response to ischemia(GO:0002931) |
| 0.1 |
0.3 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.1 |
0.1 |
GO:0009217 |
purine deoxyribonucleotide catabolic process(GO:0009155) deoxyribonucleoside triphosphate catabolic process(GO:0009204) purine deoxyribonucleoside triphosphate catabolic process(GO:0009217) |
| 0.1 |
0.1 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.1 |
0.3 |
GO:0002154 |
thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.1 |
0.5 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.1 |
0.1 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.1 |
0.1 |
GO:0061036 |
positive regulation of cartilage development(GO:0061036) |
| 0.1 |
0.8 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
0.2 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
0.8 |
GO:0006301 |
postreplication repair(GO:0006301) |
| 0.1 |
0.1 |
GO:0001922 |
B-1 B cell homeostasis(GO:0001922) |
| 0.1 |
1.6 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.1 |
0.3 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.1 |
0.1 |
GO:0032816 |
positive regulation of natural killer cell activation(GO:0032816) |
| 0.1 |
1.7 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.1 |
0.9 |
GO:0003016 |
respiratory system process(GO:0003016) |
| 0.1 |
0.2 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 |
0.2 |
GO:1990564 |
protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 |
0.1 |
GO:0010455 |
positive regulation of cell fate commitment(GO:0010455) |
| 0.1 |
0.3 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.1 |
0.3 |
GO:0001916 |
positive regulation of T cell mediated cytotoxicity(GO:0001916) |
| 0.1 |
0.2 |
GO:0006505 |
GPI anchor metabolic process(GO:0006505) |
| 0.1 |
0.2 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 |
0.1 |
GO:0008300 |
isoprenoid catabolic process(GO:0008300) |
| 0.1 |
0.1 |
GO:0060623 |
regulation of chromosome condensation(GO:0060623) |
| 0.1 |
0.7 |
GO:0046855 |
phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 |
0.5 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.1 |
0.8 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.1 |
0.1 |
GO:0003161 |
cardiac conduction system development(GO:0003161) |
| 0.1 |
0.1 |
GO:0042264 |
peptidyl-aspartic acid modification(GO:0018197) peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.1 |
0.4 |
GO:0048227 |
plasma membrane to endosome transport(GO:0048227) |
| 0.1 |
0.5 |
GO:0098781 |
ncRNA transcription(GO:0098781) |
| 0.1 |
0.1 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.1 |
2.2 |
GO:0032543 |
mitochondrial translation(GO:0032543) |
| 0.1 |
2.5 |
GO:0032526 |
response to retinoic acid(GO:0032526) |
| 0.1 |
0.1 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 |
0.1 |
GO:0034982 |
mitochondrial protein processing(GO:0034982) |
| 0.1 |
0.1 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.1 |
0.6 |
GO:0009048 |
dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 |
0.1 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.1 |
0.1 |
GO:1900121 |
negative regulation of receptor binding(GO:1900121) |
| 0.1 |
0.3 |
GO:0090050 |
positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.1 |
0.7 |
GO:0016073 |
snRNA metabolic process(GO:0016073) |
| 0.1 |
0.2 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.1 |
0.4 |
GO:0006972 |
hyperosmotic response(GO:0006972) |
| 0.1 |
0.7 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.1 |
0.2 |
GO:1901301 |
regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 |
0.2 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 |
0.5 |
GO:0051974 |
negative regulation of telomerase activity(GO:0051974) |
| 0.1 |
0.1 |
GO:0006513 |
protein monoubiquitination(GO:0006513) |
| 0.1 |
0.3 |
GO:0097039 |
protein linear polyubiquitination(GO:0097039) |
| 0.1 |
0.8 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 0.1 |
0.1 |
GO:0061051 |
positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.1 |
0.6 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 |
0.1 |
GO:0008535 |
respiratory chain complex IV assembly(GO:0008535) |
| 0.1 |
0.6 |
GO:0030574 |
collagen catabolic process(GO:0030574) |
| 0.1 |
1.9 |
GO:0050830 |
defense response to Gram-positive bacterium(GO:0050830) |
| 0.1 |
0.2 |
GO:0031295 |
lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
| 0.1 |
0.1 |
GO:0090224 |
regulation of spindle organization(GO:0090224) |
| 0.1 |
0.3 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.1 |
0.1 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 |
0.2 |
GO:0033578 |
protein glycosylation in Golgi(GO:0033578) |
| 0.1 |
0.1 |
GO:2000047 |
regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
| 0.1 |
0.2 |
GO:0032204 |
regulation of telomere maintenance(GO:0032204) |
| 0.1 |
0.3 |
GO:1990928 |
response to amino acid starvation(GO:1990928) |
| 0.1 |
0.2 |
GO:2000018 |
regulation of male gonad development(GO:2000018) positive regulation of male gonad development(GO:2000020) |
| 0.1 |
0.7 |
GO:0070207 |
protein homotrimerization(GO:0070207) |
| 0.1 |
0.8 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.1 |
1.3 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 |
0.2 |
GO:0046471 |
phosphatidylglycerol metabolic process(GO:0046471) |
| 0.1 |
0.2 |
GO:0019243 |
methylglyoxal metabolic process(GO:0009438) methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 |
2.1 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.1 |
0.1 |
GO:0032241 |
positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.1 |
0.1 |
GO:0045721 |
negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 |
0.2 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 |
0.4 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 0.1 |
4.3 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.1 |
0.2 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.1 |
0.2 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.1 |
0.5 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.1 |
0.2 |
GO:0032688 |
negative regulation of interferon-beta production(GO:0032688) |
| 0.1 |
0.6 |
GO:0015936 |
coenzyme A metabolic process(GO:0015936) |
| 0.1 |
0.2 |
GO:0009226 |
nucleotide-sugar biosynthetic process(GO:0009226) |
| 0.1 |
0.6 |
GO:0050832 |
defense response to fungus(GO:0050832) |
| 0.1 |
0.2 |
GO:0034379 |
very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.1 |
0.4 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.1 |
0.1 |
GO:0006474 |
N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 |
0.1 |
GO:2000348 |
regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 |
0.1 |
GO:0038179 |
neurotrophin signaling pathway(GO:0038179) |
| 0.0 |
0.1 |
GO:0002467 |
germinal center formation(GO:0002467) |
| 0.0 |
0.1 |
GO:0097309 |
cap1 mRNA methylation(GO:0097309) |
| 0.0 |
0.0 |
GO:0072321 |
chaperone-mediated protein transport(GO:0072321) |
| 0.0 |
0.4 |
GO:0032625 |
interleukin-21 production(GO:0032625) interleukin-21 secretion(GO:0072619) |
| 0.0 |
0.1 |
GO:0023019 |
signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.0 |
0.1 |
GO:0033108 |
mitochondrial respiratory chain complex assembly(GO:0033108) |
| 0.0 |
0.0 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 |
0.0 |
GO:0002385 |
mucosal immune response(GO:0002385) |
| 0.0 |
0.2 |
GO:0070100 |
negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.0 |
0.2 |
GO:0035752 |
lysosomal lumen pH elevation(GO:0035752) |
| 0.0 |
0.3 |
GO:0055064 |
chloride ion homeostasis(GO:0055064) |
| 0.0 |
0.5 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 |
0.0 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.0 |
0.1 |
GO:0006801 |
superoxide metabolic process(GO:0006801) |
| 0.0 |
0.0 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.0 |
0.2 |
GO:0060294 |
cilium movement involved in cell motility(GO:0060294) |
| 0.0 |
0.1 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 |
0.0 |
GO:0036228 |
protein targeting to nuclear inner membrane(GO:0036228) |
| 0.0 |
0.1 |
GO:0009644 |
response to high light intensity(GO:0009644) |
| 0.0 |
0.2 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.0 |
0.0 |
GO:0035701 |
hematopoietic stem cell migration(GO:0035701) |
| 0.0 |
0.4 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 |
0.0 |
GO:0046618 |
drug export(GO:0046618) |
| 0.0 |
0.3 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 |
1.1 |
GO:0046545 |
development of primary female sexual characteristics(GO:0046545) |
| 0.0 |
0.2 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.0 |
0.1 |
GO:0007182 |
common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.0 |
0.1 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.0 |
0.2 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.0 |
0.1 |
GO:1901185 |
negative regulation of ERBB signaling pathway(GO:1901185) |
| 0.0 |
0.1 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 |
0.5 |
GO:0006515 |
misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.0 |
0.9 |
GO:0009410 |
response to xenobiotic stimulus(GO:0009410) |
| 0.0 |
0.3 |
GO:0035518 |
histone H2A monoubiquitination(GO:0035518) |
| 0.0 |
0.1 |
GO:0090315 |
negative regulation of protein targeting to membrane(GO:0090315) |
| 0.0 |
0.3 |
GO:0033623 |
regulation of integrin activation(GO:0033623) |
| 0.0 |
0.1 |
GO:2000504 |
regulation of Fas signaling pathway(GO:1902044) negative regulation of Fas signaling pathway(GO:1902045) positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 |
0.0 |
GO:0048549 |
positive regulation of pinocytosis(GO:0048549) |
| 0.0 |
0.4 |
GO:0051988 |
regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 |
0.1 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.0 |
0.1 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.0 |
0.7 |
GO:0051693 |
actin filament capping(GO:0051693) |
| 0.0 |
0.1 |
GO:0032497 |
detection of lipopolysaccharide(GO:0032497) |
| 0.0 |
1.0 |
GO:0005978 |
glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 |
0.1 |
GO:0010830 |
regulation of myotube differentiation(GO:0010830) |
| 0.0 |
0.3 |
GO:0030049 |
muscle filament sliding(GO:0030049) |
| 0.0 |
0.6 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.0 |
0.6 |
GO:0006999 |
nuclear pore organization(GO:0006999) |
| 0.0 |
1.2 |
GO:0006405 |
RNA export from nucleus(GO:0006405) |
| 0.0 |
0.0 |
GO:0009151 |
purine deoxyribonucleotide metabolic process(GO:0009151) |
| 0.0 |
0.1 |
GO:0032025 |
response to cobalt ion(GO:0032025) |
| 0.0 |
0.5 |
GO:0043488 |
regulation of mRNA stability(GO:0043488) |
| 0.0 |
0.6 |
GO:0033006 |
regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
| 0.0 |
0.6 |
GO:0043550 |
regulation of lipid kinase activity(GO:0043550) |
| 0.0 |
0.2 |
GO:0031641 |
regulation of myelination(GO:0031641) |
| 0.0 |
0.0 |
GO:0048745 |
smooth muscle tissue development(GO:0048745) |
| 0.0 |
0.2 |
GO:0016560 |
protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 |
0.1 |
GO:2000834 |
androgen secretion(GO:0035935) testosterone secretion(GO:0035936) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 0.0 |
0.3 |
GO:0042760 |
very long-chain fatty acid catabolic process(GO:0042760) |
| 0.0 |
0.1 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.0 |
1.0 |
GO:0045540 |
regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.0 |
1.2 |
GO:0001895 |
retina homeostasis(GO:0001895) |
| 0.0 |
0.4 |
GO:2001197 |
regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.0 |
0.2 |
GO:0009098 |
branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.0 |
0.2 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 |
0.1 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 0.0 |
0.5 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.0 |
0.4 |
GO:1903846 |
positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.0 |
0.6 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 |
0.8 |
GO:0008214 |
protein demethylation(GO:0006482) protein dealkylation(GO:0008214) demethylation(GO:0070988) |
| 0.0 |
0.0 |
GO:2000310 |
regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.0 |
0.8 |
GO:0016578 |
histone deubiquitination(GO:0016578) |
| 0.0 |
0.1 |
GO:0016068 |
regulation of type I hypersensitivity(GO:0001810) positive regulation of type I hypersensitivity(GO:0001812) type I hypersensitivity(GO:0016068) |
| 0.0 |
0.1 |
GO:0032465 |
regulation of cytokinesis(GO:0032465) |
| 0.0 |
0.2 |
GO:0097341 |
inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 |
0.0 |
GO:0002679 |
respiratory burst involved in defense response(GO:0002679) |
| 0.0 |
0.1 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 |
0.2 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 0.0 |
0.1 |
GO:0042126 |
nitrate metabolic process(GO:0042126) |
| 0.0 |
0.1 |
GO:0044706 |
multi-multicellular organism process(GO:0044706) |
| 0.0 |
0.2 |
GO:0060033 |
anatomical structure regression(GO:0060033) |
| 0.0 |
0.1 |
GO:1900025 |
negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
| 0.0 |
0.3 |
GO:0050995 |
negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 |
0.1 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 |
0.2 |
GO:0007035 |
vacuolar acidification(GO:0007035) |
| 0.0 |
0.4 |
GO:0070534 |
protein K63-linked ubiquitination(GO:0070534) |
| 0.0 |
0.3 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 |
0.5 |
GO:0070613 |
regulation of protein processing(GO:0070613) |
| 0.0 |
0.1 |
GO:0010832 |
negative regulation of myotube differentiation(GO:0010832) |
| 0.0 |
0.1 |
GO:0035584 |
calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.0 |
0.1 |
GO:0034390 |
smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
| 0.0 |
0.4 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.0 |
0.1 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.0 |
0.4 |
GO:0006661 |
phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.0 |
0.2 |
GO:0043314 |
negative regulation of neutrophil degranulation(GO:0043314) regulation of blood vessel remodeling(GO:0060312) negative regulation of blood vessel remodeling(GO:0060313) negative regulation of neutrophil activation(GO:1902564) |
| 0.0 |
0.5 |
GO:0005980 |
polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 |
0.3 |
GO:0030252 |
growth hormone secretion(GO:0030252) |
| 0.0 |
0.4 |
GO:0051084 |
'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.0 |
0.5 |
GO:0006220 |
pyrimidine nucleotide metabolic process(GO:0006220) |
| 0.0 |
0.1 |
GO:0045806 |
negative regulation of endocytosis(GO:0045806) |
| 0.0 |
0.1 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.0 |
0.1 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.0 |
0.8 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.0 |
0.0 |
GO:0010893 |
positive regulation of steroid biosynthetic process(GO:0010893) |
| 0.0 |
0.1 |
GO:0042554 |
superoxide anion generation(GO:0042554) |
| 0.0 |
0.0 |
GO:0021692 |
cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
| 0.0 |
0.2 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.0 |
0.1 |
GO:0010971 |
positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.0 |
0.0 |
GO:2000598 |
regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
| 0.0 |
0.2 |
GO:0006488 |
dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.0 |
2.4 |
GO:0042254 |
ribosome biogenesis(GO:0042254) |
| 0.0 |
0.1 |
GO:0036344 |
platelet morphogenesis(GO:0036344) |
| 0.0 |
1.4 |
GO:0071229 |
cellular response to acid chemical(GO:0071229) |
| 0.0 |
0.5 |
GO:0001706 |
endoderm formation(GO:0001706) |
| 0.0 |
0.1 |
GO:1901991 |
negative regulation of mitotic cell cycle phase transition(GO:1901991) |
| 0.0 |
0.1 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.0 |
0.2 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.0 |
0.0 |
GO:0021523 |
somatic motor neuron differentiation(GO:0021523) |
| 0.0 |
0.2 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.0 |
0.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 |
0.2 |
GO:0009880 |
embryonic pattern specification(GO:0009880) |
| 0.0 |
0.3 |
GO:0071391 |
cellular response to estrogen stimulus(GO:0071391) |
| 0.0 |
0.2 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.0 |
0.2 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.0 |
0.3 |
GO:0090311 |
regulation of protein deacetylation(GO:0090311) |
| 0.0 |
0.0 |
GO:0003289 |
septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
| 0.0 |
0.1 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 |
0.4 |
GO:0006353 |
DNA-templated transcription, termination(GO:0006353) |
| 0.0 |
0.1 |
GO:0016198 |
axon choice point recognition(GO:0016198) |
| 0.0 |
0.1 |
GO:0032959 |
inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.0 |
0.1 |
GO:0043496 |
regulation of protein homodimerization activity(GO:0043496) |
| 0.0 |
0.2 |
GO:0001990 |
regulation of systemic arterial blood pressure by hormone(GO:0001990) |
| 0.0 |
0.3 |
GO:0048280 |
vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 |
0.1 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.0 |
0.1 |
GO:0006826 |
iron ion transport(GO:0006826) |
| 0.0 |
0.1 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 |
0.1 |
GO:0034350 |
regulation of glial cell apoptotic process(GO:0034350) |
| 0.0 |
0.1 |
GO:0048563 |
post-embryonic organ morphogenesis(GO:0048563) |
| 0.0 |
0.0 |
GO:0001575 |
globoside metabolic process(GO:0001575) |
| 0.0 |
0.8 |
GO:0006289 |
nucleotide-excision repair(GO:0006289) |
| 0.0 |
0.2 |
GO:0008340 |
determination of adult lifespan(GO:0008340) |
| 0.0 |
0.2 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.0 |
0.0 |
GO:0097274 |
urea homeostasis(GO:0097274) |
| 0.0 |
0.3 |
GO:0071803 |
positive regulation of podosome assembly(GO:0071803) |
| 0.0 |
0.1 |
GO:0009267 |
cellular response to starvation(GO:0009267) |
| 0.0 |
0.1 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.0 |
0.2 |
GO:0007602 |
phototransduction(GO:0007602) |
| 0.0 |
0.1 |
GO:0030811 |
regulation of glycolytic process(GO:0006110) regulation of nucleotide catabolic process(GO:0030811) |
| 0.0 |
0.0 |
GO:0008626 |
granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.0 |
0.0 |
GO:0042921 |
glucocorticoid receptor signaling pathway(GO:0042921) |
| 0.0 |
0.1 |
GO:2001025 |
positive regulation of response to drug(GO:2001025) |
| 0.0 |
0.1 |
GO:1902803 |
regulation of synaptic vesicle transport(GO:1902803) |
| 0.0 |
9.0 |
GO:0006412 |
translation(GO:0006412) |
| 0.0 |
0.0 |
GO:1904707 |
positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
| 0.0 |
0.1 |
GO:0010922 |
positive regulation of phosphatase activity(GO:0010922) positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.0 |
0.2 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.0 |
0.3 |
GO:0046596 |
regulation of viral entry into host cell(GO:0046596) |
| 0.0 |
0.1 |
GO:0001830 |
trophectodermal cell fate commitment(GO:0001830) |
| 0.0 |
0.1 |
GO:1902804 |
negative regulation of synaptic vesicle transport(GO:1902804) |
| 0.0 |
0.1 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.0 |
0.0 |
GO:0010726 |
positive regulation of hydrogen peroxide metabolic process(GO:0010726) |
| 0.0 |
1.2 |
GO:0006888 |
ER to Golgi vesicle-mediated transport(GO:0006888) |
| 0.0 |
0.2 |
GO:0010762 |
regulation of fibroblast migration(GO:0010762) |
| 0.0 |
0.1 |
GO:0003417 |
growth plate cartilage development(GO:0003417) |
| 0.0 |
0.1 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.0 |
0.2 |
GO:0002448 |
mast cell activation involved in immune response(GO:0002279) mast cell mediated immunity(GO:0002448) mast cell degranulation(GO:0043303) |
| 0.0 |
0.3 |
GO:0007052 |
mitotic spindle organization(GO:0007052) |
| 0.0 |
0.0 |
GO:0039532 |
regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039531) negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
| 0.0 |
0.3 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.0 |
0.1 |
GO:1903071 |
positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 |
0.1 |
GO:0043276 |
anoikis(GO:0043276) |
| 0.0 |
0.1 |
GO:1902897 |
regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.0 |
0.0 |
GO:0035934 |
corticosterone secretion(GO:0035934) |
| 0.0 |
0.1 |
GO:0009227 |
nucleotide-sugar catabolic process(GO:0009227) |
| 0.0 |
0.1 |
GO:0048536 |
spleen development(GO:0048536) |
| 0.0 |
0.1 |
GO:1903025 |
regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 |
0.5 |
GO:1902017 |
regulation of cilium assembly(GO:1902017) |
| 0.0 |
0.2 |
GO:0030071 |
regulation of mitotic metaphase/anaphase transition(GO:0030071) regulation of metaphase/anaphase transition of cell cycle(GO:1902099) |
| 0.0 |
0.1 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.0 |
0.0 |
GO:0048742 |
regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 |
0.1 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 |
0.2 |
GO:0006959 |
humoral immune response(GO:0006959) |
| 0.0 |
0.1 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.0 |
0.9 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.0 |
0.1 |
GO:0071971 |
extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
| 0.0 |
0.1 |
GO:0010592 |
positive regulation of lamellipodium assembly(GO:0010592) |
| 0.0 |
0.0 |
GO:0043278 |
response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.0 |
0.4 |
GO:0030317 |
sperm motility(GO:0030317) |
| 0.0 |
0.1 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.0 |
0.1 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 |
0.1 |
GO:0002076 |
osteoblast development(GO:0002076) |
| 0.0 |
0.1 |
GO:0045607 |
regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 |
0.2 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.0 |
0.1 |
GO:0005513 |
detection of calcium ion(GO:0005513) |
| 0.0 |
0.1 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 |
0.0 |
GO:0050858 |
negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
| 0.0 |
0.0 |
GO:1900037 |
regulation of cellular response to hypoxia(GO:1900037) |
| 0.0 |
0.0 |
GO:0015959 |
diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.0 |
0.0 |
GO:0061055 |
myotome development(GO:0061055) |
| 0.0 |
0.1 |
GO:0043649 |
dicarboxylic acid catabolic process(GO:0043649) |
| 0.0 |
0.1 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.0 |
0.4 |
GO:0097320 |
membrane tubulation(GO:0097320) |
| 0.0 |
0.0 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.0 |
0.0 |
GO:0001767 |
establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
| 0.0 |
0.0 |
GO:0022615 |
protein to membrane docking(GO:0022615) |
| 0.0 |
0.1 |
GO:0009992 |
cellular water homeostasis(GO:0009992) |
| 0.0 |
0.2 |
GO:0002052 |
positive regulation of neuroblast proliferation(GO:0002052) |
| 0.0 |
0.9 |
GO:1903955 |
positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 |
0.0 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 |
0.0 |
GO:2000279 |
negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.0 |
0.1 |
GO:0003170 |
heart valve development(GO:0003170) |
| 0.0 |
0.0 |
GO:0003197 |
endocardial cushion development(GO:0003197) |
| 0.0 |
0.0 |
GO:0051315 |
attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 |
0.2 |
GO:0015991 |
energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 |
0.0 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 |
0.1 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.0 |
0.0 |
GO:1990182 |
exosomal secretion(GO:1990182) |
| 0.0 |
0.0 |
GO:0033136 |
serine phosphorylation of STAT3 protein(GO:0033136) serine phosphorylation of STAT protein(GO:0042501) |
| 0.0 |
0.1 |
GO:0045879 |
negative regulation of smoothened signaling pathway(GO:0045879) |
| 0.0 |
0.1 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.0 |
0.0 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 |
0.0 |
GO:0032693 |
negative regulation of interleukin-10 production(GO:0032693) |
| 0.0 |
0.0 |
GO:0001782 |
B cell homeostasis(GO:0001782) |
| 0.0 |
0.3 |
GO:0070527 |
platelet aggregation(GO:0070527) |
| 0.0 |
0.3 |
GO:0007498 |
mesoderm development(GO:0007498) |
| 0.0 |
0.0 |
GO:0090005 |
negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.0 |
0.2 |
GO:0000910 |
cytokinesis(GO:0000910) |
| 0.0 |
0.0 |
GO:0051123 |
RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
| 0.0 |
0.0 |
GO:0021691 |
cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.0 |
0.0 |
GO:0034047 |
regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.0 |
0.0 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 |
0.0 |
GO:0009435 |
NAD biosynthetic process(GO:0009435) |