| 5.3 |
16.0 |
GO:0097402 |
neuroblast migration(GO:0097402) |
| 3.6 |
3.6 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 3.4 |
16.8 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 3.1 |
9.3 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 3.1 |
9.2 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 2.6 |
7.7 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 2.5 |
7.6 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 2.5 |
7.6 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 2.5 |
7.4 |
GO:0048352 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) |
| 2.4 |
2.4 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 2.2 |
6.7 |
GO:0030421 |
defecation(GO:0030421) |
| 2.2 |
11.0 |
GO:0015705 |
iodide transport(GO:0015705) |
| 2.1 |
6.3 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 2.1 |
2.1 |
GO:0090194 |
negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
| 2.1 |
2.1 |
GO:0030916 |
otic vesicle formation(GO:0030916) |
| 1.9 |
7.8 |
GO:0060032 |
notochord regression(GO:0060032) |
| 1.9 |
7.7 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 1.9 |
9.3 |
GO:0061181 |
regulation of chondrocyte development(GO:0061181) |
| 1.9 |
11.1 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 1.8 |
3.7 |
GO:0021938 |
smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 1.7 |
10.3 |
GO:0021798 |
forebrain dorsal/ventral pattern formation(GO:0021798) |
| 1.7 |
15.2 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 1.7 |
3.3 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 1.7 |
14.9 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 1.6 |
4.8 |
GO:0070625 |
zymogen granule exocytosis(GO:0070625) |
| 1.6 |
16.0 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 1.6 |
11.0 |
GO:0097421 |
liver regeneration(GO:0097421) |
| 1.6 |
3.2 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 1.5 |
4.6 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 1.5 |
4.5 |
GO:0086017 |
Purkinje myocyte action potential(GO:0086017) |
| 1.5 |
4.5 |
GO:0003360 |
brainstem development(GO:0003360) |
| 1.5 |
5.9 |
GO:2000525 |
regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 1.5 |
4.4 |
GO:0014028 |
notochord formation(GO:0014028) |
| 1.5 |
13.3 |
GO:0060613 |
fat pad development(GO:0060613) |
| 1.5 |
4.4 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 1.5 |
2.9 |
GO:0072197 |
ureter morphogenesis(GO:0072197) |
| 1.5 |
4.4 |
GO:0010248 |
B cell negative selection(GO:0002352) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 1.4 |
7.2 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.4 |
4.3 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 1.4 |
4.3 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 1.4 |
2.9 |
GO:0030858 |
positive regulation of epithelial cell differentiation(GO:0030858) |
| 1.4 |
7.1 |
GO:2000981 |
negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
| 1.4 |
6.9 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 1.3 |
5.4 |
GO:1900145 |
regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 1.3 |
5.4 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 1.3 |
1.3 |
GO:0042097 |
interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 1.3 |
4.0 |
GO:0009177 |
deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 1.3 |
5.3 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 1.3 |
17.1 |
GO:0032252 |
secretory granule localization(GO:0032252) |
| 1.3 |
2.6 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 1.3 |
5.2 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 1.3 |
5.1 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 1.3 |
2.6 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 1.3 |
2.5 |
GO:2000053 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 1.2 |
3.7 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 1.2 |
3.6 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 1.2 |
2.4 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 1.2 |
7.1 |
GO:0072539 |
T-helper 17 cell differentiation(GO:0072539) |
| 1.2 |
1.2 |
GO:2000382 |
positive regulation of mesoderm development(GO:2000382) |
| 1.2 |
3.5 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 1.2 |
18.5 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 1.1 |
3.4 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 1.1 |
5.7 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 1.1 |
8.0 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 1.1 |
6.9 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 1.1 |
11.4 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 1.1 |
3.3 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 1.1 |
1.1 |
GO:0060693 |
regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 1.1 |
2.2 |
GO:0097709 |
connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
| 1.1 |
27.6 |
GO:0006978 |
DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 1.1 |
5.5 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 1.1 |
3.3 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 1.1 |
5.4 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 1.1 |
3.2 |
GO:0019659 |
glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 1.1 |
3.2 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 1.1 |
1.1 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 1.1 |
4.3 |
GO:0021764 |
amygdala development(GO:0021764) |
| 1.1 |
3.2 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 1.1 |
7.5 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.1 |
1.1 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 1.1 |
7.4 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 1.0 |
2.1 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 1.0 |
4.1 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 1.0 |
5.2 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 1.0 |
2.1 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 1.0 |
6.1 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 1.0 |
11.2 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 1.0 |
5.1 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 1.0 |
3.0 |
GO:0072356 |
chromosome passenger complex localization to kinetochore(GO:0072356) |
| 1.0 |
6.0 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 1.0 |
3.0 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 1.0 |
4.9 |
GO:2000065 |
negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 1.0 |
2.0 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 1.0 |
2.0 |
GO:0021965 |
spinal cord ventral commissure morphogenesis(GO:0021965) |
| 1.0 |
5.8 |
GO:0051660 |
cortical microtubule organization(GO:0043622) establishment of centrosome localization(GO:0051660) |
| 1.0 |
1.9 |
GO:0035562 |
negative regulation of chromatin binding(GO:0035562) |
| 1.0 |
2.9 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.9 |
7.6 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.9 |
5.6 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.9 |
4.7 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.9 |
2.8 |
GO:0010633 |
negative regulation of epithelial cell migration(GO:0010633) |
| 0.9 |
1.8 |
GO:0003404 |
optic vesicle morphogenesis(GO:0003404) |
| 0.9 |
8.2 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.9 |
7.3 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.9 |
2.7 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.9 |
2.7 |
GO:0014719 |
skeletal muscle satellite cell activation(GO:0014719) |
| 0.9 |
5.4 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.9 |
5.4 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.9 |
2.7 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.9 |
7.9 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.9 |
3.5 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.9 |
3.5 |
GO:0046836 |
glycolipid transport(GO:0046836) |
| 0.9 |
5.3 |
GO:0003190 |
atrioventricular valve formation(GO:0003190) |
| 0.9 |
2.6 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.9 |
0.9 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.9 |
3.5 |
GO:0065001 |
negative regulation of histone H3-K36 methylation(GO:0000415) specification of axis polarity(GO:0065001) |
| 0.9 |
2.6 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.9 |
2.6 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.9 |
4.3 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.9 |
8.6 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.9 |
3.4 |
GO:0048570 |
notochord morphogenesis(GO:0048570) |
| 0.8 |
0.8 |
GO:1904058 |
positive regulation of sensory perception of pain(GO:1904058) |
| 0.8 |
5.0 |
GO:0031946 |
regulation of glucocorticoid biosynthetic process(GO:0031946) |
| 0.8 |
2.5 |
GO:0034241 |
positive regulation of macrophage fusion(GO:0034241) |
| 0.8 |
2.5 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.8 |
2.5 |
GO:0048208 |
vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.8 |
2.5 |
GO:0097461 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.8 |
2.5 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.8 |
0.8 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.8 |
4.1 |
GO:0015867 |
ATP transport(GO:0015867) |
| 0.8 |
0.8 |
GO:0014834 |
skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.8 |
0.8 |
GO:0009880 |
embryonic pattern specification(GO:0009880) |
| 0.8 |
3.3 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.8 |
3.2 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.8 |
5.6 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.8 |
3.2 |
GO:0002072 |
optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.8 |
6.4 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.8 |
13.5 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.8 |
2.4 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.8 |
0.8 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.8 |
0.8 |
GO:0008582 |
regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.8 |
2.3 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.8 |
3.1 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.8 |
3.1 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.8 |
3.1 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.8 |
2.3 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.8 |
8.4 |
GO:0014842 |
skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) |
| 0.8 |
2.3 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.8 |
2.3 |
GO:0072204 |
cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.8 |
3.0 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.8 |
0.8 |
GO:0036228 |
protein targeting to nuclear inner membrane(GO:0036228) |
| 0.7 |
0.7 |
GO:0045590 |
negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.7 |
8.2 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.7 |
3.0 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 0.7 |
9.6 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 0.7 |
2.2 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.7 |
0.7 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.7 |
4.4 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.7 |
2.9 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.7 |
2.9 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.7 |
4.4 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.7 |
0.7 |
GO:0043101 |
purine-containing compound salvage(GO:0043101) |
| 0.7 |
1.4 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.7 |
2.1 |
GO:0002636 |
positive regulation of germinal center formation(GO:0002636) |
| 0.7 |
4.3 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.7 |
0.7 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.7 |
0.7 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.7 |
2.8 |
GO:0035878 |
nail development(GO:0035878) |
| 0.7 |
4.2 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.7 |
3.5 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.7 |
2.8 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.7 |
2.1 |
GO:0021893 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) |
| 0.7 |
2.0 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.7 |
2.7 |
GO:1904667 |
negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.7 |
4.1 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.7 |
2.0 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.7 |
2.0 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.7 |
0.7 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.7 |
7.9 |
GO:0001779 |
natural killer cell differentiation(GO:0001779) |
| 0.7 |
5.9 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.7 |
3.3 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.7 |
0.7 |
GO:0061054 |
dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
| 0.7 |
2.0 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 0.6 |
2.6 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.6 |
3.2 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.6 |
2.6 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) |
| 0.6 |
4.5 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.6 |
3.2 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.6 |
5.0 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 0.6 |
1.9 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 0.6 |
4.4 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.6 |
2.5 |
GO:0072675 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.6 |
1.3 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.6 |
1.3 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 0.6 |
2.5 |
GO:0010890 |
positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.6 |
1.9 |
GO:2001206 |
positive regulation of osteoclast development(GO:2001206) |
| 0.6 |
5.0 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 0.6 |
1.2 |
GO:2000224 |
testosterone biosynthetic process(GO:0061370) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.6 |
1.9 |
GO:0003376 |
sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.6 |
3.7 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.6 |
2.5 |
GO:2000483 |
negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.6 |
3.1 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.6 |
0.6 |
GO:0060536 |
cartilage morphogenesis(GO:0060536) |
| 0.6 |
1.8 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.6 |
2.4 |
GO:0051971 |
positive regulation of transmission of nerve impulse(GO:0051971) |
| 0.6 |
1.8 |
GO:0090425 |
hepatocyte cell migration(GO:0002194) branching involved in pancreas morphogenesis(GO:0061114) acinar cell differentiation(GO:0090425) regulation of forebrain neuron differentiation(GO:2000977) positive regulation of forebrain neuron differentiation(GO:2000979) |
| 0.6 |
1.8 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.6 |
1.2 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.6 |
7.2 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.6 |
1.8 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.6 |
4.2 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.6 |
3.0 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.6 |
2.4 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.6 |
4.8 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.6 |
3.0 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.6 |
2.4 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.6 |
3.0 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.6 |
1.8 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.6 |
4.1 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.6 |
0.6 |
GO:1904030 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.6 |
0.6 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.6 |
3.5 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.6 |
1.8 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.6 |
1.8 |
GO:0070844 |
misfolded protein transport(GO:0070843) polyubiquitinated protein transport(GO:0070844) polyubiquitinated misfolded protein transport(GO:0070845) Hsp90 deacetylation(GO:0070846) |
| 0.6 |
3.5 |
GO:0060836 |
lymphatic endothelial cell differentiation(GO:0060836) |
| 0.6 |
1.2 |
GO:0007056 |
spindle assembly involved in female meiosis(GO:0007056) |
| 0.6 |
6.9 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.6 |
2.3 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.6 |
1.1 |
GO:0048636 |
positive regulation of striated muscle tissue development(GO:0045844) positive regulation of muscle organ development(GO:0048636) |
| 0.6 |
1.1 |
GO:0048863 |
stem cell differentiation(GO:0048863) |
| 0.6 |
11.4 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.6 |
4.0 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.6 |
1.1 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.6 |
2.2 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.6 |
2.2 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.6 |
3.4 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.6 |
1.1 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.6 |
0.6 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.6 |
1.7 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.6 |
0.6 |
GO:0035630 |
bone mineralization involved in bone maturation(GO:0035630) |
| 0.6 |
5.0 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.6 |
0.6 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.6 |
1.1 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.6 |
2.2 |
GO:2001137 |
positive regulation of endocytic recycling(GO:2001137) |
| 0.5 |
12.6 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.5 |
1.6 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.5 |
4.3 |
GO:2000258 |
negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
| 0.5 |
3.2 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.5 |
2.2 |
GO:0051305 |
chromosome movement towards spindle pole(GO:0051305) |
| 0.5 |
0.5 |
GO:0000963 |
mitochondrial RNA processing(GO:0000963) |
| 0.5 |
1.6 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.5 |
3.8 |
GO:0090132 |
tissue migration(GO:0090130) epithelium migration(GO:0090132) |
| 0.5 |
0.5 |
GO:0060385 |
axonogenesis involved in innervation(GO:0060385) |
| 0.5 |
1.6 |
GO:1901675 |
response to methylglyoxal(GO:0051595) negative regulation of histone H3-K27 acetylation(GO:1901675) |
| 0.5 |
3.7 |
GO:0045198 |
establishment of epithelial cell apical/basal polarity(GO:0045198) |
| 0.5 |
1.6 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.5 |
1.1 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.5 |
4.2 |
GO:1903689 |
regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.5 |
2.1 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.5 |
3.1 |
GO:0006570 |
tyrosine metabolic process(GO:0006570) |
| 0.5 |
2.1 |
GO:0071305 |
cellular response to vitamin D(GO:0071305) |
| 0.5 |
4.2 |
GO:0010766 |
negative regulation of sodium ion transport(GO:0010766) |
| 0.5 |
1.0 |
GO:0046641 |
positive regulation of alpha-beta T cell proliferation(GO:0046641) |
| 0.5 |
1.0 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.5 |
2.6 |
GO:0060272 |
embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.5 |
4.1 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.5 |
1.0 |
GO:0051124 |
synaptic growth at neuromuscular junction(GO:0051124) |
| 0.5 |
2.0 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.5 |
4.1 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.5 |
2.0 |
GO:0003365 |
establishment of cell polarity involved in ameboidal cell migration(GO:0003365) |
| 0.5 |
1.5 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.5 |
1.5 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.5 |
1.0 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.5 |
2.0 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.5 |
6.4 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.5 |
4.4 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.5 |
1.9 |
GO:1902990 |
telomere maintenance via semi-conservative replication(GO:0032201) mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
| 0.5 |
2.4 |
GO:0051315 |
attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.5 |
1.9 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.5 |
1.0 |
GO:0007494 |
midgut development(GO:0007494) |
| 0.5 |
0.5 |
GO:0048619 |
embryonic hindgut morphogenesis(GO:0048619) |
| 0.5 |
1.9 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.5 |
1.4 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
| 0.5 |
2.9 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.5 |
1.4 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.5 |
0.9 |
GO:0060594 |
mammary gland specification(GO:0060594) |
| 0.5 |
4.7 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.5 |
0.5 |
GO:1905050 |
positive regulation of metallopeptidase activity(GO:1905050) |
| 0.5 |
1.9 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.5 |
3.7 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.5 |
5.1 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.5 |
2.3 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.5 |
2.8 |
GO:0031100 |
organ regeneration(GO:0031100) |
| 0.5 |
1.4 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.5 |
3.7 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.5 |
0.5 |
GO:0050685 |
positive regulation of mRNA processing(GO:0050685) |
| 0.5 |
0.5 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.5 |
1.8 |
GO:1900147 |
Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.5 |
2.3 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.5 |
1.8 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.5 |
1.4 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.5 |
2.3 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.5 |
1.8 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.5 |
0.5 |
GO:0072038 |
mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
| 0.5 |
2.7 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.4 |
1.8 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.4 |
1.3 |
GO:0090274 |
positive regulation of somatostatin secretion(GO:0090274) |
| 0.4 |
2.2 |
GO:0046666 |
retinal cell programmed cell death(GO:0046666) |
| 0.4 |
3.6 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.4 |
0.4 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.4 |
3.1 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.4 |
0.4 |
GO:0021871 |
forebrain regionalization(GO:0021871) |
| 0.4 |
0.4 |
GO:0030950 |
establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.4 |
2.2 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.4 |
0.9 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.4 |
2.2 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.4 |
4.8 |
GO:0060391 |
positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.4 |
2.2 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.4 |
3.9 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.4 |
0.9 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.4 |
0.9 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 0.4 |
2.6 |
GO:0010747 |
positive regulation of plasma membrane long-chain fatty acid transport(GO:0010747) |
| 0.4 |
1.7 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.4 |
1.7 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.4 |
4.7 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.4 |
3.0 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.4 |
0.4 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.4 |
0.4 |
GO:0002925 |
positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.4 |
0.4 |
GO:0035112 |
genitalia morphogenesis(GO:0035112) |
| 0.4 |
1.3 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.4 |
4.2 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.4 |
0.4 |
GO:0048021 |
regulation of secondary metabolic process(GO:0043455) regulation of melanin biosynthetic process(GO:0048021) positive regulation of melanin biosynthetic process(GO:0048023) regulation of secondary metabolite biosynthetic process(GO:1900376) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 0.4 |
4.6 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.4 |
1.3 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.4 |
1.7 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.4 |
1.2 |
GO:0030202 |
heparin metabolic process(GO:0030202) |
| 0.4 |
0.4 |
GO:0090080 |
positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.4 |
2.9 |
GO:0035360 |
positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.4 |
0.4 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.4 |
1.2 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.4 |
0.8 |
GO:0033484 |
nitric oxide homeostasis(GO:0033484) |
| 0.4 |
0.4 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.4 |
0.8 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.4 |
2.0 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.4 |
0.8 |
GO:0002741 |
positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.4 |
0.4 |
GO:0048296 |
isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.4 |
13.4 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.4 |
1.6 |
GO:0090244 |
Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.4 |
0.8 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.4 |
1.2 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.4 |
1.6 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.4 |
2.4 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 0.4 |
0.4 |
GO:0060762 |
regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.4 |
0.8 |
GO:0010519 |
negative regulation of phospholipase activity(GO:0010519) |
| 0.4 |
2.0 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.4 |
1.6 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.4 |
3.9 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 0.4 |
3.1 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.4 |
0.4 |
GO:0032817 |
regulation of natural killer cell proliferation(GO:0032817) positive regulation of natural killer cell proliferation(GO:0032819) positive regulation of male germ cell proliferation(GO:2000256) |
| 0.4 |
1.2 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 0.4 |
1.2 |
GO:0010899 |
regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 0.4 |
0.4 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 0.4 |
2.3 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.4 |
1.2 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.4 |
0.8 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.4 |
1.5 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.4 |
0.8 |
GO:0060011 |
Sertoli cell proliferation(GO:0060011) |
| 0.4 |
1.1 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.4 |
1.5 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.4 |
0.8 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.4 |
1.9 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.4 |
0.4 |
GO:0021957 |
corticospinal tract morphogenesis(GO:0021957) |
| 0.4 |
3.8 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.4 |
0.8 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.4 |
3.0 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.4 |
1.5 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.4 |
3.4 |
GO:0060252 |
positive regulation of glial cell proliferation(GO:0060252) |
| 0.4 |
1.9 |
GO:0030539 |
male genitalia development(GO:0030539) |
| 0.4 |
1.1 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.4 |
1.1 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) aromatic amino acid family catabolic process(GO:0009074) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.4 |
1.1 |
GO:1903061 |
regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.4 |
8.5 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.4 |
3.3 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.4 |
2.6 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.4 |
2.2 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.4 |
7.0 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.4 |
1.1 |
GO:0000059 |
protein import into nucleus, docking(GO:0000059) |
| 0.4 |
0.7 |
GO:1905065 |
positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.4 |
0.7 |
GO:0070093 |
negative regulation of glucagon secretion(GO:0070093) |
| 0.4 |
0.7 |
GO:0051798 |
positive regulation of hair follicle development(GO:0051798) |
| 0.4 |
1.1 |
GO:0010944 |
negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.4 |
1.1 |
GO:0042998 |
positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.4 |
1.1 |
GO:1903519 |
apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.4 |
2.5 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.4 |
1.8 |
GO:0090091 |
positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.4 |
0.7 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.4 |
1.4 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.4 |
1.1 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.4 |
3.6 |
GO:0036289 |
peptidyl-serine autophosphorylation(GO:0036289) |
| 0.4 |
1.8 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 0.4 |
0.4 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.4 |
2.1 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.4 |
0.7 |
GO:0071673 |
positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.4 |
1.1 |
GO:0002184 |
cytoplasmic translational termination(GO:0002184) |
| 0.4 |
1.1 |
GO:0072431 |
signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) |
| 0.4 |
1.8 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.4 |
1.4 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.4 |
1.8 |
GO:0019216 |
regulation of lipid metabolic process(GO:0019216) |
| 0.4 |
1.1 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.3 |
1.0 |
GO:0051661 |
maintenance of centrosome location(GO:0051661) |
| 0.3 |
0.7 |
GO:0090032 |
negative regulation of steroid hormone biosynthetic process(GO:0090032) |
| 0.3 |
1.0 |
GO:0046655 |
folic acid metabolic process(GO:0046655) |
| 0.3 |
1.0 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.3 |
1.7 |
GO:0060297 |
regulation of sarcomere organization(GO:0060297) |
| 0.3 |
0.7 |
GO:1900426 |
positive regulation of defense response to bacterium(GO:1900426) |
| 0.3 |
4.1 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.3 |
7.2 |
GO:0060441 |
epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.3 |
1.0 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.3 |
7.4 |
GO:0035329 |
hippo signaling(GO:0035329) |
| 0.3 |
0.3 |
GO:0002904 |
positive regulation of B cell apoptotic process(GO:0002904) |
| 0.3 |
0.3 |
GO:0046885 |
regulation of hormone biosynthetic process(GO:0046885) |
| 0.3 |
1.0 |
GO:0019255 |
glucose 1-phosphate metabolic process(GO:0019255) |
| 0.3 |
2.3 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.3 |
2.3 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.3 |
11.8 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.3 |
1.6 |
GO:0031648 |
protein destabilization(GO:0031648) |
| 0.3 |
0.7 |
GO:0007063 |
regulation of sister chromatid cohesion(GO:0007063) |
| 0.3 |
0.6 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.3 |
1.3 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.3 |
0.3 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.3 |
1.0 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.3 |
1.6 |
GO:0090234 |
regulation of kinetochore assembly(GO:0090234) |
| 0.3 |
0.6 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.3 |
0.3 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.3 |
4.1 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.3 |
0.3 |
GO:0002331 |
pre-B cell allelic exclusion(GO:0002331) |
| 0.3 |
2.5 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.3 |
0.9 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 0.3 |
4.7 |
GO:2000144 |
positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.3 |
0.9 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.3 |
3.1 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.3 |
1.2 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) trophectodermal cell proliferation(GO:0001834) |
| 0.3 |
0.9 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.3 |
2.2 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.3 |
2.5 |
GO:0071803 |
positive regulation of podosome assembly(GO:0071803) |
| 0.3 |
5.9 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.3 |
0.9 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.3 |
2.5 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.3 |
1.2 |
GO:0035993 |
cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) deltoid tuberosity development(GO:0035993) cardiac neural crest cell development involved in outflow tract morphogenesis(GO:0061309) |
| 0.3 |
0.9 |
GO:0006338 |
chromatin remodeling(GO:0006338) |
| 0.3 |
2.1 |
GO:0046325 |
negative regulation of glucose import(GO:0046325) |
| 0.3 |
6.4 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.3 |
2.1 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.3 |
0.9 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.3 |
1.8 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.3 |
0.3 |
GO:0048631 |
regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.3 |
0.9 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.3 |
0.9 |
GO:1902415 |
regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
| 0.3 |
1.5 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.3 |
2.4 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.3 |
1.5 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.3 |
0.6 |
GO:0060235 |
lens induction in camera-type eye(GO:0060235) |
| 0.3 |
0.9 |
GO:2000851 |
positive regulation of glucocorticoid secretion(GO:2000851) |
| 0.3 |
1.8 |
GO:0061087 |
positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.3 |
1.2 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.3 |
0.6 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.3 |
0.3 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.3 |
0.6 |
GO:0072243 |
metanephric nephron epithelium development(GO:0072243) |
| 0.3 |
0.9 |
GO:0045072 |
regulation of interferon-gamma biosynthetic process(GO:0045072) positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
| 0.3 |
2.0 |
GO:0006924 |
activation-induced cell death of T cells(GO:0006924) |
| 0.3 |
5.2 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.3 |
1.2 |
GO:0046476 |
glycosylceramide biosynthetic process(GO:0046476) |
| 0.3 |
4.3 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.3 |
0.6 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.3 |
0.9 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.3 |
0.6 |
GO:0071865 |
regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.3 |
2.3 |
GO:0071459 |
protein localization to chromosome, centromeric region(GO:0071459) |
| 0.3 |
0.9 |
GO:0009644 |
response to high light intensity(GO:0009644) |
| 0.3 |
0.6 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.3 |
2.0 |
GO:2001198 |
regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.3 |
0.9 |
GO:1901860 |
positive regulation of mitochondrial DNA metabolic process(GO:1901860) |
| 0.3 |
1.1 |
GO:0046084 |
adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.3 |
0.6 |
GO:0061687 |
detoxification of inorganic compound(GO:0061687) |
| 0.3 |
0.6 |
GO:2000484 |
positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.3 |
3.4 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.3 |
1.7 |
GO:0048702 |
embryonic neurocranium morphogenesis(GO:0048702) |
| 0.3 |
0.8 |
GO:0043584 |
nose development(GO:0043584) |
| 0.3 |
2.0 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.3 |
0.6 |
GO:2000416 |
regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.3 |
3.9 |
GO:0032508 |
DNA duplex unwinding(GO:0032508) |
| 0.3 |
2.8 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.3 |
0.6 |
GO:0046835 |
carbohydrate phosphorylation(GO:0046835) |
| 0.3 |
0.6 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.3 |
0.3 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.3 |
0.8 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.3 |
0.8 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.3 |
8.2 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.3 |
1.4 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.3 |
0.8 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.3 |
3.8 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.3 |
1.1 |
GO:0042403 |
thyroid hormone metabolic process(GO:0042403) |
| 0.3 |
1.1 |
GO:0038063 |
collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
| 0.3 |
0.8 |
GO:0015793 |
renal water transport(GO:0003097) glycerol transport(GO:0015793) renal water absorption(GO:0070295) |
| 0.3 |
1.9 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.3 |
0.3 |
GO:0003161 |
cardiac conduction system development(GO:0003161) |
| 0.3 |
0.5 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.3 |
0.3 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.3 |
2.1 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.3 |
2.1 |
GO:0031498 |
nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
| 0.3 |
0.8 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.3 |
7.0 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.3 |
1.0 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.3 |
0.5 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.3 |
0.3 |
GO:0001866 |
NK T cell proliferation(GO:0001866) |
| 0.3 |
2.8 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.3 |
4.9 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.3 |
0.8 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.3 |
0.3 |
GO:0046877 |
regulation of saliva secretion(GO:0046877) |
| 0.3 |
0.8 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.3 |
1.3 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.3 |
1.0 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.3 |
2.0 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.3 |
0.3 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.3 |
1.0 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.3 |
1.0 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.2 |
3.0 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.2 |
1.2 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.2 |
0.5 |
GO:0070922 |
small RNA loading onto RISC(GO:0070922) |
| 0.2 |
1.7 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.2 |
0.2 |
GO:0043974 |
histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.2 |
0.7 |
GO:0009174 |
UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.2 |
0.5 |
GO:0003203 |
endocardial cushion morphogenesis(GO:0003203) |
| 0.2 |
0.5 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.2 |
0.2 |
GO:0003100 |
regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.2 |
2.9 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.2 |
0.5 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.2 |
0.2 |
GO:0051875 |
melanosome localization(GO:0032400) pigment granule localization(GO:0051875) |
| 0.2 |
3.4 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.2 |
1.5 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 0.2 |
5.1 |
GO:0046596 |
regulation of viral entry into host cell(GO:0046596) |
| 0.2 |
1.7 |
GO:0071850 |
mitotic cell cycle arrest(GO:0071850) |
| 0.2 |
1.4 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) |
| 0.2 |
0.2 |
GO:0060718 |
chorionic trophoblast cell differentiation(GO:0060718) |
| 0.2 |
1.4 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.2 |
0.2 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.2 |
0.9 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.2 |
0.7 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.2 |
6.1 |
GO:0030514 |
negative regulation of BMP signaling pathway(GO:0030514) |
| 0.2 |
1.6 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.2 |
1.6 |
GO:0045901 |
positive regulation of translational elongation(GO:0045901) |
| 0.2 |
1.6 |
GO:1902033 |
regulation of hematopoietic stem cell proliferation(GO:1902033) |
| 0.2 |
0.5 |
GO:0045618 |
positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.2 |
0.7 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.2 |
1.4 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.2 |
0.9 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.2 |
0.5 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.2 |
4.1 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.2 |
1.1 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.2 |
1.1 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.2 |
1.8 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.2 |
0.9 |
GO:1902916 |
positive regulation of protein polyubiquitination(GO:1902916) |
| 0.2 |
0.9 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.2 |
0.9 |
GO:0051382 |
kinetochore assembly(GO:0051382) |
| 0.2 |
4.5 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.2 |
1.1 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.2 |
1.1 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.2 |
0.4 |
GO:0009948 |
anterior/posterior axis specification(GO:0009948) |
| 0.2 |
0.2 |
GO:0015920 |
lipopolysaccharide transport(GO:0015920) |
| 0.2 |
0.4 |
GO:0042518 |
negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.2 |
0.4 |
GO:0042701 |
progesterone secretion(GO:0042701) |
| 0.2 |
1.1 |
GO:2000105 |
positive regulation of DNA-dependent DNA replication(GO:2000105) |
| 0.2 |
0.4 |
GO:0097501 |
stress response to metal ion(GO:0097501) |
| 0.2 |
0.7 |
GO:0090169 |
regulation of spindle assembly(GO:0090169) regulation of mitotic spindle assembly(GO:1901673) |
| 0.2 |
0.7 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.2 |
0.4 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.2 |
4.8 |
GO:0048025 |
negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
| 0.2 |
0.9 |
GO:0021983 |
pituitary gland development(GO:0021983) |
| 0.2 |
2.0 |
GO:0071364 |
cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.2 |
0.2 |
GO:1902255 |
positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.2 |
1.1 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.2 |
0.6 |
GO:0043696 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.2 |
0.6 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.2 |
0.2 |
GO:0034238 |
macrophage fusion(GO:0034238) |
| 0.2 |
0.4 |
GO:0002182 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.2 |
21.5 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.2 |
0.6 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.2 |
7.0 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.2 |
0.2 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.2 |
1.3 |
GO:1904754 |
positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.2 |
1.5 |
GO:0071285 |
cellular response to lithium ion(GO:0071285) |
| 0.2 |
1.0 |
GO:0035510 |
DNA dealkylation(GO:0035510) |
| 0.2 |
1.0 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.2 |
0.6 |
GO:2000768 |
glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.2 |
1.5 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.2 |
0.2 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.2 |
0.6 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.2 |
1.6 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.2 |
0.8 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.2 |
0.6 |
GO:0035089 |
establishment of apical/basal cell polarity(GO:0035089) |
| 0.2 |
0.4 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.2 |
1.0 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.2 |
0.6 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.2 |
0.2 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.2 |
0.6 |
GO:1900127 |
positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.2 |
0.2 |
GO:0071034 |
CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.2 |
0.6 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.2 |
6.3 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.2 |
0.2 |
GO:0070873 |
regulation of glycogen metabolic process(GO:0070873) |
| 0.2 |
0.8 |
GO:0072176 |
nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
| 0.2 |
1.0 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.2 |
0.4 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 0.2 |
4.5 |
GO:0009649 |
entrainment of circadian clock(GO:0009649) |
| 0.2 |
1.0 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.2 |
1.0 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.2 |
1.0 |
GO:0031022 |
nuclear migration along microfilament(GO:0031022) |
| 0.2 |
0.4 |
GO:0019915 |
lipid storage(GO:0019915) |
| 0.2 |
0.8 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.2 |
0.4 |
GO:0001951 |
intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 0.2 |
0.6 |
GO:0032782 |
bile acid secretion(GO:0032782) |
| 0.2 |
1.5 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.2 |
0.6 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.2 |
1.5 |
GO:0060746 |
parental behavior(GO:0060746) |
| 0.2 |
0.4 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.2 |
5.8 |
GO:0051304 |
chromosome separation(GO:0051304) |
| 0.2 |
1.5 |
GO:0007062 |
sister chromatid cohesion(GO:0007062) |
| 0.2 |
1.9 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.2 |
0.2 |
GO:0033084 |
immature T cell proliferation in thymus(GO:0033080) regulation of immature T cell proliferation(GO:0033083) regulation of immature T cell proliferation in thymus(GO:0033084) |
| 0.2 |
0.2 |
GO:0042633 |
molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.2 |
2.2 |
GO:2001224 |
positive regulation of neuron migration(GO:2001224) |
| 0.2 |
0.6 |
GO:0019852 |
L-ascorbic acid metabolic process(GO:0019852) |
| 0.2 |
0.9 |
GO:0010763 |
positive regulation of fibroblast migration(GO:0010763) |
| 0.2 |
1.3 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.2 |
0.4 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.2 |
1.1 |
GO:0032332 |
positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.2 |
0.2 |
GO:0060018 |
astrocyte fate commitment(GO:0060018) |
| 0.2 |
0.2 |
GO:0040038 |
meiotic cytokinesis(GO:0033206) polar body extrusion after meiotic divisions(GO:0040038) |
| 0.2 |
0.5 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.2 |
1.3 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.2 |
1.6 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.2 |
0.5 |
GO:0019676 |
ammonia assimilation cycle(GO:0019676) |
| 0.2 |
0.2 |
GO:2001012 |
mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
| 0.2 |
0.2 |
GO:0039692 |
single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.2 |
0.3 |
GO:0003091 |
renal water homeostasis(GO:0003091) |
| 0.2 |
0.3 |
GO:0030862 |
regulation of polarized epithelial cell differentiation(GO:0030860) positive regulation of polarized epithelial cell differentiation(GO:0030862) |
| 0.2 |
0.2 |
GO:0060324 |
face development(GO:0060324) |
| 0.2 |
0.9 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.2 |
1.2 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.2 |
0.2 |
GO:0061428 |
negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.2 |
0.7 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.2 |
0.5 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.2 |
0.5 |
GO:0003215 |
cardiac right ventricle morphogenesis(GO:0003215) |
| 0.2 |
0.9 |
GO:0045930 |
negative regulation of mitotic cell cycle(GO:0045930) |
| 0.2 |
1.4 |
GO:0000467 |
exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.2 |
2.6 |
GO:0033194 |
response to hydroperoxide(GO:0033194) |
| 0.2 |
0.5 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.2 |
0.3 |
GO:1903279 |
regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.2 |
0.8 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.2 |
0.7 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.2 |
0.2 |
GO:0099515 |
actin filament-based transport(GO:0099515) |
| 0.2 |
0.3 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.2 |
0.7 |
GO:0015819 |
lysine transport(GO:0015819) |
| 0.2 |
0.5 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.2 |
0.7 |
GO:0010288 |
response to lead ion(GO:0010288) |
| 0.2 |
0.8 |
GO:0070633 |
transepithelial transport(GO:0070633) |
| 0.2 |
3.0 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.2 |
1.6 |
GO:0015884 |
folic acid transport(GO:0015884) |
| 0.2 |
0.5 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.2 |
0.2 |
GO:0042088 |
T-helper 1 type immune response(GO:0042088) |
| 0.2 |
0.7 |
GO:0045839 |
negative regulation of mitotic nuclear division(GO:0045839) |
| 0.2 |
0.3 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.2 |
1.9 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.2 |
0.3 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.2 |
0.5 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.2 |
0.3 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.2 |
1.5 |
GO:0032516 |
positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.2 |
0.5 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.2 |
0.5 |
GO:0034379 |
very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.2 |
0.6 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 0.2 |
0.6 |
GO:1902897 |
regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.2 |
1.1 |
GO:0015838 |
amino-acid betaine transport(GO:0015838) |
| 0.2 |
0.5 |
GO:0030225 |
macrophage differentiation(GO:0030225) |
| 0.2 |
1.6 |
GO:0048535 |
lymph node development(GO:0048535) |
| 0.2 |
3.0 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.2 |
0.9 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.2 |
0.8 |
GO:0009169 |
purine nucleoside monophosphate catabolic process(GO:0009128) ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.2 |
0.6 |
GO:0061029 |
eyelid development in camera-type eye(GO:0061029) |
| 0.2 |
3.3 |
GO:0000184 |
nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.2 |
2.9 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.2 |
0.9 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.2 |
0.5 |
GO:0001781 |
neutrophil apoptotic process(GO:0001781) regulation of neutrophil apoptotic process(GO:0033029) negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.2 |
0.5 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 0.2 |
0.3 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.2 |
2.2 |
GO:0071539 |
protein localization to centrosome(GO:0071539) |
| 0.2 |
0.3 |
GO:2001286 |
regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.2 |
0.5 |
GO:1901533 |
negative regulation of hematopoietic progenitor cell differentiation(GO:1901533) |
| 0.2 |
2.6 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.2 |
0.6 |
GO:0071372 |
cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.2 |
0.6 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.2 |
0.5 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.2 |
0.5 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.2 |
0.3 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.2 |
3.8 |
GO:0045737 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.2 |
2.0 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.1 |
0.3 |
GO:0001774 |
microglial cell activation(GO:0001774) |
| 0.1 |
2.7 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.1 |
1.2 |
GO:0043501 |
skeletal muscle adaptation(GO:0043501) |
| 0.1 |
0.6 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.1 |
1.0 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.1 |
0.4 |
GO:1903347 |
negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.1 |
0.1 |
GO:0010046 |
response to mycotoxin(GO:0010046) |
| 0.1 |
1.0 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.1 |
0.3 |
GO:0001945 |
lymph vessel development(GO:0001945) |
| 0.1 |
0.9 |
GO:0089711 |
L-glutamate transmembrane transport(GO:0089711) |
| 0.1 |
0.3 |
GO:0043619 |
regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.1 |
0.4 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.1 |
0.9 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.1 |
0.4 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.1 |
1.7 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.1 |
0.3 |
GO:0090177 |
establishment of planar polarity involved in neural tube closure(GO:0090177) |
| 0.1 |
0.1 |
GO:2000773 |
negative regulation of cellular senescence(GO:2000773) |
| 0.1 |
1.6 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
0.3 |
GO:0050748 |
negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.1 |
0.4 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.1 |
0.7 |
GO:0015669 |
gas transport(GO:0015669) oxygen transport(GO:0015671) |
| 0.1 |
0.6 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.1 |
1.3 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.1 |
0.1 |
GO:0043489 |
RNA stabilization(GO:0043489) |
| 0.1 |
0.4 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.1 |
1.1 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 |
0.7 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 |
0.3 |
GO:0002092 |
positive regulation of receptor internalization(GO:0002092) |
| 0.1 |
0.1 |
GO:0060856 |
establishment of blood-brain barrier(GO:0060856) |
| 0.1 |
0.6 |
GO:0046909 |
intermembrane transport(GO:0046909) |
| 0.1 |
0.8 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 |
1.0 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.1 |
1.5 |
GO:0030201 |
heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.1 |
3.1 |
GO:0046039 |
GTP metabolic process(GO:0046039) |
| 0.1 |
0.4 |
GO:0060947 |
cardiac vascular smooth muscle cell differentiation(GO:0060947) |
| 0.1 |
1.1 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.1 |
0.4 |
GO:0036233 |
glycine import(GO:0036233) |
| 0.1 |
0.1 |
GO:0060412 |
ventricular septum morphogenesis(GO:0060412) |
| 0.1 |
0.4 |
GO:0050929 |
corticospinal neuron axon guidance through spinal cord(GO:0021972) positive regulation of negative chemotaxis(GO:0050924) induction of negative chemotaxis(GO:0050929) negative regulation of smooth muscle cell chemotaxis(GO:0071672) negative regulation of mononuclear cell migration(GO:0071676) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.1 |
1.1 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.1 |
0.3 |
GO:0032075 |
positive regulation of nuclease activity(GO:0032075) |
| 0.1 |
0.8 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.1 |
0.3 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.1 |
0.1 |
GO:0000414 |
regulation of histone H3-K36 methylation(GO:0000414) |
| 0.1 |
0.4 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 |
0.5 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.1 |
0.4 |
GO:1903371 |
regulation of endoplasmic reticulum tubular network organization(GO:1903371) positive regulation of IRE1-mediated unfolded protein response(GO:1903896) positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.1 |
0.7 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.1 |
0.5 |
GO:0097194 |
execution phase of apoptosis(GO:0097194) |
| 0.1 |
0.1 |
GO:0014744 |
positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of muscle adaptation(GO:0014744) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.1 |
0.4 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.1 |
2.7 |
GO:0007492 |
endoderm development(GO:0007492) |
| 0.1 |
0.8 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.1 |
1.2 |
GO:0014823 |
response to activity(GO:0014823) |
| 0.1 |
1.2 |
GO:0002329 |
immature B cell differentiation(GO:0002327) pre-B cell differentiation(GO:0002329) |
| 0.1 |
2.4 |
GO:0001890 |
placenta development(GO:0001890) |
| 0.1 |
0.3 |
GO:1903753 |
negative regulation of p38MAPK cascade(GO:1903753) |
| 0.1 |
0.8 |
GO:0008053 |
mitochondrial fusion(GO:0008053) |
| 0.1 |
1.0 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.1 |
1.0 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 |
0.5 |
GO:0031441 |
negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.1 |
4.3 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
0.4 |
GO:0042246 |
tissue regeneration(GO:0042246) |
| 0.1 |
1.2 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 |
1.0 |
GO:0033572 |
transferrin transport(GO:0033572) |
| 0.1 |
0.3 |
GO:0071649 |
chemokine (C-C motif) ligand 5 production(GO:0071609) regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.1 |
0.4 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 |
0.5 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 |
2.0 |
GO:0008589 |
regulation of smoothened signaling pathway(GO:0008589) |
| 0.1 |
0.1 |
GO:0072584 |
caveolin-mediated endocytosis(GO:0072584) |
| 0.1 |
0.4 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 |
2.1 |
GO:0001658 |
branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.1 |
0.5 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.1 |
0.7 |
GO:0002089 |
lens morphogenesis in camera-type eye(GO:0002089) |
| 0.1 |
0.1 |
GO:1902837 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) amino acid import into cell(GO:1902837) L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 0.1 |
0.4 |
GO:0070836 |
caveola assembly(GO:0070836) |
| 0.1 |
0.7 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.1 |
0.4 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 |
0.1 |
GO:1903026 |
negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.1 |
2.5 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.1 |
2.0 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
0.5 |
GO:0071166 |
ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.1 |
0.5 |
GO:0000076 |
DNA replication checkpoint(GO:0000076) |
| 0.1 |
0.5 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.1 |
0.2 |
GO:2000680 |
regulation of rubidium ion transport(GO:2000680) |
| 0.1 |
1.8 |
GO:0045445 |
myoblast differentiation(GO:0045445) |
| 0.1 |
0.4 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.1 |
0.1 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.1 |
0.6 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.1 |
1.1 |
GO:0019471 |
4-hydroxyproline metabolic process(GO:0019471) |
| 0.1 |
0.1 |
GO:2000313 |
fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.1 |
0.2 |
GO:1901838 |
positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 |
1.2 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 |
0.1 |
GO:0044387 |
negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
| 0.1 |
0.1 |
GO:2000058 |
regulation of proteolysis involved in cellular protein catabolic process(GO:1903050) regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000058) |
| 0.1 |
0.4 |
GO:0034214 |
protein hexamerization(GO:0034214) |
| 0.1 |
0.4 |
GO:0043570 |
maintenance of DNA repeat elements(GO:0043570) |
| 0.1 |
0.2 |
GO:0006103 |
2-oxoglutarate metabolic process(GO:0006103) |
| 0.1 |
1.4 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.1 |
0.3 |
GO:0007320 |
insemination(GO:0007320) |
| 0.1 |
0.1 |
GO:0090344 |
negative regulation of cell aging(GO:0090344) |
| 0.1 |
0.2 |
GO:0035790 |
platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.1 |
2.7 |
GO:0033120 |
positive regulation of RNA splicing(GO:0033120) |
| 0.1 |
0.5 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 |
0.2 |
GO:0006278 |
RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
| 0.1 |
0.3 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.1 |
0.7 |
GO:0007257 |
activation of JUN kinase activity(GO:0007257) |
| 0.1 |
0.2 |
GO:0016445 |
somatic diversification of immunoglobulins(GO:0016445) |
| 0.1 |
0.2 |
GO:0046110 |
xanthine metabolic process(GO:0046110) |
| 0.1 |
0.3 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.1 |
1.0 |
GO:2001244 |
positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
| 0.1 |
1.2 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.1 |
1.4 |
GO:0017145 |
stem cell division(GO:0017145) |
| 0.1 |
0.2 |
GO:0006072 |
glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.1 |
0.2 |
GO:0097212 |
lysosomal membrane organization(GO:0097212) |
| 0.1 |
0.6 |
GO:2000191 |
regulation of fatty acid transport(GO:2000191) |
| 0.1 |
0.6 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.1 |
2.9 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 |
0.1 |
GO:0016573 |
histone acetylation(GO:0016573) internal peptidyl-lysine acetylation(GO:0018393) peptidyl-lysine acetylation(GO:0018394) |
| 0.1 |
0.5 |
GO:0010764 |
negative regulation of fibroblast migration(GO:0010764) |
| 0.1 |
0.4 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.1 |
0.2 |
GO:0006533 |
aspartate catabolic process(GO:0006533) |
| 0.1 |
0.5 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.1 |
0.9 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.1 |
0.2 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.1 |
0.5 |
GO:0042769 |
DNA damage response, detection of DNA damage(GO:0042769) |
| 0.1 |
0.5 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.1 |
0.6 |
GO:0043615 |
astrocyte cell migration(GO:0043615) |
| 0.1 |
0.5 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.1 |
0.7 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.1 |
1.5 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.1 |
0.1 |
GO:0046633 |
alpha-beta T cell proliferation(GO:0046633) |
| 0.1 |
0.3 |
GO:0071044 |
histone mRNA catabolic process(GO:0071044) |
| 0.1 |
0.3 |
GO:1903624 |
regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
| 0.1 |
3.9 |
GO:0000245 |
spliceosomal complex assembly(GO:0000245) |
| 0.1 |
0.5 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.1 |
0.8 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.1 |
2.7 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.1 |
0.6 |
GO:2001241 |
positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.1 |
0.8 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.1 |
0.4 |
GO:0042760 |
very long-chain fatty acid catabolic process(GO:0042760) |
| 0.1 |
0.4 |
GO:0060770 |
negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.1 |
0.1 |
GO:0043278 |
response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.1 |
0.3 |
GO:0072526 |
pyridine-containing compound catabolic process(GO:0072526) |
| 0.1 |
1.1 |
GO:0006260 |
DNA replication(GO:0006260) |
| 0.1 |
0.5 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.1 |
0.6 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.1 |
0.7 |
GO:0021846 |
cell proliferation in forebrain(GO:0021846) |
| 0.1 |
0.2 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.1 |
0.3 |
GO:1901072 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) glucosamine-containing compound catabolic process(GO:1901072) |
| 0.1 |
0.4 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 |
0.1 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.1 |
0.4 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.1 |
0.3 |
GO:2001240 |
negative regulation of signal transduction in absence of ligand(GO:1901099) regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001239) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.1 |
0.2 |
GO:0044030 |
regulation of DNA methylation(GO:0044030) |
| 0.1 |
0.5 |
GO:0090666 |
scaRNA localization to Cajal body(GO:0090666) |
| 0.1 |
2.8 |
GO:0070303 |
negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.1 |
0.3 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.1 |
0.5 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 0.1 |
0.1 |
GO:0061339 |
establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.1 |
0.5 |
GO:0042634 |
regulation of hair cycle(GO:0042634) |
| 0.1 |
4.4 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
0.5 |
GO:2001014 |
regulation of skeletal muscle cell differentiation(GO:2001014) |
| 0.1 |
0.1 |
GO:1990403 |
embryonic brain development(GO:1990403) |
| 0.1 |
1.1 |
GO:0001947 |
heart looping(GO:0001947) |
| 0.1 |
3.5 |
GO:0006446 |
regulation of translational initiation(GO:0006446) |
| 0.1 |
0.3 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 |
0.7 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.1 |
0.7 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.1 |
0.5 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.1 |
0.7 |
GO:0006730 |
one-carbon metabolic process(GO:0006730) |
| 0.1 |
0.3 |
GO:0014054 |
positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.1 |
0.5 |
GO:0030953 |
astral microtubule organization(GO:0030953) |
| 0.1 |
0.6 |
GO:0060351 |
cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.1 |
0.2 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 0.1 |
0.6 |
GO:0003085 |
negative regulation of systemic arterial blood pressure(GO:0003085) |
| 0.1 |
0.9 |
GO:0051156 |
glucose 6-phosphate metabolic process(GO:0051156) |
| 0.1 |
1.4 |
GO:0043631 |
RNA polyadenylation(GO:0043631) |
| 0.1 |
1.9 |
GO:0046856 |
phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 |
0.3 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.1 |
0.1 |
GO:1901068 |
guanosine-containing compound metabolic process(GO:1901068) |
| 0.1 |
0.5 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.1 |
0.9 |
GO:0006490 |
oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.1 |
0.4 |
GO:0072520 |
seminiferous tubule development(GO:0072520) |
| 0.1 |
0.3 |
GO:1904211 |
membrane protein proteolysis involved in retrograde protein transport, ER to cytosol(GO:1904211) |
| 0.1 |
0.2 |
GO:0072331 |
signal transduction by p53 class mediator(GO:0072331) |
| 0.1 |
0.4 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 |
0.1 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.1 |
0.2 |
GO:2000678 |
negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.1 |
0.4 |
GO:0045616 |
regulation of keratinocyte differentiation(GO:0045616) |
| 0.1 |
0.7 |
GO:0007140 |
male meiosis(GO:0007140) |
| 0.1 |
0.2 |
GO:1902109 |
negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
| 0.1 |
0.8 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.1 |
0.4 |
GO:0046135 |
pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
| 0.1 |
0.1 |
GO:0060135 |
maternal process involved in female pregnancy(GO:0060135) |
| 0.1 |
0.2 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 |
0.3 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.1 |
4.2 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.1 |
0.1 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 0.1 |
0.9 |
GO:0016568 |
chromatin modification(GO:0016568) |
| 0.1 |
0.1 |
GO:0001826 |
inner cell mass cell differentiation(GO:0001826) |
| 0.1 |
0.1 |
GO:0035771 |
interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.1 |
1.3 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.1 |
0.1 |
GO:0072203 |
cell proliferation involved in metanephros development(GO:0072203) |
| 0.1 |
0.3 |
GO:1902743 |
regulation of lamellipodium organization(GO:1902743) |
| 0.1 |
15.4 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.1 |
0.4 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.1 |
0.2 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.1 |
2.4 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.5 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.1 |
0.2 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.1 |
0.2 |
GO:0097278 |
complement-dependent cytotoxicity(GO:0097278) |
| 0.1 |
1.1 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.1 |
0.5 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.1 |
1.1 |
GO:0001841 |
neural tube formation(GO:0001841) |
| 0.1 |
0.1 |
GO:1901660 |
calcium ion export(GO:1901660) |
| 0.1 |
0.6 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 |
0.2 |
GO:0061458 |
reproductive system development(GO:0061458) |
| 0.1 |
0.1 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 |
0.3 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 |
0.3 |
GO:0035518 |
histone H2A monoubiquitination(GO:0035518) |
| 0.1 |
0.5 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.1 |
0.5 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 |
0.5 |
GO:0015677 |
copper ion import(GO:0015677) |
| 0.1 |
0.2 |
GO:0009211 |
pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 0.1 |
0.2 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 |
1.0 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.1 |
0.5 |
GO:0090022 |
regulation of neutrophil chemotaxis(GO:0090022) |
| 0.1 |
0.5 |
GO:1904816 |
positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.1 |
0.4 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.1 |
0.5 |
GO:0071577 |
zinc II ion transmembrane transport(GO:0071577) |
| 0.1 |
0.7 |
GO:0009437 |
amino-acid betaine metabolic process(GO:0006577) carnitine metabolic process(GO:0009437) |
| 0.1 |
0.7 |
GO:0098534 |
centriole replication(GO:0007099) centriole assembly(GO:0098534) |
| 0.1 |
0.4 |
GO:0030259 |
lipid glycosylation(GO:0030259) |
| 0.1 |
0.3 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.1 |
0.2 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 |
0.3 |
GO:0090503 |
RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.1 |
0.7 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.1 |
0.6 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.1 |
0.4 |
GO:0035025 |
positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.1 |
0.4 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 |
1.4 |
GO:0051497 |
negative regulation of stress fiber assembly(GO:0051497) |
| 0.1 |
3.2 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.1 |
0.1 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.1 |
0.3 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) chloride ion homeostasis(GO:0055064) |
| 0.1 |
0.1 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
0.6 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.1 |
0.3 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 |
0.1 |
GO:1905208 |
negative regulation of cardiocyte differentiation(GO:1905208) |
| 0.1 |
1.2 |
GO:0071108 |
protein K48-linked deubiquitination(GO:0071108) |
| 0.1 |
0.1 |
GO:0060008 |
Sertoli cell differentiation(GO:0060008) |
| 0.1 |
0.1 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.1 |
0.1 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 |
0.2 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.1 |
0.3 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.1 |
0.5 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.1 |
0.3 |
GO:0061684 |
chaperone-mediated autophagy(GO:0061684) |
| 0.1 |
0.2 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.1 |
0.2 |
GO:0042511 |
tyrosine phosphorylation of Stat1 protein(GO:0042508) positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
| 0.1 |
0.2 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
0.6 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.1 |
0.3 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 |
0.3 |
GO:0051893 |
regulation of focal adhesion assembly(GO:0051893) regulation of cell-substrate junction assembly(GO:0090109) regulation of adherens junction organization(GO:1903391) |
| 0.1 |
0.5 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 |
0.3 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 |
0.4 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 |
0.3 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.1 |
2.0 |
GO:0045727 |
positive regulation of translation(GO:0045727) |
| 0.1 |
0.2 |
GO:0033523 |
histone H2B ubiquitination(GO:0033523) |
| 0.1 |
0.4 |
GO:0001996 |
regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) positive regulation of heart rate by epinephrine(GO:0003065) positive regulation of blood pressure by epinephrine-norepinephrine(GO:0003321) |
| 0.1 |
0.1 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 0.1 |
0.2 |
GO:0014911 |
positive regulation of smooth muscle cell migration(GO:0014911) |
| 0.1 |
0.1 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.1 |
0.4 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 0.1 |
0.6 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 |
0.1 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 |
0.4 |
GO:0098739 |
sodium ion import across plasma membrane(GO:0098719) import across plasma membrane(GO:0098739) sodium ion import into cell(GO:1990118) |
| 0.1 |
1.0 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.1 |
0.1 |
GO:0003197 |
endocardial cushion development(GO:0003197) |
| 0.1 |
0.2 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 |
0.1 |
GO:0010872 |
regulation of cholesterol esterification(GO:0010872) |
| 0.1 |
0.1 |
GO:1900744 |
regulation of p38MAPK cascade(GO:1900744) |
| 0.1 |
0.3 |
GO:0009164 |
nucleoside catabolic process(GO:0009164) |
| 0.1 |
0.4 |
GO:0071479 |
cellular response to ionizing radiation(GO:0071479) |
| 0.1 |
0.1 |
GO:0042483 |
negative regulation of odontogenesis(GO:0042483) |
| 0.1 |
0.1 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 0.1 |
0.3 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.1 |
0.2 |
GO:1901341 |
positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.1 |
0.2 |
GO:0061042 |
vascular wound healing(GO:0061042) |
| 0.1 |
0.3 |
GO:0070193 |
synaptonemal complex organization(GO:0070193) |
| 0.1 |
0.1 |
GO:0060900 |
embryonic camera-type eye formation(GO:0060900) |
| 0.1 |
0.3 |
GO:0045076 |
regulation of interleukin-2 biosynthetic process(GO:0045076) |
| 0.1 |
0.2 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.1 |
5.1 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.1 |
0.2 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
0.3 |
GO:0080182 |
histone H3-K4 trimethylation(GO:0080182) |
| 0.1 |
0.2 |
GO:0018202 |
peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.1 |
0.4 |
GO:0006301 |
postreplication repair(GO:0006301) |
| 0.1 |
0.1 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.1 |
1.1 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.1 |
0.2 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.1 |
0.3 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.1 |
1.4 |
GO:0001895 |
retina homeostasis(GO:0001895) |
| 0.1 |
0.5 |
GO:0008630 |
intrinsic apoptotic signaling pathway in response to DNA damage(GO:0008630) |
| 0.1 |
0.1 |
GO:0010961 |
cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 |
0.1 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.1 |
0.6 |
GO:0045580 |
regulation of T cell differentiation(GO:0045580) |
| 0.1 |
0.5 |
GO:1902850 |
mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.1 |
0.2 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.1 |
1.2 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.1 |
0.1 |
GO:0019400 |
alditol metabolic process(GO:0019400) |
| 0.1 |
0.3 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.1 |
0.9 |
GO:0008584 |
male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.1 |
0.2 |
GO:0051771 |
negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 |
0.1 |
GO:0046077 |
dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.1 |
0.1 |
GO:0097066 |
response to thyroid hormone(GO:0097066) |
| 0.1 |
0.9 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.0 |
0.1 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 |
0.3 |
GO:0007095 |
mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.0 |
0.1 |
GO:0070734 |
histone H3-K27 methylation(GO:0070734) |
| 0.0 |
0.8 |
GO:0007368 |
determination of left/right symmetry(GO:0007368) |
| 0.0 |
0.1 |
GO:0030183 |
B cell differentiation(GO:0030183) |
| 0.0 |
0.2 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 |
0.2 |
GO:0006448 |
regulation of translational elongation(GO:0006448) |
| 0.0 |
0.1 |
GO:1904469 |
positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.0 |
0.1 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.0 |
0.1 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.0 |
0.3 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.0 |
0.1 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.0 |
0.1 |
GO:0046148 |
pigment biosynthetic process(GO:0046148) |
| 0.0 |
0.1 |
GO:0021794 |
thalamus development(GO:0021794) |
| 0.0 |
0.2 |
GO:0044342 |
type B pancreatic cell proliferation(GO:0044342) |
| 0.0 |
0.1 |
GO:0002021 |
response to dietary excess(GO:0002021) |
| 0.0 |
0.2 |
GO:0031666 |
positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 |
0.3 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 |
0.4 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 |
0.2 |
GO:0006661 |
phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.0 |
0.7 |
GO:0045137 |
development of primary sexual characteristics(GO:0045137) |
| 0.0 |
0.8 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.0 |
0.2 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 |
0.1 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 0.0 |
0.4 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.0 |
0.4 |
GO:0033233 |
regulation of protein sumoylation(GO:0033233) |
| 0.0 |
0.3 |
GO:0009449 |
gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.0 |
0.2 |
GO:0045601 |
regulation of endothelial cell differentiation(GO:0045601) |
| 0.0 |
0.3 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.0 |
0.6 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.0 |
0.5 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.0 |
0.4 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.0 |
0.5 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.0 |
0.1 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 |
1.0 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.0 |
0.1 |
GO:0035024 |
negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 |
0.2 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.0 |
0.1 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.0 |
0.3 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 |
0.2 |
GO:2000036 |
regulation of stem cell population maintenance(GO:2000036) |
| 0.0 |
0.2 |
GO:0008611 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.0 |
0.6 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.0 |
0.8 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.0 |
0.5 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.0 |
1.5 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.0 |
0.1 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 0.0 |
1.0 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.0 |
2.7 |
GO:0043123 |
positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.0 |
0.1 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 |
0.2 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.0 |
0.1 |
GO:0070536 |
protein K63-linked deubiquitination(GO:0070536) |
| 0.0 |
0.1 |
GO:0030205 |
dermatan sulfate metabolic process(GO:0030205) |
| 0.0 |
0.1 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.0 |
0.1 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 |
0.3 |
GO:0018095 |
protein polyglutamylation(GO:0018095) |
| 0.0 |
0.1 |
GO:0048312 |
intracellular distribution of mitochondria(GO:0048312) |
| 0.0 |
0.4 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.0 |
0.1 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.0 |
0.1 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 |
0.1 |
GO:0042790 |
transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.0 |
0.5 |
GO:0033209 |
tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.0 |
0.0 |
GO:0098501 |
polynucleotide dephosphorylation(GO:0098501) |
| 0.0 |
0.2 |
GO:0030813 |
positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.0 |
0.1 |
GO:0003351 |
epithelial cilium movement(GO:0003351) |
| 0.0 |
0.3 |
GO:0060628 |
regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.0 |
0.3 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.0 |
0.1 |
GO:0001542 |
ovulation from ovarian follicle(GO:0001542) |
| 0.0 |
0.1 |
GO:2000641 |
regulation of early endosome to late endosome transport(GO:2000641) |
| 0.0 |
0.3 |
GO:2001238 |
positive regulation of extrinsic apoptotic signaling pathway(GO:2001238) |
| 0.0 |
0.3 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.0 |
0.1 |
GO:0045333 |
energy derivation by oxidation of organic compounds(GO:0015980) cellular respiration(GO:0045333) |
| 0.0 |
0.1 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 |
0.1 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.0 |
0.1 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 |
0.1 |
GO:0046460 |
triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
| 0.0 |
0.3 |
GO:0034312 |
diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.0 |
0.2 |
GO:0071800 |
podosome assembly(GO:0071800) |
| 0.0 |
0.2 |
GO:0046040 |
IMP metabolic process(GO:0046040) |
| 0.0 |
0.2 |
GO:2000269 |
regulation of fibroblast apoptotic process(GO:2000269) |
| 0.0 |
0.0 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 |
0.2 |
GO:0033145 |
positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
| 0.0 |
0.2 |
GO:0055090 |
acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.0 |
0.0 |
GO:0072367 |
regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) regulation of lipid transport by negative regulation of transcription from RNA polymerase II promoter(GO:0072368) |
| 0.0 |
0.1 |
GO:0046485 |
ether lipid metabolic process(GO:0046485) |
| 0.0 |
0.1 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.0 |
0.4 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.0 |
0.0 |
GO:0060753 |
regulation of mast cell chemotaxis(GO:0060753) |
| 0.0 |
0.1 |
GO:0070613 |
regulation of protein processing(GO:0070613) regulation of protein maturation(GO:1903317) |
| 0.0 |
0.3 |
GO:0009191 |
ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.0 |
1.0 |
GO:0017148 |
negative regulation of translation(GO:0017148) |
| 0.0 |
0.6 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 |
0.0 |
GO:0010593 |
negative regulation of lamellipodium assembly(GO:0010593) |
| 0.0 |
4.3 |
GO:0006281 |
DNA repair(GO:0006281) |
| 0.0 |
0.1 |
GO:0090038 |
negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 |
0.3 |
GO:0071392 |
cellular response to estradiol stimulus(GO:0071392) |
| 0.0 |
1.8 |
GO:0042254 |
ribosome biogenesis(GO:0042254) |
| 0.0 |
0.1 |
GO:0043201 |
response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.0 |
0.1 |
GO:0010155 |
regulation of proton transport(GO:0010155) |
| 0.0 |
0.1 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 0.0 |
0.4 |
GO:0051043 |
regulation of membrane protein ectodomain proteolysis(GO:0051043) |
| 0.0 |
0.9 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
0.1 |
GO:0070232 |
regulation of T cell apoptotic process(GO:0070232) |
| 0.0 |
0.1 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.0 |
0.1 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.0 |
0.0 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.0 |
0.1 |
GO:1903975 |
regulation of glial cell migration(GO:1903975) |
| 0.0 |
0.1 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 |
0.3 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.0 |
0.5 |
GO:0006783 |
heme biosynthetic process(GO:0006783) |
| 0.0 |
0.1 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 |
0.3 |
GO:0045722 |
positive regulation of gluconeogenesis(GO:0045722) |
| 0.0 |
0.1 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 |
0.1 |
GO:0010528 |
regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 |
0.0 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.0 |
0.1 |
GO:0007006 |
mitochondrial membrane organization(GO:0007006) |
| 0.0 |
0.1 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.0 |
0.1 |
GO:0046500 |
S-adenosylmethionine metabolic process(GO:0046500) |
| 0.0 |
0.3 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.0 |
0.0 |
GO:2000170 |
positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.0 |
0.1 |
GO:0015816 |
glycine transport(GO:0015816) |
| 0.0 |
0.1 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 |
0.2 |
GO:0007569 |
cell aging(GO:0007569) |
| 0.0 |
0.0 |
GO:0033143 |
regulation of intracellular steroid hormone receptor signaling pathway(GO:0033143) |
| 0.0 |
0.0 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 |
0.1 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.0 |
0.1 |
GO:0021691 |
cerebellar Purkinje cell layer maturation(GO:0021691) |
| 0.0 |
0.2 |
GO:0010388 |
protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.0 |
0.1 |
GO:0030330 |
DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.0 |
0.1 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.0 |
0.0 |
GO:1905048 |
regulation of metallopeptidase activity(GO:1905048) |
| 0.0 |
0.1 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 |
0.1 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.0 |
0.1 |
GO:0018195 |
peptidyl-arginine modification(GO:0018195) |
| 0.0 |
0.1 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 |
0.1 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.0 |
0.1 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.0 |
0.1 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 |
0.1 |
GO:0008064 |
regulation of actin polymerization or depolymerization(GO:0008064) |
| 0.0 |
0.0 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 |
0.2 |
GO:0010883 |
regulation of lipid storage(GO:0010883) |
| 0.0 |
0.1 |
GO:0090151 |
establishment of protein localization to mitochondrial membrane(GO:0090151) |
| 0.0 |
0.0 |
GO:0045204 |
MAPK export from nucleus(GO:0045204) |
| 0.0 |
0.0 |
GO:0006544 |
glycine metabolic process(GO:0006544) |
| 0.0 |
0.1 |
GO:0071542 |
dopaminergic neuron differentiation(GO:0071542) |
| 0.0 |
0.4 |
GO:0007229 |
integrin-mediated signaling pathway(GO:0007229) |
| 0.0 |
0.1 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 |
0.0 |
GO:0048484 |
enteric nervous system development(GO:0048484) |
| 0.0 |
0.3 |
GO:0032008 |
positive regulation of TOR signaling(GO:0032008) |
| 0.0 |
0.0 |
GO:0043090 |
amino acid import(GO:0043090) |
| 0.0 |
0.1 |
GO:0034383 |
low-density lipoprotein particle clearance(GO:0034383) |
| 0.0 |
0.0 |
GO:1900119 |
positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 |
0.0 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.0 |
0.1 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.0 |
0.0 |
GO:0046391 |
5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 |
0.1 |
GO:0002385 |
organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.0 |
0.2 |
GO:0071300 |
cellular response to retinoic acid(GO:0071300) |
| 0.0 |
0.1 |
GO:0006359 |
regulation of transcription from RNA polymerase III promoter(GO:0006359) |
| 0.0 |
0.0 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.0 |
0.1 |
GO:1901998 |
toxin transport(GO:1901998) |
| 0.0 |
0.1 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.0 |
0.0 |
GO:0060690 |
epithelial cell differentiation involved in salivary gland development(GO:0060690) |
