| 4.8 |
14.5 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
| 3.1 |
9.3 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 2.5 |
7.6 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 2.4 |
7.1 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 2.2 |
8.7 |
GO:0086069 |
bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 2.1 |
6.3 |
GO:0048352 |
neural plate mediolateral regionalization(GO:0021998) mesoderm structural organization(GO:0048338) paraxial mesoderm structural organization(GO:0048352) |
| 2.0 |
6.1 |
GO:0035622 |
intrahepatic bile duct development(GO:0035622) |
| 2.0 |
5.9 |
GO:1900158 |
negative regulation of bone mineralization involved in bone maturation(GO:1900158) |
| 1.9 |
5.8 |
GO:1904395 |
regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 1.9 |
7.7 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 1.9 |
7.6 |
GO:0021764 |
amygdala development(GO:0021764) |
| 1.8 |
5.5 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 1.8 |
10.6 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 1.8 |
7.0 |
GO:2000313 |
fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 1.7 |
5.2 |
GO:0046544 |
regulation of natural killer cell proliferation(GO:0032817) positive regulation of natural killer cell proliferation(GO:0032819) development of secondary male sexual characteristics(GO:0046544) |
| 1.7 |
5.2 |
GO:0044849 |
estrous cycle(GO:0044849) |
| 1.7 |
8.6 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 1.7 |
15.5 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 1.7 |
8.4 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 1.6 |
4.9 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 1.6 |
4.8 |
GO:1904457 |
positive regulation of neuronal action potential(GO:1904457) |
| 1.6 |
7.8 |
GO:2000053 |
regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
| 1.5 |
7.5 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 1.5 |
1.5 |
GO:0060968 |
regulation of gene silencing(GO:0060968) |
| 1.5 |
10.2 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.4 |
1.4 |
GO:1903011 |
negative regulation of bone development(GO:1903011) |
| 1.4 |
7.1 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 1.4 |
7.1 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 1.4 |
1.4 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 1.4 |
2.8 |
GO:2000974 |
negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of pro-B cell differentiation(GO:2000974) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
| 1.4 |
9.6 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 1.4 |
4.1 |
GO:0060489 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 1.4 |
9.5 |
GO:0000022 |
mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 1.4 |
5.5 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 1.3 |
7.9 |
GO:1903753 |
negative regulation of p38MAPK cascade(GO:1903753) |
| 1.3 |
5.3 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 1.3 |
7.9 |
GO:0003383 |
apical constriction(GO:0003383) |
| 1.3 |
3.9 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 1.3 |
6.5 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 1.3 |
3.8 |
GO:0036388 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 1.3 |
3.8 |
GO:0071898 |
odontoblast differentiation(GO:0071895) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 1.3 |
5.1 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 1.2 |
1.2 |
GO:0009786 |
regulation of asymmetric cell division(GO:0009786) |
| 1.2 |
1.2 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 1.2 |
5.0 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 1.2 |
1.2 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 1.2 |
4.9 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 1.2 |
1.2 |
GO:0035562 |
negative regulation of chromatin binding(GO:0035562) |
| 1.2 |
3.5 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 1.2 |
5.9 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 1.2 |
3.5 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 1.2 |
4.7 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 1.1 |
4.6 |
GO:1903251 |
multi-ciliated epithelial cell differentiation(GO:1903251) |
| 1.1 |
1.1 |
GO:0003431 |
growth plate cartilage chondrocyte development(GO:0003431) |
| 1.1 |
3.4 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 1.1 |
3.4 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 1.1 |
1.1 |
GO:0060298 |
positive regulation of sarcomere organization(GO:0060298) |
| 1.1 |
9.9 |
GO:0060059 |
embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 1.1 |
6.5 |
GO:0035469 |
determination of pancreatic left/right asymmetry(GO:0035469) |
| 1.1 |
2.1 |
GO:0002069 |
columnar/cuboidal epithelial cell maturation(GO:0002069) |
| 1.1 |
2.1 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 1.1 |
1.1 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 1.0 |
3.1 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 1.0 |
4.2 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 1.0 |
1.0 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 1.0 |
4.2 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 1.0 |
3.1 |
GO:0030421 |
defecation(GO:0030421) |
| 1.0 |
1.0 |
GO:2000834 |
androgen secretion(GO:0035935) testosterone secretion(GO:0035936) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) regulation of testosterone secretion(GO:2000843) positive regulation of testosterone secretion(GO:2000845) |
| 1.0 |
3.1 |
GO:0046671 |
negative regulation of retinal cell programmed cell death(GO:0046671) |
| 1.0 |
2.0 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 1.0 |
4.0 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 1.0 |
3.0 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 1.0 |
1.0 |
GO:0090394 |
negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 1.0 |
3.9 |
GO:0010510 |
regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 1.0 |
3.8 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) |
| 1.0 |
1.0 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.9 |
8.5 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 0.9 |
0.9 |
GO:0043101 |
purine-containing compound salvage(GO:0043101) |
| 0.9 |
2.7 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 0.9 |
4.5 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.9 |
8.0 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.9 |
8.0 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.9 |
8.8 |
GO:0043922 |
negative regulation by host of viral transcription(GO:0043922) |
| 0.9 |
0.9 |
GO:0061502 |
early endosome to recycling endosome transport(GO:0061502) |
| 0.9 |
4.4 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.9 |
1.7 |
GO:1904059 |
regulation of locomotor rhythm(GO:1904059) |
| 0.9 |
0.9 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.9 |
2.6 |
GO:0060915 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) fibroblast growth factor receptor signaling pathway involved in mammary gland specification(GO:0060595) mammary gland bud formation(GO:0060615) branch elongation involved in salivary gland morphogenesis(GO:0060667) mesenchymal cell differentiation involved in lung development(GO:0060915) |
| 0.9 |
1.7 |
GO:0045875 |
negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.9 |
3.4 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.9 |
0.9 |
GO:1903960 |
negative regulation of anion transmembrane transport(GO:1903960) |
| 0.9 |
2.6 |
GO:0060853 |
arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) Notch signaling pathway involved in arterial endothelial cell fate commitment(GO:0060853) blood vessel endothelial cell fate specification(GO:0097101) |
| 0.9 |
2.6 |
GO:0090298 |
negative regulation of mitochondrial DNA replication(GO:0090298) |
| 0.8 |
3.4 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.8 |
2.5 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.8 |
4.2 |
GO:2000042 |
negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
| 0.8 |
3.3 |
GO:0045084 |
positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.8 |
8.3 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.8 |
4.1 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.8 |
4.9 |
GO:0060836 |
lymphatic endothelial cell differentiation(GO:0060836) |
| 0.8 |
2.4 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.8 |
2.4 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.8 |
8.1 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.8 |
4.0 |
GO:0038031 |
non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.8 |
2.4 |
GO:0072356 |
chromosome passenger complex localization to kinetochore(GO:0072356) |
| 0.8 |
2.4 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.8 |
5.5 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.8 |
2.4 |
GO:0032916 |
positive regulation of transforming growth factor beta3 production(GO:0032916) |
| 0.8 |
1.6 |
GO:0042505 |
tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.8 |
3.9 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.8 |
4.6 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.8 |
3.1 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.8 |
9.2 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.8 |
6.9 |
GO:0000076 |
DNA replication checkpoint(GO:0000076) |
| 0.8 |
5.3 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.8 |
6.0 |
GO:0045719 |
negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.7 |
4.5 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.7 |
3.7 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.7 |
7.4 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.7 |
2.2 |
GO:0070093 |
negative regulation of glucagon secretion(GO:0070093) |
| 0.7 |
1.5 |
GO:0030324 |
respiratory tube development(GO:0030323) lung development(GO:0030324) |
| 0.7 |
3.0 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.7 |
5.9 |
GO:1903689 |
regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.7 |
4.4 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.7 |
4.4 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.7 |
1.5 |
GO:0014028 |
notochord formation(GO:0014028) |
| 0.7 |
0.7 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.7 |
2.2 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.7 |
2.9 |
GO:0014835 |
myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.7 |
2.9 |
GO:0072383 |
plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.7 |
2.9 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 0.7 |
0.7 |
GO:0030997 |
regulation of centriole-centriole cohesion(GO:0030997) |
| 0.7 |
1.4 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.7 |
0.7 |
GO:0060715 |
syncytiotrophoblast cell differentiation involved in labyrinthine layer development(GO:0060715) |
| 0.7 |
1.4 |
GO:0035020 |
regulation of Rac protein signal transduction(GO:0035020) |
| 0.7 |
5.7 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.7 |
2.1 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.7 |
2.1 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.7 |
2.8 |
GO:0035313 |
wound healing, spreading of epidermal cells(GO:0035313) |
| 0.7 |
4.2 |
GO:0072257 |
metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.7 |
2.1 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.7 |
1.4 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 0.7 |
6.3 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.7 |
3.5 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.7 |
3.4 |
GO:0002066 |
columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.7 |
5.5 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.7 |
3.4 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.7 |
0.7 |
GO:0033143 |
regulation of intracellular steroid hormone receptor signaling pathway(GO:0033143) |
| 0.7 |
2.7 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.7 |
2.7 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.7 |
2.7 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.7 |
2.0 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.7 |
0.7 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.7 |
2.0 |
GO:0035574 |
histone H4-K20 demethylation(GO:0035574) |
| 0.7 |
2.6 |
GO:0044565 |
dendritic cell proliferation(GO:0044565) |
| 0.6 |
2.6 |
GO:0030718 |
germ-line stem cell population maintenance(GO:0030718) |
| 0.6 |
3.2 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.6 |
1.3 |
GO:0036518 |
chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.6 |
2.6 |
GO:0071104 |
response to interleukin-9(GO:0071104) |
| 0.6 |
5.8 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.6 |
2.5 |
GO:0016340 |
calcium-dependent cell-matrix adhesion(GO:0016340) |
| 0.6 |
3.2 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.6 |
1.9 |
GO:0089700 |
protein kinase D signaling(GO:0089700) |
| 0.6 |
3.2 |
GO:0033278 |
cell proliferation in midbrain(GO:0033278) |
| 0.6 |
1.9 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.6 |
1.9 |
GO:0045819 |
positive regulation of glycogen catabolic process(GO:0045819) |
| 0.6 |
3.1 |
GO:1902410 |
mitotic cytokinetic process(GO:1902410) |
| 0.6 |
1.9 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.6 |
1.2 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.6 |
1.9 |
GO:0032922 |
circadian regulation of gene expression(GO:0032922) |
| 0.6 |
3.7 |
GO:0002072 |
optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.6 |
10.5 |
GO:0022027 |
interkinetic nuclear migration(GO:0022027) |
| 0.6 |
3.7 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.6 |
1.8 |
GO:0032240 |
negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.6 |
1.8 |
GO:1902528 |
regulation of protein linear polyubiquitination(GO:1902528) positive regulation of protein linear polyubiquitination(GO:1902530) |
| 0.6 |
4.2 |
GO:0019321 |
pentose metabolic process(GO:0019321) |
| 0.6 |
1.8 |
GO:0090234 |
regulation of kinetochore assembly(GO:0090234) |
| 0.6 |
1.8 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.6 |
4.8 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.6 |
3.6 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.6 |
0.6 |
GO:1901563 |
response to camptothecin(GO:1901563) |
| 0.6 |
8.3 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.6 |
3.6 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.6 |
1.8 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.6 |
1.8 |
GO:1903896 |
positive regulation of IRE1-mediated unfolded protein response(GO:1903896) |
| 0.6 |
2.9 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.6 |
0.6 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.6 |
2.9 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.6 |
2.9 |
GO:0015705 |
iodide transport(GO:0015705) |
| 0.6 |
1.2 |
GO:0035743 |
CD4-positive, alpha-beta T cell cytokine production(GO:0035743) T-helper 2 cell cytokine production(GO:0035745) |
| 0.6 |
2.3 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.6 |
1.1 |
GO:2000191 |
regulation of fatty acid transport(GO:2000191) |
| 0.6 |
1.7 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.6 |
5.1 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.6 |
1.7 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.6 |
1.7 |
GO:0006273 |
lagging strand elongation(GO:0006273) |
| 0.6 |
2.8 |
GO:0045724 |
positive regulation of cilium assembly(GO:0045724) |
| 0.6 |
0.6 |
GO:0033122 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.6 |
0.6 |
GO:0035878 |
nail development(GO:0035878) |
| 0.6 |
4.5 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.6 |
1.1 |
GO:0060221 |
retinal rod cell differentiation(GO:0060221) |
| 0.6 |
5.5 |
GO:0002043 |
blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.5 |
4.9 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 0.5 |
2.7 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.5 |
1.1 |
GO:0061029 |
eyelid development in camera-type eye(GO:0061029) |
| 0.5 |
1.6 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.5 |
1.6 |
GO:0010835 |
regulation of protein ADP-ribosylation(GO:0010835) |
| 0.5 |
1.6 |
GO:2000983 |
regulation of ATP citrate synthase activity(GO:2000983) negative regulation of ATP citrate synthase activity(GO:2000984) |
| 0.5 |
5.4 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.5 |
1.6 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.5 |
1.6 |
GO:0071865 |
regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.5 |
1.6 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.5 |
4.2 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.5 |
1.6 |
GO:0010824 |
regulation of centrosome duplication(GO:0010824) |
| 0.5 |
2.6 |
GO:0035022 |
positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.5 |
1.6 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.5 |
4.2 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.5 |
11.0 |
GO:0071539 |
protein localization to centrosome(GO:0071539) |
| 0.5 |
2.6 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.5 |
1.6 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.5 |
1.6 |
GO:0060235 |
lens induction in camera-type eye(GO:0060235) |
| 0.5 |
1.0 |
GO:0010700 |
negative regulation of norepinephrine secretion(GO:0010700) |
| 0.5 |
4.7 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.5 |
1.0 |
GO:0000087 |
mitotic M phase(GO:0000087) |
| 0.5 |
14.0 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.5 |
2.6 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.5 |
3.1 |
GO:0060017 |
parathyroid gland development(GO:0060017) |
| 0.5 |
2.6 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.5 |
2.0 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 0.5 |
6.1 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.5 |
6.6 |
GO:0060236 |
regulation of mitotic spindle organization(GO:0060236) |
| 0.5 |
0.5 |
GO:0003161 |
cardiac conduction system development(GO:0003161) |
| 0.5 |
4.5 |
GO:0030853 |
negative regulation of granulocyte differentiation(GO:0030853) |
| 0.5 |
1.0 |
GO:0046668 |
regulation of retinal cell programmed cell death(GO:0046668) |
| 0.5 |
3.0 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.5 |
3.5 |
GO:0048733 |
sebaceous gland development(GO:0048733) |
| 0.5 |
2.0 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.5 |
5.0 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.5 |
1.0 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) |
| 0.5 |
4.5 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.5 |
1.5 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.5 |
1.5 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.5 |
1.0 |
GO:0008065 |
establishment of blood-nerve barrier(GO:0008065) |
| 0.5 |
1.0 |
GO:0006085 |
acetyl-CoA biosynthetic process(GO:0006085) |
| 0.5 |
2.0 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 0.5 |
2.0 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.5 |
1.5 |
GO:0097278 |
complement-dependent cytotoxicity(GO:0097278) |
| 0.5 |
4.8 |
GO:0051383 |
kinetochore organization(GO:0051383) |
| 0.5 |
1.0 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.5 |
1.9 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.5 |
2.4 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.5 |
0.5 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 0.5 |
1.4 |
GO:0000966 |
RNA 5'-end processing(GO:0000966) |
| 0.5 |
3.3 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.5 |
3.3 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.5 |
1.4 |
GO:0048208 |
vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.5 |
4.2 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.5 |
0.5 |
GO:0000237 |
leptotene(GO:0000237) |
| 0.5 |
1.9 |
GO:1900145 |
regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.5 |
1.9 |
GO:1901165 |
positive regulation of trophoblast cell migration(GO:1901165) |
| 0.5 |
0.9 |
GO:0046666 |
retinal cell programmed cell death(GO:0046666) |
| 0.5 |
1.9 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.5 |
1.4 |
GO:0021893 |
cerebral cortex GABAergic interneuron fate commitment(GO:0021893) |
| 0.5 |
1.4 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 0.5 |
3.6 |
GO:0006477 |
protein sulfation(GO:0006477) |
| 0.5 |
3.2 |
GO:0045199 |
maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.5 |
1.8 |
GO:1905050 |
positive regulation of metallopeptidase activity(GO:1905050) |
| 0.5 |
0.9 |
GO:0051660 |
cortical microtubule organization(GO:0043622) establishment of centrosome localization(GO:0051660) |
| 0.4 |
1.3 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.4 |
0.9 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.4 |
4.9 |
GO:0010569 |
regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.4 |
0.4 |
GO:0010872 |
regulation of cholesterol esterification(GO:0010872) |
| 0.4 |
0.9 |
GO:0007351 |
tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.4 |
1.8 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.4 |
1.3 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.4 |
0.4 |
GO:0060423 |
foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.4 |
4.0 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 0.4 |
2.2 |
GO:0070535 |
histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.4 |
0.9 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.4 |
0.9 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.4 |
0.9 |
GO:0070936 |
protein K48-linked ubiquitination(GO:0070936) |
| 0.4 |
2.2 |
GO:0014886 |
transition between slow and fast fiber(GO:0014886) |
| 0.4 |
2.6 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.4 |
2.6 |
GO:0090244 |
Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.4 |
1.3 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 0.4 |
0.4 |
GO:0060037 |
pharyngeal system development(GO:0060037) |
| 0.4 |
3.1 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.4 |
3.1 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.4 |
4.8 |
GO:0072520 |
seminiferous tubule development(GO:0072520) |
| 0.4 |
13.0 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.4 |
5.2 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.4 |
1.3 |
GO:1902965 |
regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.4 |
0.9 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.4 |
0.9 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.4 |
1.3 |
GO:0009174 |
UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.4 |
2.9 |
GO:0071459 |
protein localization to chromosome, centromeric region(GO:0071459) |
| 0.4 |
1.3 |
GO:0010899 |
regulation of phosphatidylcholine catabolic process(GO:0010899) |
| 0.4 |
5.0 |
GO:0060213 |
regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.4 |
2.5 |
GO:0051088 |
PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.4 |
1.7 |
GO:0071168 |
protein localization to chromatin(GO:0071168) |
| 0.4 |
1.7 |
GO:0046125 |
pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.4 |
0.4 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.4 |
1.2 |
GO:0031590 |
wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.4 |
4.1 |
GO:1901409 |
regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.4 |
0.4 |
GO:2000049 |
positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.4 |
2.0 |
GO:0060623 |
regulation of chromosome condensation(GO:0060623) |
| 0.4 |
2.0 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.4 |
1.6 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.4 |
4.1 |
GO:0002176 |
male germ cell proliferation(GO:0002176) |
| 0.4 |
1.2 |
GO:1904948 |
midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.4 |
2.0 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.4 |
1.6 |
GO:0097694 |
establishment of RNA localization to telomere(GO:0097694) |
| 0.4 |
2.4 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.4 |
1.2 |
GO:0035795 |
negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.4 |
2.4 |
GO:0060068 |
vagina development(GO:0060068) |
| 0.4 |
0.8 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.4 |
0.8 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.4 |
5.2 |
GO:0031297 |
replication fork processing(GO:0031297) DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.4 |
1.2 |
GO:0090526 |
regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.4 |
1.2 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.4 |
1.6 |
GO:0043490 |
malate-aspartate shuttle(GO:0043490) |
| 0.4 |
2.8 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.4 |
2.7 |
GO:0033148 |
positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.4 |
0.4 |
GO:0007352 |
zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.4 |
13.3 |
GO:0035329 |
hippo signaling(GO:0035329) |
| 0.4 |
1.2 |
GO:0010838 |
positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.4 |
0.4 |
GO:0072204 |
cell-cell signaling involved in kidney development(GO:0060995) Wnt signaling pathway involved in kidney development(GO:0061289) canonical Wnt signaling pathway involved in metanephric kidney development(GO:0061290) cell-cell signaling involved in metanephros development(GO:0072204) |
| 0.4 |
1.2 |
GO:0051305 |
chromosome movement towards spindle pole(GO:0051305) |
| 0.4 |
4.7 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.4 |
3.5 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.4 |
1.1 |
GO:0002326 |
B cell lineage commitment(GO:0002326) |
| 0.4 |
2.3 |
GO:0046909 |
intermembrane transport(GO:0046909) |
| 0.4 |
1.5 |
GO:0070814 |
hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.4 |
12.6 |
GO:0045880 |
positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.4 |
0.8 |
GO:0070498 |
interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.4 |
1.1 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.4 |
0.8 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 0.4 |
2.3 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.4 |
0.8 |
GO:2000416 |
regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.4 |
1.5 |
GO:0043974 |
histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.4 |
3.3 |
GO:0090261 |
positive regulation of inclusion body assembly(GO:0090261) |
| 0.4 |
1.1 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.4 |
4.8 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.4 |
1.8 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.4 |
2.2 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.4 |
2.9 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.4 |
0.7 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.4 |
2.9 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.4 |
1.1 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.4 |
1.8 |
GO:0015788 |
UDP-N-acetylglucosamine transport(GO:0015788) |
| 0.4 |
1.5 |
GO:0070829 |
heterochromatin maintenance(GO:0070829) |
| 0.4 |
1.1 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.4 |
1.4 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.4 |
0.4 |
GO:0000414 |
regulation of histone H3-K36 methylation(GO:0000414) |
| 0.4 |
1.1 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.4 |
4.3 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.4 |
1.1 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.4 |
0.7 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.4 |
1.4 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.3 |
4.9 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.3 |
4.9 |
GO:0006298 |
mismatch repair(GO:0006298) |
| 0.3 |
1.4 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 0.3 |
3.5 |
GO:0006610 |
ribosomal protein import into nucleus(GO:0006610) |
| 0.3 |
0.3 |
GO:0072205 |
metanephric collecting duct development(GO:0072205) |
| 0.3 |
1.0 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.3 |
0.7 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.3 |
0.3 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 0.3 |
2.1 |
GO:0006307 |
DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.3 |
1.0 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 0.3 |
7.2 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.3 |
1.7 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.3 |
0.7 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.3 |
5.4 |
GO:0006978 |
DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 0.3 |
1.3 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.3 |
4.0 |
GO:0018342 |
protein prenylation(GO:0018342) prenylation(GO:0097354) |
| 0.3 |
2.7 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.3 |
1.7 |
GO:0097341 |
inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.3 |
1.3 |
GO:0033091 |
positive regulation of immature T cell proliferation(GO:0033091) |
| 0.3 |
1.7 |
GO:0030263 |
apoptotic chromosome condensation(GO:0030263) |
| 0.3 |
15.7 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.3 |
0.7 |
GO:0051542 |
elastin biosynthetic process(GO:0051542) |
| 0.3 |
1.0 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.3 |
2.0 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.3 |
0.7 |
GO:1902065 |
response to L-glutamate(GO:1902065) |
| 0.3 |
1.7 |
GO:0080111 |
DNA dealkylation(GO:0035510) DNA demethylation(GO:0080111) |
| 0.3 |
0.3 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.3 |
2.3 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.3 |
1.6 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.3 |
2.0 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.3 |
1.0 |
GO:0000183 |
chromatin silencing at rDNA(GO:0000183) |
| 0.3 |
1.3 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.3 |
0.7 |
GO:0060916 |
mesenchymal cell proliferation involved in lung development(GO:0060916) regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
| 0.3 |
2.9 |
GO:1903672 |
positive regulation of sprouting angiogenesis(GO:1903672) |
| 0.3 |
2.3 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.3 |
7.1 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.3 |
0.3 |
GO:0032875 |
regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
| 0.3 |
2.3 |
GO:0030206 |
chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.3 |
0.3 |
GO:0035058 |
nonmotile primary cilium assembly(GO:0035058) |
| 0.3 |
1.3 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.3 |
1.6 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.3 |
1.3 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.3 |
0.6 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.3 |
0.9 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.3 |
4.3 |
GO:2000353 |
positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.3 |
0.9 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.3 |
0.3 |
GO:0032627 |
interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) positive regulation of interleukin-23 production(GO:0032747) |
| 0.3 |
1.8 |
GO:0006824 |
cobalt ion transport(GO:0006824) |
| 0.3 |
2.5 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.3 |
1.2 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.3 |
1.2 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.3 |
1.2 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.3 |
1.5 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.3 |
3.3 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.3 |
0.9 |
GO:0019065 |
receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.3 |
0.6 |
GO:0018364 |
peptidyl-glutamine methylation(GO:0018364) |
| 0.3 |
0.9 |
GO:0030208 |
dermatan sulfate biosynthetic process(GO:0030208) |
| 0.3 |
0.9 |
GO:0033030 |
negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.3 |
0.9 |
GO:0061085 |
regulation of histone H3-K27 methylation(GO:0061085) |
| 0.3 |
0.3 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.3 |
1.5 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.3 |
0.9 |
GO:0009812 |
flavonoid metabolic process(GO:0009812) flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.3 |
0.9 |
GO:0060060 |
post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.3 |
2.9 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.3 |
2.9 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.3 |
0.9 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.3 |
1.5 |
GO:0010826 |
negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.3 |
0.9 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.3 |
0.3 |
GO:0010273 |
detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.3 |
1.2 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.3 |
0.9 |
GO:1903265 |
positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.3 |
1.2 |
GO:0072675 |
osteoclast fusion(GO:0072675) |
| 0.3 |
3.7 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.3 |
5.7 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.3 |
1.1 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.3 |
0.9 |
GO:2000973 |
regulation of pro-B cell differentiation(GO:2000973) |
| 0.3 |
0.9 |
GO:0033326 |
cerebrospinal fluid secretion(GO:0033326) |
| 0.3 |
4.8 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.3 |
0.6 |
GO:0002901 |
mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.3 |
3.1 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.3 |
0.6 |
GO:0002643 |
regulation of tolerance induction(GO:0002643) |
| 0.3 |
0.8 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.3 |
0.8 |
GO:0000059 |
protein import into nucleus, docking(GO:0000059) |
| 0.3 |
1.1 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.3 |
0.8 |
GO:2000768 |
glomerular parietal epithelial cell differentiation(GO:0072139) positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.3 |
2.5 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.3 |
1.1 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.3 |
3.6 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.3 |
2.2 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.3 |
1.1 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.3 |
1.7 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.3 |
0.8 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.3 |
0.8 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.3 |
0.8 |
GO:0045743 |
positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.3 |
1.4 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.3 |
1.4 |
GO:2000322 |
regulation of glucocorticoid receptor signaling pathway(GO:2000322) |
| 0.3 |
1.4 |
GO:0046060 |
dATP metabolic process(GO:0046060) |
| 0.3 |
0.3 |
GO:0002669 |
positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.3 |
1.6 |
GO:0008611 |
ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.3 |
1.6 |
GO:0016078 |
tRNA catabolic process(GO:0016078) |
| 0.3 |
0.5 |
GO:0002667 |
lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.3 |
2.4 |
GO:0034770 |
histone H4-K20 methylation(GO:0034770) |
| 0.3 |
0.8 |
GO:0060161 |
positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.3 |
0.3 |
GO:0050869 |
negative regulation of B cell activation(GO:0050869) |
| 0.3 |
0.8 |
GO:0033860 |
regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.3 |
0.8 |
GO:1904738 |
vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.3 |
0.5 |
GO:1903378 |
positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.3 |
1.6 |
GO:0033145 |
positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
| 0.3 |
4.0 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.3 |
0.5 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) |
| 0.3 |
0.8 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.3 |
1.1 |
GO:0065001 |
negative regulation of histone H3-K36 methylation(GO:0000415) negative regulation of histone H3-K4 methylation(GO:0051572) specification of axis polarity(GO:0065001) |
| 0.3 |
0.3 |
GO:0021798 |
forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.3 |
0.8 |
GO:0090179 |
planar cell polarity pathway involved in neural tube closure(GO:0090179) |
| 0.3 |
0.8 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.3 |
0.5 |
GO:0001779 |
natural killer cell differentiation(GO:0001779) |
| 0.3 |
1.3 |
GO:0006152 |
purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.3 |
1.8 |
GO:0006560 |
proline metabolic process(GO:0006560) |
| 0.3 |
1.3 |
GO:0022417 |
protein maturation by protein folding(GO:0022417) |
| 0.3 |
1.0 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.3 |
1.5 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.3 |
0.5 |
GO:1900041 |
negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.3 |
1.3 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.3 |
0.8 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.3 |
0.3 |
GO:0043619 |
regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
| 0.3 |
1.0 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.3 |
0.8 |
GO:0051016 |
barbed-end actin filament capping(GO:0051016) |
| 0.3 |
1.3 |
GO:1900147 |
Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.3 |
0.8 |
GO:0035973 |
aggrephagy(GO:0035973) |
| 0.3 |
0.8 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.3 |
1.3 |
GO:0060903 |
regulation of meiosis I(GO:0060631) positive regulation of meiosis I(GO:0060903) |
| 0.2 |
3.2 |
GO:0035751 |
regulation of lysosomal lumen pH(GO:0035751) |
| 0.2 |
1.2 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.2 |
0.7 |
GO:0051031 |
tRNA transport(GO:0051031) |
| 0.2 |
0.7 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.2 |
1.0 |
GO:0000055 |
ribosomal large subunit export from nucleus(GO:0000055) |
| 0.2 |
26.8 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.2 |
0.2 |
GO:0098743 |
cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
| 0.2 |
2.2 |
GO:0060340 |
positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.2 |
0.7 |
GO:0032058 |
positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.2 |
1.7 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.2 |
2.0 |
GO:0060457 |
negative regulation of digestive system process(GO:0060457) |
| 0.2 |
1.2 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.2 |
1.5 |
GO:0007008 |
outer mitochondrial membrane organization(GO:0007008) |
| 0.2 |
0.5 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.2 |
0.2 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.2 |
1.0 |
GO:0001880 |
Mullerian duct regression(GO:0001880) |
| 0.2 |
2.7 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.2 |
4.4 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.2 |
1.9 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.2 |
1.0 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.2 |
0.2 |
GO:2000832 |
negative regulation of growth hormone secretion(GO:0060125) negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.2 |
2.4 |
GO:0036120 |
response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.2 |
0.7 |
GO:0051933 |
amino acid neurotransmitter reuptake(GO:0051933) glutamate reuptake(GO:0051935) |
| 0.2 |
0.7 |
GO:0000350 |
generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.2 |
0.5 |
GO:0045579 |
positive regulation of B cell differentiation(GO:0045579) |
| 0.2 |
7.2 |
GO:0000470 |
maturation of LSU-rRNA(GO:0000470) |
| 0.2 |
0.2 |
GO:0070365 |
hepatocyte differentiation(GO:0070365) |
| 0.2 |
1.4 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) |
| 0.2 |
1.9 |
GO:0035269 |
protein O-linked mannosylation(GO:0035269) |
| 0.2 |
0.2 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.2 |
1.2 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.2 |
0.7 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.2 |
1.4 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.2 |
0.5 |
GO:0040036 |
regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.2 |
4.7 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.2 |
0.7 |
GO:0043696 |
dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
| 0.2 |
0.7 |
GO:0043247 |
protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
| 0.2 |
6.0 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.2 |
1.2 |
GO:0090166 |
Golgi disassembly(GO:0090166) |
| 0.2 |
3.7 |
GO:0070884 |
regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.2 |
2.5 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.2 |
0.5 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.2 |
1.1 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.2 |
1.6 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.2 |
0.7 |
GO:0045404 |
positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.2 |
0.2 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.2 |
0.7 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.2 |
0.2 |
GO:0009193 |
pyrimidine ribonucleoside diphosphate metabolic process(GO:0009193) UDP metabolic process(GO:0046048) |
| 0.2 |
0.7 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.2 |
1.1 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.2 |
0.7 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.2 |
4.2 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.2 |
1.3 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.2 |
0.4 |
GO:0030210 |
heparin biosynthetic process(GO:0030210) |
| 0.2 |
0.4 |
GO:0030950 |
establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.2 |
0.4 |
GO:0000733 |
DNA strand renaturation(GO:0000733) |
| 0.2 |
0.2 |
GO:0060525 |
prostate glandular acinus development(GO:0060525) |
| 0.2 |
1.5 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.2 |
0.9 |
GO:0015744 |
succinate transport(GO:0015744) |
| 0.2 |
1.1 |
GO:0042997 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.2 |
6.0 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.2 |
0.6 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.2 |
1.7 |
GO:1903332 |
regulation of protein folding(GO:1903332) |
| 0.2 |
1.5 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.2 |
1.1 |
GO:0034720 |
histone H3-K4 demethylation(GO:0034720) |
| 0.2 |
0.6 |
GO:2000144 |
positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.2 |
1.7 |
GO:0002089 |
lens morphogenesis in camera-type eye(GO:0002089) |
| 0.2 |
0.4 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.2 |
1.9 |
GO:2001256 |
regulation of store-operated calcium entry(GO:2001256) |
| 0.2 |
0.4 |
GO:0046628 |
positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.2 |
0.4 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.2 |
6.2 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.2 |
0.2 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.2 |
1.0 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.2 |
2.9 |
GO:1902808 |
positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.2 |
2.3 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.2 |
0.2 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.2 |
0.8 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.2 |
0.6 |
GO:0046622 |
positive regulation of organ growth(GO:0046622) |
| 0.2 |
0.6 |
GO:0006428 |
isoleucyl-tRNA aminoacylation(GO:0006428) |
| 0.2 |
1.4 |
GO:0006390 |
transcription from mitochondrial promoter(GO:0006390) |
| 0.2 |
1.4 |
GO:0042403 |
thyroid hormone metabolic process(GO:0042403) |
| 0.2 |
1.0 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.2 |
0.6 |
GO:0035845 |
photoreceptor cell outer segment organization(GO:0035845) |
| 0.2 |
0.4 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.2 |
1.6 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.2 |
1.0 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.2 |
0.8 |
GO:0090110 |
cargo loading into COPII-coated vesicle(GO:0090110) regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.2 |
2.0 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) telencephalon regionalization(GO:0021978) |
| 0.2 |
0.8 |
GO:0045948 |
positive regulation of translational initiation(GO:0045948) |
| 0.2 |
0.2 |
GO:0006449 |
regulation of translational termination(GO:0006449) |
| 0.2 |
1.8 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.2 |
0.4 |
GO:0000722 |
telomere maintenance via recombination(GO:0000722) |
| 0.2 |
0.8 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.2 |
0.8 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.2 |
2.3 |
GO:0045589 |
regulation of regulatory T cell differentiation(GO:0045589) |
| 0.2 |
0.2 |
GO:0030046 |
parallel actin filament bundle assembly(GO:0030046) |
| 0.2 |
0.6 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 |
0.4 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.2 |
0.2 |
GO:0034427 |
nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.2 |
0.6 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.2 |
0.4 |
GO:0051084 |
'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.2 |
0.4 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.2 |
1.7 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.2 |
0.6 |
GO:0032760 |
positive regulation of tumor necrosis factor production(GO:0032760) positive regulation of tumor necrosis factor superfamily cytokine production(GO:1903557) |
| 0.2 |
0.6 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.2 |
0.6 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.2 |
0.6 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 0.2 |
0.6 |
GO:1904469 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.2 |
2.8 |
GO:0042178 |
xenobiotic catabolic process(GO:0042178) |
| 0.2 |
1.1 |
GO:0014841 |
skeletal muscle satellite cell proliferation(GO:0014841) skeletal muscle cell proliferation(GO:0014856) |
| 0.2 |
1.5 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.2 |
0.4 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.2 |
2.8 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.2 |
0.5 |
GO:0035948 |
positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.2 |
0.9 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.2 |
0.4 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.2 |
1.8 |
GO:0032897 |
negative regulation of viral transcription(GO:0032897) |
| 0.2 |
2.9 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.2 |
0.5 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.2 |
0.4 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.2 |
0.5 |
GO:0019255 |
glucose 1-phosphate metabolic process(GO:0019255) |
| 0.2 |
1.3 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.2 |
0.9 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.2 |
0.5 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.2 |
0.5 |
GO:1902913 |
positive regulation of melanocyte differentiation(GO:0045636) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.2 |
0.5 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.2 |
1.2 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.2 |
0.4 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.2 |
1.1 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.2 |
3.6 |
GO:0034724 |
DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.2 |
0.4 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.2 |
0.9 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.2 |
0.9 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.2 |
0.3 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 0.2 |
0.9 |
GO:0050000 |
chromosome localization(GO:0050000) establishment of chromosome localization(GO:0051303) |
| 0.2 |
0.9 |
GO:0046688 |
response to copper ion(GO:0046688) |
| 0.2 |
0.5 |
GO:0048211 |
Golgi vesicle docking(GO:0048211) |
| 0.2 |
0.3 |
GO:1904467 |
regulation of tumor necrosis factor secretion(GO:1904467) tumor necrosis factor secretion(GO:1990774) |
| 0.2 |
0.9 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.2 |
1.4 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 0.2 |
0.8 |
GO:1902187 |
negative regulation of viral release from host cell(GO:1902187) |
| 0.2 |
0.5 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.2 |
1.2 |
GO:0032790 |
ribosome disassembly(GO:0032790) |
| 0.2 |
1.5 |
GO:0019985 |
translesion synthesis(GO:0019985) |
| 0.2 |
0.5 |
GO:0097461 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.2 |
0.2 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.2 |
0.8 |
GO:0008584 |
male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.2 |
0.5 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.2 |
0.5 |
GO:0060385 |
axonogenesis involved in innervation(GO:0060385) |
| 0.2 |
0.7 |
GO:0046476 |
glycosylceramide biosynthetic process(GO:0046476) |
| 0.2 |
0.7 |
GO:0016259 |
selenocysteine metabolic process(GO:0016259) |
| 0.2 |
1.0 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.2 |
3.9 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.2 |
1.0 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.2 |
0.3 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 0.2 |
2.3 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.2 |
0.5 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.2 |
0.3 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.2 |
0.6 |
GO:2000779 |
regulation of double-strand break repair(GO:2000779) |
| 0.2 |
0.6 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.2 |
0.8 |
GO:0045974 |
miRNA mediated inhibition of translation(GO:0035278) negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
| 0.2 |
0.3 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.2 |
0.5 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.2 |
0.8 |
GO:0002088 |
lens development in camera-type eye(GO:0002088) |
| 0.2 |
0.6 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.2 |
0.2 |
GO:0035871 |
protein K11-linked deubiquitination(GO:0035871) |
| 0.2 |
0.3 |
GO:0031935 |
regulation of chromatin silencing(GO:0031935) |
| 0.2 |
3.8 |
GO:0046677 |
response to antibiotic(GO:0046677) |
| 0.2 |
2.7 |
GO:0061371 |
determination of heart left/right asymmetry(GO:0061371) |
| 0.2 |
1.4 |
GO:0006337 |
nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.2 |
1.3 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.2 |
1.9 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.2 |
1.6 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.2 |
0.3 |
GO:0060122 |
inner ear receptor stereocilium organization(GO:0060122) |
| 0.2 |
0.3 |
GO:0010800 |
positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.2 |
0.9 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.2 |
2.6 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.2 |
3.4 |
GO:0035567 |
non-canonical Wnt signaling pathway(GO:0035567) |
| 0.2 |
0.3 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.2 |
1.7 |
GO:0009191 |
ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.2 |
2.3 |
GO:0045943 |
positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.2 |
0.3 |
GO:0090069 |
regulation of ribosome biogenesis(GO:0090069) |
| 0.2 |
0.6 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.2 |
4.2 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.2 |
0.5 |
GO:0048739 |
cardiac muscle fiber development(GO:0048739) |
| 0.2 |
0.6 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.2 |
2.6 |
GO:0010922 |
positive regulation of phosphatase activity(GO:0010922) |
| 0.2 |
0.9 |
GO:0060510 |
Type II pneumocyte differentiation(GO:0060510) |
| 0.2 |
0.5 |
GO:0051571 |
positive regulation of histone H3-K4 methylation(GO:0051571) |
| 0.1 |
0.7 |
GO:0006699 |
bile acid biosynthetic process(GO:0006699) |
| 0.1 |
0.6 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 |
0.3 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.1 |
0.4 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
0.7 |
GO:0042758 |
long-chain fatty acid catabolic process(GO:0042758) |
| 0.1 |
0.6 |
GO:1904683 |
regulation of metalloendopeptidase activity(GO:1904683) |
| 0.1 |
0.4 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 |
0.6 |
GO:0070126 |
mitochondrial translational termination(GO:0070126) |
| 0.1 |
0.3 |
GO:2001012 |
mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
| 0.1 |
0.7 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.1 |
1.0 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.1 |
2.1 |
GO:0034315 |
regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.1 |
0.3 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.1 |
1.9 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.1 |
0.9 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.1 |
0.3 |
GO:2000674 |
regulation of type B pancreatic cell apoptotic process(GO:2000674) |
| 0.1 |
0.4 |
GO:0042264 |
peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.1 |
3.5 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.1 |
0.8 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.1 |
2.3 |
GO:0030514 |
negative regulation of BMP signaling pathway(GO:0030514) |
| 0.1 |
1.1 |
GO:0070940 |
dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.1 |
0.1 |
GO:0016573 |
histone acetylation(GO:0016573) |
| 0.1 |
0.6 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.1 |
0.3 |
GO:0033151 |
V(D)J recombination(GO:0033151) |
| 0.1 |
1.3 |
GO:0007263 |
nitric oxide mediated signal transduction(GO:0007263) |
| 0.1 |
0.8 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 |
0.3 |
GO:0042534 |
tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.1 |
0.1 |
GO:0006702 |
androgen biosynthetic process(GO:0006702) |
| 0.1 |
0.5 |
GO:0051643 |
endoplasmic reticulum localization(GO:0051643) |
| 0.1 |
0.9 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 0.1 |
0.9 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.1 |
1.6 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.1 |
0.4 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.1 |
0.4 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) cellular response to vitamin D(GO:0071305) |
| 0.1 |
0.4 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.1 |
0.4 |
GO:0030952 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) establishment or maintenance of cytoskeleton polarity(GO:0030952) |
| 0.1 |
1.7 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 |
0.1 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.1 |
0.8 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.1 |
1.7 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.1 |
0.7 |
GO:0071108 |
protein K48-linked deubiquitination(GO:0071108) |
| 0.1 |
0.7 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.1 |
0.4 |
GO:0042822 |
vitamin B6 metabolic process(GO:0042816) pyridoxal phosphate metabolic process(GO:0042822) pyridoxal phosphate biosynthetic process(GO:0042823) |
| 0.1 |
5.7 |
GO:0000245 |
spliceosomal complex assembly(GO:0000245) |
| 0.1 |
0.9 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.1 |
0.1 |
GO:0033523 |
histone H2B ubiquitination(GO:0033523) |
| 0.1 |
2.3 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.1 |
0.5 |
GO:0006741 |
NADP biosynthetic process(GO:0006741) |
| 0.1 |
0.6 |
GO:0098543 |
detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.1 |
0.3 |
GO:0007141 |
male meiosis I(GO:0007141) |
| 0.1 |
0.9 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.1 |
0.8 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 0.1 |
1.8 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.1 |
4.4 |
GO:0033120 |
positive regulation of RNA splicing(GO:0033120) |
| 0.1 |
1.3 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.1 |
0.4 |
GO:0044861 |
protein transport into plasma membrane raft(GO:0044861) |
| 0.1 |
0.4 |
GO:2000574 |
regulation of microtubule motor activity(GO:2000574) |
| 0.1 |
0.5 |
GO:0061028 |
establishment of endothelial barrier(GO:0061028) |
| 0.1 |
0.4 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 |
2.0 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.1 |
0.4 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.1 |
0.2 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.1 |
0.4 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.1 |
2.5 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.1 |
0.2 |
GO:0035050 |
embryonic heart tube development(GO:0035050) |
| 0.1 |
0.7 |
GO:0070072 |
vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.1 |
0.1 |
GO:0010040 |
response to iron(II) ion(GO:0010040) |
| 0.1 |
1.4 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.1 |
0.4 |
GO:0042532 |
negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
| 0.1 |
0.5 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.1 |
1.6 |
GO:0070536 |
protein K63-linked deubiquitination(GO:0070536) |
| 0.1 |
1.3 |
GO:0043484 |
regulation of RNA splicing(GO:0043484) |
| 0.1 |
0.4 |
GO:0035864 |
response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 |
0.7 |
GO:0055090 |
acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.1 |
0.4 |
GO:0001887 |
selenium compound metabolic process(GO:0001887) |
| 0.1 |
0.2 |
GO:0032933 |
response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.1 |
0.4 |
GO:0006421 |
asparaginyl-tRNA aminoacylation(GO:0006421) |
| 0.1 |
0.8 |
GO:0032526 |
response to retinoic acid(GO:0032526) |
| 0.1 |
1.1 |
GO:0034377 |
plasma lipoprotein particle assembly(GO:0034377) |
| 0.1 |
1.8 |
GO:0031571 |
mitotic G1 DNA damage checkpoint(GO:0031571) |
| 0.1 |
0.4 |
GO:0071971 |
extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
| 0.1 |
0.2 |
GO:0010025 |
wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
| 0.1 |
1.2 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.1 |
0.5 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 |
0.8 |
GO:0060746 |
parental behavior(GO:0060746) |
| 0.1 |
29.5 |
GO:0006397 |
mRNA processing(GO:0006397) |
| 0.1 |
0.2 |
GO:0045618 |
positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.1 |
0.3 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.1 |
3.5 |
GO:0000725 |
double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
| 0.1 |
0.9 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.1 |
1.3 |
GO:0036260 |
7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.1 |
1.1 |
GO:0006661 |
phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.1 |
0.3 |
GO:2000616 |
negative regulation of histone H3-K9 acetylation(GO:2000616) |
| 0.1 |
1.7 |
GO:1904355 |
positive regulation of telomere capping(GO:1904355) |
| 0.1 |
0.3 |
GO:0036092 |
phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 |
0.2 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) |
| 0.1 |
0.2 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 |
1.1 |
GO:2000060 |
positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.1 |
0.6 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
| 0.1 |
0.5 |
GO:0051684 |
maintenance of Golgi location(GO:0051684) |
| 0.1 |
0.5 |
GO:0032485 |
regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 |
0.2 |
GO:1901856 |
negative regulation of cellular respiration(GO:1901856) |
| 0.1 |
0.3 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 |
3.7 |
GO:0016126 |
sterol biosynthetic process(GO:0016126) |
| 0.1 |
1.7 |
GO:0001658 |
branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.1 |
0.2 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 |
1.7 |
GO:0007257 |
activation of JUN kinase activity(GO:0007257) |
| 0.1 |
0.8 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.1 |
0.2 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 |
1.1 |
GO:0010664 |
negative regulation of striated muscle cell apoptotic process(GO:0010664) |
| 0.1 |
1.1 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 |
0.6 |
GO:0042866 |
pyruvate biosynthetic process(GO:0042866) |
| 0.1 |
0.2 |
GO:0071476 |
hypotonic response(GO:0006971) cellular hypotonic response(GO:0071476) |
| 0.1 |
0.1 |
GO:0098501 |
polynucleotide dephosphorylation(GO:0098501) |
| 0.1 |
0.4 |
GO:0015819 |
lysine transport(GO:0015819) |
| 0.1 |
0.3 |
GO:0021747 |
cochlear nucleus development(GO:0021747) |
| 0.1 |
0.3 |
GO:0050872 |
white fat cell differentiation(GO:0050872) |
| 0.1 |
0.2 |
GO:1902037 |
negative regulation of hematopoietic stem cell differentiation(GO:1902037) |
| 0.1 |
0.1 |
GO:0042771 |
intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.1 |
4.6 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.1 |
0.7 |
GO:0006338 |
chromatin remodeling(GO:0006338) |
| 0.1 |
0.1 |
GO:0034393 |
positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.1 |
1.8 |
GO:0046856 |
phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 |
0.4 |
GO:0051770 |
positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.1 |
0.4 |
GO:0097237 |
cellular response to toxic substance(GO:0097237) |
| 0.1 |
0.3 |
GO:0006106 |
fumarate metabolic process(GO:0006106) aspartate catabolic process(GO:0006533) |
| 0.1 |
0.5 |
GO:0072176 |
nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
| 0.1 |
1.2 |
GO:0045879 |
negative regulation of smoothened signaling pathway(GO:0045879) |
| 0.1 |
0.4 |
GO:0006438 |
valyl-tRNA aminoacylation(GO:0006438) |
| 0.1 |
0.2 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.1 |
0.4 |
GO:1903288 |
regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
| 0.1 |
1.3 |
GO:0046033 |
AMP metabolic process(GO:0046033) |
| 0.1 |
0.3 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 |
0.1 |
GO:0040019 |
positive regulation of embryonic development(GO:0040019) |
| 0.1 |
0.2 |
GO:0071479 |
cellular response to ionizing radiation(GO:0071479) |
| 0.1 |
0.6 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.1 |
0.6 |
GO:2000303 |
regulation of ceramide biosynthetic process(GO:2000303) |
| 0.1 |
4.2 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
1.3 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.1 |
0.3 |
GO:0021794 |
thalamus development(GO:0021794) |
| 0.1 |
0.4 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.1 |
2.0 |
GO:0031016 |
pancreas development(GO:0031016) |
| 0.1 |
0.5 |
GO:0048255 |
mRNA stabilization(GO:0048255) |
| 0.1 |
0.7 |
GO:0034453 |
microtubule anchoring(GO:0034453) |
| 0.1 |
0.4 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.1 |
0.2 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.1 |
0.5 |
GO:0045616 |
regulation of keratinocyte differentiation(GO:0045616) |
| 0.1 |
1.5 |
GO:0051443 |
positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
| 0.1 |
1.2 |
GO:2000193 |
positive regulation of fatty acid transport(GO:2000193) |
| 0.1 |
0.6 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.1 |
0.3 |
GO:0033169 |
histone H3-K9 demethylation(GO:0033169) |
| 0.1 |
0.4 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 |
0.8 |
GO:0050860 |
negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.1 |
0.3 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.1 |
0.7 |
GO:0033211 |
adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 |
2.8 |
GO:0071346 |
cellular response to interferon-gamma(GO:0071346) |
| 0.1 |
1.1 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.1 |
0.3 |
GO:0070193 |
synaptonemal complex organization(GO:0070193) |
| 0.1 |
0.2 |
GO:0035826 |
rubidium ion transport(GO:0035826) regulation of rubidium ion transport(GO:2000680) |
| 0.1 |
0.1 |
GO:0035337 |
fatty-acyl-CoA metabolic process(GO:0035337) |
| 0.1 |
0.5 |
GO:0006046 |
N-acetylglucosamine catabolic process(GO:0006046) |
| 0.1 |
0.4 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.1 |
0.7 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.1 |
0.2 |
GO:0046716 |
muscle cell cellular homeostasis(GO:0046716) |
| 0.1 |
2.3 |
GO:0038061 |
NIK/NF-kappaB signaling(GO:0038061) |
| 0.1 |
0.8 |
GO:0030520 |
intracellular estrogen receptor signaling pathway(GO:0030520) |
| 0.1 |
0.2 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
0.1 |
GO:2000643 |
positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.1 |
0.4 |
GO:1902261 |
positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 |
1.3 |
GO:0006805 |
xenobiotic metabolic process(GO:0006805) cellular response to xenobiotic stimulus(GO:0071466) |
| 0.1 |
0.6 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 |
0.5 |
GO:0071364 |
response to epidermal growth factor(GO:0070849) cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.1 |
0.8 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 |
0.1 |
GO:0001787 |
natural killer cell proliferation(GO:0001787) |
| 0.1 |
0.3 |
GO:0051790 |
short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.1 |
0.7 |
GO:0035542 |
regulation of SNARE complex assembly(GO:0035542) |
| 0.1 |
0.2 |
GO:2000195 |
negative regulation of female gonad development(GO:2000195) |
| 0.1 |
0.2 |
GO:0032202 |
telomere assembly(GO:0032202) |
| 0.1 |
0.1 |
GO:0042473 |
outer ear morphogenesis(GO:0042473) |
| 0.1 |
0.6 |
GO:0060055 |
angiogenesis involved in wound healing(GO:0060055) |
| 0.1 |
0.3 |
GO:0070779 |
D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.1 |
2.3 |
GO:0003382 |
epithelial cell morphogenesis(GO:0003382) |
| 0.1 |
0.5 |
GO:0099515 |
actin filament-based transport(GO:0099515) |
| 0.1 |
0.2 |
GO:0042637 |
catagen(GO:0042637) |
| 0.1 |
0.2 |
GO:0033615 |
mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 |
0.3 |
GO:0008616 |
queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 |
1.0 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 |
0.5 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.1 |
0.6 |
GO:0007131 |
reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.1 |
0.6 |
GO:0045740 |
positive regulation of DNA replication(GO:0045740) |
| 0.1 |
0.1 |
GO:0010890 |
positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.1 |
0.2 |
GO:0070589 |
cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.1 |
1.6 |
GO:2000179 |
positive regulation of neural precursor cell proliferation(GO:2000179) |
| 0.1 |
0.4 |
GO:0046329 |
negative regulation of JNK cascade(GO:0046329) |
| 0.1 |
0.2 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.1 |
0.2 |
GO:0006536 |
glutamate metabolic process(GO:0006536) |
| 0.1 |
0.8 |
GO:0015936 |
coenzyme A metabolic process(GO:0015936) |
| 0.1 |
2.1 |
GO:0042633 |
molting cycle(GO:0042303) hair cycle(GO:0042633) |
| 0.1 |
0.9 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.1 |
0.3 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.1 |
0.2 |
GO:0002024 |
diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.1 |
0.2 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.1 |
0.2 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.1 |
0.2 |
GO:0046655 |
folic acid metabolic process(GO:0046655) |
| 0.1 |
0.9 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.1 |
0.4 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
0.6 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.1 |
0.4 |
GO:0006970 |
response to osmotic stress(GO:0006970) |
| 0.1 |
0.1 |
GO:0006760 |
folic acid-containing compound metabolic process(GO:0006760) pteridine-containing compound metabolic process(GO:0042558) |
| 0.1 |
0.2 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
1.3 |
GO:0001578 |
microtubule bundle formation(GO:0001578) |
| 0.1 |
0.3 |
GO:0070164 |
negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 |
3.0 |
GO:0007224 |
smoothened signaling pathway(GO:0007224) |
| 0.1 |
0.1 |
GO:0031915 |
positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 |
0.4 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.1 |
0.7 |
GO:0010972 |
negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 0.1 |
0.9 |
GO:0015693 |
magnesium ion transport(GO:0015693) |
| 0.1 |
0.4 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.1 |
0.3 |
GO:0071107 |
response to parathyroid hormone(GO:0071107) |
| 0.1 |
0.2 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.1 |
0.5 |
GO:0042149 |
cellular response to glucose starvation(GO:0042149) |
| 0.1 |
0.3 |
GO:0010907 |
positive regulation of glucose metabolic process(GO:0010907) |
| 0.1 |
0.7 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.1 |
0.5 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.1 |
0.2 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 |
0.8 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.1 |
0.1 |
GO:0048546 |
digestive tract morphogenesis(GO:0048546) |
| 0.1 |
0.9 |
GO:0010591 |
regulation of lamellipodium assembly(GO:0010591) |
| 0.1 |
1.6 |
GO:0001824 |
blastocyst development(GO:0001824) |
| 0.1 |
0.5 |
GO:0043276 |
anoikis(GO:0043276) |
| 0.1 |
1.1 |
GO:0006289 |
nucleotide-excision repair(GO:0006289) |
| 0.1 |
0.2 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.1 |
1.1 |
GO:0048636 |
positive regulation of striated muscle tissue development(GO:0045844) positive regulation of muscle organ development(GO:0048636) |
| 0.1 |
0.3 |
GO:0007252 |
I-kappaB phosphorylation(GO:0007252) |
| 0.1 |
3.5 |
GO:0006334 |
nucleosome assembly(GO:0006334) |
| 0.1 |
0.4 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.1 |
0.9 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 |
0.4 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.1 |
0.9 |
GO:0006260 |
DNA replication(GO:0006260) |
| 0.1 |
0.7 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
0.3 |
GO:1900095 |
regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.1 |
0.4 |
GO:0060117 |
auditory receptor cell development(GO:0060117) |
| 0.1 |
0.5 |
GO:0043584 |
nose development(GO:0043584) |
| 0.1 |
0.1 |
GO:0006404 |
RNA import into nucleus(GO:0006404) |
| 0.1 |
11.1 |
GO:0007067 |
mitotic nuclear division(GO:0007067) |
| 0.1 |
0.1 |
GO:0019348 |
dolichol metabolic process(GO:0019348) |
| 0.1 |
0.2 |
GO:0031342 |
negative regulation of cell killing(GO:0031342) |
| 0.1 |
0.1 |
GO:0046902 |
regulation of mitochondrial membrane permeability(GO:0046902) regulation of membrane permeability(GO:0090559) |
| 0.1 |
0.3 |
GO:0009410 |
response to xenobiotic stimulus(GO:0009410) |
| 0.1 |
0.2 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.1 |
2.1 |
GO:0000271 |
polysaccharide biosynthetic process(GO:0000271) |
| 0.1 |
0.7 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.1 |
0.6 |
GO:0019432 |
triglyceride biosynthetic process(GO:0019432) |
| 0.1 |
0.2 |
GO:0033127 |
regulation of histone phosphorylation(GO:0033127) positive regulation of histone phosphorylation(GO:0033129) |
| 0.1 |
0.2 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 |
0.4 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.1 |
1.1 |
GO:0032784 |
regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.1 |
0.1 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.1 |
0.2 |
GO:0048875 |
chemical homeostasis within a tissue(GO:0048875) |
| 0.1 |
0.4 |
GO:1903392 |
negative regulation of adherens junction organization(GO:1903392) |
| 0.1 |
0.2 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 |
0.3 |
GO:0010592 |
positive regulation of lamellipodium assembly(GO:0010592) |
| 0.1 |
1.5 |
GO:0048286 |
lung alveolus development(GO:0048286) |
| 0.1 |
0.6 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.1 |
0.3 |
GO:0061684 |
chaperone-mediated autophagy(GO:0061684) |
| 0.1 |
0.6 |
GO:0051642 |
centrosome localization(GO:0051642) |
| 0.1 |
0.1 |
GO:0050942 |
positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) |
| 0.1 |
0.5 |
GO:0006541 |
glutamine metabolic process(GO:0006541) |
| 0.1 |
0.5 |
GO:0030330 |
DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.1 |
1.0 |
GO:0007044 |
cell-substrate junction assembly(GO:0007044) |
| 0.1 |
0.1 |
GO:1900122 |
positive regulation of receptor binding(GO:1900122) |
| 0.1 |
0.2 |
GO:1901072 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) glucosamine-containing compound catabolic process(GO:1901072) |
| 0.1 |
1.4 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 0.1 |
0.4 |
GO:0070534 |
protein K63-linked ubiquitination(GO:0070534) |
| 0.1 |
0.2 |
GO:0006672 |
ceramide metabolic process(GO:0006672) |
| 0.1 |
2.8 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.1 |
0.2 |
GO:2001240 |
negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.1 |
0.8 |
GO:0031122 |
cytoplasmic microtubule organization(GO:0031122) |
| 0.1 |
0.1 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.1 |
1.8 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.1 |
0.2 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.1 |
0.3 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 |
0.2 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.1 |
0.5 |
GO:0001889 |
liver development(GO:0001889) |
| 0.1 |
3.1 |
GO:0007601 |
visual perception(GO:0007601) |
| 0.1 |
0.1 |
GO:0051131 |
chaperone-mediated protein complex assembly(GO:0051131) |
| 0.1 |
0.3 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.1 |
0.1 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.1 |
0.5 |
GO:0009299 |
mRNA transcription(GO:0009299) |
| 0.1 |
0.1 |
GO:0002182 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.0 |
1.6 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.0 |
0.1 |
GO:0061073 |
ciliary body morphogenesis(GO:0061073) |
| 0.0 |
0.1 |
GO:0086016 |
AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
| 0.0 |
0.9 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 |
0.4 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.0 |
0.5 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 |
0.1 |
GO:0090086 |
regulation of protein deubiquitination(GO:0090085) negative regulation of protein deubiquitination(GO:0090086) |
| 0.0 |
0.4 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.0 |
0.2 |
GO:0006573 |
valine metabolic process(GO:0006573) |
| 0.0 |
0.3 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 |
0.1 |
GO:0003338 |
metanephros morphogenesis(GO:0003338) |
| 0.0 |
0.8 |
GO:0032204 |
regulation of telomere maintenance(GO:0032204) |
| 0.0 |
0.6 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.0 |
0.1 |
GO:0090030 |
negative regulation of hormone metabolic process(GO:0032351) negative regulation of hormone biosynthetic process(GO:0032353) regulation of steroid hormone biosynthetic process(GO:0090030) |
| 0.0 |
0.8 |
GO:0030177 |
positive regulation of Wnt signaling pathway(GO:0030177) |
| 0.0 |
0.2 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.0 |
0.2 |
GO:0097503 |
sialylation(GO:0097503) |
| 0.0 |
0.1 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.0 |
0.1 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.0 |
0.1 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.0 |
0.1 |
GO:0007440 |
foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.0 |
0.0 |
GO:1900118 |
negative regulation of execution phase of apoptosis(GO:1900118) |
| 0.0 |
0.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 |
1.6 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.0 |
0.0 |
GO:0002903 |
negative regulation of B cell apoptotic process(GO:0002903) |
| 0.0 |
0.4 |
GO:0051497 |
negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 |
0.4 |
GO:0001841 |
neural tube formation(GO:0001841) |
| 0.0 |
0.7 |
GO:0050830 |
defense response to Gram-positive bacterium(GO:0050830) |
| 0.0 |
0.3 |
GO:0006730 |
one-carbon metabolic process(GO:0006730) |
| 0.0 |
0.1 |
GO:1902775 |
mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 |
0.2 |
GO:0016926 |
protein desumoylation(GO:0016926) |
| 0.0 |
0.1 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 |
0.0 |
GO:0010612 |
regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
| 0.0 |
0.1 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.0 |
0.0 |
GO:0015810 |
aspartate transport(GO:0015810) |
| 0.0 |
0.0 |
GO:2000170 |
positive regulation of peptidyl-cysteine S-nitrosylation(GO:2000170) |
| 0.0 |
0.1 |
GO:1902414 |
protein localization to cell junction(GO:1902414) |
| 0.0 |
0.1 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.0 |
0.2 |
GO:0009143 |
nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 |
0.1 |
GO:0070124 |
mitochondrial translational initiation(GO:0070124) |
| 0.0 |
1.4 |
GO:0006413 |
translational initiation(GO:0006413) |
| 0.0 |
0.1 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.0 |
0.1 |
GO:0000469 |
cleavage involved in rRNA processing(GO:0000469) |
| 0.0 |
0.1 |
GO:0009133 |
nucleoside diphosphate biosynthetic process(GO:0009133) |
| 0.0 |
0.2 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.0 |
0.1 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.0 |
0.2 |
GO:0003351 |
epithelial cilium movement(GO:0003351) |
| 0.0 |
0.4 |
GO:0046580 |
negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
| 0.0 |
0.1 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 |
0.6 |
GO:0007050 |
cell cycle arrest(GO:0007050) |
| 0.0 |
0.1 |
GO:0030813 |
positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.0 |
0.9 |
GO:0045727 |
positive regulation of translation(GO:0045727) |
| 0.0 |
0.1 |
GO:0006265 |
DNA topological change(GO:0006265) |
| 0.0 |
0.1 |
GO:1902236 |
negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 |
0.1 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.0 |
0.1 |
GO:0072673 |
lamellipodium morphogenesis(GO:0072673) |
| 0.0 |
0.0 |
GO:0046470 |
phosphatidylcholine metabolic process(GO:0046470) |
| 0.0 |
0.0 |
GO:2001023 |
regulation of response to drug(GO:2001023) |
| 0.0 |
0.1 |
GO:0045648 |
positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.0 |
0.1 |
GO:0010761 |
fibroblast migration(GO:0010761) |
| 0.0 |
0.0 |
GO:0032508 |
DNA duplex unwinding(GO:0032508) |
| 0.0 |
0.0 |
GO:0072202 |
cell differentiation involved in metanephros development(GO:0072202) |
| 0.0 |
0.1 |
GO:0045906 |
negative regulation of vasoconstriction(GO:0045906) |
| 0.0 |
0.1 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 |
0.2 |
GO:0000002 |
mitochondrial genome maintenance(GO:0000002) |
| 0.0 |
1.8 |
GO:0006281 |
DNA repair(GO:0006281) |
| 0.0 |
0.0 |
GO:0002051 |
osteoblast fate commitment(GO:0002051) |
| 0.0 |
0.1 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.0 |
0.0 |
GO:0051562 |
negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 |
0.1 |
GO:0097066 |
response to thyroid hormone(GO:0097066) |
| 0.0 |
0.0 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.0 |
0.1 |
GO:0070208 |
protein heterotrimerization(GO:0070208) |
| 0.0 |
0.1 |
GO:0001773 |
myeloid dendritic cell activation(GO:0001773) myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 |
0.1 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.0 |
0.1 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.0 |
0.0 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.0 |
0.1 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.0 |
0.0 |
GO:0031086 |
nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 |
0.1 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 |
0.0 |
GO:0071426 |
ribonucleoprotein complex export from nucleus(GO:0071426) |
| 0.0 |
0.1 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.0 |
0.2 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.0 |
0.1 |
GO:0038032 |
termination of G-protein coupled receptor signaling pathway(GO:0038032) |
| 0.0 |
0.2 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 |
0.1 |
GO:0010718 |
positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.0 |
0.1 |
GO:0061088 |
sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 |
0.0 |
GO:1990118 |
sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 |
0.0 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.0 |
0.0 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
