| 0.7 |
2.1 |
GO:0003349 |
epicardium-derived cardiac endothelial cell differentiation(GO:0003349) |
| 0.5 |
1.5 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.4 |
1.8 |
GO:0046469 |
platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.4 |
2.2 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.4 |
3.1 |
GO:0009449 |
gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.4 |
1.1 |
GO:0070649 |
meiotic chromosome movement towards spindle pole(GO:0016344) formin-nucleated actin cable assembly(GO:0070649) |
| 0.3 |
0.3 |
GO:0035561 |
regulation of chromatin binding(GO:0035561) negative regulation of chromatin binding(GO:0035562) |
| 0.3 |
1.9 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.3 |
1.5 |
GO:0070779 |
D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.3 |
1.2 |
GO:0071139 |
resolution of recombination intermediates(GO:0071139) |
| 0.3 |
0.9 |
GO:0032650 |
regulation of interleukin-1 alpha production(GO:0032650) positive regulation of interleukin-1 alpha production(GO:0032730) cardiac cell fate determination(GO:0060913) |
| 0.3 |
0.8 |
GO:0060166 |
olfactory pit development(GO:0060166) |
| 0.3 |
2.5 |
GO:0021984 |
adenohypophysis development(GO:0021984) |
| 0.2 |
0.7 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.2 |
1.2 |
GO:0015705 |
iodide transport(GO:0015705) |
| 0.2 |
1.2 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.2 |
0.7 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.2 |
1.4 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.2 |
0.2 |
GO:0061535 |
glutamate secretion, neurotransmission(GO:0061535) |
| 0.2 |
0.6 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.2 |
0.6 |
GO:0010814 |
substance P catabolic process(GO:0010814) calcitonin catabolic process(GO:0010816) endothelin maturation(GO:0034959) |
| 0.2 |
1.0 |
GO:0014719 |
skeletal muscle satellite cell activation(GO:0014719) |
| 0.2 |
0.8 |
GO:1903525 |
regulation of membrane tubulation(GO:1903525) |
| 0.2 |
0.6 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.2 |
0.9 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.2 |
0.4 |
GO:0072034 |
renal vesicle induction(GO:0072034) |
| 0.2 |
0.9 |
GO:0021764 |
amygdala development(GO:0021764) |
| 0.2 |
0.9 |
GO:1903347 |
negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.2 |
0.7 |
GO:0090467 |
lysine transport(GO:0015819) L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) amino acid import into cell(GO:1902837) |
| 0.2 |
0.5 |
GO:0008065 |
establishment of blood-nerve barrier(GO:0008065) regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion(GO:0014809) |
| 0.2 |
0.9 |
GO:0032224 |
positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.2 |
0.7 |
GO:2001274 |
negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
| 0.2 |
0.5 |
GO:0009174 |
UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.2 |
0.7 |
GO:2000211 |
regulation of glutamate metabolic process(GO:2000211) |
| 0.2 |
1.7 |
GO:2000172 |
regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.2 |
0.5 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 0.2 |
0.5 |
GO:1903279 |
regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.2 |
0.5 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 0.2 |
1.5 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 |
0.3 |
GO:0030321 |
transepithelial chloride transport(GO:0030321) |
| 0.1 |
0.7 |
GO:0060022 |
hard palate development(GO:0060022) |
| 0.1 |
1.0 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 0.1 |
0.6 |
GO:0007066 |
female meiosis sister chromatid cohesion(GO:0007066) |
| 0.1 |
0.6 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.1 |
0.6 |
GO:0060032 |
notochord regression(GO:0060032) |
| 0.1 |
0.3 |
GO:0045410 |
positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.1 |
0.8 |
GO:0030643 |
cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.1 |
1.2 |
GO:2001054 |
negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
| 0.1 |
0.4 |
GO:0060743 |
epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.1 |
1.7 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.1 |
0.5 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 0.1 |
0.4 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 0.1 |
0.4 |
GO:0010986 |
positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.1 |
0.9 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.1 |
0.4 |
GO:0070671 |
response to interleukin-12(GO:0070671) |
| 0.1 |
0.4 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.1 |
0.4 |
GO:0043651 |
linoleic acid metabolic process(GO:0043651) |
| 0.1 |
0.4 |
GO:0044333 |
Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 0.1 |
0.2 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.1 |
1.0 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 |
0.1 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.1 |
1.3 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 0.1 |
0.2 |
GO:0060666 |
dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.1 |
0.4 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 |
0.2 |
GO:0010911 |
regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.1 |
0.7 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.1 |
0.7 |
GO:0021747 |
cochlear nucleus development(GO:0021747) |
| 0.1 |
0.2 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.1 |
0.6 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.1 |
0.4 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 |
0.3 |
GO:1902174 |
positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 |
0.9 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 |
1.1 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.1 |
0.1 |
GO:0090298 |
negative regulation of mitochondrial DNA replication(GO:0090298) |
| 0.1 |
0.3 |
GO:0035672 |
regulation of cellular pH reduction(GO:0032847) oligopeptide transmembrane transport(GO:0035672) |
| 0.1 |
0.3 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.1 |
0.9 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 |
0.4 |
GO:0070213 |
protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 |
0.5 |
GO:0046601 |
positive regulation of centriole replication(GO:0046601) |
| 0.1 |
0.2 |
GO:1903795 |
regulation of inorganic anion transmembrane transport(GO:1903795) |
| 0.1 |
0.5 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 |
0.6 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.1 |
1.0 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.1 |
0.3 |
GO:0003223 |
ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.1 |
0.5 |
GO:0009052 |
pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 |
0.1 |
GO:0070884 |
calcineurin-NFAT signaling cascade(GO:0033173) inositol phosphate-mediated signaling(GO:0048016) regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.1 |
0.3 |
GO:0000087 |
mitotic M phase(GO:0000087) |
| 0.1 |
0.4 |
GO:0072385 |
minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.1 |
0.2 |
GO:0048162 |
preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.1 |
0.5 |
GO:0006172 |
ADP biosynthetic process(GO:0006172) |
| 0.1 |
0.2 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 0.1 |
0.3 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.1 |
0.1 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.1 |
0.4 |
GO:0015871 |
choline transport(GO:0015871) |
| 0.1 |
0.3 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.1 |
0.3 |
GO:0036228 |
protein targeting to nuclear inner membrane(GO:0036228) |
| 0.1 |
1.0 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.1 |
0.8 |
GO:0071420 |
cellular response to histamine(GO:0071420) |
| 0.1 |
0.1 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 |
0.3 |
GO:0010891 |
negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.1 |
0.3 |
GO:0006601 |
creatine biosynthetic process(GO:0006601) |
| 0.1 |
0.5 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.1 |
0.6 |
GO:0010908 |
regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 |
0.8 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 |
0.1 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.1 |
0.2 |
GO:0046541 |
saliva secretion(GO:0046541) |
| 0.1 |
0.2 |
GO:1903061 |
establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
| 0.1 |
0.1 |
GO:0031339 |
negative regulation of vesicle fusion(GO:0031339) |
| 0.1 |
0.2 |
GO:0008594 |
photoreceptor cell morphogenesis(GO:0008594) |
| 0.1 |
0.2 |
GO:0045014 |
detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) detection of glucose(GO:0051594) |
| 0.1 |
0.5 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.1 |
0.3 |
GO:0065001 |
negative regulation of histone H3-K36 methylation(GO:0000415) specification of axis polarity(GO:0065001) |
| 0.1 |
0.2 |
GO:0009448 |
gamma-aminobutyric acid metabolic process(GO:0009448) |
| 0.1 |
0.3 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.1 |
0.8 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.1 |
0.7 |
GO:0036371 |
protein localization to M-band(GO:0036309) protein localization to T-tubule(GO:0036371) |
| 0.1 |
0.4 |
GO:0014022 |
neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) convergent extension involved in gastrulation(GO:0060027) convergent extension involved in axis elongation(GO:0060028) |
| 0.1 |
1.6 |
GO:0061029 |
eyelid development in camera-type eye(GO:0061029) |
| 0.1 |
0.9 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.1 |
0.4 |
GO:0007528 |
neuromuscular junction development(GO:0007528) |
| 0.1 |
0.3 |
GO:0090164 |
asymmetric Golgi ribbon formation(GO:0090164) |
| 0.1 |
0.1 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) regulation of activation of JAK2 kinase activity(GO:0010534) |
| 0.1 |
0.9 |
GO:0000059 |
protein import into nucleus, docking(GO:0000059) |
| 0.1 |
0.7 |
GO:0035280 |
miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
| 0.1 |
0.3 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.1 |
0.4 |
GO:2000483 |
detection of bacterium(GO:0016045) detection of other organism(GO:0098543) negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.1 |
0.6 |
GO:0006290 |
pyrimidine dimer repair(GO:0006290) |
| 0.1 |
0.4 |
GO:0034587 |
piRNA metabolic process(GO:0034587) |
| 0.1 |
0.2 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 |
0.2 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.1 |
0.1 |
GO:1902263 |
apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.1 |
0.1 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
0.2 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.1 |
0.3 |
GO:1900169 |
regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.1 |
0.4 |
GO:0042795 |
snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.1 |
0.3 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.1 |
0.1 |
GO:0060744 |
thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 |
0.2 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.1 |
1.0 |
GO:1902287 |
semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.1 |
0.5 |
GO:0060923 |
cardiac muscle cell fate commitment(GO:0060923) |
| 0.1 |
1.0 |
GO:0044381 |
glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.1 |
0.5 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.1 |
0.2 |
GO:0050925 |
negative regulation of negative chemotaxis(GO:0050925) |
| 0.1 |
0.2 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.1 |
0.3 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 |
0.1 |
GO:0010878 |
cholesterol storage(GO:0010878) |
| 0.1 |
0.5 |
GO:0009181 |
purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
| 0.1 |
0.4 |
GO:0000160 |
phosphorelay signal transduction system(GO:0000160) |
| 0.1 |
0.9 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 0.1 |
0.3 |
GO:0016266 |
O-glycan processing(GO:0016266) |
| 0.1 |
0.4 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 |
0.3 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.1 |
0.3 |
GO:0001778 |
plasma membrane repair(GO:0001778) |
| 0.1 |
0.3 |
GO:0002182 |
cytoplasmic translational elongation(GO:0002182) regulation of cytoplasmic translational elongation(GO:1900247) negative regulation of cytoplasmic translational elongation(GO:1900248) |
| 0.1 |
0.4 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.1 |
0.5 |
GO:0046007 |
negative regulation of activated T cell proliferation(GO:0046007) |
| 0.1 |
0.5 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 |
0.2 |
GO:0031860 |
telomeric 3' overhang formation(GO:0031860) |
| 0.1 |
0.5 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.1 |
0.6 |
GO:0042711 |
maternal behavior(GO:0042711) |
| 0.1 |
1.7 |
GO:0007608 |
sensory perception of smell(GO:0007608) |
| 0.1 |
0.9 |
GO:0015693 |
magnesium ion transport(GO:0015693) |
| 0.1 |
0.1 |
GO:0007621 |
negative regulation of female receptivity(GO:0007621) |
| 0.1 |
0.3 |
GO:0051694 |
pointed-end actin filament capping(GO:0051694) |
| 0.1 |
0.2 |
GO:0046077 |
dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.1 |
0.2 |
GO:0038108 |
negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
| 0.1 |
0.8 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 0.1 |
0.4 |
GO:0061092 |
regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
| 0.1 |
0.8 |
GO:0015937 |
coenzyme A biosynthetic process(GO:0015937) |
| 0.1 |
0.2 |
GO:0072365 |
regulation of cellular ketone metabolic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072365) |
| 0.1 |
0.2 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.1 |
0.1 |
GO:1905049 |
negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.1 |
0.2 |
GO:0009405 |
pathogenesis(GO:0009405) |
| 0.1 |
0.1 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) |
| 0.1 |
0.5 |
GO:1901660 |
calcium ion export(GO:1901660) |
| 0.1 |
0.2 |
GO:0032000 |
positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.1 |
0.2 |
GO:1900028 |
negative regulation of ruffle assembly(GO:1900028) |
| 0.1 |
0.5 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.1 |
0.2 |
GO:0070944 |
neutrophil mediated killing of bacterium(GO:0070944) |
| 0.1 |
0.2 |
GO:0046381 |
CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.1 |
0.2 |
GO:2001106 |
regulation of Rho guanyl-nucleotide exchange factor activity(GO:2001106) |
| 0.0 |
0.2 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 |
0.3 |
GO:0097680 |
double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 |
0.4 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.0 |
0.4 |
GO:0045723 |
positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 |
0.3 |
GO:0097264 |
self proteolysis(GO:0097264) |
| 0.0 |
0.1 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 |
0.4 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.0 |
0.5 |
GO:0003413 |
chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
| 0.0 |
0.2 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.0 |
0.2 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 |
1.0 |
GO:0035024 |
negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.0 |
0.3 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.0 |
0.3 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.0 |
0.4 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 |
0.1 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.0 |
2.0 |
GO:2001222 |
regulation of neuron migration(GO:2001222) |
| 0.0 |
1.4 |
GO:1902476 |
chloride transmembrane transport(GO:1902476) |
| 0.0 |
0.4 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.0 |
0.1 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.0 |
0.2 |
GO:1902993 |
positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.0 |
0.2 |
GO:0001920 |
negative regulation of receptor recycling(GO:0001920) |
| 0.0 |
0.4 |
GO:0043374 |
CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 |
0.5 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.0 |
0.2 |
GO:0045627 |
positive regulation of T-helper 1 cell differentiation(GO:0045627) |
| 0.0 |
0.8 |
GO:0010763 |
positive regulation of fibroblast migration(GO:0010763) |
| 0.0 |
0.2 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.0 |
0.1 |
GO:0060397 |
JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.0 |
0.1 |
GO:0055059 |
asymmetric neuroblast division(GO:0055059) |
| 0.0 |
0.7 |
GO:1900048 |
positive regulation of blood coagulation(GO:0030194) positive regulation of hemostasis(GO:1900048) |
| 0.0 |
0.3 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.0 |
0.4 |
GO:0001711 |
endodermal cell fate commitment(GO:0001711) |
| 0.0 |
0.3 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.0 |
0.1 |
GO:0010744 |
positive regulation of macrophage derived foam cell differentiation(GO:0010744) |
| 0.0 |
0.4 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 |
0.9 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.0 |
0.1 |
GO:0014877 |
response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.0 |
0.3 |
GO:0051461 |
protein import into peroxisome matrix, docking(GO:0016560) regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.0 |
0.3 |
GO:0050957 |
equilibrioception(GO:0050957) |
| 0.0 |
0.3 |
GO:0043313 |
regulation of neutrophil degranulation(GO:0043313) regulation of neutrophil activation(GO:1902563) |
| 0.0 |
0.2 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.0 |
0.3 |
GO:0048681 |
negative regulation of axon regeneration(GO:0048681) |
| 0.0 |
0.2 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 0.0 |
0.2 |
GO:0032237 |
activation of store-operated calcium channel activity(GO:0032237) |
| 0.0 |
0.3 |
GO:0001977 |
renal system process involved in regulation of blood volume(GO:0001977) |
| 0.0 |
0.5 |
GO:0043045 |
DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.0 |
0.5 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 |
0.3 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 |
0.5 |
GO:0000052 |
citrulline metabolic process(GO:0000052) |
| 0.0 |
0.2 |
GO:0015791 |
polyol transport(GO:0015791) |
| 0.0 |
0.3 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 |
0.2 |
GO:2000370 |
positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.0 |
0.8 |
GO:0014047 |
glutamate secretion(GO:0014047) |
| 0.0 |
0.1 |
GO:0001830 |
trophectodermal cell fate commitment(GO:0001830) |
| 0.0 |
0.2 |
GO:0006041 |
glucosamine metabolic process(GO:0006041) |
| 0.0 |
0.1 |
GO:0006435 |
threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 |
0.5 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.0 |
0.0 |
GO:0033292 |
T-tubule organization(GO:0033292) |
| 0.0 |
0.2 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.0 |
2.5 |
GO:0030032 |
lamellipodium assembly(GO:0030032) |
| 0.0 |
0.3 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 |
0.7 |
GO:0010172 |
embryonic body morphogenesis(GO:0010172) |
| 0.0 |
0.0 |
GO:2000974 |
negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of pro-B cell differentiation(GO:2000974) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
| 0.0 |
0.5 |
GO:0043113 |
receptor clustering(GO:0043113) |
| 0.0 |
0.3 |
GO:2000809 |
positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.0 |
0.4 |
GO:0032460 |
negative regulation of protein oligomerization(GO:0032460) negative regulation of protein homooligomerization(GO:0032463) |
| 0.0 |
1.0 |
GO:0001573 |
ganglioside metabolic process(GO:0001573) |
| 0.0 |
0.1 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.0 |
0.1 |
GO:0046098 |
guanine metabolic process(GO:0046098) |
| 0.0 |
0.1 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.0 |
1.6 |
GO:0045022 |
early endosome to late endosome transport(GO:0045022) |
| 0.0 |
0.2 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.0 |
0.1 |
GO:0098528 |
skeletal muscle fiber differentiation(GO:0098528) |
| 0.0 |
0.2 |
GO:1904738 |
vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.0 |
0.2 |
GO:0046501 |
protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 |
1.4 |
GO:0036075 |
endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 |
0.4 |
GO:0010715 |
regulation of extracellular matrix disassembly(GO:0010715) collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.0 |
0.5 |
GO:0044030 |
regulation of DNA methylation(GO:0044030) |
| 0.0 |
0.6 |
GO:0007638 |
mechanosensory behavior(GO:0007638) |
| 0.0 |
0.1 |
GO:0090231 |
spindle checkpoint(GO:0031577) regulation of spindle checkpoint(GO:0090231) |
| 0.0 |
0.2 |
GO:0010820 |
positive regulation of T cell chemotaxis(GO:0010820) |
| 0.0 |
0.3 |
GO:0018230 |
peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.0 |
0.2 |
GO:0006544 |
glycine metabolic process(GO:0006544) |
| 0.0 |
0.2 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.0 |
0.3 |
GO:0031268 |
pseudopodium organization(GO:0031268) |
| 0.0 |
0.3 |
GO:2000766 |
negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 |
0.1 |
GO:2000507 |
positive regulation of energy homeostasis(GO:2000507) |
| 0.0 |
0.3 |
GO:0009435 |
NAD biosynthetic process(GO:0009435) |
| 0.0 |
0.4 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.0 |
1.2 |
GO:0050879 |
multicellular organismal movement(GO:0050879) musculoskeletal movement(GO:0050881) |
| 0.0 |
0.3 |
GO:0010459 |
negative regulation of heart rate(GO:0010459) |
| 0.0 |
0.1 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 |
0.6 |
GO:0007271 |
synaptic transmission, cholinergic(GO:0007271) |
| 0.0 |
0.1 |
GO:2000832 |
negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.0 |
0.5 |
GO:1903861 |
regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.0 |
0.5 |
GO:0002089 |
lens morphogenesis in camera-type eye(GO:0002089) |
| 0.0 |
0.2 |
GO:0048742 |
regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 |
0.1 |
GO:0045541 |
negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 |
0.1 |
GO:0006987 |
activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.0 |
1.7 |
GO:0048709 |
oligodendrocyte differentiation(GO:0048709) |
| 0.0 |
0.1 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 |
0.2 |
GO:0071732 |
cellular response to nitric oxide(GO:0071732) |
| 0.0 |
0.2 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 |
0.1 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 |
0.3 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.0 |
1.5 |
GO:0051304 |
chromosome separation(GO:0051304) |
| 0.0 |
0.1 |
GO:0036506 |
maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 |
0.4 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 |
0.2 |
GO:0007250 |
activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 |
0.1 |
GO:0001865 |
NK T cell differentiation(GO:0001865) regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 |
0.2 |
GO:0007220 |
Notch receptor processing(GO:0007220) |
| 0.0 |
0.2 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.0 |
0.1 |
GO:0002322 |
B cell proliferation involved in immune response(GO:0002322) |
| 0.0 |
0.1 |
GO:1904425 |
negative regulation of GTP binding(GO:1904425) |
| 0.0 |
0.2 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.0 |
0.1 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.0 |
0.1 |
GO:0035457 |
cellular response to interferon-alpha(GO:0035457) |
| 0.0 |
1.0 |
GO:0000184 |
nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 |
0.3 |
GO:0046597 |
negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 |
0.0 |
GO:0010807 |
regulation of synaptic vesicle priming(GO:0010807) |
| 0.0 |
0.1 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.0 |
0.4 |
GO:0003016 |
respiratory system process(GO:0003016) |
| 0.0 |
0.5 |
GO:0050982 |
detection of mechanical stimulus(GO:0050982) |
| 0.0 |
0.2 |
GO:0007168 |
receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 |
0.1 |
GO:0008334 |
histone mRNA metabolic process(GO:0008334) histone mRNA catabolic process(GO:0071044) |
| 0.0 |
0.1 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 0.0 |
0.4 |
GO:1902895 |
positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
| 0.0 |
0.9 |
GO:0048278 |
vesicle docking(GO:0048278) |
| 0.0 |
0.2 |
GO:0016188 |
synaptic vesicle maturation(GO:0016188) |
| 0.0 |
0.7 |
GO:0046785 |
microtubule polymerization(GO:0046785) |
| 0.0 |
0.2 |
GO:0071801 |
regulation of podosome assembly(GO:0071801) |
| 0.0 |
0.1 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.0 |
0.3 |
GO:0048671 |
negative regulation of collateral sprouting(GO:0048671) |
| 0.0 |
0.3 |
GO:0034389 |
lipid particle organization(GO:0034389) |
| 0.0 |
0.2 |
GO:0003148 |
outflow tract septum morphogenesis(GO:0003148) |
| 0.0 |
0.3 |
GO:0002063 |
chondrocyte development(GO:0002063) |
| 0.0 |
0.7 |
GO:0051220 |
cytoplasmic sequestering of protein(GO:0051220) |
| 0.0 |
0.2 |
GO:0045602 |
negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.0 |
0.2 |
GO:0006534 |
cysteine metabolic process(GO:0006534) |
| 0.0 |
0.4 |
GO:0007340 |
acrosome reaction(GO:0007340) |
| 0.0 |
0.1 |
GO:1903887 |
motile primary cilium assembly(GO:1903887) |
| 0.0 |
0.7 |
GO:0006821 |
chloride transport(GO:0006821) |
| 0.0 |
0.2 |
GO:0010883 |
regulation of lipid storage(GO:0010883) |
| 0.0 |
0.3 |
GO:0098868 |
endochondral bone growth(GO:0003416) bone growth(GO:0098868) |
| 0.0 |
0.3 |
GO:1901976 |
regulation of cell cycle checkpoint(GO:1901976) |
| 0.0 |
0.1 |
GO:0031652 |
positive regulation of heat generation(GO:0031652) |
| 0.0 |
0.2 |
GO:0001921 |
positive regulation of receptor recycling(GO:0001921) |
| 0.0 |
0.4 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.0 |
0.3 |
GO:0002031 |
G-protein coupled receptor internalization(GO:0002031) |
| 0.0 |
0.1 |
GO:1904321 |
response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 |
0.2 |
GO:1903779 |
regulation of cardiac conduction(GO:1903779) |
| 0.0 |
0.1 |
GO:0070498 |
interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.0 |
0.1 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 |
0.4 |
GO:2000651 |
positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.0 |
0.1 |
GO:0007628 |
adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
| 0.0 |
0.1 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.0 |
0.2 |
GO:1903038 |
negative regulation of leukocyte cell-cell adhesion(GO:1903038) |
| 0.0 |
0.0 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.0 |
0.3 |
GO:0007020 |
microtubule nucleation(GO:0007020) |
| 0.0 |
0.1 |
GO:0048706 |
embryonic skeletal system development(GO:0048706) |
| 0.0 |
0.1 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.0 |
0.4 |
GO:0006491 |
N-glycan processing(GO:0006491) |
| 0.0 |
0.2 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.0 |
0.4 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 |
0.1 |
GO:0046514 |
ceramide catabolic process(GO:0046514) |
| 0.0 |
0.1 |
GO:0009249 |
protein lipoylation(GO:0009249) |
| 0.0 |
0.1 |
GO:0035590 |
purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 |
0.5 |
GO:0006730 |
one-carbon metabolic process(GO:0006730) |
| 0.0 |
0.1 |
GO:0071712 |
ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 |
0.3 |
GO:0001881 |
receptor recycling(GO:0001881) |
| 0.0 |
0.3 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.0 |
0.2 |
GO:0060259 |
regulation of feeding behavior(GO:0060259) |
| 0.0 |
0.1 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.0 |
0.0 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.0 |
0.2 |
GO:0007218 |
neuropeptide signaling pathway(GO:0007218) |
| 0.0 |
0.3 |
GO:0030201 |
heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.0 |
0.1 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.0 |
0.0 |
GO:2000409 |
positive regulation of T cell extravasation(GO:2000409) |
| 0.0 |
0.4 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.0 |
0.1 |
GO:0035970 |
peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.0 |
0.1 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.0 |
0.3 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 |
0.1 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.0 |
0.1 |
GO:0035493 |
SNARE complex assembly(GO:0035493) |
| 0.0 |
0.4 |
GO:1902850 |
mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
| 0.0 |
0.3 |
GO:0010951 |
negative regulation of endopeptidase activity(GO:0010951) |
| 0.0 |
0.1 |
GO:0033600 |
negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.0 |
0.0 |
GO:0032570 |
response to progesterone(GO:0032570) |
| 0.0 |
0.1 |
GO:0006338 |
chromatin remodeling(GO:0006338) |
| 0.0 |
0.3 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 |
0.1 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 |
0.2 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.0 |
0.1 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 0.0 |
0.1 |
GO:0006646 |
phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 |
0.2 |
GO:0006306 |
DNA alkylation(GO:0006305) DNA methylation(GO:0006306) |
| 0.0 |
0.1 |
GO:0031468 |
nuclear envelope reassembly(GO:0031468) |
| 0.0 |
0.3 |
GO:1904030 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 0.0 |
0.1 |
GO:1990126 |
retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 |
0.1 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 |
0.2 |
GO:0030500 |
regulation of bone mineralization(GO:0030500) |
| 0.0 |
0.1 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 |
0.2 |
GO:0001843 |
neural tube closure(GO:0001843) tube closure(GO:0060606) |
| 0.0 |
0.2 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.0 |
0.1 |
GO:0000012 |
single strand break repair(GO:0000012) |
| 0.0 |
0.5 |
GO:0060395 |
SMAD protein signal transduction(GO:0060395) |
| 0.0 |
0.1 |
GO:0008306 |
associative learning(GO:0008306) |
| 0.0 |
0.1 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.0 |
0.0 |
GO:0071404 |
cellular response to lipoprotein particle stimulus(GO:0071402) cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
| 0.0 |
0.1 |
GO:0016139 |
glycoside catabolic process(GO:0016139) |
| 0.0 |
0.3 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.0 |
0.3 |
GO:1901799 |
negative regulation of proteasomal protein catabolic process(GO:1901799) |
| 0.0 |
0.3 |
GO:0097120 |
receptor localization to synapse(GO:0097120) |
| 0.0 |
1.0 |
GO:0050821 |
protein stabilization(GO:0050821) |
