Motif ID: Pou3f4
Z-value: 0.757
Transcription factors associated with Pou3f4:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Pou3f4 | ENSMUSG00000056854.3 | Pou3f4 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Pou3f4 | mm10_v2_chrX_+_110814390_110814413 | 0.43 | 2.9e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.8 | 14.2 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.7 | 2.2 | GO:0016095 | polyprenol catabolic process(GO:0016095) terpenoid catabolic process(GO:0016115) primary alcohol catabolic process(GO:0034310) |
| 0.5 | 3.2 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.5 | 2.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.3 | 2.2 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.3 | 2.5 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.2 | 1.9 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.2 | 0.5 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
| 0.2 | 0.5 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.2 | 2.3 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.1 | 1.3 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.1 | 0.3 | GO:0048686 | regulation of sprouting of injured axon(GO:0048686) regulation of axon extension involved in regeneration(GO:0048690) |
| 0.1 | 0.4 | GO:0071726 | response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
| 0.1 | 1.9 | GO:0007614 | short-term memory(GO:0007614) |
| 0.1 | 0.9 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.1 | 0.3 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.1 | 0.2 | GO:0060431 | primary lung bud formation(GO:0060431) |
| 0.0 | 0.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.2 | GO:0044830 | modulation by host of viral RNA genome replication(GO:0044830) |
| 0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 | 0.8 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
| 0.0 | 0.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.2 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.2 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.0 | 0.8 | GO:0060065 | uterus development(GO:0060065) |
| 0.0 | 0.4 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 | 0.7 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.1 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.0 | 0.1 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.5 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.8 | GO:0007616 | long-term memory(GO:0007616) |
| 0.0 | 0.1 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.5 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.0 | 1.1 | GO:0007628 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
| 0.0 | 0.2 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.8 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 0.0 | GO:0072429 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) positive regulation of t-circle formation(GO:1904431) |
| 0.0 | 0.5 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.3 | GO:0001553 | luteinization(GO:0001553) |
| 0.0 | 0.1 | GO:1903599 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) positive regulation of mitophagy(GO:1903599) |
| 0.0 | 0.1 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.0 | 0.1 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
| 0.0 | 0.3 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.0 | 0.2 | GO:0045475 | locomotor rhythm(GO:0045475) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 14.2 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.1 | 0.5 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 0.3 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.1 | 0.4 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 0.4 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 0.2 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.1 | 0.5 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.1 | 0.5 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.1 | 0.2 | GO:0031230 | intrinsic component of cell outer membrane(GO:0031230) integral component of cell outer membrane(GO:0045203) |
| 0.0 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.3 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 0.4 | GO:0030867 | desmosome(GO:0030057) rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.1 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.5 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 1.6 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.9 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 2.9 | GO:0008021 | synaptic vesicle(GO:0008021) |
| 0.0 | 0.6 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.0 | 1.2 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.0 | 1.9 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.0 | 4.5 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.0 | 0.0 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.1 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 1.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 3.2 | GO:0036468 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
| 0.6 | 14.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.4 | 2.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.3 | 1.3 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
| 0.1 | 1.9 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 0.6 | GO:0016918 | retinal binding(GO:0016918) |
| 0.1 | 0.4 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.1 | 0.4 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.1 | 0.5 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.1 | 0.5 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.1 | 0.6 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.8 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 2.3 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 0.3 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.2 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.0 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.8 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 2.4 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 1.9 | GO:0019842 | vitamin binding(GO:0019842) |
| 0.0 | 1.4 | GO:0008146 | sulfotransferase activity(GO:0008146) |
| 0.0 | 0.5 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.9 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.3 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.0 | 0.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.0 | 0.3 | GO:0042556 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.2 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.2 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.3 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.0 | 0.3 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.0 | 0.0 | GO:0031687 | A2A adenosine receptor binding(GO:0031687) |


