| 0.4 |
8.2 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.4 |
1.2 |
GO:1902460 |
regulation of mesenchymal stem cell proliferation(GO:1902460) positive regulation of mesenchymal stem cell proliferation(GO:1902462) |
| 0.3 |
1.7 |
GO:0003223 |
ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) |
| 0.2 |
0.5 |
GO:0033159 |
negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.2 |
0.7 |
GO:1905065 |
hematopoietic stem cell migration(GO:0035701) positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.2 |
0.9 |
GO:1901204 |
regulation of adrenergic receptor signaling pathway involved in heart process(GO:1901204) |
| 0.2 |
0.6 |
GO:0003219 |
cardiac right ventricle formation(GO:0003219) |
| 0.2 |
0.4 |
GO:0070885 |
negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.2 |
0.7 |
GO:2000546 |
positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.2 |
1.2 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.2 |
0.8 |
GO:0035093 |
spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.1 |
0.7 |
GO:0045657 |
positive regulation of monocyte differentiation(GO:0045657) cellular response to potassium ion starvation(GO:0051365) |
| 0.1 |
0.7 |
GO:0010991 |
negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.1 |
0.8 |
GO:0006172 |
ADP biosynthetic process(GO:0006172) |
| 0.1 |
0.6 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.1 |
0.4 |
GO:2000313 |
fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.1 |
0.7 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.1 |
0.5 |
GO:0051964 |
negative regulation of synapse assembly(GO:0051964) |
| 0.1 |
0.4 |
GO:0030947 |
regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) vascular endothelial growth factor receptor signaling pathway(GO:0048010) |
| 0.1 |
0.2 |
GO:1903351 |
response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) regulation of sodium:potassium-exchanging ATPase activity(GO:1903406) |
| 0.1 |
0.7 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) |
| 0.1 |
0.4 |
GO:0036072 |
intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.1 |
0.2 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.1 |
0.2 |
GO:0032241 |
positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.1 |
0.5 |
GO:0048251 |
elastic fiber assembly(GO:0048251) |
| 0.1 |
1.1 |
GO:0021516 |
dorsal spinal cord development(GO:0021516) |
| 0.1 |
0.3 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 |
0.8 |
GO:0048368 |
lateral mesoderm development(GO:0048368) |
| 0.0 |
0.3 |
GO:0060907 |
positive regulation of macrophage cytokine production(GO:0060907) |
| 0.0 |
0.5 |
GO:0071225 |
cellular response to muramyl dipeptide(GO:0071225) |
| 0.0 |
0.1 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.0 |
0.9 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.0 |
4.1 |
GO:0006342 |
chromatin silencing(GO:0006342) |
| 0.0 |
0.2 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.0 |
0.1 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.0 |
0.1 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 |
0.4 |
GO:0033690 |
positive regulation of osteoblast proliferation(GO:0033690) |
| 0.0 |
0.1 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 |
0.9 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 |
0.2 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.0 |
0.4 |
GO:0035414 |
negative regulation of catenin import into nucleus(GO:0035414) |
| 0.0 |
0.1 |
GO:0043654 |
skeletal muscle satellite cell differentiation(GO:0014816) recognition of apoptotic cell(GO:0043654) |
| 0.0 |
0.1 |
GO:2000809 |
positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.0 |
0.8 |
GO:0010972 |
negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 0.0 |
0.4 |
GO:1900046 |
regulation of blood coagulation(GO:0030193) regulation of hemostasis(GO:1900046) |
| 0.0 |
0.3 |
GO:0070498 |
interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.0 |
0.3 |
GO:0060481 |
lobar bronchus epithelium development(GO:0060481) |
| 0.0 |
1.1 |
GO:0003407 |
neural retina development(GO:0003407) |
| 0.0 |
0.1 |
GO:2000623 |
regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 |
0.5 |
GO:0031572 |
G2 DNA damage checkpoint(GO:0031572) |
| 0.0 |
0.5 |
GO:0034063 |
stress granule assembly(GO:0034063) |
| 0.0 |
0.1 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 |
0.8 |
GO:0007157 |
heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 |
0.2 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 |
0.2 |
GO:0002227 |
innate immune response in mucosa(GO:0002227) |
| 0.0 |
0.3 |
GO:0010758 |
regulation of macrophage chemotaxis(GO:0010758) |
| 0.0 |
0.1 |
GO:0006481 |
C-terminal protein methylation(GO:0006481) |
| 0.0 |
0.5 |
GO:0043551 |
regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
| 0.0 |
0.3 |
GO:0000731 |
DNA synthesis involved in DNA repair(GO:0000731) |
| 0.0 |
0.2 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.0 |
0.1 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.0 |
0.7 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 |
0.2 |
GO:0031295 |
lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
| 0.0 |
0.2 |
GO:0008210 |
estrogen metabolic process(GO:0008210) |
| 0.0 |
0.5 |
GO:0042632 |
cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
| 0.0 |
0.9 |
GO:0008625 |
extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |