Motif ID: Sox18_Sox12
Z-value: 0.748
Transcription factors associated with Sox18_Sox12:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Sox12 | ENSMUSG00000051817.8 | Sox12 |
| Sox18 | ENSMUSG00000046470.5 | Sox18 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Sox12 | mm10_v2_chr2_-_152398046_152398076 | -0.56 | 3.2e-03 | Click! |
| Sox18 | mm10_v2_chr2_-_181671622_181671645 | -0.36 | 7.0e-02 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.9 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.4 | 1.3 | GO:0042320 | regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) positive regulation of circadian sleep/wake cycle, sleep(GO:0045938) |
| 0.4 | 1.5 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.3 | 0.9 | GO:0046381 | CMP-N-acetylneuraminate metabolic process(GO:0046381) |
| 0.3 | 0.9 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.3 | 1.5 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.3 | 1.1 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.3 | 0.3 | GO:1902524 | positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 0.2 | 2.1 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.2 | 0.9 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.2 | 1.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.2 | 1.2 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.2 | 0.6 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.2 | 1.7 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.2 | 0.5 | GO:0050929 | corticospinal neuron axon guidance through spinal cord(GO:0021972) positive regulation of negative chemotaxis(GO:0050924) induction of negative chemotaxis(GO:0050929) negative regulation of mononuclear cell migration(GO:0071676) negative regulation of retinal ganglion cell axon guidance(GO:0090260) |
| 0.2 | 0.5 | GO:0060743 | estrous cycle(GO:0044849) epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.2 | 1.5 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.1 | 0.6 | GO:0072362 | regulation of glycolytic process by negative regulation of transcription from RNA polymerase II promoter(GO:0072362) |
| 0.1 | 0.9 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
| 0.1 | 1.4 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 | 0.7 | GO:0071894 | histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.1 | 1.2 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.1 | 0.9 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.1 | 0.6 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 1.2 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.1 | 0.3 | GO:0002371 | dendritic cell cytokine production(GO:0002371) regulation of dendritic cell cytokine production(GO:0002730) interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.1 | 0.3 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.1 | 0.3 | GO:0097089 | methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.1 | 0.6 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.1 | 0.5 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.7 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 | 0.5 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.1 | 0.9 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.1 | 0.3 | GO:0001869 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.1 | 0.6 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.1 | 0.3 | GO:0001550 | ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.1 | 0.4 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.1 | 0.4 | GO:0021764 | amygdala development(GO:0021764) |
| 0.1 | 0.5 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.5 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.1 | 1.2 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 | 0.2 | GO:0060160 | musculoskeletal movement, spinal reflex action(GO:0050883) negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.1 | 0.3 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.2 | GO:0036518 | chemorepulsion of dopaminergic neuron axon(GO:0036518) |
| 0.1 | 1.4 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.1 | 0.4 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.1 | 0.2 | GO:0003192 | mitral valve formation(GO:0003192) cell migration involved in endocardial cushion formation(GO:0003273) condensed mesenchymal cell proliferation(GO:0072137) |
| 0.0 | 0.2 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.0 | 0.2 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.0 | 0.4 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.0 | 0.7 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 | 0.3 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.0 | 0.4 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.1 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
| 0.0 | 0.2 | GO:0051461 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.0 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.2 | GO:0046549 | retinal cone cell development(GO:0046549) |
| 0.0 | 0.9 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.2 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.9 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 1.5 | GO:0006378 | mRNA polyadenylation(GO:0006378) |
| 0.0 | 0.1 | GO:0034285 | response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.0 | 0.3 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.1 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.0 | 0.9 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 1.7 | GO:0051489 | regulation of filopodium assembly(GO:0051489) |
| 0.0 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.0 | 0.2 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.1 | GO:1990046 | positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.0 | 0.4 | GO:0042640 | anagen(GO:0042640) |
| 0.0 | 0.1 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.0 | 0.4 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.1 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) oxygen metabolic process(GO:0072592) |
| 0.0 | 0.5 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 | 0.2 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 2.7 | GO:0051028 | mRNA transport(GO:0051028) |
| 0.0 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.3 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 | 0.5 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.2 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.0 | 0.2 | GO:0032620 | interleukin-17 production(GO:0032620) |
| 0.0 | 0.2 | GO:0045066 | regulatory T cell differentiation(GO:0045066) regulation of regulatory T cell differentiation(GO:0045589) |
| 0.0 | 0.4 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.4 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.0 | 0.1 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) serotonin uptake(GO:0051610) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.0 | 0.2 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
| 0.0 | 0.5 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.8 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 | 0.5 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 0.0 | 1.2 | GO:0050868 | negative regulation of T cell activation(GO:0050868) |
| 0.0 | 0.5 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.0 | 0.1 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
| 0.0 | 0.1 | GO:0046036 | GTP biosynthetic process(GO:0006183) CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
| 0.0 | 0.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.0 | 0.5 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.3 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.0 | 0.6 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.0 | GO:0005595 | collagen type XII trimer(GO:0005595) anchoring collagen complex(GO:0030934) |
| 0.3 | 1.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.1 | 0.5 | GO:0072487 | MSL complex(GO:0072487) |
| 0.1 | 1.5 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.1 | 0.9 | GO:0051286 | cell tip(GO:0051286) |
| 0.1 | 0.9 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.9 | GO:0001527 | microfibril(GO:0001527) |
| 0.1 | 1.0 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 1.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.0 | 0.6 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.1 | GO:0042584 | chromaffin granule membrane(GO:0042584) |
| 0.0 | 0.9 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 1.4 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.5 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.2 | GO:0045275 | respiratory chain complex III(GO:0045275) |
| 0.0 | 0.6 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.4 | GO:0032156 | septin cytoskeleton(GO:0032156) |
| 0.0 | 0.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 1.3 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 0.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.1 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.6 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 2.3 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 0.1 | GO:0071438 | NADPH oxidase complex(GO:0043020) invadopodium membrane(GO:0071438) |
| 0.0 | 0.3 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.3 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 1.1 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 1.8 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 0.5 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.3 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.0 | 2.6 | GO:0005769 | early endosome(GO:0005769) |
| 0.0 | 1.0 | GO:0030139 | endocytic vesicle(GO:0030139) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 2.9 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) lysophosphatidic acid receptor activity(GO:0070915) |
| 0.5 | 1.9 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.3 | 0.9 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.2 | 1.4 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.2 | 0.9 | GO:0001011 | transcription factor activity, sequence-specific DNA binding, RNA polymerase recruiting(GO:0001011) transcription factor activity, TFIIB-class binding(GO:0001087) |
| 0.2 | 0.7 | GO:0038049 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
| 0.2 | 0.5 | GO:0038052 | RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
| 0.2 | 1.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.2 | 0.6 | GO:0015501 | glutamate:sodium symporter activity(GO:0015501) |
| 0.2 | 1.5 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.1 | 0.6 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.4 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.5 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 0.1 | 1.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.3 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 0.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.1 | 1.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.1 | 0.6 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 0.6 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.1 | 0.9 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.1 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.4 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.1 | 1.5 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.1 | 1.3 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.1 | 0.2 | GO:0048045 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
| 0.1 | 0.9 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
| 0.1 | 0.2 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.1 | 0.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.7 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.2 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.0 | 0.2 | GO:0047389 | glycerophosphocholine phosphodiesterase activity(GO:0047389) |
| 0.0 | 0.4 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.6 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.2 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.0 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.3 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.0 | 0.3 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.2 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.0 | 0.9 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.7 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.3 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.0 | 0.5 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.5 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.3 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
| 0.0 | 0.9 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.5 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.2 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.1 | GO:0030171 | voltage-gated proton channel activity(GO:0030171) |
| 0.0 | 2.0 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 1.3 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.1 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
| 0.0 | 0.3 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.3 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.4 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.0 | 0.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.6 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.6 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.0 | 0.2 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.4 | GO:0004532 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity(GO:0004532) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.3 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.4 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.0 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
| 0.0 | 0.8 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |


