| 2.6 |
15.8 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 1.8 |
8.8 |
GO:0021905 |
pancreatic A cell development(GO:0003322) forebrain-midbrain boundary formation(GO:0021905) somatic motor neuron fate commitment(GO:0021917) regulation of transcription from RNA polymerase II promoter involved in somatic motor neuron fate commitment(GO:0021918) |
| 1.6 |
6.4 |
GO:0051311 |
spindle assembly involved in female meiosis(GO:0007056) meiotic metaphase plate congression(GO:0051311) |
| 1.2 |
3.7 |
GO:0046022 |
regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) axial mesoderm morphogenesis(GO:0048319) |
| 1.1 |
3.4 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 1.1 |
4.2 |
GO:0045608 |
inhibition of neuroepithelial cell differentiation(GO:0002085) negative regulation of auditory receptor cell differentiation(GO:0045608) |
| 1.0 |
4.1 |
GO:0010957 |
negative regulation of vitamin D biosynthetic process(GO:0010957) negative regulation of vitamin metabolic process(GO:0046137) |
| 1.0 |
7.6 |
GO:0033314 |
mitotic DNA replication checkpoint(GO:0033314) |
| 0.9 |
0.9 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 0.9 |
5.3 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.9 |
2.6 |
GO:0034135 |
regulation of toll-like receptor 2 signaling pathway(GO:0034135) |
| 0.8 |
3.4 |
GO:0000255 |
allantoin metabolic process(GO:0000255) |
| 0.8 |
2.4 |
GO:0035696 |
monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.8 |
1.6 |
GO:1903416 |
response to glycoside(GO:1903416) |
| 0.8 |
0.8 |
GO:0043029 |
T cell homeostasis(GO:0043029) |
| 0.8 |
3.2 |
GO:0070425 |
negative regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070425) negative regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070433) |
| 0.8 |
3.0 |
GO:0097211 |
response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.8 |
3.0 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.7 |
2.2 |
GO:0044849 |
estrous cycle(GO:0044849) |
| 0.7 |
2.2 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) odontoblast differentiation(GO:0071895) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.7 |
4.3 |
GO:0071883 |
activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.7 |
2.8 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.7 |
2.1 |
GO:0038203 |
TORC2 signaling(GO:0038203) |
| 0.7 |
2.0 |
GO:0032240 |
RNA import into nucleus(GO:0006404) mRNA export from nucleus in response to heat stress(GO:0031990) negative regulation of nucleobase-containing compound transport(GO:0032240) negative regulation of RNA export from nucleus(GO:0046832) |
| 0.7 |
2.0 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.6 |
1.9 |
GO:0021698 |
cerebellar cortex structural organization(GO:0021698) |
| 0.6 |
1.9 |
GO:0072429 |
response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.6 |
1.3 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.6 |
2.5 |
GO:1903899 |
positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.6 |
7.5 |
GO:0033572 |
transferrin transport(GO:0033572) |
| 0.6 |
3.0 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.6 |
2.4 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.6 |
3.6 |
GO:0046645 |
positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.6 |
9.6 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.6 |
1.8 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.6 |
2.3 |
GO:0050748 |
negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.6 |
0.6 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.6 |
4.5 |
GO:0015670 |
carbon dioxide transport(GO:0015670) |
| 0.5 |
2.2 |
GO:0031052 |
programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
| 0.5 |
2.7 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.5 |
2.1 |
GO:0060032 |
notochord regression(GO:0060032) |
| 0.5 |
2.1 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.5 |
3.0 |
GO:1900246 |
positive regulation of RIG-I signaling pathway(GO:1900246) |
| 0.5 |
1.5 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.5 |
1.0 |
GO:0009957 |
epidermal cell fate specification(GO:0009957) |
| 0.5 |
0.5 |
GO:0060821 |
inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.5 |
1.4 |
GO:0060010 |
Sertoli cell fate commitment(GO:0060010) |
| 0.5 |
0.5 |
GO:0045410 |
positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.5 |
2.3 |
GO:0003376 |
sphingosine-1-phosphate signaling pathway(GO:0003376) sphingolipid mediated signaling pathway(GO:0090520) |
| 0.4 |
1.3 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.4 |
1.8 |
GO:0071105 |
response to interleukin-11(GO:0071105) |
| 0.4 |
1.3 |
GO:0008594 |
photoreceptor cell morphogenesis(GO:0008594) |
| 0.4 |
1.3 |
GO:0021759 |
globus pallidus development(GO:0021759) |
| 0.4 |
1.3 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.4 |
1.3 |
GO:0014735 |
regulation of muscle atrophy(GO:0014735) |
| 0.4 |
0.9 |
GO:0010911 |
regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.4 |
1.7 |
GO:2000705 |
regulation of dense core granule biogenesis(GO:2000705) |
| 0.4 |
2.1 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.4 |
3.7 |
GO:0051639 |
actin filament network formation(GO:0051639) |
| 0.4 |
1.2 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.4 |
1.6 |
GO:0001550 |
ovarian cumulus expansion(GO:0001550) fused antrum stage(GO:0048165) |
| 0.4 |
1.2 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.4 |
1.2 |
GO:0071921 |
establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.4 |
1.6 |
GO:0071139 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) resolution of recombination intermediates(GO:0071139) |
| 0.4 |
2.0 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.4 |
1.2 |
GO:0010986 |
positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.4 |
1.2 |
GO:1990034 |
calcium ion export from cell(GO:1990034) |
| 0.4 |
1.1 |
GO:0032066 |
nucleolus to nucleoplasm transport(GO:0032066) |
| 0.4 |
0.4 |
GO:0038161 |
prolactin signaling pathway(GO:0038161) |
| 0.4 |
2.6 |
GO:0007296 |
vitellogenesis(GO:0007296) |
| 0.4 |
1.1 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.4 |
1.1 |
GO:0042320 |
regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) positive regulation of circadian sleep/wake cycle, sleep(GO:0045938) |
| 0.4 |
1.1 |
GO:0002447 |
eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) regulation of eosinophil activation(GO:1902566) |
| 0.4 |
1.1 |
GO:0036388 |
pre-replicative complex assembly involved in nuclear cell cycle DNA replication(GO:0006267) pre-replicative complex assembly(GO:0036388) pre-replicative complex assembly involved in cell cycle DNA replication(GO:1902299) |
| 0.4 |
3.7 |
GO:0033631 |
cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.4 |
0.4 |
GO:1903984 |
positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.4 |
4.1 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.4 |
3.7 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.4 |
1.1 |
GO:2000686 |
regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.4 |
0.4 |
GO:0097094 |
craniofacial suture morphogenesis(GO:0097094) |
| 0.4 |
1.4 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.4 |
0.4 |
GO:0070933 |
histone H4 deacetylation(GO:0070933) |
| 0.4 |
2.2 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.4 |
1.4 |
GO:0002322 |
B cell proliferation involved in immune response(GO:0002322) |
| 0.4 |
1.4 |
GO:0007406 |
negative regulation of neuroblast proliferation(GO:0007406) |
| 0.4 |
0.4 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.4 |
1.1 |
GO:0090193 |
positive regulation of glomerulus development(GO:0090193) |
| 0.3 |
1.7 |
GO:0032298 |
positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.3 |
0.3 |
GO:0034285 |
response to sucrose(GO:0009744) response to disaccharide(GO:0034285) |
| 0.3 |
3.4 |
GO:0006273 |
lagging strand elongation(GO:0006273) |
| 0.3 |
1.0 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.3 |
1.4 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.3 |
1.0 |
GO:1903054 |
negative regulation of extracellular matrix organization(GO:1903054) |
| 0.3 |
2.0 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.3 |
1.4 |
GO:0048304 |
positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.3 |
1.0 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.3 |
0.3 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.3 |
1.3 |
GO:0010890 |
positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.3 |
2.3 |
GO:0031508 |
pericentric heterochromatin assembly(GO:0031508) |
| 0.3 |
1.3 |
GO:0050862 |
positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.3 |
1.0 |
GO:0002924 |
negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.3 |
1.0 |
GO:0033030 |
negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.3 |
1.0 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.3 |
1.3 |
GO:0042905 |
9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.3 |
0.6 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.3 |
0.9 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.3 |
0.6 |
GO:0046013 |
regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.3 |
0.9 |
GO:0000707 |
meiotic DNA recombinase assembly(GO:0000707) |
| 0.3 |
0.9 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.3 |
1.2 |
GO:0010792 |
DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.3 |
0.6 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 0.3 |
1.2 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) thrombopoietin-mediated signaling pathway(GO:0038163) positive regulation of male germ cell proliferation(GO:2000256) |
| 0.3 |
1.5 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.3 |
1.2 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.3 |
0.6 |
GO:0003406 |
retinal pigment epithelium development(GO:0003406) |
| 0.3 |
3.6 |
GO:0032211 |
negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.3 |
1.8 |
GO:0016081 |
synaptic vesicle docking(GO:0016081) |
| 0.3 |
1.8 |
GO:0043353 |
enucleate erythrocyte differentiation(GO:0043353) |
| 0.3 |
1.5 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.3 |
5.5 |
GO:0051127 |
positive regulation of actin nucleation(GO:0051127) |
| 0.3 |
0.9 |
GO:0060399 |
positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.3 |
0.3 |
GO:0045409 |
negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.3 |
2.3 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.3 |
2.3 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.3 |
1.1 |
GO:0072224 |
metanephric glomerulus development(GO:0072224) |
| 0.3 |
1.1 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.3 |
2.3 |
GO:0033601 |
positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.3 |
1.1 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.3 |
1.1 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.3 |
2.2 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.3 |
1.7 |
GO:2000491 |
positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.3 |
2.2 |
GO:0007016 |
cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.3 |
1.4 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.3 |
8.4 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.3 |
0.5 |
GO:0035790 |
platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.3 |
0.8 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.3 |
1.3 |
GO:1900170 |
negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 0.3 |
1.3 |
GO:0007028 |
cytoplasm organization(GO:0007028) |
| 0.3 |
2.1 |
GO:0034501 |
protein localization to kinetochore(GO:0034501) |
| 0.3 |
0.5 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.3 |
0.8 |
GO:0042264 |
peptidyl-aspartic acid hydroxylation(GO:0042264) |
| 0.3 |
0.8 |
GO:0030167 |
proteoglycan catabolic process(GO:0030167) |
| 0.3 |
1.0 |
GO:0019372 |
lipoxygenase pathway(GO:0019372) |
| 0.3 |
1.3 |
GO:0098543 |
detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.3 |
0.5 |
GO:0060282 |
positive regulation of oocyte development(GO:0060282) |
| 0.3 |
1.0 |
GO:0048539 |
bone marrow development(GO:0048539) |
| 0.3 |
2.3 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.3 |
4.1 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.3 |
3.1 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.3 |
1.0 |
GO:0010464 |
regulation of mesenchymal cell proliferation(GO:0010464) |
| 0.3 |
1.3 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.3 |
2.6 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.3 |
1.0 |
GO:0010499 |
proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.3 |
0.8 |
GO:0085020 |
protein K6-linked ubiquitination(GO:0085020) |
| 0.3 |
1.0 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.2 |
1.0 |
GO:0006742 |
NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
| 0.2 |
2.2 |
GO:0007221 |
positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.2 |
1.0 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.2 |
2.2 |
GO:0046499 |
S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.2 |
0.7 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.2 |
1.0 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.2 |
0.5 |
GO:2000819 |
regulation of nucleotide-excision repair(GO:2000819) |
| 0.2 |
1.0 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 0.2 |
0.5 |
GO:0002741 |
positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.2 |
1.7 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.2 |
0.5 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.2 |
2.1 |
GO:0000083 |
regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.2 |
0.2 |
GO:0060971 |
embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.2 |
1.2 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.2 |
0.7 |
GO:0002331 |
pre-B cell allelic exclusion(GO:0002331) |
| 0.2 |
3.1 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.2 |
0.7 |
GO:0019405 |
alditol catabolic process(GO:0019405) glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
| 0.2 |
0.7 |
GO:0060447 |
bud outgrowth involved in lung branching(GO:0060447) |
| 0.2 |
0.7 |
GO:2000224 |
testosterone biosynthetic process(GO:0061370) regulation of testosterone biosynthetic process(GO:2000224) |
| 0.2 |
0.7 |
GO:0060437 |
lung growth(GO:0060437) |
| 0.2 |
0.5 |
GO:0061085 |
regulation of histone H3-K27 methylation(GO:0061085) positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.2 |
0.7 |
GO:1901097 |
negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 |
0.7 |
GO:1903722 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) late endosomal microautophagy(GO:0061738) regulation of centriole elongation(GO:1903722) |
| 0.2 |
0.9 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.2 |
2.9 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.2 |
0.7 |
GO:0086017 |
renal response to blood flow involved in circulatory renin-angiotensin regulation of systemic arterial blood pressure(GO:0001999) renin secretion into blood stream(GO:0002001) cell communication by chemical coupling(GO:0010643) Purkinje myocyte action potential(GO:0086017) regulation of renin secretion into blood stream(GO:1900133) |
| 0.2 |
1.3 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.2 |
0.7 |
GO:1904569 |
regulation of selenocysteine incorporation(GO:1904569) |
| 0.2 |
1.5 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.2 |
0.2 |
GO:0090296 |
regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA replication(GO:0090298) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.2 |
0.6 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.2 |
1.3 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.2 |
0.2 |
GO:0050703 |
interleukin-1 alpha production(GO:0032610) interleukin-1 alpha secretion(GO:0050703) |
| 0.2 |
0.6 |
GO:0035574 |
histone H4-K20 demethylation(GO:0035574) |
| 0.2 |
1.2 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.2 |
0.8 |
GO:0010046 |
response to mycotoxin(GO:0010046) |
| 0.2 |
0.4 |
GO:0045472 |
response to ether(GO:0045472) |
| 0.2 |
0.4 |
GO:0045014 |
carbon catabolite repression of transcription(GO:0045013) negative regulation of transcription by glucose(GO:0045014) |
| 0.2 |
0.8 |
GO:1990414 |
replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.2 |
1.6 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.2 |
0.4 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.2 |
1.4 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 0.2 |
0.6 |
GO:0003273 |
cell migration involved in endocardial cushion formation(GO:0003273) |
| 0.2 |
0.6 |
GO:0030327 |
prenylated protein catabolic process(GO:0030327) |
| 0.2 |
0.6 |
GO:1904357 |
negative regulation of telomere maintenance via telomere lengthening(GO:1904357) |
| 0.2 |
0.4 |
GO:2000008 |
regulation of protein localization to cell surface(GO:2000008) negative regulation of protein localization to cell surface(GO:2000009) |
| 0.2 |
2.5 |
GO:0006000 |
fructose metabolic process(GO:0006000) |
| 0.2 |
1.3 |
GO:0032534 |
regulation of microvillus assembly(GO:0032534) |
| 0.2 |
1.9 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.2 |
0.4 |
GO:1905154 |
negative regulation of membrane invagination(GO:1905154) |
| 0.2 |
0.2 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.2 |
0.4 |
GO:0060018 |
astrocyte fate commitment(GO:0060018) |
| 0.2 |
2.0 |
GO:0035721 |
intraciliary retrograde transport(GO:0035721) |
| 0.2 |
0.5 |
GO:0018199 |
peptidyl-glutamine modification(GO:0018199) |
| 0.2 |
0.4 |
GO:2000484 |
positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.2 |
0.7 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.2 |
4.1 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.2 |
0.5 |
GO:0034035 |
purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.2 |
1.8 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.2 |
0.3 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.2 |
0.9 |
GO:0034397 |
telomere localization(GO:0034397) |
| 0.2 |
0.5 |
GO:0018103 |
protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.2 |
2.1 |
GO:0000244 |
spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.2 |
0.7 |
GO:0021847 |
ventricular zone neuroblast division(GO:0021847) |
| 0.2 |
0.7 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.2 |
3.4 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.2 |
3.1 |
GO:0043486 |
histone exchange(GO:0043486) |
| 0.2 |
1.5 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.2 |
0.8 |
GO:0051045 |
negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.2 |
0.5 |
GO:0033600 |
negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.2 |
1.4 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.2 |
1.0 |
GO:2000482 |
interleukin-8 secretion(GO:0072606) regulation of interleukin-8 secretion(GO:2000482) |
| 0.2 |
1.9 |
GO:2001256 |
regulation of store-operated calcium entry(GO:2001256) |
| 0.2 |
0.8 |
GO:1902669 |
positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
| 0.2 |
1.2 |
GO:0021521 |
ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.2 |
0.5 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.2 |
1.0 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.2 |
1.5 |
GO:0070932 |
histone H3 deacetylation(GO:0070932) |
| 0.2 |
0.2 |
GO:0001569 |
patterning of blood vessels(GO:0001569) |
| 0.2 |
0.3 |
GO:0018171 |
peptidyl-cysteine oxidation(GO:0018171) |
| 0.2 |
0.5 |
GO:0006065 |
UDP-glucuronate biosynthetic process(GO:0006065) |
| 0.2 |
0.5 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
| 0.2 |
0.3 |
GO:0031627 |
telomeric loop formation(GO:0031627) |
| 0.2 |
1.3 |
GO:0018026 |
peptidyl-lysine monomethylation(GO:0018026) |
| 0.2 |
0.6 |
GO:0098581 |
detection of external biotic stimulus(GO:0098581) |
| 0.2 |
0.5 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.2 |
0.8 |
GO:2001170 |
negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.2 |
0.3 |
GO:0042117 |
monocyte activation(GO:0042117) |
| 0.2 |
1.9 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.2 |
0.2 |
GO:0070535 |
histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.2 |
1.1 |
GO:0072498 |
embryonic skeletal joint development(GO:0072498) |
| 0.2 |
0.5 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.2 |
0.5 |
GO:2000416 |
regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
| 0.2 |
0.9 |
GO:0032463 |
negative regulation of protein homooligomerization(GO:0032463) |
| 0.2 |
1.9 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.2 |
0.5 |
GO:0060842 |
arterial endothelial cell differentiation(GO:0060842) |
| 0.2 |
1.3 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.2 |
0.2 |
GO:2000642 |
negative regulation of early endosome to late endosome transport(GO:2000642) |
| 0.2 |
0.9 |
GO:0046909 |
intermembrane transport(GO:0046909) |
| 0.2 |
0.6 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.2 |
0.2 |
GO:0090289 |
regulation of osteoclast proliferation(GO:0090289) |
| 0.2 |
0.9 |
GO:0035743 |
CD4-positive, alpha-beta T cell cytokine production(GO:0035743) T-helper 2 cell cytokine production(GO:0035745) |
| 0.2 |
0.5 |
GO:1903215 |
negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.2 |
0.6 |
GO:0035752 |
lysosomal lumen pH elevation(GO:0035752) |
| 0.1 |
0.4 |
GO:0001732 |
formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 |
0.9 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.1 |
0.3 |
GO:0035864 |
response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 |
0.7 |
GO:2001237 |
negative regulation of extrinsic apoptotic signaling pathway(GO:2001237) |
| 0.1 |
2.4 |
GO:0050856 |
regulation of T cell receptor signaling pathway(GO:0050856) |
| 0.1 |
1.3 |
GO:0097341 |
inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 |
1.5 |
GO:0014842 |
skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) skeletal muscle cell proliferation(GO:0014856) regulation of skeletal muscle cell proliferation(GO:0014857) |
| 0.1 |
0.3 |
GO:2000189 |
positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 |
2.6 |
GO:0009954 |
proximal/distal pattern formation(GO:0009954) |
| 0.1 |
0.1 |
GO:0031587 |
positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.1 |
0.7 |
GO:2000348 |
regulation of CD40 signaling pathway(GO:2000348) |
| 0.1 |
0.7 |
GO:0060690 |
epithelial cell differentiation involved in salivary gland development(GO:0060690) |
| 0.1 |
0.6 |
GO:1900157 |
regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.1 |
1.6 |
GO:0035988 |
chondrocyte proliferation(GO:0035988) |
| 0.1 |
1.1 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 |
0.6 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 |
2.8 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.1 |
0.3 |
GO:2000286 |
receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 |
0.7 |
GO:0030242 |
pexophagy(GO:0030242) |
| 0.1 |
1.1 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.1 |
0.3 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 |
1.1 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 |
0.4 |
GO:0035526 |
retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 |
0.7 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.1 |
2.3 |
GO:0006613 |
cotranslational protein targeting to membrane(GO:0006613) |
| 0.1 |
2.5 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.1 |
0.4 |
GO:0018076 |
N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.1 |
1.5 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.1 |
1.2 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 |
0.4 |
GO:0090168 |
Golgi reassembly(GO:0090168) |
| 0.1 |
1.1 |
GO:0035871 |
protein K11-linked deubiquitination(GO:0035871) |
| 0.1 |
0.7 |
GO:0000103 |
sulfate assimilation(GO:0000103) |
| 0.1 |
2.2 |
GO:0032060 |
bleb assembly(GO:0032060) |
| 0.1 |
0.4 |
GO:1902950 |
regulation of dendritic spine maintenance(GO:1902950) positive regulation of dendritic spine maintenance(GO:1902952) |
| 0.1 |
0.4 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.1 |
0.8 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.1 |
0.5 |
GO:0032516 |
positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
| 0.1 |
1.3 |
GO:0080009 |
mRNA methylation(GO:0080009) |
| 0.1 |
0.8 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.1 |
3.5 |
GO:0030488 |
tRNA methylation(GO:0030488) |
| 0.1 |
0.1 |
GO:2000313 |
fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.1 |
0.7 |
GO:0098700 |
aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.1 |
0.7 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.1 |
1.7 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.1 |
0.2 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 |
0.2 |
GO:0032847 |
positive regulation of prostaglandin biosynthetic process(GO:0031394) regulation of cellular pH reduction(GO:0032847) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
| 0.1 |
0.6 |
GO:1900095 |
regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.1 |
1.6 |
GO:0043368 |
positive T cell selection(GO:0043368) |
| 0.1 |
0.4 |
GO:0035590 |
purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.1 |
0.6 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.1 |
0.4 |
GO:0090370 |
negative regulation of cholesterol efflux(GO:0090370) |
| 0.1 |
3.6 |
GO:0044380 |
protein localization to cytoskeleton(GO:0044380) |
| 0.1 |
1.2 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.1 |
0.7 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 |
0.1 |
GO:0070488 |
neutrophil aggregation(GO:0070488) |
| 0.1 |
0.3 |
GO:0042271 |
susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.1 |
0.6 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.1 |
1.3 |
GO:0001773 |
myeloid dendritic cell activation(GO:0001773) |
| 0.1 |
0.5 |
GO:0034975 |
protein folding in endoplasmic reticulum(GO:0034975) |
| 0.1 |
0.3 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 0.1 |
0.6 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 |
1.5 |
GO:0051043 |
regulation of membrane protein ectodomain proteolysis(GO:0051043) positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 |
0.1 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 |
0.3 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.1 |
0.4 |
GO:0071449 |
cellular response to lipid hydroperoxide(GO:0071449) |
| 0.1 |
0.7 |
GO:0019336 |
phenol-containing compound catabolic process(GO:0019336) |
| 0.1 |
1.5 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
0.6 |
GO:0060872 |
semicircular canal morphogenesis(GO:0048752) semicircular canal development(GO:0060872) |
| 0.1 |
0.9 |
GO:0007000 |
nucleolus organization(GO:0007000) |
| 0.1 |
0.5 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.1 |
0.3 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.1 |
0.8 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.1 |
2.0 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 |
0.9 |
GO:0048199 |
vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.1 |
0.3 |
GO:0060753 |
regulation of mast cell chemotaxis(GO:0060753) |
| 0.1 |
0.7 |
GO:0006621 |
protein retention in ER lumen(GO:0006621) |
| 0.1 |
0.2 |
GO:1902202 |
regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
| 0.1 |
0.7 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 |
0.5 |
GO:0042518 |
negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.1 |
0.3 |
GO:0002036 |
regulation of L-glutamate transport(GO:0002036) |
| 0.1 |
0.6 |
GO:0034433 |
steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.1 |
1.7 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.1 |
0.4 |
GO:1903887 |
motile primary cilium assembly(GO:1903887) |
| 0.1 |
0.8 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.1 |
0.5 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.1 |
0.2 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.1 |
1.1 |
GO:0042346 |
positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.1 |
0.9 |
GO:0008063 |
Toll signaling pathway(GO:0008063) |
| 0.1 |
0.5 |
GO:0007379 |
segment specification(GO:0007379) |
| 0.1 |
0.5 |
GO:0033147 |
negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 |
1.2 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.1 |
0.9 |
GO:0035020 |
regulation of Rac protein signal transduction(GO:0035020) |
| 0.1 |
0.5 |
GO:0032196 |
transposition(GO:0032196) |
| 0.1 |
2.7 |
GO:0010842 |
retina layer formation(GO:0010842) |
| 0.1 |
0.5 |
GO:0060330 |
regulation of response to interferon-gamma(GO:0060330) |
| 0.1 |
0.2 |
GO:0010216 |
maintenance of DNA methylation(GO:0010216) |
| 0.1 |
0.3 |
GO:0044861 |
protein transport into plasma membrane raft(GO:0044861) |
| 0.1 |
0.8 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.1 |
0.6 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.1 |
0.3 |
GO:0016344 |
meiotic chromosome movement towards spindle pole(GO:0016344) |
| 0.1 |
0.5 |
GO:0097152 |
mesenchymal cell apoptotic process(GO:0097152) |
| 0.1 |
0.2 |
GO:0035021 |
negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.1 |
0.5 |
GO:0006072 |
glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.1 |
3.2 |
GO:0007091 |
metaphase/anaphase transition of mitotic cell cycle(GO:0007091) metaphase/anaphase transition of cell cycle(GO:0044784) |
| 0.1 |
1.0 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.1 |
0.6 |
GO:0043129 |
surfactant homeostasis(GO:0043129) |
| 0.1 |
0.8 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.1 |
0.5 |
GO:0070561 |
vitamin D receptor signaling pathway(GO:0070561) |
| 0.1 |
0.4 |
GO:0090283 |
regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 |
0.1 |
GO:0045852 |
pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
| 0.1 |
0.5 |
GO:0002317 |
plasma cell differentiation(GO:0002317) |
| 0.1 |
0.3 |
GO:0032488 |
Cdc42 protein signal transduction(GO:0032488) |
| 0.1 |
0.7 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.1 |
0.2 |
GO:0090245 |
axis elongation involved in somitogenesis(GO:0090245) |
| 0.1 |
0.7 |
GO:0051567 |
histone H3-K9 methylation(GO:0051567) |
| 0.1 |
0.2 |
GO:0071492 |
cellular response to UV-A(GO:0071492) |
| 0.1 |
0.4 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.1 |
0.5 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.1 |
1.6 |
GO:0071800 |
podosome assembly(GO:0071800) |
| 0.1 |
0.5 |
GO:0052646 |
alditol phosphate metabolic process(GO:0052646) |
| 0.1 |
0.7 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.1 |
0.7 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.1 |
1.1 |
GO:0000185 |
activation of MAPKKK activity(GO:0000185) |
| 0.1 |
1.1 |
GO:0097062 |
dendritic spine maintenance(GO:0097062) |
| 0.1 |
0.7 |
GO:0035855 |
megakaryocyte development(GO:0035855) |
| 0.1 |
0.4 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.1 |
0.3 |
GO:0035106 |
operant conditioning(GO:0035106) |
| 0.1 |
0.4 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.1 |
0.4 |
GO:0071260 |
cellular response to mechanical stimulus(GO:0071260) |
| 0.1 |
0.3 |
GO:0070889 |
platelet alpha granule organization(GO:0070889) |
| 0.1 |
0.2 |
GO:0001866 |
NK T cell proliferation(GO:0001866) |
| 0.1 |
2.0 |
GO:0002244 |
hematopoietic progenitor cell differentiation(GO:0002244) |
| 0.1 |
0.3 |
GO:0002710 |
negative regulation of T cell mediated immunity(GO:0002710) |
| 0.1 |
0.6 |
GO:0030514 |
negative regulation of BMP signaling pathway(GO:0030514) |
| 0.1 |
0.8 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 |
0.2 |
GO:0097155 |
fasciculation of sensory neuron axon(GO:0097155) |
| 0.1 |
0.3 |
GO:0007039 |
protein catabolic process in the vacuole(GO:0007039) |
| 0.1 |
0.2 |
GO:1903748 |
negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.1 |
0.2 |
GO:0042359 |
vitamin D metabolic process(GO:0042359) |
| 0.1 |
0.2 |
GO:0032380 |
regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 |
0.8 |
GO:0061298 |
retina vasculature development in camera-type eye(GO:0061298) |
| 0.1 |
0.3 |
GO:0060373 |
regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 |
0.3 |
GO:2000051 |
negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 |
0.5 |
GO:2000010 |
positive regulation of protein localization to cell surface(GO:2000010) |
| 0.1 |
1.0 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 |
0.6 |
GO:0014807 |
regulation of somitogenesis(GO:0014807) |
| 0.1 |
0.9 |
GO:0019368 |
fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.1 |
0.6 |
GO:0036037 |
CD8-positive, alpha-beta T cell activation(GO:0036037) |
| 0.1 |
1.1 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.1 |
0.2 |
GO:0061030 |
epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.1 |
0.7 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.1 |
0.4 |
GO:0045053 |
protein retention in Golgi apparatus(GO:0045053) |
| 0.1 |
0.6 |
GO:1902065 |
response to L-glutamate(GO:1902065) |
| 0.1 |
2.1 |
GO:0001921 |
positive regulation of receptor recycling(GO:0001921) |
| 0.1 |
1.4 |
GO:0001522 |
pseudouridine synthesis(GO:0001522) |
| 0.1 |
0.2 |
GO:0031914 |
negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 |
0.3 |
GO:0003413 |
chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
| 0.1 |
0.8 |
GO:0031114 |
regulation of microtubule depolymerization(GO:0031114) |
| 0.1 |
0.1 |
GO:0061647 |
histone H3-K9 modification(GO:0061647) |
| 0.1 |
0.2 |
GO:0010920 |
negative regulation of inositol phosphate biosynthetic process(GO:0010920) |
| 0.1 |
0.3 |
GO:0071557 |
histone H3-K27 demethylation(GO:0071557) |
| 0.1 |
0.5 |
GO:0042403 |
thyroid hormone metabolic process(GO:0042403) |
| 0.1 |
0.3 |
GO:0018202 |
peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.1 |
0.3 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.1 |
2.9 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.1 |
0.1 |
GO:0045778 |
positive regulation of ossification(GO:0045778) |
| 0.1 |
0.2 |
GO:0061010 |
gall bladder development(GO:0061010) |
| 0.1 |
1.2 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 |
0.2 |
GO:0006290 |
pyrimidine dimer repair(GO:0006290) |
| 0.1 |
0.4 |
GO:0032486 |
Rap protein signal transduction(GO:0032486) |
| 0.1 |
0.2 |
GO:0034310 |
primary alcohol catabolic process(GO:0034310) |
| 0.1 |
0.7 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
0.8 |
GO:0006490 |
oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.1 |
0.2 |
GO:0042693 |
muscle cell fate commitment(GO:0042693) |
| 0.1 |
0.8 |
GO:0030033 |
microvillus assembly(GO:0030033) |
| 0.1 |
0.2 |
GO:0021965 |
spinal cord ventral commissure morphogenesis(GO:0021965) |
| 0.1 |
0.3 |
GO:0045629 |
negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.1 |
0.8 |
GO:0006107 |
oxaloacetate metabolic process(GO:0006107) |
| 0.1 |
0.4 |
GO:0040031 |
snRNA modification(GO:0040031) |
| 0.1 |
0.6 |
GO:0090527 |
actin filament reorganization(GO:0090527) |
| 0.1 |
0.7 |
GO:0035024 |
negative regulation of Rho protein signal transduction(GO:0035024) |
| 0.1 |
0.8 |
GO:0009396 |
folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.1 |
3.0 |
GO:0070206 |
protein trimerization(GO:0070206) |
| 0.1 |
0.6 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.1 |
0.4 |
GO:0031584 |
activation of phospholipase D activity(GO:0031584) |
| 0.1 |
0.4 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational elongation(GO:0045901) positive regulation of translational termination(GO:0045905) |
| 0.1 |
0.2 |
GO:1900060 |
negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.1 |
0.4 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.1 |
0.4 |
GO:0036260 |
7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.1 |
0.8 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.1 |
1.3 |
GO:0016973 |
poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.1 |
0.9 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 |
0.3 |
GO:0070127 |
tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.1 |
0.4 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.1 |
0.2 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
0.2 |
GO:1990776 |
cellular response to angiotensin(GO:1904385) response to angiotensin(GO:1990776) |
| 0.1 |
0.3 |
GO:0033683 |
nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.1 |
0.1 |
GO:0008635 |
activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.1 |
0.8 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
1.6 |
GO:0000038 |
very long-chain fatty acid metabolic process(GO:0000038) |
| 0.1 |
0.4 |
GO:0044375 |
regulation of peroxisome size(GO:0044375) |
| 0.1 |
0.3 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 |
0.5 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.1 |
0.1 |
GO:0048680 |
positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
| 0.1 |
0.4 |
GO:0045907 |
positive regulation of vasoconstriction(GO:0045907) |
| 0.1 |
1.6 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
0.3 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.1 |
0.5 |
GO:0051418 |
interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.1 |
0.4 |
GO:0045040 |
protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 |
0.5 |
GO:0050680 |
negative regulation of epithelial cell proliferation(GO:0050680) |
| 0.1 |
0.1 |
GO:1901069 |
guanosine-containing compound catabolic process(GO:1901069) |
| 0.1 |
0.2 |
GO:0015960 |
diadenosine polyphosphate biosynthetic process(GO:0015960) diadenosine tetraphosphate metabolic process(GO:0015965) diadenosine tetraphosphate biosynthetic process(GO:0015966) |
| 0.1 |
2.8 |
GO:0008589 |
regulation of smoothened signaling pathway(GO:0008589) |
| 0.1 |
0.9 |
GO:0009191 |
ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.1 |
1.1 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 |
0.9 |
GO:0033866 |
nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.1 |
0.2 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.1 |
0.3 |
GO:0042255 |
ribosome assembly(GO:0042255) |
| 0.1 |
0.4 |
GO:1903624 |
regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
| 0.1 |
0.3 |
GO:0006309 |
apoptotic DNA fragmentation(GO:0006309) |
| 0.1 |
1.1 |
GO:0072673 |
lamellipodium morphogenesis(GO:0072673) |
| 0.1 |
0.3 |
GO:0032753 |
positive regulation of interleukin-4 production(GO:0032753) |
| 0.1 |
0.3 |
GO:0045618 |
positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.1 |
0.3 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 |
0.5 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
2.3 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
0.1 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.1 |
0.4 |
GO:0006308 |
DNA catabolic process(GO:0006308) |
| 0.1 |
0.5 |
GO:0048386 |
positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 |
0.4 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.1 |
0.1 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.1 |
0.3 |
GO:0090400 |
stress-induced premature senescence(GO:0090400) |
| 0.1 |
1.3 |
GO:0032611 |
interleukin-1 beta production(GO:0032611) |
| 0.1 |
2.7 |
GO:0017145 |
stem cell division(GO:0017145) |
| 0.1 |
0.6 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.1 |
0.2 |
GO:0036151 |
platelet activating factor biosynthetic process(GO:0006663) phosphatidylcholine acyl-chain remodeling(GO:0036151) platelet activating factor metabolic process(GO:0046469) |
| 0.1 |
0.2 |
GO:0071596 |
ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
| 0.1 |
1.5 |
GO:0046825 |
regulation of protein export from nucleus(GO:0046825) |
| 0.1 |
1.1 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.1 |
0.1 |
GO:0030579 |
ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.1 |
0.2 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.1 |
0.6 |
GO:0031295 |
lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
| 0.1 |
0.4 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.1 |
1.0 |
GO:0071108 |
protein K48-linked deubiquitination(GO:0071108) |
| 0.1 |
0.1 |
GO:0071033 |
nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
| 0.1 |
0.2 |
GO:0046487 |
glyoxylate metabolic process(GO:0046487) |
| 0.1 |
0.9 |
GO:0000154 |
rRNA modification(GO:0000154) |
| 0.1 |
1.6 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.1 |
0.1 |
GO:0090272 |
negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.1 |
0.4 |
GO:0033353 |
S-adenosylmethionine cycle(GO:0033353) |
| 0.1 |
0.2 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.1 |
1.3 |
GO:1902017 |
regulation of cilium assembly(GO:1902017) |
| 0.1 |
0.2 |
GO:0006681 |
galactosylceramide metabolic process(GO:0006681) galactolipid metabolic process(GO:0019374) |
| 0.1 |
0.2 |
GO:0010592 |
positive regulation of lamellipodium assembly(GO:0010592) |
| 0.1 |
0.6 |
GO:0048642 |
negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 |
0.4 |
GO:0031936 |
negative regulation of chromatin silencing(GO:0031936) |
| 0.1 |
0.6 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 |
0.4 |
GO:0006686 |
sphingomyelin biosynthetic process(GO:0006686) |
| 0.1 |
0.2 |
GO:0010572 |
positive regulation of platelet activation(GO:0010572) |
| 0.1 |
0.6 |
GO:1902042 |
negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.1 |
0.5 |
GO:0090435 |
protein localization to nuclear envelope(GO:0090435) |
| 0.1 |
0.5 |
GO:0010225 |
response to UV-C(GO:0010225) |
| 0.1 |
0.7 |
GO:0060216 |
definitive hemopoiesis(GO:0060216) |
| 0.1 |
0.4 |
GO:0071318 |
cellular response to ATP(GO:0071318) |
| 0.1 |
0.3 |
GO:0045954 |
positive regulation of natural killer cell mediated immunity(GO:0002717) positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.1 |
0.2 |
GO:0002693 |
positive regulation of cellular extravasation(GO:0002693) |
| 0.1 |
0.1 |
GO:2000407 |
regulation of T cell extravasation(GO:2000407) |
| 0.1 |
0.6 |
GO:0090503 |
RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.1 |
0.3 |
GO:0071447 |
cellular response to hydroperoxide(GO:0071447) |
| 0.1 |
0.3 |
GO:0002507 |
tolerance induction(GO:0002507) |
| 0.1 |
0.4 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.1 |
0.1 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.1 |
0.9 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.1 |
1.0 |
GO:0048255 |
mRNA stabilization(GO:0048255) |
| 0.1 |
0.2 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.1 |
0.1 |
GO:0070365 |
hepatocyte differentiation(GO:0070365) |
| 0.0 |
0.2 |
GO:1903427 |
negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
| 0.0 |
0.1 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.0 |
0.1 |
GO:0032042 |
mitochondrial DNA metabolic process(GO:0032042) |
| 0.0 |
2.2 |
GO:0006261 |
DNA-dependent DNA replication(GO:0006261) |
| 0.0 |
0.4 |
GO:0019800 |
peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 |
1.1 |
GO:0001658 |
branching involved in ureteric bud morphogenesis(GO:0001658) |
| 0.0 |
0.2 |
GO:0007019 |
microtubule depolymerization(GO:0007019) |
| 0.0 |
0.3 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.0 |
0.2 |
GO:0031282 |
regulation of guanylate cyclase activity(GO:0031282) |
| 0.0 |
0.1 |
GO:0071285 |
cellular response to lithium ion(GO:0071285) |
| 0.0 |
0.3 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 |
0.2 |
GO:0099500 |
synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 |
0.0 |
GO:0032829 |
regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.0 |
0.4 |
GO:0007168 |
receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 |
0.4 |
GO:0001779 |
natural killer cell differentiation(GO:0001779) |
| 0.0 |
1.1 |
GO:0046580 |
negative regulation of Ras protein signal transduction(GO:0046580) |
| 0.0 |
0.5 |
GO:2000505 |
regulation of energy homeostasis(GO:2000505) |
| 0.0 |
0.7 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.0 |
1.0 |
GO:0046856 |
phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.0 |
0.2 |
GO:0060768 |
epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 |
0.8 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 |
0.2 |
GO:0090148 |
membrane fission(GO:0090148) |
| 0.0 |
2.5 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.0 |
0.6 |
GO:0035019 |
somatic stem cell population maintenance(GO:0035019) |
| 0.0 |
0.3 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.0 |
0.9 |
GO:0006607 |
NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 |
0.8 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.0 |
0.4 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.0 |
1.4 |
GO:0001895 |
retina homeostasis(GO:0001895) |
| 0.0 |
0.3 |
GO:0006172 |
ADP biosynthetic process(GO:0006172) |
| 0.0 |
0.3 |
GO:0060013 |
righting reflex(GO:0060013) |
| 0.0 |
0.1 |
GO:0016571 |
histone methylation(GO:0016571) |
| 0.0 |
0.7 |
GO:0008299 |
isoprenoid biosynthetic process(GO:0008299) |
| 0.0 |
0.1 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.0 |
0.2 |
GO:0050908 |
detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 |
0.5 |
GO:0060042 |
retina morphogenesis in camera-type eye(GO:0060042) |
| 0.0 |
0.3 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.0 |
0.1 |
GO:0051409 |
response to nitrosative stress(GO:0051409) |
| 0.0 |
2.1 |
GO:0051028 |
mRNA transport(GO:0051028) |
| 0.0 |
0.4 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.0 |
0.2 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.0 |
0.3 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 |
0.3 |
GO:0043923 |
positive regulation by host of viral transcription(GO:0043923) |
| 0.0 |
0.3 |
GO:1904262 |
negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 |
0.5 |
GO:0048172 |
regulation of short-term neuronal synaptic plasticity(GO:0048172) |
| 0.0 |
0.4 |
GO:0043277 |
apoptotic cell clearance(GO:0043277) |
| 0.0 |
0.4 |
GO:0010867 |
positive regulation of triglyceride biosynthetic process(GO:0010867) |
| 0.0 |
0.3 |
GO:0006895 |
Golgi to endosome transport(GO:0006895) |
| 0.0 |
0.1 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.0 |
0.1 |
GO:0010793 |
regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.0 |
0.1 |
GO:0003180 |
aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
| 0.0 |
1.0 |
GO:0015914 |
phospholipid transport(GO:0015914) |
| 0.0 |
0.1 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.0 |
0.5 |
GO:2000144 |
positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 |
7.2 |
GO:0000375 |
RNA splicing, via transesterification reactions(GO:0000375) |
| 0.0 |
0.2 |
GO:1902775 |
mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 |
1.6 |
GO:0006506 |
GPI anchor biosynthetic process(GO:0006506) |
| 0.0 |
0.4 |
GO:0048821 |
erythrocyte development(GO:0048821) |
| 0.0 |
0.2 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 |
0.2 |
GO:0071894 |
histone H2B conserved C-terminal lysine ubiquitination(GO:0071894) |
| 0.0 |
1.2 |
GO:0000184 |
nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 |
0.2 |
GO:0045721 |
negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 |
0.4 |
GO:0043984 |
histone H4-K16 acetylation(GO:0043984) |
| 0.0 |
0.1 |
GO:0006657 |
CDP-choline pathway(GO:0006657) |
| 0.0 |
0.6 |
GO:0043968 |
histone H2A acetylation(GO:0043968) |
| 0.0 |
0.1 |
GO:1900364 |
negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.0 |
0.3 |
GO:0071320 |
cellular response to cAMP(GO:0071320) |
| 0.0 |
0.2 |
GO:0042759 |
long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.0 |
0.5 |
GO:0006693 |
prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.0 |
0.2 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.0 |
0.1 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 |
0.2 |
GO:0006983 |
ER overload response(GO:0006983) |
| 0.0 |
0.3 |
GO:0006491 |
N-glycan processing(GO:0006491) |
| 0.0 |
0.5 |
GO:0045722 |
positive regulation of gluconeogenesis(GO:0045722) |
| 0.0 |
0.4 |
GO:0090501 |
RNA phosphodiester bond hydrolysis(GO:0090501) |
| 0.0 |
0.4 |
GO:0032967 |
positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.0 |
0.6 |
GO:0070979 |
protein K11-linked ubiquitination(GO:0070979) |
| 0.0 |
0.3 |
GO:0050892 |
intestinal absorption(GO:0050892) |
| 0.0 |
0.1 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.0 |
0.9 |
GO:1902653 |
cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
| 0.0 |
0.0 |
GO:0003188 |
heart valve formation(GO:0003188) |
| 0.0 |
1.3 |
GO:0030512 |
negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 0.0 |
0.5 |
GO:0035329 |
hippo signaling(GO:0035329) |
| 0.0 |
0.2 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 |
0.4 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.0 |
0.1 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.0 |
0.1 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 |
0.8 |
GO:0001649 |
osteoblast differentiation(GO:0001649) |
| 0.0 |
0.1 |
GO:0032933 |
response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.0 |
0.2 |
GO:0051534 |
negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 |
0.2 |
GO:0002031 |
G-protein coupled receptor internalization(GO:0002031) |
| 0.0 |
0.1 |
GO:1903048 |
regulation of acetylcholine-gated cation channel activity(GO:1903048) |
| 0.0 |
0.5 |
GO:0043171 |
peptide catabolic process(GO:0043171) |
| 0.0 |
0.5 |
GO:0033622 |
integrin activation(GO:0033622) |
| 0.0 |
0.1 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.0 |
0.1 |
GO:0060259 |
regulation of feeding behavior(GO:0060259) |
| 0.0 |
0.2 |
GO:0030382 |
sperm mitochondrion organization(GO:0030382) |
| 0.0 |
0.1 |
GO:0010667 |
negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.0 |
1.0 |
GO:0043484 |
regulation of RNA splicing(GO:0043484) |
| 0.0 |
0.1 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.0 |
0.1 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.0 |
0.9 |
GO:0006805 |
xenobiotic metabolic process(GO:0006805) cellular response to xenobiotic stimulus(GO:0071466) |
| 0.0 |
0.4 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.0 |
1.0 |
GO:0015804 |
neutral amino acid transport(GO:0015804) |
| 0.0 |
0.3 |
GO:0051156 |
glucose 6-phosphate metabolic process(GO:0051156) |
| 0.0 |
0.2 |
GO:0021924 |
cell proliferation in external granule layer(GO:0021924) cerebellar granule cell precursor proliferation(GO:0021930) |
| 0.0 |
0.6 |
GO:0034605 |
cellular response to heat(GO:0034605) |
| 0.0 |
0.2 |
GO:0006013 |
mannose metabolic process(GO:0006013) |
| 0.0 |
0.0 |
GO:0006071 |
glycerol metabolic process(GO:0006071) |
| 0.0 |
0.2 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.0 |
0.0 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.0 |
0.2 |
GO:0006544 |
glycine metabolic process(GO:0006544) |
| 0.0 |
0.1 |
GO:0071436 |
sodium ion export from cell(GO:0036376) sodium ion export(GO:0071436) |
| 0.0 |
0.5 |
GO:0048670 |
regulation of collateral sprouting(GO:0048670) |
| 0.0 |
0.1 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.0 |
0.1 |
GO:0045646 |
regulation of erythrocyte differentiation(GO:0045646) |
| 0.0 |
0.0 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 0.0 |
0.3 |
GO:0042059 |
negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
| 0.0 |
0.2 |
GO:0021684 |
cerebellar granular layer morphogenesis(GO:0021683) cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.0 |
0.3 |
GO:0033235 |
positive regulation of protein sumoylation(GO:0033235) |
| 0.0 |
0.1 |
GO:0070126 |
mitochondrial translational termination(GO:0070126) |
| 0.0 |
0.1 |
GO:0032462 |
regulation of protein homooligomerization(GO:0032462) |
| 0.0 |
0.7 |
GO:0006367 |
transcription initiation from RNA polymerase II promoter(GO:0006367) |
| 0.0 |
0.1 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.0 |
0.2 |
GO:0051057 |
positive regulation of small GTPase mediated signal transduction(GO:0051057) |
| 0.0 |
0.0 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.0 |
0.4 |
GO:0007099 |
centriole replication(GO:0007099) |
| 0.0 |
0.3 |
GO:0032981 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 |
0.7 |
GO:0002088 |
lens development in camera-type eye(GO:0002088) |
| 0.0 |
0.0 |
GO:2001169 |
regulation of ATP biosynthetic process(GO:2001169) |
| 0.0 |
0.2 |
GO:0035690 |
cellular response to drug(GO:0035690) |
| 0.0 |
0.3 |
GO:0030201 |
heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.0 |
0.2 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.0 |
0.4 |
GO:0001959 |
regulation of cytokine-mediated signaling pathway(GO:0001959) |
| 0.0 |
0.2 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
| 0.0 |
0.1 |
GO:0071955 |
recycling endosome to Golgi transport(GO:0071955) |
| 0.0 |
0.1 |
GO:0045351 |
type I interferon biosynthetic process(GO:0045351) |
| 0.0 |
0.1 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 |
0.3 |
GO:0060828 |
regulation of canonical Wnt signaling pathway(GO:0060828) |
| 0.0 |
0.2 |
GO:0006828 |
manganese ion transport(GO:0006828) |
| 0.0 |
1.3 |
GO:0001841 |
neural tube formation(GO:0001841) |
| 0.0 |
0.5 |
GO:0006631 |
fatty acid metabolic process(GO:0006631) |
| 0.0 |
0.3 |
GO:0070534 |
protein K63-linked ubiquitination(GO:0070534) |
| 0.0 |
0.1 |
GO:0070098 |
chemokine-mediated signaling pathway(GO:0070098) |
| 0.0 |
0.7 |
GO:0030032 |
lamellipodium assembly(GO:0030032) |
| 0.0 |
0.0 |
GO:0090141 |
positive regulation of mitochondrial fission(GO:0090141) |
| 0.0 |
0.6 |
GO:1902476 |
chloride transmembrane transport(GO:1902476) |
| 0.0 |
0.5 |
GO:0008584 |
male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.0 |
0.1 |
GO:0034312 |
diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) sphingoid biosynthetic process(GO:0046520) |
| 0.0 |
0.0 |
GO:0000491 |
small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 |
0.0 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.0 |
0.4 |
GO:0051099 |
positive regulation of binding(GO:0051099) |
| 0.0 |
0.5 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.0 |
0.2 |
GO:0001889 |
liver development(GO:0001889) hepaticobiliary system development(GO:0061008) |
| 0.0 |
0.1 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 |
0.2 |
GO:0007368 |
determination of left/right symmetry(GO:0007368) specification of symmetry(GO:0009799) determination of bilateral symmetry(GO:0009855) |
| 0.0 |
0.2 |
GO:0042274 |
ribosomal small subunit biogenesis(GO:0042274) |
| 0.0 |
0.2 |
GO:0071594 |
T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
| 0.0 |
0.2 |
GO:0008535 |
respiratory chain complex IV assembly(GO:0008535) |
| 0.0 |
0.5 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.0 |
0.1 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 |
0.1 |
GO:0043508 |
negative regulation of JUN kinase activity(GO:0043508) |
| 0.0 |
0.5 |
GO:0006635 |
fatty acid beta-oxidation(GO:0006635) |
| 0.0 |
0.1 |
GO:0051683 |
establishment of Golgi localization(GO:0051683) |
| 0.0 |
0.1 |
GO:0045063 |
T-helper 1 cell differentiation(GO:0045063) |
| 0.0 |
0.1 |
GO:2000270 |
negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 |
0.2 |
GO:0051092 |
positive regulation of NF-kappaB transcription factor activity(GO:0051092) |
| 0.0 |
0.1 |
GO:0045056 |
transcytosis(GO:0045056) |
| 0.0 |
0.0 |
GO:0010800 |
positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 |
0.2 |
GO:0045682 |
regulation of epidermis development(GO:0045682) |
| 0.0 |
0.3 |
GO:0060612 |
adipose tissue development(GO:0060612) |
| 0.0 |
0.0 |
GO:0006436 |
tryptophanyl-tRNA aminoacylation(GO:0006436) |
| 0.0 |
0.3 |
GO:0090263 |
positive regulation of canonical Wnt signaling pathway(GO:0090263) |
| 0.0 |
0.1 |
GO:0001504 |
neurotransmitter uptake(GO:0001504) |
| 0.0 |
0.2 |
GO:0008214 |
protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
| 0.0 |
0.0 |
GO:0060838 |
lymphatic endothelial cell fate commitment(GO:0060838) regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.0 |
0.1 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.0 |
0.1 |
GO:0023019 |
signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.0 |
0.1 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.0 |
0.0 |
GO:0070072 |
vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 |
0.2 |
GO:0000266 |
mitochondrial fission(GO:0000266) |
| 0.0 |
0.1 |
GO:0006513 |
protein monoubiquitination(GO:0006513) |
| 0.0 |
0.1 |
GO:0045601 |
regulation of endothelial cell differentiation(GO:0045601) |
