Motif ID: Zbtb3
Z-value: 0.666
Transcription factors associated with Zbtb3:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Zbtb3 | ENSMUSG00000071661.6 | Zbtb3 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Zbtb3 | mm10_v2_chr19_+_8802486_8802530 | 0.66 | 2.1e-04 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 1.0 | GO:0001978 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.3 | 1.3 | GO:1904529 | regulation of actin filament binding(GO:1904529) regulation of actin binding(GO:1904616) |
| 0.3 | 3.0 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
| 0.2 | 0.6 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.2 | 0.6 | GO:0010512 | negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) |
| 0.2 | 1.1 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.2 | 1.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 0.4 | GO:0060854 | patterning of lymph vessels(GO:0060854) |
| 0.1 | 1.1 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
| 0.1 | 0.3 | GO:0032918 | polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.1 | 0.6 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.1 | 1.5 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) membrane hyperpolarization(GO:0060081) |
| 0.1 | 0.4 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.4 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) proprioception(GO:0019230) |
| 0.1 | 0.3 | GO:0030070 | insulin processing(GO:0030070) |
| 0.1 | 0.4 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.1 | 1.0 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.1 | 1.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.2 | GO:1902524 | negative regulation of interferon-alpha production(GO:0032687) interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) negative regulation of interferon-beta biosynthetic process(GO:0045358) positive regulation of protein K48-linked ubiquitination(GO:1902524) |
| 0.1 | 0.7 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 | 0.6 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.1 | 0.4 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.1 | 0.7 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.6 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.1 | 1.1 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.9 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.9 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
| 0.0 | 0.5 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.9 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.5 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.5 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
| 0.0 | 3.4 | GO:0014065 | phosphatidylinositol 3-kinase signaling(GO:0014065) |
| 0.0 | 0.8 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
| 0.0 | 0.4 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 | 0.2 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.0 | 0.1 | GO:0032415 | regulation of sodium:proton antiporter activity(GO:0032415) positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.0 | 1.8 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.0 | 0.3 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.0 | 1.0 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 | 0.8 | GO:0007193 | adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
| 0.0 | 0.3 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.0 | 0.4 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
| 0.0 | 0.2 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 | 0.2 | GO:0007569 | cell aging(GO:0007569) |
| 0.0 | 0.0 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.5 | GO:1901998 | toxin transport(GO:1901998) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.2 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 1.0 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.1 | 3.0 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.1 | 0.5 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.4 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 3.5 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.5 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.0 | 2.5 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.5 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 1.3 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 1.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
| 0.0 | 0.6 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.0 | 0.4 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 1.1 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.8 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 1.4 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.9 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.5 | GO:0030286 | dynein complex(GO:0030286) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.2 | 0.6 | GO:0042030 | ATPase inhibitor activity(GO:0042030) angiostatin binding(GO:0043532) |
| 0.2 | 0.6 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.2 | 0.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.2 | 1.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.2 | 0.6 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.1 | 1.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.8 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.1 | 0.9 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 1.0 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.3 | GO:0004145 | diamine N-acetyltransferase activity(GO:0004145) |
| 0.1 | 1.1 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
| 0.1 | 0.3 | GO:0017057 | 6-phosphogluconolactonase activity(GO:0017057) |
| 0.1 | 1.3 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 3.0 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.1 | 0.5 | GO:0045703 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.1 | 0.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.4 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.0 | 0.6 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.5 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 4.1 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.3 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.6 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.7 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.7 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) cobalt ion binding(GO:0050897) |
| 0.0 | 0.8 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 0.3 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.3 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.9 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
