Motif ID: E2f2_E2f5
Z-value: 3.815
Transcription factors associated with E2f2_E2f5:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| E2f2 | ENSMUSG00000018983.9 | E2f2 |
| E2f5 | ENSMUSG00000027552.8 | E2f5 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| E2f2 | mm10_v2_chr4_+_136172367_136172395 | 0.83 | 1.7e-05 | Click! |
| E2f5 | mm10_v2_chr3_+_14578609_14578687 | 0.81 | 4.4e-05 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.1 | 12.3 | GO:0032877 | positive regulation of DNA endoreduplication(GO:0032877) |
| 4.0 | 31.8 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 3.8 | 38.1 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
| 3.7 | 25.8 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 2.5 | 7.6 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 2.2 | 6.7 | GO:0045004 | DNA replication proofreading(GO:0045004) |
| 2.2 | 4.5 | GO:0006272 | leading strand elongation(GO:0006272) |
| 1.9 | 7.5 | GO:0046655 | glycine biosynthetic process(GO:0006545) folic acid metabolic process(GO:0046655) |
| 1.5 | 21.4 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 1.5 | 43.8 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 1.5 | 8.7 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 1.4 | 1.4 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
| 1.4 | 5.8 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
| 1.4 | 7.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 1.4 | 9.5 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 1.3 | 21.6 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
| 1.3 | 15.1 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 1.2 | 5.0 | GO:0046604 | positive regulation of mitotic centrosome separation(GO:0046604) |
| 1.1 | 9.9 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 1.0 | 3.1 | GO:0045819 | plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 1.0 | 9.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.9 | 2.7 | GO:0071707 | immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 0.9 | 2.7 | GO:0019046 | release from viral latency(GO:0019046) regulation of DNA strand elongation(GO:0060382) |
| 0.9 | 2.7 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.8 | 3.4 | GO:0072369 | regulation of lipid transport by positive regulation of transcription from RNA polymerase II promoter(GO:0072369) |
| 0.8 | 0.8 | GO:0072554 | blood vessel lumenization(GO:0072554) |
| 0.8 | 2.4 | GO:0090204 | protein localization to nuclear pore(GO:0090204) positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.8 | 2.4 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.8 | 3.8 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.7 | 3.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
| 0.7 | 8.2 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.7 | 4.4 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.7 | 2.9 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.7 | 1.4 | GO:0031660 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
| 0.7 | 5.9 | GO:0033504 | floor plate development(GO:0033504) |
| 0.7 | 2.0 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.6 | 3.2 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.6 | 1.9 | GO:0061181 | regulation of chondrocyte development(GO:0061181) |
| 0.6 | 4.2 | GO:0042148 | strand invasion(GO:0042148) |
| 0.6 | 4.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.6 | 2.3 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.6 | 1.1 | GO:0051311 | meiotic metaphase plate congression(GO:0051311) |
| 0.6 | 2.8 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.5 | 2.7 | GO:0019230 | proprioception(GO:0019230) |
| 0.5 | 1.1 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.5 | 15.7 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.5 | 2.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.5 | 1.5 | GO:0035604 | orbitofrontal cortex development(GO:0021769) fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) fibroblast growth factor receptor signaling pathway involved in orbitofrontal cortex development(GO:0035607) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
| 0.5 | 1.5 | GO:0001193 | maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 0.5 | 4.5 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.5 | 1.9 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.4 | 1.8 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.4 | 0.8 | GO:0070602 | regulation of centromeric sister chromatid cohesion(GO:0070602) |
| 0.4 | 1.3 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
| 0.4 | 2.1 | GO:1901731 | positive regulation of platelet aggregation(GO:1901731) |
| 0.4 | 5.3 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.4 | 1.2 | GO:0002184 | cytoplasmic translational termination(GO:0002184) |
| 0.4 | 24.5 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
| 0.4 | 3.6 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.4 | 4.7 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.4 | 5.0 | GO:0002385 | mucosal immune response(GO:0002385) |
| 0.4 | 1.1 | GO:0031990 | mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.4 | 4.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.4 | 1.5 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.4 | 2.2 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.4 | 1.4 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
| 0.4 | 1.8 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.3 | 4.6 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
| 0.3 | 1.6 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.3 | 1.8 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.3 | 0.9 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.3 | 1.8 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.3 | 1.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.3 | 2.4 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.3 | 0.3 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
| 0.3 | 5.7 | GO:0043486 | histone exchange(GO:0043486) |
| 0.3 | 3.3 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.3 | 1.6 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) establishment of Sertoli cell barrier(GO:0097368) |
| 0.3 | 4.6 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.3 | 2.7 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.3 | 0.8 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 0.3 | 10.5 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.3 | 1.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.3 | 7.8 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.2 | 0.7 | GO:0019389 | glucuronoside metabolic process(GO:0019389) |
| 0.2 | 2.6 | GO:0030238 | male sex determination(GO:0030238) |
| 0.2 | 5.6 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.2 | 3.7 | GO:0042407 | cristae formation(GO:0042407) |
| 0.2 | 2.1 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.2 | 0.7 | GO:0071603 | endothelial cell-cell adhesion(GO:0071603) |
| 0.2 | 0.7 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
| 0.2 | 19.2 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.2 | 0.7 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.2 | 4.7 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
| 0.2 | 1.6 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.2 | 5.0 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.2 | 1.4 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.2 | 0.4 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
| 0.2 | 1.4 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.2 | 0.8 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 | 4.6 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
| 0.2 | 1.4 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.2 | 0.9 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.2 | 1.6 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.2 | 0.7 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.2 | 1.2 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.2 | 1.6 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.2 | 0.5 | GO:1903490 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.2 | 0.5 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.2 | 2.4 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.2 | 0.5 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.2 | 0.9 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.2 | 2.6 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.1 | 0.4 | GO:0071929 | alpha-tubulin acetylation(GO:0071929) |
| 0.1 | 1.4 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.1 | 6.7 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
| 0.1 | 1.7 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 | 6.7 | GO:0030512 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) |
| 0.1 | 0.6 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.1 | 0.2 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 3.9 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.1 | 1.8 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) mitotic G2/M transition checkpoint(GO:0044818) |
| 0.1 | 1.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.1 | 2.5 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
| 0.1 | 1.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.1 | 1.0 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.1 | 1.0 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
| 0.1 | 0.9 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 0.6 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
| 0.1 | 1.5 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 3.3 | GO:0060135 | maternal process involved in female pregnancy(GO:0060135) |
| 0.1 | 0.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.1 | 0.9 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
| 0.1 | 0.7 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
| 0.1 | 1.0 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.1 | 1.2 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.1 | 0.4 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) negative regulation by host of viral genome replication(GO:0044828) |
| 0.1 | 1.3 | GO:0048255 | mRNA stabilization(GO:0048255) |
| 0.1 | 1.0 | GO:0045860 | positive regulation of protein kinase activity(GO:0045860) |
| 0.1 | 4.0 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.1 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.1 | 0.5 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.1 | 1.4 | GO:0021511 | spinal cord patterning(GO:0021511) |
| 0.1 | 0.6 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 11.4 | GO:0006260 | DNA replication(GO:0006260) |
| 0.1 | 1.2 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.1 | 1.8 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
| 0.1 | 1.5 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.1 | 0.4 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.0 | 0.5 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
| 0.0 | 1.4 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.4 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.0 | 0.3 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.0 | 7.4 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
| 0.0 | 4.1 | GO:0035308 | negative regulation of protein dephosphorylation(GO:0035308) |
| 0.0 | 2.1 | GO:0016925 | protein sumoylation(GO:0016925) |
| 0.0 | 3.2 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.2 | GO:0006983 | ER overload response(GO:0006983) negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.0 | 0.9 | GO:0065004 | protein-DNA complex assembly(GO:0065004) |
| 0.0 | 1.6 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 1.0 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.0 | 0.7 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
| 0.0 | 1.2 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
| 0.0 | 0.4 | GO:0009952 | anterior/posterior pattern specification(GO:0009952) |
| 0.0 | 0.1 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.0 | 1.4 | GO:0001885 | endothelial cell development(GO:0001885) |
| 0.0 | 0.2 | GO:0098703 | calcium ion import across plasma membrane(GO:0098703) calcium ion import into cell(GO:1990035) |
| 0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.4 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 | 0.2 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.7 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
| 0.0 | 0.5 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 4.3 | GO:0018108 | peptidyl-tyrosine phosphorylation(GO:0018108) |
| 0.0 | 0.4 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.0 | 1.1 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.0 | 0.1 | GO:0072395 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
| 0.0 | 0.2 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 1.1 | GO:0006986 | response to unfolded protein(GO:0006986) |
| 0.0 | 0.3 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.4 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.3 | 21.6 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 4.1 | 4.1 | GO:0000811 | GINS complex(GO:0000811) |
| 3.7 | 55.5 | GO:0042555 | MCM complex(GO:0042555) |
| 2.3 | 11.3 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 2.0 | 9.9 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 1.9 | 13.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 1.6 | 1.6 | GO:0035061 | interchromatin granule(GO:0035061) |
| 1.3 | 3.9 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.9 | 2.7 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
| 0.9 | 6.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.8 | 4.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.8 | 2.4 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
| 0.8 | 7.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.8 | 2.4 | GO:0000801 | central element(GO:0000801) |
| 0.7 | 3.6 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.6 | 33.4 | GO:0005657 | replication fork(GO:0005657) |
| 0.6 | 3.4 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.5 | 1.6 | GO:0000785 | chromatin(GO:0000785) |
| 0.5 | 8.2 | GO:0000800 | lateral element(GO:0000800) |
| 0.5 | 5.0 | GO:0034709 | methylosome(GO:0034709) |
| 0.4 | 1.3 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.4 | 3.7 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.4 | 1.2 | GO:0018444 | translation release factor complex(GO:0018444) |
| 0.4 | 3.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.4 | 3.0 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.3 | 23.4 | GO:0000786 | nucleosome(GO:0000786) |
| 0.3 | 4.4 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.3 | 5.3 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.3 | 0.9 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.3 | 0.3 | GO:0001740 | Barr body(GO:0001740) |
| 0.3 | 1.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.2 | 0.9 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.2 | 2.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.2 | 1.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.2 | 3.9 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.2 | 1.4 | GO:0005638 | lamin filament(GO:0005638) |
| 0.2 | 10.9 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.2 | 4.0 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.2 | 1.2 | GO:0070187 | telosome(GO:0070187) |
| 0.2 | 0.9 | GO:0033503 | HULC complex(GO:0033503) |
| 0.2 | 27.3 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.2 | 1.2 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.2 | 2.3 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
| 0.2 | 1.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 2.4 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 1.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.1 | 1.1 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.1 | 1.0 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
| 0.1 | 1.4 | GO:0000796 | condensin complex(GO:0000796) |
| 0.1 | 1.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 7.8 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.1 | 1.6 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 7.0 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 4.9 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.1 | 0.4 | GO:0001652 | granular component(GO:0001652) |
| 0.1 | 1.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 24.1 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 0.8 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 3.7 | GO:0005814 | centriole(GO:0005814) |
| 0.1 | 2.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.1 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.1 | 4.1 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 2.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.1 | 0.8 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 0.5 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.1 | 2.5 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 2.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 0.9 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.1 | 1.5 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.1 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 3.9 | GO:0000922 | spindle pole(GO:0000922) |
| 0.1 | 0.9 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 1.5 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.0 | 2.9 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 3.2 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.0 | 1.0 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
| 0.0 | 0.4 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 1.4 | GO:0030686 | 90S preribosome(GO:0030686) |
| 0.0 | 0.9 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.0 | 0.4 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 1.0 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 1.5 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
| 0.0 | 2.9 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.2 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 2.6 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.0 | 7.2 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 0.6 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 1.3 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.8 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 1.3 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.4 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 1.0 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 2.3 | GO:0005681 | spliceosomal complex(GO:0005681) |
| 0.0 | 71.0 | GO:0005634 | nucleus(GO:0005634) |
| 0.0 | 0.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.7 | 18.7 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
| 4.3 | 21.6 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 2.5 | 7.5 | GO:0051870 | methotrexate binding(GO:0051870) |
| 2.1 | 8.5 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 1.9 | 13.6 | GO:0000150 | recombinase activity(GO:0000150) |
| 1.9 | 7.6 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
| 1.8 | 25.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 1.4 | 8.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 1.1 | 6.7 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
| 1.1 | 4.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 1.0 | 3.1 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
| 1.0 | 4.0 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.9 | 2.8 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.9 | 2.7 | GO:0030337 | mismatch base pair DNA N-glycosylase activity(GO:0000700) DNA polymerase processivity factor activity(GO:0030337) |
| 0.9 | 12.9 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.8 | 5.8 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
| 0.7 | 3.0 | GO:0070279 | vitamin B6 binding(GO:0070279) |
| 0.7 | 16.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.6 | 2.6 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
| 0.6 | 7.1 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.6 | 3.6 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.6 | 3.4 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.6 | 2.8 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.5 | 20.9 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.5 | 1.5 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.5 | 3.1 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.5 | 16.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.5 | 1.4 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.5 | 1.8 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.5 | 5.9 | GO:0098505 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) |
| 0.4 | 1.8 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.4 | 6.8 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.4 | 4.8 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.4 | 3.1 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.4 | 5.8 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.4 | 1.9 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.4 | 2.5 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.4 | 5.3 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.3 | 4.5 | GO:0031386 | protein tag(GO:0031386) |
| 0.3 | 0.7 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.3 | 2.2 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.3 | 2.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.3 | 3.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.3 | 4.7 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.3 | 22.4 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.3 | 1.8 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.2 | 2.4 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.2 | 9.6 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.2 | 0.6 | GO:0032564 | dATP binding(GO:0032564) |
| 0.2 | 2.1 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.2 | 1.4 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
| 0.2 | 1.4 | GO:0070697 | activin receptor binding(GO:0070697) |
| 0.2 | 1.0 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.2 | 1.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.2 | 0.8 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
| 0.2 | 0.6 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.2 | 36.5 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.2 | 1.2 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.2 | 1.4 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.2 | 1.0 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.2 | 1.5 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.2 | 3.0 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.2 | 2.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.2 | 6.1 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.2 | 1.3 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.2 | 0.9 | GO:0000990 | transcription factor activity, core RNA polymerase binding(GO:0000990) |
| 0.2 | 0.9 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.2 | 1.2 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.2 | 2.0 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.1 | 2.7 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.1 | 0.9 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
| 0.1 | 16.3 | GO:0004386 | helicase activity(GO:0004386) |
| 0.1 | 0.7 | GO:0070330 | aromatase activity(GO:0070330) |
| 0.1 | 0.6 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 1.9 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 0.6 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.1 | 0.5 | GO:0017050 | sphinganine kinase activity(GO:0008481) D-erythro-sphingosine kinase activity(GO:0017050) |
| 0.1 | 0.4 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.1 | 0.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 0.8 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.5 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 4.3 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.1 | 5.9 | GO:0000975 | regulatory region DNA binding(GO:0000975) transcription regulatory region DNA binding(GO:0044212) |
| 0.1 | 7.0 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.1 | 2.6 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
| 0.1 | 0.9 | GO:0004526 | ribonuclease P activity(GO:0004526) |
| 0.1 | 3.1 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 1.4 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.1 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.1 | 1.4 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.1 | 0.6 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.1 | 1.9 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 8.3 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.1 | 17.0 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.1 | 2.6 | GO:0036002 | pre-mRNA binding(GO:0036002) |
| 0.1 | 2.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 1.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 8.3 | GO:0042393 | histone binding(GO:0042393) |
| 0.1 | 1.4 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 37.0 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
| 0.1 | 5.9 | GO:0051087 | chaperone binding(GO:0051087) |
| 0.1 | 1.5 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.1 | 1.1 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 1.4 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.1 | 2.4 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.1 | 0.2 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 1.0 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.4 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.5 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.7 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 1.3 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 1.2 | GO:0045182 | translation regulator activity(GO:0045182) |
| 0.0 | 1.0 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 1.1 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 1.0 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 1.6 | GO:0019842 | vitamin binding(GO:0019842) |
| 0.0 | 0.9 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.0 | 0.2 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 1.5 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.0 | 0.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.8 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 1.6 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
| 0.0 | 10.2 | GO:0046982 | protein heterodimerization activity(GO:0046982) |
| 0.0 | 0.3 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.0 | 0.8 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 1.2 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.0 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 5.6 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 0.3 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 2.9 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
| 0.0 | 0.4 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 2.5 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.7 | GO:0032934 | cholesterol binding(GO:0015485) sterol binding(GO:0032934) |
| 0.0 | 0.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.6 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
| 0.0 | 0.3 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.2 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.4 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.0 | 0.7 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.4 | 21.8 | SA_G2_AND_M_PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 2.2 | 30.5 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 1.2 | 51.4 | PID_ATR_PATHWAY | ATR signaling pathway |
| 0.8 | 63.4 | PID_E2F_PATHWAY | E2F transcription factor network |
| 0.4 | 10.5 | PID_FOXM1_PATHWAY | FOXM1 transcription factor network |
| 0.2 | 3.2 | PID_IL5_PATHWAY | IL5-mediated signaling events |
| 0.2 | 10.6 | PID_PLK1_PATHWAY | PLK1 signaling events |
| 0.2 | 5.9 | PID_FANCONI_PATHWAY | Fanconi anemia pathway |
| 0.2 | 5.9 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.2 | 8.3 | PID_RB_1PATHWAY | Regulation of retinoblastoma protein |
| 0.2 | 2.7 | PID_BARD1_PATHWAY | BARD1 signaling events |
| 0.2 | 15.7 | PID_MYC_ACTIV_PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 2.4 | PID_RANBP2_PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 0.7 | ST_JAK_STAT_PATHWAY | Jak-STAT Pathway |
| 0.1 | 9.9 | PID_CMYB_PATHWAY | C-MYB transcription factor network |
| 0.1 | 3.1 | PID_TOLL_ENDOGENOUS_PATHWAY | Endogenous TLR signaling |
| 0.1 | 9.8 | PID_BETA_CATENIN_NUC_PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.1 | 3.5 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 3.5 | PID_ATF2_PATHWAY | ATF-2 transcription factor network |
| 0.1 | 1.6 | PID_CD40_PATHWAY | CD40/CD40L signaling |
| 0.1 | 2.9 | PID_RAC1_PATHWAY | RAC1 signaling pathway |
| 0.1 | 2.3 | PID_TELOMERASE_PATHWAY | Regulation of Telomerase |
| 0.0 | 1.0 | PID_IL4_2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.6 | PID_HDAC_CLASSIII_PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 2.8 | PID_NOTCH_PATHWAY | Notch signaling pathway |
| 0.0 | 1.9 | PID_FGF_PATHWAY | FGF signaling pathway |
| 0.0 | 0.5 | PID_S1P_S1P1_PATHWAY | S1P1 pathway |
| 0.0 | 0.5 | PID_SYNDECAN_2_PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.8 | PID_TRAIL_PATHWAY | TRAIL signaling pathway |
| 0.0 | 0.9 | PID_ERBB4_PATHWAY | ErbB4 signaling events |
| 0.0 | 1.4 | PID_CASPASE_PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.4 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
| 0.0 | 1.2 | PID_BMP_PATHWAY | BMP receptor signaling |
| 0.0 | 0.7 | ST_ERK1_ERK2_MAPK_PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.0 | 0.4 | PID_HIF1A_PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 1.1 | PID_TGFBR_PATHWAY | TGF-beta receptor signaling |
| 0.0 | 1.1 | PID_REG_GR_PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 1.0 | PID_ARF6_TRAFFICKING_PATHWAY | Arf6 trafficking events |
| 0.0 | 0.8 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.7 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.2 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 4.0 | 63.3 | REACTOME_UNWINDING_OF_DNA | Genes involved in Unwinding of DNA |
| 3.7 | 67.2 | REACTOME_G1_S_SPECIFIC_TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 3.7 | 40.3 | REACTOME_ASSOCIATION_OF_LICENSING_FACTORS_WITH_THE_PRE_REPLICATIVE_COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 1.6 | 22.3 | REACTOME_REPAIR_SYNTHESIS_FOR_GAP_FILLING_BY_DNA_POL_IN_TC_NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 1.4 | 2.8 | REACTOME_REMOVAL_OF_THE_FLAP_INTERMEDIATE_FROM_THE_C_STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 1.3 | 5.3 | REACTOME_LAGGING_STRAND_SYNTHESIS | Genes involved in Lagging Strand Synthesis |
| 1.1 | 13.0 | REACTOME_HOMOLOGOUS_RECOMBINATION_REPAIR_OF_REPLICATION_INDEPENDENT_DOUBLE_STRAND_BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 1.0 | 8.8 | REACTOME_G2_M_DNA_DAMAGE_CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.7 | 12.1 | REACTOME_G0_AND_EARLY_G1 | Genes involved in G0 and Early G1 |
| 0.5 | 2.6 | REACTOME_ACTIVATION_OF_THE_PRE_REPLICATIVE_COMPLEX | Genes involved in Activation of the pre-replicative complex |
| 0.5 | 9.9 | REACTOME_CHONDROITIN_SULFATE_BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.4 | 23.7 | REACTOME_MEIOTIC_RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.3 | 3.1 | REACTOME_CYCLIN_A_B1_ASSOCIATED_EVENTS_DURING_G2_M_TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.3 | 1.2 | REACTOME_REGULATION_OF_THE_FANCONI_ANEMIA_PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.3 | 8.1 | REACTOME_G1_PHASE | Genes involved in G1 Phase |
| 0.3 | 4.8 | REACTOME_VIRAL_MESSENGER_RNA_SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.3 | 7.0 | REACTOME_KINESINS | Genes involved in Kinesins |
| 0.2 | 2.2 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.2 | 7.8 | REACTOME_MRNA_SPLICING_MINOR_PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.2 | 1.2 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.2 | 3.7 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.2 | 1.2 | REACTOME_IRAK2_MEDIATED_ACTIVATION_OF_TAK1_COMPLEX_UPON_TLR7_8_OR_9_STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.2 | 2.4 | REACTOME_REGULATION_OF_IFNG_SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.2 | 6.0 | REACTOME_RNA_POL_I_TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.2 | 2.1 | REACTOME_PLATELET_SENSITIZATION_BY_LDL | Genes involved in Platelet sensitization by LDL |
| 0.2 | 1.9 | REACTOME_RECEPTOR_LIGAND_BINDING_INITIATES_THE_SECOND_PROTEOLYTIC_CLEAVAGE_OF_NOTCH_RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.2 | 1.2 | REACTOME_RECRUITMENT_OF_NUMA_TO_MITOTIC_CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.1 | 1.6 | REACTOME_ACTIVATION_OF_IRF3_IRF7_MEDIATED_BY_TBK1_IKK_EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.1 | 0.8 | REACTOME_APOPTOTIC_CLEAVAGE_OF_CELL_ADHESION_PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 1.5 | REACTOME_FGFR2C_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.1 | 1.9 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_EARLY_ENDOSOME_MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 1.9 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 2.6 | REACTOME_SYNTHESIS_AND_INTERCONVERSION_OF_NUCLEOTIDE_DI_AND_TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.1 | 8.8 | REACTOME_LATE_PHASE_OF_HIV_LIFE_CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.1 | 1.8 | REACTOME_PURINE_SALVAGE | Genes involved in Purine salvage |
| 0.1 | 0.7 | REACTOME_ENDOGENOUS_STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 0.5 | REACTOME_CYCLIN_E_ASSOCIATED_EVENTS_DURING_G1_S_TRANSITION_ | Genes involved in Cyclin E associated events during G1/S transition |
| 0.1 | 0.7 | REACTOME_ERKS_ARE_INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 2.3 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 6.6 | REACTOME_FACTORS_INVOLVED_IN_MEGAKARYOCYTE_DEVELOPMENT_AND_PLATELET_PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.1 | 1.0 | REACTOME_VITAMIN_B5_PANTOTHENATE_METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
| 0.1 | 11.1 | REACTOME_SIGNALING_BY_RHO_GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 1.2 | REACTOME_DEPOSITION_OF_NEW_CENPA_CONTAINING_NUCLEOSOMES_AT_THE_CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.6 | REACTOME_AMINE_LIGAND_BINDING_RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.7 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.4 | REACTOME_NOTCH_HLH_TRANSCRIPTION_PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 1.2 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.6 | REACTOME_REGULATION_OF_KIT_SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.4 | REACTOME_OXYGEN_DEPENDENT_PROLINE_HYDROXYLATION_OF_HYPOXIA_INDUCIBLE_FACTOR_ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.7 | REACTOME_CRMPS_IN_SEMA3A_SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 8.2 | REACTOME_ANTIGEN_PROCESSING_UBIQUITINATION_PROTEASOME_DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.8 | REACTOME_CELL_EXTRACELLULAR_MATRIX_INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.5 | REACTOME_FORMATION_OF_ATP_BY_CHEMIOSMOTIC_COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.0 | 0.7 | REACTOME_ACTIVATION_OF_GENES_BY_ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.0 | 0.8 | REACTOME_DEADENYLATION_OF_MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 1.4 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.8 | REACTOME_TRANSPORT_OF_MATURE_TRANSCRIPT_TO_CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.9 | REACTOME_EGFR_DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.4 | REACTOME_CITRIC_ACID_CYCLE_TCA_CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 1.7 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 1.9 | REACTOME_RESPONSE_TO_ELEVATED_PLATELET_CYTOSOLIC_CA2_ | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.0 | 0.9 | REACTOME_SPHINGOLIPID_DE_NOVO_BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.2 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.4 | REACTOME_SIGNALING_BY_FGFR1_FUSION_MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.3 | REACTOME_PTM_GAMMA_CARBOXYLATION_HYPUSINE_FORMATION_AND_ARYLSULFATASE_ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.0 | 0.1 | REACTOME_CS_DS_DEGRADATION | Genes involved in CS/DS degradation |
|
|
|