| 0.6 |
3.1 |
GO:0015671 |
oxygen transport(GO:0015671) |
| 0.6 |
1.8 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.5 |
1.4 |
GO:0045819 |
plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
| 0.4 |
1.3 |
GO:0021557 |
oculomotor nerve development(GO:0021557) |
| 0.4 |
1.2 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.4 |
1.1 |
GO:2000435 |
regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.3 |
2.7 |
GO:0048625 |
myoblast fate commitment(GO:0048625) |
| 0.3 |
1.4 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.3 |
1.3 |
GO:0046655 |
folic acid metabolic process(GO:0046655) |
| 0.3 |
0.9 |
GO:0031204 |
posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.3 |
0.9 |
GO:1902071 |
regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.3 |
1.2 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.3 |
0.9 |
GO:0060523 |
prostate epithelial cord elongation(GO:0060523) |
| 0.3 |
0.8 |
GO:0030421 |
defecation(GO:0030421) |
| 0.3 |
0.3 |
GO:0033088 |
negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.3 |
3.0 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 0.3 |
0.3 |
GO:0060290 |
transdifferentiation(GO:0060290) |
| 0.3 |
0.3 |
GO:0033087 |
negative regulation of immature T cell proliferation(GO:0033087) |
| 0.3 |
0.8 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 0.3 |
0.8 |
GO:0001193 |
maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 0.2 |
0.7 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.2 |
1.2 |
GO:0001705 |
ectoderm formation(GO:0001705) |
| 0.2 |
1.0 |
GO:0071726 |
response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
| 0.2 |
0.7 |
GO:0046133 |
pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.2 |
0.7 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.2 |
1.6 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.2 |
1.2 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 0.2 |
0.9 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.2 |
4.2 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.2 |
0.9 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.2 |
0.7 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.2 |
2.7 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.2 |
1.6 |
GO:1900747 |
negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.2 |
0.9 |
GO:0002337 |
B-1a B cell differentiation(GO:0002337) |
| 0.2 |
0.7 |
GO:0045004 |
DNA replication proofreading(GO:0045004) |
| 0.2 |
1.1 |
GO:0042780 |
tRNA 3'-end processing(GO:0042780) |
| 0.2 |
0.4 |
GO:0001757 |
somite specification(GO:0001757) |
| 0.2 |
1.1 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.2 |
0.8 |
GO:0050748 |
negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.2 |
1.2 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.2 |
0.8 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 0.2 |
0.6 |
GO:0097350 |
neutrophil clearance(GO:0097350) |
| 0.2 |
0.8 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 0.2 |
0.6 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.2 |
1.1 |
GO:0061643 |
chemorepulsion of axon(GO:0061643) |
| 0.2 |
0.8 |
GO:0003342 |
proepicardium development(GO:0003342) septum transversum development(GO:0003343) |
| 0.2 |
0.9 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.2 |
0.2 |
GO:0021603 |
cranial nerve formation(GO:0021603) |
| 0.2 |
0.6 |
GO:1905203 |
regulation of connective tissue replacement(GO:1905203) |
| 0.2 |
1.1 |
GO:0048664 |
neuron fate determination(GO:0048664) |
| 0.2 |
0.2 |
GO:0044830 |
modulation by host of viral RNA genome replication(GO:0044830) |
| 0.2 |
0.4 |
GO:0090073 |
positive regulation of protein homodimerization activity(GO:0090073) |
| 0.2 |
0.5 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 0.2 |
0.3 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 0.2 |
0.5 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.2 |
0.2 |
GO:0070837 |
dehydroascorbic acid transport(GO:0070837) |
| 0.2 |
0.5 |
GO:0061153 |
trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) odontoblast differentiation(GO:0071895) regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.2 |
0.5 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.2 |
0.2 |
GO:0042097 |
interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.2 |
0.3 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.2 |
0.5 |
GO:0006566 |
threonine metabolic process(GO:0006566) |
| 0.2 |
0.7 |
GO:0032227 |
negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.2 |
0.5 |
GO:0046122 |
purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.2 |
0.5 |
GO:1900108 |
negative regulation of nodal signaling pathway(GO:1900108) |
| 0.2 |
2.4 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 |
0.7 |
GO:0072592 |
oxygen metabolic process(GO:0072592) |
| 0.2 |
0.9 |
GO:0031120 |
snRNA pseudouridine synthesis(GO:0031120) |
| 0.2 |
0.2 |
GO:2000504 |
positive regulation of blood vessel remodeling(GO:2000504) |
| 0.2 |
0.5 |
GO:0048014 |
Tie signaling pathway(GO:0048014) |
| 0.2 |
0.6 |
GO:0045903 |
positive regulation of translational fidelity(GO:0045903) |
| 0.2 |
0.5 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 0.2 |
0.6 |
GO:0019323 |
pentose catabolic process(GO:0019323) |
| 0.2 |
0.3 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.2 |
0.5 |
GO:0072488 |
ammonium transmembrane transport(GO:0072488) |
| 0.2 |
1.1 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.2 |
0.9 |
GO:0051987 |
positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
| 0.2 |
0.2 |
GO:1905065 |
positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
| 0.2 |
0.8 |
GO:0033499 |
galactose catabolic process via UDP-galactose(GO:0033499) |
| 0.2 |
0.2 |
GO:0045716 |
positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.2 |
0.8 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.1 |
0.9 |
GO:1901979 |
regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.1 |
0.4 |
GO:0072378 |
blood coagulation, fibrin clot formation(GO:0072378) |
| 0.1 |
0.4 |
GO:0001803 |
type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
| 0.1 |
0.3 |
GO:0021913 |
regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.1 |
0.9 |
GO:1904798 |
positive regulation of core promoter binding(GO:1904798) |
| 0.1 |
0.3 |
GO:0090274 |
positive regulation of somatostatin secretion(GO:0090274) |
| 0.1 |
0.9 |
GO:0042776 |
mitochondrial ATP synthesis coupled proton transport(GO:0042776) |
| 0.1 |
0.4 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.1 |
0.6 |
GO:0038145 |
macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.1 |
0.1 |
GO:0072095 |
regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.1 |
0.3 |
GO:0007161 |
calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.1 |
0.7 |
GO:0070171 |
negative regulation of tooth mineralization(GO:0070171) |
| 0.1 |
0.3 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 |
0.7 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.1 |
0.1 |
GO:1905072 |
cardiac jelly development(GO:1905072) |
| 0.1 |
0.8 |
GO:1902255 |
positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
| 0.1 |
0.4 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 0.1 |
0.4 |
GO:0033092 |
positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.1 |
1.6 |
GO:0006120 |
mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 |
0.4 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 |
0.8 |
GO:0072086 |
specification of loop of Henle identity(GO:0072086) |
| 0.1 |
0.4 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 |
0.1 |
GO:0032611 |
interleukin-1 beta production(GO:0032611) |
| 0.1 |
1.7 |
GO:0097067 |
cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 |
0.1 |
GO:2000334 |
blood microparticle formation(GO:0072564) regulation of blood microparticle formation(GO:2000332) positive regulation of blood microparticle formation(GO:2000334) |
| 0.1 |
0.9 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 |
5.5 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 |
0.5 |
GO:0019287 |
isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 |
0.5 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.1 |
0.3 |
GO:0045085 |
negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 |
0.3 |
GO:0006356 |
regulation of transcription from RNA polymerase I promoter(GO:0006356) positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.1 |
0.1 |
GO:0051353 |
positive regulation of oxidoreductase activity(GO:0051353) |
| 0.1 |
1.4 |
GO:0045899 |
positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 |
0.1 |
GO:0010804 |
negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.1 |
0.5 |
GO:0006529 |
asparagine biosynthetic process(GO:0006529) |
| 0.1 |
0.5 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.1 |
0.4 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.1 |
0.4 |
GO:1904578 |
response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.1 |
2.3 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 |
0.2 |
GO:0006977 |
DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
| 0.1 |
0.5 |
GO:0006933 |
negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.1 |
0.6 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.1 |
0.5 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 |
2.8 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.1 |
0.2 |
GO:0034310 |
primary alcohol catabolic process(GO:0034310) |
| 0.1 |
0.1 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 |
0.7 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.1 |
0.1 |
GO:0003278 |
apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.1 |
0.4 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 0.1 |
0.5 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 |
0.7 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.1 |
0.5 |
GO:0070125 |
mitochondrial translational elongation(GO:0070125) |
| 0.1 |
0.6 |
GO:1900170 |
negative regulation of glucocorticoid mediated signaling pathway(GO:1900170) |
| 0.1 |
0.3 |
GO:0070682 |
proteasome regulatory particle assembly(GO:0070682) |
| 0.1 |
0.5 |
GO:0006244 |
pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.1 |
0.9 |
GO:0070474 |
positive regulation of uterine smooth muscle contraction(GO:0070474) |
| 0.1 |
0.1 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.1 |
0.9 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.1 |
0.4 |
GO:0045409 |
negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.1 |
1.2 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.1 |
0.3 |
GO:0003195 |
tricuspid valve formation(GO:0003195) |
| 0.1 |
1.8 |
GO:0021796 |
cerebral cortex regionalization(GO:0021796) |
| 0.1 |
1.4 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
0.6 |
GO:0046689 |
response to mercury ion(GO:0046689) |
| 0.1 |
0.3 |
GO:0071163 |
DNA replication preinitiation complex assembly(GO:0071163) |
| 0.1 |
0.2 |
GO:0009814 |
defense response, incompatible interaction(GO:0009814) |
| 0.1 |
0.3 |
GO:0060242 |
contact inhibition(GO:0060242) |
| 0.1 |
0.4 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.1 |
0.2 |
GO:0045349 |
interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
| 0.1 |
0.7 |
GO:0055118 |
negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.1 |
0.3 |
GO:0097274 |
urea homeostasis(GO:0097274) |
| 0.1 |
0.1 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 0.1 |
0.3 |
GO:0021546 |
rhombomere development(GO:0021546) |
| 0.1 |
0.3 |
GO:0000430 |
regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
| 0.1 |
0.8 |
GO:0042095 |
interferon-gamma biosynthetic process(GO:0042095) |
| 0.1 |
0.3 |
GO:0016115 |
terpenoid catabolic process(GO:0016115) |
| 0.1 |
0.3 |
GO:0051771 |
negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
| 0.1 |
0.2 |
GO:0002578 |
negative regulation of antigen processing and presentation(GO:0002578) |
| 0.1 |
0.3 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 |
0.3 |
GO:0032918 |
polyamine acetylation(GO:0032917) spermidine acetylation(GO:0032918) |
| 0.1 |
0.6 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.1 |
0.1 |
GO:2000489 |
hepatic stellate cell activation(GO:0035733) fibroblast activation(GO:0072537) regulation of hepatic stellate cell activation(GO:2000489) positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.1 |
0.5 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.1 |
0.1 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.1 |
0.3 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 |
0.3 |
GO:0043988 |
histone H3-S28 phosphorylation(GO:0043988) |
| 0.1 |
0.4 |
GO:0043328 |
protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.1 |
0.3 |
GO:2001160 |
regulation of histone H3-K79 methylation(GO:2001160) |
| 0.1 |
0.5 |
GO:2000255 |
negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 |
0.2 |
GO:0060916 |
mesenchymal cell proliferation involved in lung development(GO:0060916) regulation of mesenchymal cell proliferation involved in lung development(GO:2000790) negative regulation of mesenchymal cell proliferation involved in lung development(GO:2000791) |
| 0.1 |
0.5 |
GO:2000774 |
positive regulation of cellular senescence(GO:2000774) |
| 0.1 |
0.6 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.1 |
0.6 |
GO:1990564 |
protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.1 |
0.8 |
GO:0006123 |
mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 |
0.3 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.1 |
0.1 |
GO:0033122 |
regulation of purine nucleotide catabolic process(GO:0033121) negative regulation of purine nucleotide catabolic process(GO:0033122) |
| 0.1 |
0.3 |
GO:0072717 |
cellular response to actinomycin D(GO:0072717) |
| 0.1 |
0.3 |
GO:1904879 |
positive regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1904879) |
| 0.1 |
0.2 |
GO:1904956 |
Wnt signaling pathway involved in somitogenesis(GO:0090244) regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.1 |
0.2 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 |
0.5 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.1 |
0.4 |
GO:0015825 |
L-serine transport(GO:0015825) |
| 0.1 |
0.2 |
GO:0042663 |
regulation of endodermal cell fate specification(GO:0042663) |
| 0.1 |
0.6 |
GO:0034080 |
CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 |
0.1 |
GO:0006059 |
hexitol metabolic process(GO:0006059) inner medullary collecting duct development(GO:0072061) |
| 0.1 |
0.6 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.1 |
0.4 |
GO:0042535 |
positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
| 0.1 |
0.3 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.1 |
0.6 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 0.1 |
0.3 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.1 |
0.7 |
GO:0006122 |
mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.1 |
0.4 |
GO:0000957 |
mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 |
0.2 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 |
0.1 |
GO:0006545 |
glycine biosynthetic process(GO:0006545) |
| 0.1 |
0.4 |
GO:0090086 |
negative regulation of protein deubiquitination(GO:0090086) |
| 0.1 |
0.6 |
GO:0015669 |
gas transport(GO:0015669) carbon dioxide transport(GO:0015670) |
| 0.1 |
0.1 |
GO:0072236 |
metanephric loop of Henle development(GO:0072236) |
| 0.1 |
0.5 |
GO:1903862 |
positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 |
0.3 |
GO:0097089 |
methyl-branched fatty acid metabolic process(GO:0097089) |
| 0.1 |
0.9 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 |
0.2 |
GO:1900109 |
regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.1 |
1.1 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.1 |
0.4 |
GO:0006616 |
SRP-dependent cotranslational protein targeting to membrane, translocation(GO:0006616) |
| 0.1 |
0.4 |
GO:0035948 |
positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.1 |
0.4 |
GO:0006177 |
GMP biosynthetic process(GO:0006177) |
| 0.1 |
0.9 |
GO:0001682 |
tRNA 5'-leader removal(GO:0001682) |
| 0.1 |
0.3 |
GO:0007181 |
transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.1 |
0.2 |
GO:0046878 |
positive regulation of saliva secretion(GO:0046878) |
| 0.1 |
0.4 |
GO:0002457 |
T cell antigen processing and presentation(GO:0002457) |
| 0.1 |
0.6 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.1 |
0.3 |
GO:0006269 |
DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 |
0.1 |
GO:0007127 |
meiosis I(GO:0007127) |
| 0.1 |
0.3 |
GO:0000492 |
box C/D snoRNP assembly(GO:0000492) |
| 0.1 |
0.3 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
0.1 |
GO:0032829 |
regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
| 0.1 |
1.1 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.1 |
1.2 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.1 |
0.3 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 |
0.1 |
GO:0014016 |
neuroblast differentiation(GO:0014016) |
| 0.1 |
0.3 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.1 |
0.4 |
GO:0071688 |
striated muscle myosin thick filament assembly(GO:0071688) |
| 0.1 |
0.1 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 0.1 |
0.3 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.1 |
0.2 |
GO:0009106 |
lipoate metabolic process(GO:0009106) |
| 0.1 |
0.4 |
GO:0080184 |
response to stilbenoid(GO:0035634) response to phenylpropanoid(GO:0080184) |
| 0.1 |
0.2 |
GO:0010757 |
negative regulation of plasminogen activation(GO:0010757) |
| 0.1 |
0.2 |
GO:0070278 |
extracellular matrix constituent secretion(GO:0070278) |
| 0.1 |
0.6 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 |
0.6 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.1 |
0.9 |
GO:2001269 |
positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.1 |
0.4 |
GO:0036151 |
phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.1 |
0.3 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 0.1 |
0.2 |
GO:0002484 |
antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
| 0.1 |
0.1 |
GO:0032753 |
positive regulation of interleukin-4 production(GO:0032753) |
| 0.1 |
0.2 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.1 |
0.1 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.1 |
0.3 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.1 |
1.1 |
GO:0034219 |
carbohydrate transmembrane transport(GO:0034219) |
| 0.1 |
0.1 |
GO:0003134 |
BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) cell-cell signaling involved in cell fate commitment(GO:0045168) |
| 0.1 |
0.1 |
GO:0002925 |
positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.1 |
0.2 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 |
0.8 |
GO:0032876 |
negative regulation of DNA endoreduplication(GO:0032876) |
| 0.1 |
4.7 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.1 |
0.2 |
GO:0007171 |
activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 |
0.5 |
GO:0060334 |
regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.1 |
0.3 |
GO:0002481 |
antigen processing and presentation of exogenous peptide antigen via MHC class Ib(GO:0002477) antigen processing and presentation of exogenous protein antigen via MHC class Ib, TAP-dependent(GO:0002481) |
| 0.1 |
0.9 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
0.2 |
GO:1904139 |
microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.1 |
0.3 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.1 |
0.2 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.1 |
0.2 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.1 |
0.2 |
GO:0032275 |
luteinizing hormone secretion(GO:0032275) |
| 0.1 |
0.3 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.1 |
0.3 |
GO:0090282 |
trophectodermal cell proliferation(GO:0001834) positive regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071931) positive regulation of transcription involved in G2/M transition of mitotic cell cycle(GO:0090282) |
| 0.1 |
0.4 |
GO:0042976 |
activation of Janus kinase activity(GO:0042976) |
| 0.1 |
0.5 |
GO:0009162 |
deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.1 |
0.2 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.1 |
0.5 |
GO:0031145 |
anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 |
0.5 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 |
0.1 |
GO:0033030 |
negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.1 |
0.4 |
GO:0019659 |
fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.1 |
0.3 |
GO:0006788 |
heme oxidation(GO:0006788) |
| 0.1 |
0.3 |
GO:0046013 |
T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.1 |
0.2 |
GO:0019184 |
nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.1 |
0.2 |
GO:0002309 |
T cell proliferation involved in immune response(GO:0002309) |
| 0.1 |
0.4 |
GO:0008354 |
germ cell migration(GO:0008354) |
| 0.1 |
1.2 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.1 |
0.5 |
GO:1901970 |
positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.1 |
0.2 |
GO:0006027 |
glycosaminoglycan catabolic process(GO:0006027) |
| 0.1 |
0.1 |
GO:1902730 |
positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 |
0.5 |
GO:0033129 |
positive regulation of histone phosphorylation(GO:0033129) |
| 0.1 |
0.1 |
GO:0033561 |
regulation of water loss via skin(GO:0033561) |
| 0.1 |
0.9 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.1 |
0.8 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.1 |
0.2 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 |
0.4 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 |
0.4 |
GO:0000467 |
exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) tRNA catabolic process(GO:0016078) nuclear polyadenylation-dependent tRNA catabolic process(GO:0071038) |
| 0.1 |
0.1 |
GO:0061051 |
positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.1 |
0.1 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.1 |
0.2 |
GO:1904207 |
chemokine (C-C motif) ligand 2 secretion(GO:0035926) regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904207) positive regulation of chemokine (C-C motif) ligand 2 secretion(GO:1904209) |
| 0.1 |
0.3 |
GO:0044036 |
cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
| 0.1 |
0.6 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 |
0.1 |
GO:0032241 |
positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.1 |
0.3 |
GO:0045915 |
positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.1 |
0.4 |
GO:0000237 |
leptotene(GO:0000237) |
| 0.1 |
0.4 |
GO:2001244 |
positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
| 0.1 |
0.2 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 |
0.2 |
GO:0060018 |
astrocyte fate commitment(GO:0060018) |
| 0.1 |
0.2 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.1 |
3.9 |
GO:0032543 |
mitochondrial translation(GO:0032543) |
| 0.1 |
0.1 |
GO:0097029 |
mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 |
0.9 |
GO:0046485 |
ether lipid metabolic process(GO:0046485) |
| 0.1 |
0.6 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.1 |
1.2 |
GO:0042832 |
defense response to protozoan(GO:0042832) |
| 0.1 |
0.2 |
GO:0051311 |
meiotic metaphase plate congression(GO:0051311) |
| 0.1 |
0.1 |
GO:0010831 |
positive regulation of myotube differentiation(GO:0010831) |
| 0.1 |
0.4 |
GO:0043144 |
snoRNA processing(GO:0043144) |
| 0.1 |
0.2 |
GO:2000484 |
positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.1 |
1.1 |
GO:0051482 |
positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.1 |
0.1 |
GO:0002865 |
negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
| 0.1 |
0.4 |
GO:0045163 |
clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 |
0.2 |
GO:2000768 |
positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) positive regulation of nephron tubule epithelial cell differentiation(GO:2000768) |
| 0.1 |
0.2 |
GO:0051754 |
meiotic sister chromatid cohesion, centromeric(GO:0051754) |
| 0.1 |
0.1 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 |
0.3 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 0.1 |
1.0 |
GO:0042775 |
mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.1 |
0.2 |
GO:0030070 |
insulin processing(GO:0030070) |
| 0.1 |
0.4 |
GO:0007021 |
tubulin complex assembly(GO:0007021) |
| 0.1 |
0.2 |
GO:0061744 |
motor behavior(GO:0061744) |
| 0.1 |
0.1 |
GO:0002922 |
positive regulation of humoral immune response(GO:0002922) |
| 0.1 |
0.2 |
GO:2000314 |
negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.1 |
0.1 |
GO:0060266 |
regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.1 |
0.2 |
GO:0006662 |
glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
| 0.1 |
0.3 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 |
0.6 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.1 |
0.1 |
GO:0003104 |
positive regulation of glomerular filtration(GO:0003104) |
| 0.1 |
0.2 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.1 |
0.5 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 |
0.2 |
GO:2000195 |
negative regulation of female gonad development(GO:2000195) |
| 0.1 |
0.1 |
GO:0034137 |
positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.1 |
0.8 |
GO:2000172 |
regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.1 |
1.9 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.1 |
0.3 |
GO:0033632 |
regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.1 |
0.2 |
GO:0032621 |
interleukin-18 production(GO:0032621) |
| 0.1 |
2.3 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.1 |
0.2 |
GO:0002331 |
pre-B cell allelic exclusion(GO:0002331) |
| 0.1 |
0.2 |
GO:1901536 |
regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.1 |
0.3 |
GO:0061325 |
extraocular skeletal muscle development(GO:0002074) subthalamus development(GO:0021539) subthalamic nucleus development(GO:0021763) left lung development(GO:0060459) left lung morphogenesis(GO:0060460) pulmonary vein morphogenesis(GO:0060577) superior vena cava morphogenesis(GO:0060578) cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
| 0.1 |
0.2 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.1 |
0.1 |
GO:0034982 |
mitochondrial protein processing(GO:0034982) |
| 0.1 |
0.1 |
GO:0071351 |
interleukin-18-mediated signaling pathway(GO:0035655) cellular response to interleukin-18(GO:0071351) |
| 0.1 |
0.3 |
GO:1902626 |
assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.1 |
0.5 |
GO:0003433 |
chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.1 |
0.3 |
GO:0042640 |
anagen(GO:0042640) |
| 0.1 |
0.3 |
GO:1904627 |
response to phorbol 13-acetate 12-myristate(GO:1904627) cellular response to phorbol 13-acetate 12-myristate(GO:1904628) |
| 0.1 |
0.3 |
GO:1901526 |
positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.1 |
0.6 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.1 |
0.2 |
GO:0045920 |
negative regulation of exocytosis(GO:0045920) |
| 0.1 |
0.7 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 |
0.3 |
GO:0045292 |
mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 |
0.1 |
GO:0071707 |
immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 0.1 |
0.2 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.1 |
0.1 |
GO:0010940 |
positive regulation of necrotic cell death(GO:0010940) |
| 0.1 |
0.1 |
GO:0045650 |
negative regulation of macrophage differentiation(GO:0045650) |
| 0.1 |
0.3 |
GO:0007320 |
insemination(GO:0007320) |
| 0.1 |
0.1 |
GO:1902219 |
negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
| 0.1 |
0.3 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 |
0.1 |
GO:0032472 |
Golgi calcium ion transport(GO:0032472) |
| 0.1 |
0.4 |
GO:0032929 |
negative regulation of superoxide anion generation(GO:0032929) |
| 0.1 |
0.2 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.1 |
0.4 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 |
0.2 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.1 |
0.1 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.1 |
0.2 |
GO:0032747 |
positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 |
0.2 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.1 |
0.2 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 0.1 |
0.5 |
GO:0070236 |
negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 |
0.1 |
GO:2000659 |
regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.1 |
0.2 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.1 |
0.6 |
GO:0043046 |
DNA methylation involved in gamete generation(GO:0043046) |
| 0.1 |
0.1 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 |
1.1 |
GO:0070816 |
phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 |
0.1 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.1 |
0.1 |
GO:1901252 |
regulation of intracellular transport of viral material(GO:1901252) |
| 0.1 |
0.4 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.1 |
0.1 |
GO:0042573 |
retinoic acid metabolic process(GO:0042573) |
| 0.1 |
1.0 |
GO:0019731 |
antibacterial humoral response(GO:0019731) |
| 0.1 |
0.1 |
GO:1902455 |
negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 |
0.2 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.1 |
0.3 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.1 |
0.4 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.1 |
0.3 |
GO:0003417 |
growth plate cartilage development(GO:0003417) |
| 0.1 |
0.2 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 |
0.3 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.1 |
0.2 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.1 |
0.5 |
GO:0061158 |
3'-UTR-mediated mRNA destabilization(GO:0061158) |
| 0.1 |
0.1 |
GO:2000501 |
natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
| 0.1 |
1.3 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.1 |
0.4 |
GO:0032049 |
cardiolipin biosynthetic process(GO:0032049) |
| 0.1 |
1.0 |
GO:0030213 |
hyaluronan biosynthetic process(GO:0030213) |
| 0.1 |
0.2 |
GO:0032914 |
positive regulation of transforming growth factor beta1 production(GO:0032914) |
| 0.1 |
0.3 |
GO:2000288 |
positive regulation of myoblast proliferation(GO:2000288) |
| 0.1 |
0.1 |
GO:0010958 |
regulation of amino acid import(GO:0010958) |
| 0.1 |
0.1 |
GO:0000096 |
sulfur amino acid metabolic process(GO:0000096) sulfur compound catabolic process(GO:0044273) |
| 0.1 |
0.2 |
GO:0045648 |
positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.1 |
0.1 |
GO:0060056 |
mammary gland involution(GO:0060056) |
| 0.1 |
0.2 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.1 |
0.1 |
GO:0060696 |
regulation of phospholipid catabolic process(GO:0060696) |
| 0.1 |
0.5 |
GO:0098700 |
neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.1 |
2.0 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.1 |
0.1 |
GO:0098886 |
modification of dendritic spine(GO:0098886) |
| 0.1 |
0.2 |
GO:0006532 |
aspartate biosynthetic process(GO:0006532) |
| 0.1 |
0.1 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.1 |
0.4 |
GO:0071493 |
cellular response to UV-B(GO:0071493) |
| 0.1 |
0.3 |
GO:2001199 |
negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 |
0.2 |
GO:0071500 |
cellular response to nitrosative stress(GO:0071500) |
| 0.1 |
0.2 |
GO:0042758 |
long-chain fatty acid catabolic process(GO:0042758) |
| 0.1 |
0.1 |
GO:0002572 |
pro-T cell differentiation(GO:0002572) |
| 0.1 |
0.3 |
GO:0036337 |
Fas signaling pathway(GO:0036337) |
| 0.1 |
0.4 |
GO:0006614 |
SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.1 |
0.3 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.1 |
0.3 |
GO:1901164 |
negative regulation of trophoblast cell migration(GO:1901164) |
| 0.1 |
0.2 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.1 |
0.5 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 |
0.4 |
GO:0002523 |
leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.1 |
0.3 |
GO:0033089 |
positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
| 0.1 |
0.1 |
GO:0051572 |
negative regulation of histone H3-K4 methylation(GO:0051572) |
| 0.1 |
0.3 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.1 |
0.4 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.1 |
0.4 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.1 |
0.1 |
GO:0070203 |
regulation of establishment of protein localization to telomere(GO:0070203) positive regulation of establishment of protein localization to telomere(GO:1904851) |
| 0.1 |
0.3 |
GO:0001711 |
endodermal cell fate commitment(GO:0001711) |
| 0.1 |
0.6 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.1 |
0.1 |
GO:0042256 |
mature ribosome assembly(GO:0042256) |
| 0.1 |
0.4 |
GO:2000601 |
positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.1 |
1.1 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.1 |
0.3 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.1 |
0.2 |
GO:0002940 |
tRNA N2-guanine methylation(GO:0002940) |
| 0.1 |
0.3 |
GO:0060736 |
prostate gland growth(GO:0060736) |
| 0.1 |
0.2 |
GO:0070093 |
negative regulation of glucagon secretion(GO:0070093) |
| 0.1 |
0.3 |
GO:0021914 |
negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 |
0.2 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.1 |
0.5 |
GO:0030049 |
muscle filament sliding(GO:0030049) |
| 0.1 |
0.2 |
GO:0070973 |
protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 |
0.6 |
GO:0048873 |
homeostasis of number of cells within a tissue(GO:0048873) |
| 0.1 |
0.1 |
GO:0002538 |
arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.1 |
0.2 |
GO:0051715 |
cytolysis in other organism(GO:0051715) |
| 0.1 |
0.1 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.1 |
0.2 |
GO:0009826 |
unidimensional cell growth(GO:0009826) |
| 0.1 |
0.3 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.1 |
0.2 |
GO:1904238 |
pericyte cell differentiation(GO:1904238) |
| 0.0 |
0.0 |
GO:0010700 |
negative regulation of norepinephrine secretion(GO:0010700) |
| 0.0 |
0.1 |
GO:0071638 |
negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
| 0.0 |
0.1 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.0 |
0.1 |
GO:0019370 |
leukotriene biosynthetic process(GO:0019370) |
| 0.0 |
1.1 |
GO:0000027 |
ribosomal large subunit assembly(GO:0000027) |
| 0.0 |
0.3 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.0 |
0.3 |
GO:0006363 |
termination of RNA polymerase I transcription(GO:0006363) |
| 0.0 |
0.9 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.0 |
0.1 |
GO:0003340 |
negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.0 |
0.0 |
GO:0046101 |
hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.0 |
0.1 |
GO:0072734 |
response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
| 0.0 |
0.1 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.0 |
0.0 |
GO:0060231 |
mesenchymal to epithelial transition(GO:0060231) |
| 0.0 |
0.2 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 |
0.4 |
GO:0033194 |
response to hydroperoxide(GO:0033194) |
| 0.0 |
0.1 |
GO:0071673 |
positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.0 |
0.3 |
GO:0017196 |
N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 |
0.0 |
GO:0045110 |
intermediate filament bundle assembly(GO:0045110) |
| 0.0 |
0.8 |
GO:0031987 |
locomotion involved in locomotory behavior(GO:0031987) |
| 0.0 |
0.4 |
GO:0060732 |
positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.0 |
0.2 |
GO:1901837 |
negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
| 0.0 |
0.1 |
GO:0051152 |
positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.0 |
0.7 |
GO:0035563 |
positive regulation of chromatin binding(GO:0035563) |
| 0.0 |
0.1 |
GO:1903588 |
negative regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903588) |
| 0.0 |
0.2 |
GO:0070243 |
regulation of thymocyte apoptotic process(GO:0070243) |
| 0.0 |
0.2 |
GO:0032439 |
endosome localization(GO:0032439) |
| 0.0 |
1.1 |
GO:0043029 |
T cell homeostasis(GO:0043029) |
| 0.0 |
0.3 |
GO:0018195 |
peptidyl-arginine modification(GO:0018195) |
| 0.0 |
0.2 |
GO:1902583 |
viral mRNA export from host cell nucleus(GO:0046784) intracellular transport of virus(GO:0075733) multi-organism intracellular transport(GO:1902583) |
| 0.0 |
0.4 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.0 |
0.3 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.0 |
0.1 |
GO:0034242 |
negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.0 |
0.3 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 0.0 |
0.1 |
GO:2001245 |
regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.0 |
0.0 |
GO:0000389 |
mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 |
0.2 |
GO:2000679 |
positive regulation of transcription regulatory region DNA binding(GO:2000679) |
| 0.0 |
0.1 |
GO:0016114 |
terpenoid biosynthetic process(GO:0016114) |
| 0.0 |
0.2 |
GO:0060467 |
negative regulation of fertilization(GO:0060467) |
| 0.0 |
0.3 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.0 |
0.2 |
GO:2000065 |
negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) dense core granule biogenesis(GO:0061110) negative regulation of cortisol biosynthetic process(GO:2000065) regulation of dense core granule biogenesis(GO:2000705) |
| 0.0 |
0.5 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.0 |
0.3 |
GO:0006012 |
galactose metabolic process(GO:0006012) |
| 0.0 |
2.4 |
GO:0006749 |
glutathione metabolic process(GO:0006749) |
| 0.0 |
0.0 |
GO:1903244 |
positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
| 0.0 |
0.1 |
GO:0042985 |
negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 |
0.2 |
GO:0042905 |
9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.0 |
0.0 |
GO:0090024 |
negative regulation of granulocyte chemotaxis(GO:0071623) negative regulation of neutrophil chemotaxis(GO:0090024) negative regulation of neutrophil migration(GO:1902623) |
| 0.0 |
0.4 |
GO:0010739 |
positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 |
0.3 |
GO:0008631 |
intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
| 0.0 |
0.1 |
GO:0045654 |
positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 |
1.2 |
GO:0000413 |
protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 |
0.7 |
GO:0000578 |
embryonic axis specification(GO:0000578) |
| 0.0 |
0.3 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 |
0.4 |
GO:0000054 |
ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.0 |
0.1 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.0 |
0.1 |
GO:0006553 |
lysine metabolic process(GO:0006553) |
| 0.0 |
0.1 |
GO:0008612 |
peptidyl-lysine modification to peptidyl-hypusine(GO:0008612) |
| 0.0 |
0.6 |
GO:0035115 |
embryonic forelimb morphogenesis(GO:0035115) |
| 0.0 |
0.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 |
0.6 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.0 |
0.1 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.0 |
0.6 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.0 |
0.1 |
GO:1901642 |
purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
| 0.0 |
0.1 |
GO:0003214 |
cardiac left ventricle morphogenesis(GO:0003214) |
| 0.0 |
0.5 |
GO:0043486 |
histone exchange(GO:0043486) |
| 0.0 |
0.4 |
GO:0042104 |
positive regulation of activated T cell proliferation(GO:0042104) |
| 0.0 |
0.3 |
GO:0043970 |
histone H3-K9 acetylation(GO:0043970) |
| 0.0 |
0.3 |
GO:0090230 |
regulation of centromere complex assembly(GO:0090230) |
| 0.0 |
0.1 |
GO:0060594 |
mammary gland specification(GO:0060594) |
| 0.0 |
0.2 |
GO:0006384 |
transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 |
2.1 |
GO:0035082 |
axoneme assembly(GO:0035082) |
| 0.0 |
0.1 |
GO:0043461 |
proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 |
0.4 |
GO:0046643 |
regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 |
0.2 |
GO:0070234 |
positive regulation of T cell apoptotic process(GO:0070234) |
| 0.0 |
0.1 |
GO:1903026 |
negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.0 |
0.1 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.0 |
0.5 |
GO:0033210 |
leptin-mediated signaling pathway(GO:0033210) |
| 0.0 |
0.3 |
GO:0006627 |
protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 |
0.2 |
GO:0098706 |
ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
| 0.0 |
0.0 |
GO:0044351 |
macropinocytosis(GO:0044351) |
| 0.0 |
0.7 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.0 |
0.0 |
GO:0019244 |
lactate biosynthetic process from pyruvate(GO:0019244) |
| 0.0 |
0.0 |
GO:0072191 |
ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
| 0.0 |
0.2 |
GO:0035021 |
negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 |
0.1 |
GO:0033574 |
response to testosterone(GO:0033574) |
| 0.0 |
0.1 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.0 |
0.3 |
GO:0019886 |
antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.0 |
0.2 |
GO:0045059 |
positive thymic T cell selection(GO:0045059) |
| 0.0 |
0.1 |
GO:0070086 |
ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 |
0.6 |
GO:0002052 |
positive regulation of neuroblast proliferation(GO:0002052) |
| 0.0 |
0.1 |
GO:0010919 |
regulation of inositol phosphate biosynthetic process(GO:0010919) |
| 0.0 |
0.1 |
GO:0040037 |
negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.0 |
0.2 |
GO:0042373 |
vitamin K metabolic process(GO:0042373) |
| 0.0 |
0.2 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.0 |
0.2 |
GO:0052548 |
regulation of endopeptidase activity(GO:0052548) |
| 0.0 |
0.1 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.0 |
0.0 |
GO:0001562 |
response to protozoan(GO:0001562) |
| 0.0 |
0.1 |
GO:0015772 |
disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 |
0.5 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.0 |
0.1 |
GO:0048521 |
negative regulation of behavior(GO:0048521) |
| 0.0 |
0.2 |
GO:1901029 |
negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.0 |
0.1 |
GO:0033762 |
response to glucagon(GO:0033762) |
| 0.0 |
0.1 |
GO:1903070 |
negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.0 |
0.1 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.0 |
0.7 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.0 |
0.3 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.0 |
0.6 |
GO:0044243 |
multicellular organism catabolic process(GO:0044243) |
| 0.0 |
0.2 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.0 |
0.2 |
GO:0032346 |
positive regulation of aldosterone metabolic process(GO:0032346) regulation of aldosterone biosynthetic process(GO:0032347) positive regulation of aldosterone biosynthetic process(GO:0032349) |
| 0.0 |
0.0 |
GO:0070601 |
centromeric sister chromatid cohesion(GO:0070601) |
| 0.0 |
0.1 |
GO:0060586 |
multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.0 |
0.1 |
GO:0051309 |
female meiosis chromosome separation(GO:0051309) |
| 0.0 |
0.1 |
GO:0050904 |
diapedesis(GO:0050904) |
| 0.0 |
0.3 |
GO:0043568 |
positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 |
0.1 |
GO:0035964 |
COPI-coated vesicle budding(GO:0035964) |
| 0.0 |
0.0 |
GO:0061032 |
visceral serous pericardium development(GO:0061032) |
| 0.0 |
0.1 |
GO:0097500 |
receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 |
0.1 |
GO:0060750 |
epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) branch elongation involved in mammary gland duct branching(GO:0060751) |
| 0.0 |
0.8 |
GO:0061014 |
positive regulation of mRNA catabolic process(GO:0061014) |
| 0.0 |
0.1 |
GO:0042474 |
middle ear morphogenesis(GO:0042474) |
| 0.0 |
0.1 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.0 |
0.7 |
GO:0006910 |
phagocytosis, recognition(GO:0006910) |
| 0.0 |
0.1 |
GO:0042773 |
ATP synthesis coupled electron transport(GO:0042773) |
| 0.0 |
0.1 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.0 |
0.0 |
GO:0051204 |
protein insertion into mitochondrial membrane(GO:0051204) |
| 0.0 |
0.1 |
GO:1902224 |
cellular ketone body metabolic process(GO:0046950) ketone body metabolic process(GO:1902224) |
| 0.0 |
0.1 |
GO:0010512 |
negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.0 |
0.1 |
GO:0071677 |
positive regulation of mononuclear cell migration(GO:0071677) |
| 0.0 |
0.0 |
GO:0060700 |
regulation of ribonuclease activity(GO:0060700) |
| 0.0 |
0.0 |
GO:0060160 |
negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.0 |
0.1 |
GO:0002002 |
regulation of systemic arterial blood pressure by circulatory renin-angiotensin(GO:0001991) regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
| 0.0 |
0.3 |
GO:0031274 |
positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 |
0.2 |
GO:0040032 |
post-embryonic body morphogenesis(GO:0040032) hair follicle placode formation(GO:0060789) |
| 0.0 |
0.1 |
GO:1904046 |
negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.0 |
0.1 |
GO:0051712 |
positive regulation of killing of cells of other organism(GO:0051712) |
| 0.0 |
0.7 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 |
0.2 |
GO:0001821 |
histamine secretion(GO:0001821) histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.0 |
0.1 |
GO:0070863 |
positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 |
0.4 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 |
0.1 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 |
0.1 |
GO:0042167 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 |
0.1 |
GO:0010992 |
ubiquitin homeostasis(GO:0010992) |
| 0.0 |
0.1 |
GO:0033580 |
protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
| 0.0 |
0.1 |
GO:0045627 |
positive regulation of T-helper 1 cell differentiation(GO:0045627) |
| 0.0 |
0.1 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.0 |
0.1 |
GO:0045779 |
negative regulation of bone resorption(GO:0045779) |
| 0.0 |
0.0 |
GO:0045876 |
positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.0 |
0.1 |
GO:0019695 |
choline metabolic process(GO:0019695) |
| 0.0 |
0.2 |
GO:0007197 |
adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 |
0.5 |
GO:2000816 |
negative regulation of mitotic sister chromatid separation(GO:2000816) |
| 0.0 |
0.2 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.0 |
0.1 |
GO:0072382 |
minus-end-directed vesicle transport along microtubule(GO:0072382) |
| 0.0 |
0.1 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.0 |
0.2 |
GO:0060346 |
bone trabecula formation(GO:0060346) |
| 0.0 |
0.3 |
GO:0032927 |
positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 |
0.1 |
GO:0010324 |
membrane invagination(GO:0010324) |
| 0.0 |
0.2 |
GO:0036444 |
calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 |
0.0 |
GO:0031660 |
regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
| 0.0 |
0.2 |
GO:0045792 |
negative regulation of cell size(GO:0045792) |
| 0.0 |
0.2 |
GO:0098734 |
protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 |
0.1 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.0 |
0.3 |
GO:0051255 |
spindle midzone assembly(GO:0051255) mitotic spindle midzone assembly(GO:0051256) |
| 0.0 |
0.1 |
GO:0046032 |
ADP catabolic process(GO:0046032) |
| 0.0 |
0.2 |
GO:0072526 |
pyridine-containing compound catabolic process(GO:0072526) |
| 0.0 |
0.1 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.0 |
0.1 |
GO:0072126 |
positive regulation of glomerular mesangial cell proliferation(GO:0072126) |
| 0.0 |
0.1 |
GO:0071459 |
protein localization to kinetochore(GO:0034501) protein localization to chromosome, centromeric region(GO:0071459) |
| 0.0 |
0.4 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 0.0 |
0.0 |
GO:1990379 |
lipid transport across blood brain barrier(GO:1990379) |
| 0.0 |
0.3 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.0 |
0.1 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.0 |
0.2 |
GO:0090179 |
planar cell polarity pathway involved in neural tube closure(GO:0090179) |
| 0.0 |
0.0 |
GO:0002423 |
natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002420) natural killer cell mediated immune response to tumor cell(GO:0002423) regulation of natural killer cell mediated immune response to tumor cell(GO:0002855) regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002858) |
| 0.0 |
0.3 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.0 |
0.2 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.0 |
0.2 |
GO:1990845 |
adaptive thermogenesis(GO:1990845) |
| 0.0 |
0.1 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 |
0.1 |
GO:0038128 |
ERBB2 signaling pathway(GO:0038128) |
| 0.0 |
0.3 |
GO:0070935 |
3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 |
0.3 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 |
0.3 |
GO:0015865 |
purine nucleotide transport(GO:0015865) |
| 0.0 |
0.1 |
GO:0070536 |
protein K63-linked deubiquitination(GO:0070536) |
| 0.0 |
0.1 |
GO:0070200 |
establishment of protein localization to telomere(GO:0070200) |
| 0.0 |
0.1 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.0 |
0.2 |
GO:0031424 |
keratinization(GO:0031424) |
| 0.0 |
0.1 |
GO:0046341 |
CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 |
0.2 |
GO:0007512 |
adult heart development(GO:0007512) |
| 0.0 |
0.1 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.0 |
0.1 |
GO:0051026 |
chiasma assembly(GO:0051026) |
| 0.0 |
0.1 |
GO:0001978 |
regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.0 |
0.1 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.0 |
0.1 |
GO:0031133 |
regulation of axon diameter(GO:0031133) |
| 0.0 |
0.7 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 |
0.1 |
GO:0090204 |
protein localization to nuclear pore(GO:0090204) positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.0 |
0.3 |
GO:1901739 |
regulation of myoblast fusion(GO:1901739) positive regulation of myoblast fusion(GO:1901741) |
| 0.0 |
0.1 |
GO:0072677 |
eosinophil chemotaxis(GO:0048245) eosinophil migration(GO:0072677) |
| 0.0 |
0.1 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.0 |
0.1 |
GO:0001731 |
formation of translation preinitiation complex(GO:0001731) |
| 0.0 |
0.1 |
GO:0035881 |
amacrine cell differentiation(GO:0035881) |
| 0.0 |
0.1 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 |
0.1 |
GO:0019043 |
establishment of viral latency(GO:0019043) |
| 0.0 |
0.2 |
GO:0035814 |
negative regulation of renal sodium excretion(GO:0035814) |
| 0.0 |
0.2 |
GO:0006003 |
fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 |
0.1 |
GO:0042275 |
error-free postreplication DNA repair(GO:0042275) |
| 0.0 |
0.3 |
GO:0001765 |
membrane raft assembly(GO:0001765) |
| 0.0 |
0.4 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.0 |
0.1 |
GO:0090070 |
positive regulation of ribosome biogenesis(GO:0090070) positive regulation of rRNA processing(GO:2000234) |
| 0.0 |
0.1 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.0 |
0.1 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.0 |
0.1 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.0 |
0.1 |
GO:0090400 |
stress-induced premature senescence(GO:0090400) |
| 0.0 |
0.1 |
GO:0090285 |
negative regulation of protein glycosylation in Golgi(GO:0090285) |
| 0.0 |
0.1 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 0.0 |
0.1 |
GO:1902165 |
regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902165) |
| 0.0 |
0.1 |
GO:0006930 |
substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 |
0.6 |
GO:0046827 |
positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 |
0.2 |
GO:0090136 |
epithelial cell-cell adhesion(GO:0090136) |
| 0.0 |
0.4 |
GO:0097435 |
fibril organization(GO:0097435) |
| 0.0 |
0.1 |
GO:0036344 |
platelet morphogenesis(GO:0036344) |
| 0.0 |
0.1 |
GO:0051490 |
negative regulation of filopodium assembly(GO:0051490) |
| 0.0 |
0.1 |
GO:0006780 |
uroporphyrinogen III biosynthetic process(GO:0006780) |
| 0.0 |
0.1 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.0 |
0.0 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.0 |
0.2 |
GO:0019884 |
antigen processing and presentation of exogenous antigen(GO:0019884) |
| 0.0 |
0.0 |
GO:0006026 |
aminoglycan catabolic process(GO:0006026) |
| 0.0 |
0.0 |
GO:0015747 |
urate transport(GO:0015747) |
| 0.0 |
0.1 |
GO:1901724 |
positive regulation of cell proliferation involved in kidney development(GO:1901724) |
| 0.0 |
0.1 |
GO:0032695 |
negative regulation of interleukin-12 production(GO:0032695) |
| 0.0 |
0.1 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 |
0.0 |
GO:1990414 |
replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.0 |
0.5 |
GO:0050830 |
defense response to Gram-positive bacterium(GO:0050830) |
| 0.0 |
0.1 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.0 |
0.2 |
GO:0051967 |
negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 |
0.1 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 |
0.2 |
GO:0006957 |
complement activation, alternative pathway(GO:0006957) |
| 0.0 |
0.2 |
GO:0042759 |
long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.0 |
0.1 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 |
0.1 |
GO:2000676 |
positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 |
0.1 |
GO:0098974 |
postsynaptic actin cytoskeleton organization(GO:0098974) |
| 0.0 |
0.1 |
GO:0048630 |
skeletal muscle tissue growth(GO:0048630) |
| 0.0 |
0.1 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.0 |
0.1 |
GO:0006361 |
transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.0 |
0.1 |
GO:0002544 |
chronic inflammatory response(GO:0002544) |
| 0.0 |
0.6 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 |
0.2 |
GO:0003351 |
epithelial cilium movement(GO:0003351) |
| 0.0 |
0.1 |
GO:0010796 |
regulation of multivesicular body size(GO:0010796) |
| 0.0 |
0.1 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.0 |
0.2 |
GO:0015961 |
diadenosine polyphosphate catabolic process(GO:0015961) |
| 0.0 |
0.1 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.0 |
0.1 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.0 |
0.1 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.0 |
0.1 |
GO:0006706 |
steroid catabolic process(GO:0006706) |
| 0.0 |
0.0 |
GO:0031272 |
regulation of pseudopodium assembly(GO:0031272) |
| 0.0 |
0.1 |
GO:1900864 |
mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 |
0.1 |
GO:0015786 |
UDP-glucose transport(GO:0015786) protein O-linked fucosylation(GO:0036066) |
| 0.0 |
0.1 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.0 |
0.3 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 |
0.1 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.0 |
0.1 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 |
0.2 |
GO:0030212 |
hyaluronan metabolic process(GO:0030212) |
| 0.0 |
0.1 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.0 |
0.1 |
GO:0097476 |
spinal cord motor neuron migration(GO:0097476) |
| 0.0 |
0.0 |
GO:0060681 |
branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.0 |
0.1 |
GO:0018364 |
peptidyl-glutamine methylation(GO:0018364) rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.0 |
0.1 |
GO:0033004 |
negative regulation of mast cell activation(GO:0033004) |
| 0.0 |
0.3 |
GO:0031573 |
intra-S DNA damage checkpoint(GO:0031573) |
| 0.0 |
0.1 |
GO:1904491 |
protein localization to ciliary transition zone(GO:1904491) |
| 0.0 |
0.1 |
GO:0018206 |
peptidyl-methionine modification(GO:0018206) |
| 0.0 |
0.1 |
GO:0045109 |
intermediate filament organization(GO:0045109) |
| 0.0 |
0.1 |
GO:0006450 |
regulation of translational fidelity(GO:0006450) |
| 0.0 |
0.0 |
GO:0021764 |
amygdala development(GO:0021764) |
| 0.0 |
0.0 |
GO:0032095 |
regulation of response to food(GO:0032095) negative regulation of response to food(GO:0032096) negative regulation of appetite(GO:0032099) |
| 0.0 |
0.1 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.0 |
0.0 |
GO:0051852 |
disruption by host of symbiont cells(GO:0051852) killing by host of symbiont cells(GO:0051873) |
| 0.0 |
0.0 |
GO:0035928 |
RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
| 0.0 |
0.1 |
GO:0048853 |
forebrain morphogenesis(GO:0048853) |
| 0.0 |
0.1 |
GO:0006730 |
one-carbon metabolic process(GO:0006730) |
| 0.0 |
0.0 |
GO:1903630 |
regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) |
| 0.0 |
0.1 |
GO:0002318 |
myeloid progenitor cell differentiation(GO:0002318) |
| 0.0 |
0.1 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.0 |
0.1 |
GO:0071624 |
positive regulation of granulocyte chemotaxis(GO:0071624) positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.0 |
0.0 |
GO:0072070 |
loop of Henle development(GO:0072070) |
| 0.0 |
0.1 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.0 |
0.1 |
GO:1990022 |
RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 |
0.3 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.0 |
0.1 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.0 |
0.6 |
GO:0000462 |
maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.0 |
0.3 |
GO:0071542 |
dopaminergic neuron differentiation(GO:0071542) |
| 0.0 |
0.4 |
GO:0007035 |
vacuolar acidification(GO:0007035) |
| 0.0 |
0.1 |
GO:0036112 |
medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.0 |
0.1 |
GO:0060261 |
positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.0 |
0.0 |
GO:0015936 |
coenzyme A metabolic process(GO:0015936) |
| 0.0 |
0.3 |
GO:0042994 |
cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.0 |
0.1 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 |
0.1 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.0 |
0.0 |
GO:1904429 |
t-circle formation(GO:0090656) regulation of t-circle formation(GO:1904429) positive regulation of t-circle formation(GO:1904431) |
| 0.0 |
0.1 |
GO:0019227 |
neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 |
0.1 |
GO:0006564 |
L-serine biosynthetic process(GO:0006564) |
| 0.0 |
0.2 |
GO:0034390 |
smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
| 0.0 |
0.0 |
GO:1904170 |
regulation of bleb assembly(GO:1904170) |
| 0.0 |
0.1 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 0.0 |
0.0 |
GO:1903546 |
protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 |
0.1 |
GO:0002934 |
desmosome organization(GO:0002934) |
| 0.0 |
0.0 |
GO:0008300 |
isoprenoid catabolic process(GO:0008300) |
| 0.0 |
0.0 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.0 |
0.0 |
GO:0019395 |
fatty acid oxidation(GO:0019395) |
| 0.0 |
0.0 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 |
0.1 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.0 |
0.1 |
GO:0007100 |
mitotic centrosome separation(GO:0007100) |
| 0.0 |
0.0 |
GO:0070231 |
T cell apoptotic process(GO:0070231) |
| 0.0 |
0.4 |
GO:0071466 |
cellular response to xenobiotic stimulus(GO:0071466) |
| 0.0 |
0.1 |
GO:1902732 |
positive regulation of chondrocyte proliferation(GO:1902732) |
| 0.0 |
0.1 |
GO:0006851 |
mitochondrial calcium ion transport(GO:0006851) |
| 0.0 |
0.0 |
GO:1902031 |
regulation of NADP metabolic process(GO:1902031) |
| 0.0 |
0.1 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 |
0.1 |
GO:0031666 |
positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 |
0.1 |
GO:0042126 |
nitrate metabolic process(GO:0042126) |
| 0.0 |
0.1 |
GO:0050651 |
dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
| 0.0 |
0.0 |
GO:0002741 |
positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.0 |
0.1 |
GO:0034316 |
negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
| 0.0 |
0.1 |
GO:0060710 |
chorio-allantoic fusion(GO:0060710) |
| 0.0 |
0.5 |
GO:0035456 |
response to interferon-beta(GO:0035456) |
| 0.0 |
0.1 |
GO:0036091 |
positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
| 0.0 |
0.2 |
GO:0071353 |
cellular response to interleukin-4(GO:0071353) |
| 0.0 |
0.0 |
GO:0090085 |
regulation of protein deubiquitination(GO:0090085) |
| 0.0 |
0.4 |
GO:2000134 |
negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.0 |
0.2 |
GO:0033273 |
response to vitamin(GO:0033273) |
| 0.0 |
0.1 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.0 |
0.1 |
GO:0010839 |
negative regulation of keratinocyte proliferation(GO:0010839) |
| 0.0 |
0.2 |
GO:0090200 |
positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.0 |
0.1 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.0 |
0.0 |
GO:0070212 |
protein poly-ADP-ribosylation(GO:0070212) |
| 0.0 |
0.1 |
GO:0090383 |
phagosome acidification(GO:0090383) |
| 0.0 |
0.1 |
GO:0032688 |
negative regulation of interferon-beta production(GO:0032688) |
| 0.0 |
0.1 |
GO:0051725 |
protein de-ADP-ribosylation(GO:0051725) |
| 0.0 |
0.1 |
GO:0019346 |
homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.0 |
0.4 |
GO:0034314 |
Arp2/3 complex-mediated actin nucleation(GO:0034314) |
| 0.0 |
0.0 |
GO:0060842 |
arterial endothelial cell differentiation(GO:0060842) |
| 0.0 |
0.1 |
GO:0040016 |
embryonic cleavage(GO:0040016) |
| 0.0 |
0.8 |
GO:0045454 |
cell redox homeostasis(GO:0045454) |
| 0.0 |
0.1 |
GO:0046541 |
saliva secretion(GO:0046541) |
| 0.0 |
0.1 |
GO:0042989 |
sequestering of actin monomers(GO:0042989) |
| 0.0 |
0.1 |
GO:0006048 |
UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 |
0.0 |
GO:0060352 |
cell adhesion molecule production(GO:0060352) |
| 0.0 |
0.0 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.0 |
0.1 |
GO:0090271 |
positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.0 |
0.1 |
GO:0090045 |
positive regulation of deacetylase activity(GO:0090045) |
| 0.0 |
0.0 |
GO:0071169 |
establishment of protein localization to chromatin(GO:0071169) |
| 0.0 |
0.1 |
GO:0060837 |
blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 |
0.1 |
GO:0060055 |
angiogenesis involved in wound healing(GO:0060055) |
| 0.0 |
0.0 |
GO:0035934 |
corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 |
0.1 |
GO:0031590 |
wybutosine metabolic process(GO:0031590) wybutosine biosynthetic process(GO:0031591) |
| 0.0 |
0.1 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.0 |
0.3 |
GO:0009649 |
entrainment of circadian clock(GO:0009649) |
| 0.0 |
0.1 |
GO:0042760 |
very long-chain fatty acid catabolic process(GO:0042760) |
| 0.0 |
0.1 |
GO:0046599 |
regulation of centriole replication(GO:0046599) |
| 0.0 |
0.0 |
GO:0042304 |
regulation of fatty acid biosynthetic process(GO:0042304) |
| 0.0 |
0.1 |
GO:0035372 |
protein localization to microtubule(GO:0035372) |
| 0.0 |
0.0 |
GO:0006434 |
seryl-tRNA aminoacylation(GO:0006434) |
| 0.0 |
0.0 |
GO:1903719 |
regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.0 |
0.2 |
GO:0001516 |
prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.0 |
0.2 |
GO:0072243 |
metanephric nephron epithelium development(GO:0072243) |
| 0.0 |
0.1 |
GO:1901678 |
iron coordination entity transport(GO:1901678) |
| 0.0 |
0.1 |
GO:0050872 |
white fat cell differentiation(GO:0050872) |
| 0.0 |
0.0 |
GO:0033364 |
mast cell secretory granule organization(GO:0033364) |
| 0.0 |
0.1 |
GO:1900028 |
negative regulation of ruffle assembly(GO:1900028) |
| 0.0 |
0.0 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.0 |
0.2 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.0 |
0.1 |
GO:0042891 |
antibiotic transport(GO:0042891) |
| 0.0 |
0.1 |
GO:0006108 |
malate metabolic process(GO:0006108) |
| 0.0 |
0.1 |
GO:0031547 |
brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 |
0.1 |
GO:0050716 |
positive regulation of interleukin-1 secretion(GO:0050716) positive regulation of interleukin-1 beta secretion(GO:0050718) |
| 0.0 |
0.2 |
GO:0031365 |
N-terminal protein amino acid modification(GO:0031365) |
| 0.0 |
0.0 |
GO:0046604 |
positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.0 |
0.0 |
GO:0006528 |
asparagine metabolic process(GO:0006528) |
| 0.0 |
0.0 |
GO:0039530 |
MDA-5 signaling pathway(GO:0039530) |
| 0.0 |
0.1 |
GO:0046185 |
aldehyde catabolic process(GO:0046185) |
| 0.0 |
0.1 |
GO:0040036 |
regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
| 0.0 |
0.1 |
GO:0006398 |
mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 |
0.1 |
GO:1900745 |
positive regulation of p38MAPK cascade(GO:1900745) |
| 0.0 |
0.1 |
GO:0006828 |
manganese ion transport(GO:0006828) |
| 0.0 |
0.1 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 |
0.1 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 |
0.0 |
GO:0006014 |
D-ribose metabolic process(GO:0006014) |
| 0.0 |
0.1 |
GO:0021527 |
spinal cord association neuron differentiation(GO:0021527) |
| 0.0 |
0.9 |
GO:0000380 |
alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 |
0.1 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 |
0.1 |
GO:0007566 |
embryo implantation(GO:0007566) |
| 0.0 |
0.2 |
GO:0006298 |
mismatch repair(GO:0006298) |
| 0.0 |
0.1 |
GO:0071346 |
cellular response to interferon-gamma(GO:0071346) |
| 0.0 |
0.0 |
GO:0042537 |
benzene-containing compound metabolic process(GO:0042537) |
| 0.0 |
0.0 |
GO:1903378 |
positive regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903378) |
| 0.0 |
0.3 |
GO:0030513 |
positive regulation of BMP signaling pathway(GO:0030513) |
| 0.0 |
0.0 |
GO:0090286 |
cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.0 |
0.0 |
GO:1901563 |
response to camptothecin(GO:1901563) |
| 0.0 |
0.0 |
GO:1901069 |
guanosine-containing compound catabolic process(GO:1901069) |
| 0.0 |
0.1 |
GO:0001833 |
inner cell mass cell proliferation(GO:0001833) |
| 0.0 |
0.1 |
GO:0016486 |
peptide hormone processing(GO:0016486) |
| 0.0 |
0.0 |
GO:0019614 |
catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
| 0.0 |
0.0 |
GO:1901856 |
negative regulation of cellular respiration(GO:1901856) |
| 0.0 |
0.1 |
GO:0043569 |
negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 |
0.2 |
GO:0003341 |
cilium movement(GO:0003341) |
| 0.0 |
0.1 |
GO:1903961 |
positive regulation of anion transmembrane transport(GO:1903961) |
| 0.0 |
0.0 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.0 |
0.1 |
GO:0015937 |
coenzyme A biosynthetic process(GO:0015937) |
| 0.0 |
0.1 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.0 |
0.1 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.0 |
0.0 |
GO:0060766 |
negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.0 |
0.1 |
GO:1905098 |
negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
| 0.0 |
0.0 |
GO:0032511 |
late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.0 |
0.1 |
GO:0006451 |
selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 |
0.0 |
GO:1903223 |
positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.0 |
0.1 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 |
0.1 |
GO:1903963 |
arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.0 |
0.0 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 |
0.2 |
GO:0051290 |
protein heterotetramerization(GO:0051290) |
| 0.0 |
0.1 |
GO:0018344 |
protein geranylgeranylation(GO:0018344) |
| 0.0 |
0.0 |
GO:0035590 |
purinergic nucleotide receptor signaling pathway(GO:0035590) |
| 0.0 |
0.1 |
GO:0034122 |
negative regulation of toll-like receptor signaling pathway(GO:0034122) |
| 0.0 |
0.0 |
GO:0046794 |
multi-organism transport(GO:0044766) transport of virus(GO:0046794) multi-organism localization(GO:1902579) |
| 0.0 |
0.0 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.0 |
0.1 |
GO:0016559 |
peroxisome fission(GO:0016559) |
| 0.0 |
0.0 |
GO:0032731 |
positive regulation of interleukin-1 beta production(GO:0032731) |
| 0.0 |
0.1 |
GO:1903361 |
protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 |
0.1 |
GO:0035337 |
fatty-acyl-CoA metabolic process(GO:0035337) |
| 0.0 |
0.1 |
GO:0071578 |
zinc II ion transmembrane import(GO:0071578) |
| 0.0 |
0.1 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.0 |
0.0 |
GO:0015793 |
glycerol transport(GO:0015793) renal water absorption(GO:0070295) |
| 0.0 |
0.1 |
GO:0019217 |
regulation of fatty acid metabolic process(GO:0019217) |
| 0.0 |
0.0 |
GO:1901162 |
serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.0 |
0.0 |
GO:0061357 |
Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) positive regulation of Wnt protein secretion(GO:0061357) |
| 0.0 |
0.1 |
GO:0016139 |
glycoside catabolic process(GO:0016139) |
| 0.0 |
0.0 |
GO:0090288 |
negative regulation of cellular response to growth factor stimulus(GO:0090288) |
| 0.0 |
0.0 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.0 |
0.0 |
GO:0030852 |
regulation of granulocyte differentiation(GO:0030852) |
| 0.0 |
0.0 |
GO:0042182 |
ketone catabolic process(GO:0042182) |
| 0.0 |
0.0 |
GO:0009298 |
GDP-mannose biosynthetic process(GO:0009298) |
| 0.0 |
0.0 |
GO:2000059 |
negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
| 0.0 |
0.0 |
GO:0035511 |
oxidative DNA demethylation(GO:0035511) |
| 0.0 |
0.0 |
GO:1902237 |
positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.0 |
0.0 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 0.0 |
0.0 |
GO:0018343 |
protein farnesylation(GO:0018343) |
| 0.0 |
0.0 |
GO:1903599 |
positive regulation of mitophagy(GO:1903599) |
| 0.0 |
0.3 |
GO:1902808 |
positive regulation of cell cycle G1/S phase transition(GO:1902808) |
| 0.0 |
0.1 |
GO:0016255 |
attachment of GPI anchor to protein(GO:0016255) |
| 0.0 |
0.1 |
GO:0019348 |
dolichol metabolic process(GO:0019348) |
| 0.0 |
0.1 |
GO:0001659 |
temperature homeostasis(GO:0001659) |
| 0.0 |
0.4 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.0 |
0.0 |
GO:0060394 |
negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 |
0.1 |
GO:2000780 |
negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
| 0.0 |
0.0 |
GO:0007525 |
somatic muscle development(GO:0007525) |
| 0.0 |
0.0 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 0.0 |
0.1 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.0 |
0.0 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 |
0.0 |
GO:1990859 |
cellular response to endothelin(GO:1990859) |
| 0.0 |
0.0 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.0 |
0.1 |
GO:0009098 |
branched-chain amino acid biosynthetic process(GO:0009082) leucine biosynthetic process(GO:0009098) valine biosynthetic process(GO:0009099) |
| 0.0 |
0.2 |
GO:0031116 |
positive regulation of microtubule polymerization(GO:0031116) |
| 0.0 |
0.0 |
GO:0042938 |
dipeptide transport(GO:0042938) |
| 0.0 |
0.0 |
GO:1902302 |
regulation of potassium ion export(GO:1902302) |
| 0.0 |
0.0 |
GO:0071494 |
cellular response to UV-C(GO:0071494) |
| 0.0 |
0.2 |
GO:0046596 |
regulation of viral entry into host cell(GO:0046596) |
| 0.0 |
0.1 |
GO:0006301 |
postreplication repair(GO:0006301) |
| 0.0 |
0.1 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.0 |
0.1 |
GO:0035090 |
maintenance of apical/basal cell polarity(GO:0035090) |
| 0.0 |
0.1 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.0 |
0.0 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
