| 1.8 |
5.3 |
GO:0060129 |
thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
| 1.6 |
4.9 |
GO:0030421 |
defecation(GO:0030421) |
| 1.5 |
4.5 |
GO:1904274 |
tricellular tight junction assembly(GO:1904274) |
| 1.3 |
3.9 |
GO:0014738 |
regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
| 1.2 |
8.2 |
GO:0031536 |
positive regulation of exit from mitosis(GO:0031536) |
| 1.1 |
3.4 |
GO:0014877 |
response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 1.1 |
3.3 |
GO:0036166 |
phenotypic switching(GO:0036166) |
| 1.0 |
4.2 |
GO:0006663 |
platelet activating factor biosynthetic process(GO:0006663) |
| 1.0 |
1.0 |
GO:0045736 |
negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
| 1.0 |
3.0 |
GO:1902162 |
regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
| 1.0 |
1.9 |
GO:1902913 |
positive regulation of melanocyte differentiation(GO:0045636) positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.9 |
2.8 |
GO:0048496 |
maintenance of organ identity(GO:0048496) |
| 0.9 |
0.9 |
GO:0061642 |
chemoattraction of axon(GO:0061642) |
| 0.9 |
2.7 |
GO:0060167 |
regulation of adenosine receptor signaling pathway(GO:0060167) |
| 0.9 |
2.6 |
GO:0061144 |
alveolar secondary septum development(GO:0061144) |
| 0.9 |
3.5 |
GO:0015888 |
thiamine transport(GO:0015888) |
| 0.8 |
3.3 |
GO:0003360 |
brainstem development(GO:0003360) |
| 0.8 |
3.1 |
GO:0007113 |
endomitotic cell cycle(GO:0007113) |
| 0.7 |
3.7 |
GO:0007386 |
compartment pattern specification(GO:0007386) |
| 0.7 |
3.6 |
GO:0003199 |
endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 0.7 |
0.7 |
GO:0060489 |
orthogonal dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060488) planar dichotomous subdivision of terminal units involved in lung branching morphogenesis(GO:0060489) lateral sprouting involved in lung morphogenesis(GO:0060490) |
| 0.7 |
0.7 |
GO:0010360 |
negative regulation of anion channel activity(GO:0010360) |
| 0.7 |
1.4 |
GO:0072076 |
nephrogenic mesenchyme development(GO:0072076) |
| 0.7 |
2.7 |
GO:0035262 |
gonad morphogenesis(GO:0035262) |
| 0.7 |
2.0 |
GO:0090118 |
receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
| 0.6 |
0.6 |
GO:1900145 |
regulation of nodal signaling pathway involved in determination of left/right asymmetry(GO:1900145) regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900175) positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) |
| 0.6 |
1.9 |
GO:0035519 |
protein K29-linked ubiquitination(GO:0035519) |
| 0.6 |
1.9 |
GO:0071707 |
immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
| 0.6 |
2.5 |
GO:0035606 |
peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
| 0.6 |
0.6 |
GO:0006268 |
DNA unwinding involved in DNA replication(GO:0006268) |
| 0.6 |
0.6 |
GO:0060994 |
regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
| 0.6 |
1.8 |
GO:0000320 |
re-entry into mitotic cell cycle(GO:0000320) |
| 0.6 |
1.8 |
GO:1901420 |
negative regulation of response to alcohol(GO:1901420) |
| 0.6 |
1.2 |
GO:0014063 |
negative regulation of serotonin secretion(GO:0014063) |
| 0.6 |
4.6 |
GO:0010032 |
meiotic chromosome condensation(GO:0010032) |
| 0.6 |
1.7 |
GO:0030200 |
heparan sulfate proteoglycan catabolic process(GO:0030200) |
| 0.6 |
1.1 |
GO:0044837 |
assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
| 0.6 |
3.3 |
GO:0060754 |
positive regulation of mast cell chemotaxis(GO:0060754) |
| 0.6 |
3.3 |
GO:0006452 |
translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
| 0.5 |
0.5 |
GO:0070366 |
regulation of hepatocyte differentiation(GO:0070366) |
| 0.5 |
2.2 |
GO:0072137 |
condensed mesenchymal cell proliferation(GO:0072137) |
| 0.5 |
2.7 |
GO:0071499 |
response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 0.5 |
1.6 |
GO:0035604 |
fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
| 0.5 |
2.1 |
GO:0030091 |
protein repair(GO:0030091) |
| 0.5 |
1.6 |
GO:1902566 |
regulation of eosinophil activation(GO:1902566) |
| 0.5 |
2.0 |
GO:0006244 |
pyrimidine nucleotide catabolic process(GO:0006244) pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.5 |
1.5 |
GO:0060672 |
epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.5 |
1.5 |
GO:0008582 |
regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.5 |
0.5 |
GO:0038163 |
thrombopoietin-mediated signaling pathway(GO:0038163) |
| 0.5 |
2.9 |
GO:1903236 |
regulation of leukocyte tethering or rolling(GO:1903236) |
| 0.5 |
1.5 |
GO:0006578 |
amino-acid betaine biosynthetic process(GO:0006578) |
| 0.5 |
0.5 |
GO:0051660 |
establishment of centrosome localization(GO:0051660) |
| 0.5 |
1.4 |
GO:0006285 |
base-excision repair, AP site formation(GO:0006285) |
| 0.5 |
0.9 |
GO:0003100 |
regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.5 |
3.3 |
GO:0006369 |
termination of RNA polymerase II transcription(GO:0006369) |
| 0.5 |
1.9 |
GO:0043973 |
histone H3-K4 acetylation(GO:0043973) |
| 0.5 |
1.4 |
GO:0042908 |
xenobiotic transport(GO:0042908) |
| 0.5 |
0.9 |
GO:2000373 |
regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000371) positive regulation of DNA topoisomerase (ATP-hydrolyzing) activity(GO:2000373) |
| 0.5 |
0.9 |
GO:0035880 |
embryonic nail plate morphogenesis(GO:0035880) |
| 0.5 |
4.6 |
GO:0016127 |
cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.5 |
2.3 |
GO:1903553 |
positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.5 |
1.4 |
GO:0034184 |
positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.5 |
0.5 |
GO:1990705 |
cholangiocyte proliferation(GO:1990705) |
| 0.5 |
2.3 |
GO:0007089 |
traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.5 |
2.7 |
GO:0060449 |
bud elongation involved in lung branching(GO:0060449) |
| 0.5 |
1.8 |
GO:0070318 |
positive regulation of G0 to G1 transition(GO:0070318) |
| 0.5 |
2.3 |
GO:0071699 |
olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.5 |
1.8 |
GO:2000065 |
negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.4 |
4.9 |
GO:2000675 |
negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.4 |
1.8 |
GO:0051151 |
negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.4 |
1.3 |
GO:0071579 |
regulation of zinc ion transport(GO:0071579) |
| 0.4 |
1.3 |
GO:0060598 |
dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
| 0.4 |
1.8 |
GO:0071930 |
negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.4 |
4.0 |
GO:1904714 |
regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.4 |
1.8 |
GO:1902340 |
telomeric heterochromatin assembly(GO:0031509) negative regulation of chromosome condensation(GO:1902340) |
| 0.4 |
1.8 |
GO:0033085 |
negative regulation of T cell differentiation in thymus(GO:0033085) |
| 0.4 |
0.9 |
GO:0061314 |
Notch signaling involved in heart development(GO:0061314) |
| 0.4 |
1.3 |
GO:0090187 |
positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.4 |
1.3 |
GO:0060244 |
negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.4 |
0.4 |
GO:0097350 |
neutrophil clearance(GO:0097350) |
| 0.4 |
0.4 |
GO:0016554 |
cytidine to uridine editing(GO:0016554) |
| 0.4 |
1.7 |
GO:2000048 |
negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.4 |
0.4 |
GO:0007354 |
zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.4 |
0.4 |
GO:1900109 |
regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.4 |
1.3 |
GO:0009950 |
dorsal/ventral axis specification(GO:0009950) |
| 0.4 |
1.3 |
GO:0045004 |
DNA replication proofreading(GO:0045004) |
| 0.4 |
3.0 |
GO:0060903 |
positive regulation of meiosis I(GO:0060903) |
| 0.4 |
1.7 |
GO:0032053 |
ciliary basal body organization(GO:0032053) |
| 0.4 |
0.4 |
GO:0003415 |
chondrocyte hypertrophy(GO:0003415) |
| 0.4 |
1.6 |
GO:0072236 |
metanephric loop of Henle development(GO:0072236) |
| 0.4 |
1.2 |
GO:0060708 |
spongiotrophoblast differentiation(GO:0060708) |
| 0.4 |
1.2 |
GO:0042732 |
D-xylose metabolic process(GO:0042732) |
| 0.4 |
1.6 |
GO:2001185 |
regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.4 |
4.4 |
GO:0032825 |
positive regulation of natural killer cell differentiation(GO:0032825) |
| 0.4 |
2.0 |
GO:0072513 |
positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.4 |
1.2 |
GO:1904975 |
response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
| 0.4 |
1.2 |
GO:0090324 |
negative regulation of oxidative phosphorylation(GO:0090324) |
| 0.4 |
0.8 |
GO:0072223 |
metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
| 0.4 |
1.2 |
GO:0051026 |
chiasma assembly(GO:0051026) |
| 0.4 |
1.6 |
GO:0046552 |
eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.4 |
1.2 |
GO:0001193 |
maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
| 0.4 |
0.8 |
GO:0051124 |
synaptic growth at neuromuscular junction(GO:0051124) |
| 0.4 |
0.4 |
GO:0021847 |
ventricular zone neuroblast division(GO:0021847) |
| 0.4 |
0.4 |
GO:0050869 |
negative regulation of B cell activation(GO:0050869) |
| 0.4 |
0.4 |
GO:0036118 |
hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.4 |
0.4 |
GO:0000279 |
M phase(GO:0000279) |
| 0.4 |
0.4 |
GO:0090272 |
negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.4 |
0.4 |
GO:0030214 |
hyaluronan catabolic process(GO:0030214) |
| 0.4 |
1.2 |
GO:2001160 |
regulation of histone H3-K79 methylation(GO:2001160) |
| 0.4 |
0.4 |
GO:0035993 |
deltoid tuberosity development(GO:0035993) |
| 0.4 |
0.8 |
GO:1904760 |
myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
| 0.4 |
1.5 |
GO:0048382 |
mesendoderm development(GO:0048382) |
| 0.4 |
0.8 |
GO:1990869 |
response to chemokine(GO:1990868) cellular response to chemokine(GO:1990869) |
| 0.4 |
0.7 |
GO:0009757 |
carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.4 |
1.9 |
GO:0034421 |
post-translational protein acetylation(GO:0034421) |
| 0.4 |
3.0 |
GO:0045647 |
negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.4 |
3.7 |
GO:0035873 |
lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.4 |
9.2 |
GO:0048385 |
regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.4 |
0.7 |
GO:0032877 |
positive regulation of DNA endoreduplication(GO:0032877) |
| 0.4 |
1.5 |
GO:0000379 |
tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.4 |
1.8 |
GO:0048318 |
axial mesoderm development(GO:0048318) |
| 0.4 |
1.1 |
GO:0072382 |
minus-end-directed vesicle transport along microtubule(GO:0072382) |
| 0.4 |
0.7 |
GO:0036292 |
DNA rewinding(GO:0036292) |
| 0.4 |
0.7 |
GO:1904020 |
regulation of G-protein coupled receptor internalization(GO:1904020) |
| 0.4 |
1.1 |
GO:1904154 |
positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
| 0.4 |
0.7 |
GO:0001516 |
prostaglandin biosynthetic process(GO:0001516) icosanoid biosynthetic process(GO:0046456) prostanoid biosynthetic process(GO:0046457) fatty acid derivative biosynthetic process(GO:1901570) |
| 0.4 |
2.9 |
GO:0035726 |
common myeloid progenitor cell proliferation(GO:0035726) |
| 0.4 |
1.8 |
GO:0030423 |
targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.4 |
1.1 |
GO:0021849 |
neuroblast division in subventricular zone(GO:0021849) |
| 0.4 |
2.1 |
GO:1903847 |
regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.4 |
0.7 |
GO:0014028 |
notochord formation(GO:0014028) |
| 0.4 |
1.4 |
GO:0006982 |
response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
| 0.4 |
1.1 |
GO:0071898 |
regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.4 |
1.4 |
GO:0032901 |
positive regulation of neurotrophin production(GO:0032901) |
| 0.4 |
1.8 |
GO:0072103 |
glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.3 |
1.0 |
GO:0007351 |
tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
| 0.3 |
1.0 |
GO:1903070 |
negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
| 0.3 |
1.4 |
GO:0070934 |
CRD-mediated mRNA stabilization(GO:0070934) |
| 0.3 |
1.0 |
GO:2000195 |
negative regulation of female gonad development(GO:2000195) |
| 0.3 |
1.4 |
GO:0072272 |
proximal/distal pattern formation involved in metanephric nephron development(GO:0072272) |
| 0.3 |
1.4 |
GO:1904451 |
regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904451) positive regulation of hydrogen:potassium-exchanging ATPase activity(GO:1904453) |
| 0.3 |
1.4 |
GO:1905077 |
negative regulation of interleukin-17 secretion(GO:1905077) |
| 0.3 |
1.4 |
GO:0006409 |
tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
| 0.3 |
1.0 |
GO:0098968 |
neurotransmitter receptor transport postsynaptic membrane to endosome(GO:0098968) |
| 0.3 |
0.3 |
GO:0031944 |
negative regulation of glucocorticoid metabolic process(GO:0031944) negative regulation of glucocorticoid biosynthetic process(GO:0031947) |
| 0.3 |
3.1 |
GO:0090267 |
positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
| 0.3 |
0.7 |
GO:0072070 |
loop of Henle development(GO:0072070) |
| 0.3 |
2.0 |
GO:0048254 |
snoRNA localization(GO:0048254) |
| 0.3 |
1.7 |
GO:0038018 |
Wnt receptor catabolic process(GO:0038018) |
| 0.3 |
2.3 |
GO:2000781 |
positive regulation of double-strand break repair(GO:2000781) |
| 0.3 |
1.3 |
GO:0046655 |
glycine biosynthetic process(GO:0006545) folic acid metabolic process(GO:0046655) |
| 0.3 |
6.3 |
GO:0030903 |
notochord development(GO:0030903) |
| 0.3 |
1.7 |
GO:0060266 |
negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.3 |
4.3 |
GO:1902459 |
positive regulation of stem cell population maintenance(GO:1902459) |
| 0.3 |
1.0 |
GO:0034241 |
positive regulation of macrophage fusion(GO:0034241) |
| 0.3 |
1.0 |
GO:0045799 |
positive regulation of chromatin assembly or disassembly(GO:0045799) |
| 0.3 |
2.0 |
GO:0021539 |
subthalamus development(GO:0021539) |
| 0.3 |
1.0 |
GO:0060741 |
prostate gland stromal morphogenesis(GO:0060741) |
| 0.3 |
0.7 |
GO:0061054 |
dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.3 |
2.9 |
GO:0042538 |
hyperosmotic salinity response(GO:0042538) |
| 0.3 |
1.0 |
GO:0060364 |
frontal suture morphogenesis(GO:0060364) |
| 0.3 |
0.6 |
GO:0046947 |
hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
| 0.3 |
0.6 |
GO:1904245 |
regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
| 0.3 |
0.6 |
GO:0007130 |
synaptonemal complex assembly(GO:0007130) |
| 0.3 |
1.0 |
GO:0034287 |
detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.3 |
1.0 |
GO:0010248 |
B cell negative selection(GO:0002352) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.3 |
1.0 |
GO:0006083 |
acetate metabolic process(GO:0006083) |
| 0.3 |
1.0 |
GO:1901355 |
response to rapamycin(GO:1901355) |
| 0.3 |
0.3 |
GO:0036462 |
TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.3 |
0.3 |
GO:0042097 |
interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
| 0.3 |
0.6 |
GO:0035188 |
blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.3 |
0.6 |
GO:0045650 |
negative regulation of macrophage differentiation(GO:0045650) |
| 0.3 |
1.6 |
GO:0030644 |
cellular chloride ion homeostasis(GO:0030644) |
| 0.3 |
1.6 |
GO:0048133 |
germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.3 |
0.9 |
GO:0003221 |
right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.3 |
0.3 |
GO:2001184 |
regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.3 |
1.3 |
GO:0072615 |
interleukin-17 secretion(GO:0072615) |
| 0.3 |
0.3 |
GO:0090502 |
RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
| 0.3 |
2.5 |
GO:0006105 |
succinate metabolic process(GO:0006105) |
| 0.3 |
0.3 |
GO:0031990 |
mRNA export from nucleus in response to heat stress(GO:0031990) |
| 0.3 |
2.5 |
GO:0010587 |
miRNA catabolic process(GO:0010587) |
| 0.3 |
4.9 |
GO:0060579 |
ventral spinal cord interneuron fate commitment(GO:0060579) cell fate commitment involved in pattern specification(GO:0060581) |
| 0.3 |
1.8 |
GO:0097368 |
establishment of Sertoli cell barrier(GO:0097368) |
| 0.3 |
0.9 |
GO:0071600 |
otic vesicle morphogenesis(GO:0071600) |
| 0.3 |
1.5 |
GO:0007223 |
Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.3 |
1.2 |
GO:0006447 |
regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.3 |
0.9 |
GO:0051964 |
negative regulation of synapse assembly(GO:0051964) |
| 0.3 |
0.6 |
GO:0048105 |
establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
| 0.3 |
2.4 |
GO:0008343 |
adult feeding behavior(GO:0008343) |
| 0.3 |
2.7 |
GO:0071493 |
cellular response to UV-B(GO:0071493) |
| 0.3 |
1.2 |
GO:1903347 |
negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.3 |
1.2 |
GO:0051024 |
positive regulation of immunoglobulin secretion(GO:0051024) |
| 0.3 |
0.6 |
GO:0045578 |
negative regulation of B cell differentiation(GO:0045578) |
| 0.3 |
2.1 |
GO:0033567 |
DNA replication, Okazaki fragment processing(GO:0033567) |
| 0.3 |
0.9 |
GO:0090235 |
regulation of metaphase plate congression(GO:0090235) |
| 0.3 |
0.6 |
GO:0007290 |
spermatid nucleus elongation(GO:0007290) |
| 0.3 |
8.6 |
GO:0048255 |
mRNA stabilization(GO:0048255) |
| 0.3 |
0.9 |
GO:0030647 |
polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.3 |
0.6 |
GO:0006059 |
hexitol metabolic process(GO:0006059) |
| 0.3 |
0.3 |
GO:0051387 |
negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.3 |
0.3 |
GO:0010224 |
response to UV-B(GO:0010224) |
| 0.3 |
0.6 |
GO:0071205 |
protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.3 |
1.2 |
GO:2001032 |
regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.3 |
2.0 |
GO:0031943 |
regulation of glucocorticoid metabolic process(GO:0031943) |
| 0.3 |
1.4 |
GO:0044806 |
G-quadruplex DNA unwinding(GO:0044806) |
| 0.3 |
0.3 |
GO:0021938 |
smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 0.3 |
1.4 |
GO:0034137 |
positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.3 |
3.2 |
GO:0060252 |
positive regulation of glial cell proliferation(GO:0060252) |
| 0.3 |
0.9 |
GO:0044339 |
canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.3 |
2.6 |
GO:0045003 |
DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.3 |
1.1 |
GO:0015705 |
iodide transport(GO:0015705) |
| 0.3 |
0.6 |
GO:0015675 |
nickel cation transport(GO:0015675) |
| 0.3 |
2.5 |
GO:0046826 |
negative regulation of protein export from nucleus(GO:0046826) |
| 0.3 |
7.9 |
GO:0006346 |
methylation-dependent chromatin silencing(GO:0006346) |
| 0.3 |
8.7 |
GO:0034723 |
DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.3 |
3.9 |
GO:0043567 |
regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.3 |
0.6 |
GO:0002678 |
positive regulation of chronic inflammatory response(GO:0002678) |
| 0.3 |
2.2 |
GO:0006004 |
fucose metabolic process(GO:0006004) |
| 0.3 |
0.8 |
GO:0019405 |
alditol catabolic process(GO:0019405) |
| 0.3 |
0.8 |
GO:0006001 |
fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.3 |
0.3 |
GO:0070094 |
positive regulation of glucagon secretion(GO:0070094) |
| 0.3 |
0.5 |
GO:0002636 |
positive regulation of germinal center formation(GO:0002636) |
| 0.3 |
2.7 |
GO:0007096 |
regulation of exit from mitosis(GO:0007096) |
| 0.3 |
1.1 |
GO:0006344 |
maintenance of chromatin silencing(GO:0006344) |
| 0.3 |
1.3 |
GO:2000271 |
positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.3 |
0.5 |
GO:0034372 |
very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.3 |
0.5 |
GO:0090199 |
regulation of release of cytochrome c from mitochondria(GO:0090199) negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.3 |
0.5 |
GO:0048745 |
smooth muscle tissue development(GO:0048745) |
| 0.3 |
0.8 |
GO:0031204 |
posttranslational protein targeting to membrane, translocation(GO:0031204) |
| 0.3 |
0.5 |
GO:0009814 |
defense response, incompatible interaction(GO:0009814) |
| 0.3 |
0.3 |
GO:0060689 |
cell differentiation involved in salivary gland development(GO:0060689) |
| 0.3 |
1.1 |
GO:1902268 |
negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.3 |
0.8 |
GO:0046133 |
pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.3 |
0.5 |
GO:1903719 |
regulation of I-kappaB phosphorylation(GO:1903719) positive regulation of I-kappaB phosphorylation(GO:1903721) |
| 0.3 |
0.8 |
GO:0036123 |
histone H3-K9 dimethylation(GO:0036123) |
| 0.3 |
1.1 |
GO:1900186 |
negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.3 |
0.3 |
GO:0038030 |
non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
| 0.3 |
0.3 |
GO:0030538 |
embryonic genitalia morphogenesis(GO:0030538) |
| 0.3 |
5.5 |
GO:0044458 |
motile cilium assembly(GO:0044458) |
| 0.3 |
1.3 |
GO:0003420 |
regulation of growth plate cartilage chondrocyte proliferation(GO:0003420) |
| 0.3 |
1.0 |
GO:0015825 |
L-serine transport(GO:0015825) |
| 0.3 |
0.8 |
GO:1903800 |
positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.3 |
2.9 |
GO:0060707 |
trophoblast giant cell differentiation(GO:0060707) |
| 0.3 |
2.3 |
GO:1902373 |
negative regulation of mRNA catabolic process(GO:1902373) |
| 0.3 |
1.0 |
GO:1904565 |
response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
| 0.3 |
0.5 |
GO:0048633 |
positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.3 |
0.3 |
GO:0016332 |
establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
| 0.3 |
9.7 |
GO:0006270 |
DNA replication initiation(GO:0006270) |
| 0.3 |
1.0 |
GO:0015889 |
cobalamin transport(GO:0015889) |
| 0.3 |
1.3 |
GO:1903504 |
regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
| 0.3 |
3.8 |
GO:0051451 |
myoblast migration(GO:0051451) |
| 0.3 |
0.8 |
GO:0014005 |
microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.3 |
1.0 |
GO:0061743 |
motor learning(GO:0061743) |
| 0.3 |
1.0 |
GO:0006776 |
vitamin A metabolic process(GO:0006776) |
| 0.3 |
4.8 |
GO:0001886 |
endothelial cell morphogenesis(GO:0001886) |
| 0.3 |
0.8 |
GO:0006931 |
substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.3 |
1.0 |
GO:0097501 |
stress response to metal ion(GO:0097501) |
| 0.3 |
0.8 |
GO:0007521 |
muscle cell fate determination(GO:0007521) |
| 0.3 |
4.3 |
GO:0071157 |
negative regulation of cell cycle arrest(GO:0071157) |
| 0.2 |
1.0 |
GO:0098762 |
meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
| 0.2 |
0.5 |
GO:0007066 |
female meiosis sister chromatid cohesion(GO:0007066) |
| 0.2 |
0.2 |
GO:0045019 |
negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.2 |
0.5 |
GO:0001831 |
trophectodermal cellular morphogenesis(GO:0001831) |
| 0.2 |
1.7 |
GO:1902166 |
negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.2 |
0.7 |
GO:0033209 |
tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.2 |
0.7 |
GO:1903976 |
negative regulation of glial cell migration(GO:1903976) |
| 0.2 |
0.2 |
GO:0070170 |
negative regulation of odontogenesis(GO:0042483) regulation of tooth mineralization(GO:0070170) |
| 0.2 |
1.0 |
GO:0006547 |
histidine metabolic process(GO:0006547) |
| 0.2 |
1.2 |
GO:0021797 |
forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.2 |
0.7 |
GO:0015910 |
peroxisomal long-chain fatty acid import(GO:0015910) |
| 0.2 |
1.9 |
GO:0060019 |
radial glial cell differentiation(GO:0060019) |
| 0.2 |
1.0 |
GO:0010836 |
negative regulation of protein ADP-ribosylation(GO:0010836) |
| 0.2 |
0.7 |
GO:0003340 |
negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.2 |
4.6 |
GO:0048240 |
sperm capacitation(GO:0048240) |
| 0.2 |
0.7 |
GO:1902071 |
regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.2 |
0.7 |
GO:2000138 |
positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.2 |
1.9 |
GO:0035437 |
maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.2 |
1.0 |
GO:0035426 |
extracellular matrix-cell signaling(GO:0035426) |
| 0.2 |
0.2 |
GO:0010637 |
negative regulation of mitochondrial fusion(GO:0010637) |
| 0.2 |
0.7 |
GO:0019441 |
tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
| 0.2 |
0.7 |
GO:1903334 |
positive regulation of protein folding(GO:1903334) |
| 0.2 |
0.2 |
GO:0050689 |
negative regulation of defense response to virus by host(GO:0050689) |
| 0.2 |
0.9 |
GO:0035624 |
receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.2 |
0.2 |
GO:0034729 |
histone H3-K79 methylation(GO:0034729) |
| 0.2 |
0.9 |
GO:0006166 |
purine ribonucleoside salvage(GO:0006166) |
| 0.2 |
0.5 |
GO:0035793 |
negative regulation of phosphatidylinositol biosynthetic process(GO:0010512) cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.2 |
2.1 |
GO:0060026 |
convergent extension(GO:0060026) |
| 0.2 |
0.7 |
GO:0036353 |
histone H2A-K119 monoubiquitination(GO:0036353) |
| 0.2 |
0.7 |
GO:0044314 |
protein K27-linked ubiquitination(GO:0044314) |
| 0.2 |
0.7 |
GO:0086053 |
AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
| 0.2 |
0.9 |
GO:0070493 |
thrombin receptor signaling pathway(GO:0070493) |
| 0.2 |
2.9 |
GO:0001675 |
acrosome assembly(GO:0001675) |
| 0.2 |
2.5 |
GO:0060539 |
diaphragm development(GO:0060539) |
| 0.2 |
0.4 |
GO:0071896 |
protein localization to adherens junction(GO:0071896) |
| 0.2 |
2.4 |
GO:0001779 |
natural killer cell differentiation(GO:0001779) |
| 0.2 |
0.7 |
GO:0050748 |
negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.2 |
1.1 |
GO:0043383 |
negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
| 0.2 |
1.7 |
GO:0000056 |
ribosomal small subunit export from nucleus(GO:0000056) |
| 0.2 |
1.3 |
GO:0046600 |
negative regulation of centriole replication(GO:0046600) |
| 0.2 |
0.2 |
GO:0070858 |
negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
| 0.2 |
0.6 |
GO:0043586 |
tongue development(GO:0043586) |
| 0.2 |
2.4 |
GO:0006020 |
inositol metabolic process(GO:0006020) |
| 0.2 |
0.4 |
GO:0002191 |
cap-dependent translational initiation(GO:0002191) |
| 0.2 |
0.4 |
GO:0051295 |
establishment of meiotic spindle localization(GO:0051295) |
| 0.2 |
0.4 |
GO:0072488 |
ammonium transmembrane transport(GO:0072488) |
| 0.2 |
0.9 |
GO:0002143 |
tRNA wobble position uridine thiolation(GO:0002143) |
| 0.2 |
0.4 |
GO:0000720 |
pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.2 |
0.4 |
GO:0043504 |
mitochondrial DNA repair(GO:0043504) |
| 0.2 |
1.1 |
GO:0072697 |
protein localization to cell cortex(GO:0072697) |
| 0.2 |
0.6 |
GO:0019230 |
proprioception(GO:0019230) |
| 0.2 |
0.4 |
GO:0031665 |
negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.2 |
1.3 |
GO:0045583 |
regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.2 |
0.2 |
GO:1902807 |
negative regulation of cell cycle G1/S phase transition(GO:1902807) |
| 0.2 |
0.8 |
GO:2000346 |
negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.2 |
0.2 |
GO:0044851 |
anagen(GO:0042640) hair cycle phase(GO:0044851) |
| 0.2 |
0.6 |
GO:0046104 |
thymidine metabolic process(GO:0046104) |
| 0.2 |
1.3 |
GO:0046459 |
short-chain fatty acid metabolic process(GO:0046459) |
| 0.2 |
1.3 |
GO:0035331 |
negative regulation of hippo signaling(GO:0035331) |
| 0.2 |
0.6 |
GO:2000393 |
negative regulation of lamellipodium morphogenesis(GO:2000393) |
| 0.2 |
0.6 |
GO:0019043 |
establishment of viral latency(GO:0019043) |
| 0.2 |
0.4 |
GO:0009794 |
regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.2 |
1.2 |
GO:0043951 |
negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.2 |
4.7 |
GO:0051764 |
actin crosslink formation(GO:0051764) |
| 0.2 |
1.4 |
GO:0038092 |
nodal signaling pathway(GO:0038092) |
| 0.2 |
0.4 |
GO:0010694 |
positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.2 |
0.2 |
GO:0021553 |
olfactory nerve development(GO:0021553) |
| 0.2 |
0.2 |
GO:0060665 |
regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.2 |
0.4 |
GO:0014722 |
regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.2 |
1.8 |
GO:0090557 |
establishment of endothelial intestinal barrier(GO:0090557) |
| 0.2 |
0.6 |
GO:0007084 |
mitotic nuclear envelope reassembly(GO:0007084) |
| 0.2 |
0.4 |
GO:0033484 |
nitric oxide homeostasis(GO:0033484) |
| 0.2 |
0.6 |
GO:1903225 |
negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.2 |
0.6 |
GO:0023016 |
signal transduction by trans-phosphorylation(GO:0023016) |
| 0.2 |
0.4 |
GO:2000035 |
regulation of stem cell division(GO:2000035) |
| 0.2 |
1.4 |
GO:0006729 |
tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.2 |
0.4 |
GO:0061300 |
cerebellum vasculature development(GO:0061300) |
| 0.2 |
0.2 |
GO:0072539 |
T-helper 17 cell differentiation(GO:0072539) |
| 0.2 |
0.8 |
GO:1903300 |
negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.2 |
0.4 |
GO:0002725 |
negative regulation of T cell cytokine production(GO:0002725) |
| 0.2 |
0.4 |
GO:0030422 |
production of siRNA involved in RNA interference(GO:0030422) |
| 0.2 |
0.4 |
GO:0060648 |
mammary gland bud morphogenesis(GO:0060648) |
| 0.2 |
0.6 |
GO:0044778 |
meiotic DNA integrity checkpoint(GO:0044778) |
| 0.2 |
1.2 |
GO:0046666 |
retinal cell programmed cell death(GO:0046666) |
| 0.2 |
1.0 |
GO:0018002 |
N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.2 |
0.8 |
GO:0035413 |
positive regulation of catenin import into nucleus(GO:0035413) |
| 0.2 |
1.4 |
GO:0035360 |
positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.2 |
0.8 |
GO:0070269 |
pyroptosis(GO:0070269) |
| 0.2 |
0.6 |
GO:0046061 |
dATP catabolic process(GO:0046061) |
| 0.2 |
0.8 |
GO:0006297 |
nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.2 |
0.4 |
GO:1901563 |
response to camptothecin(GO:1901563) |
| 0.2 |
1.7 |
GO:0070072 |
vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.2 |
1.4 |
GO:0006703 |
estrogen biosynthetic process(GO:0006703) |
| 0.2 |
0.8 |
GO:2000158 |
positive regulation of ubiquitin-specific protease activity(GO:2000158) |
| 0.2 |
2.5 |
GO:1901623 |
regulation of lymphocyte chemotaxis(GO:1901623) |
| 0.2 |
0.4 |
GO:0010533 |
regulation of activation of Janus kinase activity(GO:0010533) |
| 0.2 |
1.0 |
GO:0045918 |
negative regulation of cytolysis(GO:0045918) |
| 0.2 |
0.4 |
GO:0032286 |
central nervous system myelin maintenance(GO:0032286) |
| 0.2 |
0.6 |
GO:0006526 |
arginine biosynthetic process(GO:0006526) |
| 0.2 |
0.4 |
GO:0034334 |
adherens junction maintenance(GO:0034334) |
| 0.2 |
0.8 |
GO:0002949 |
tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.2 |
0.4 |
GO:0048852 |
diencephalon morphogenesis(GO:0048852) |
| 0.2 |
1.3 |
GO:0016584 |
nucleosome positioning(GO:0016584) |
| 0.2 |
0.4 |
GO:0002765 |
immune response-inhibiting signal transduction(GO:0002765) |
| 0.2 |
1.7 |
GO:0006682 |
galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
| 0.2 |
0.7 |
GO:0060857 |
establishment of glial blood-brain barrier(GO:0060857) |
| 0.2 |
0.7 |
GO:0032020 |
ISG15-protein conjugation(GO:0032020) |
| 0.2 |
0.2 |
GO:1903760 |
regulation of voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1903760) regulation of membrane repolarization during ventricular cardiac muscle cell action potential(GO:1905024) |
| 0.2 |
0.7 |
GO:0086028 |
bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.2 |
0.7 |
GO:2001045 |
negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.2 |
0.7 |
GO:0006271 |
DNA strand elongation involved in DNA replication(GO:0006271) |
| 0.2 |
1.3 |
GO:0035735 |
intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.2 |
3.1 |
GO:0030866 |
cortical actin cytoskeleton organization(GO:0030866) |
| 0.2 |
0.5 |
GO:0070942 |
neutrophil mediated cytotoxicity(GO:0070942) neutrophil mediated killing of symbiont cell(GO:0070943) |
| 0.2 |
0.9 |
GO:0019659 |
fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.2 |
1.3 |
GO:0090037 |
positive regulation of protein kinase C signaling(GO:0090037) |
| 0.2 |
0.2 |
GO:1901630 |
negative regulation of presynaptic membrane organization(GO:1901630) |
| 0.2 |
1.4 |
GO:0002315 |
marginal zone B cell differentiation(GO:0002315) |
| 0.2 |
1.1 |
GO:0014883 |
transition between fast and slow fiber(GO:0014883) |
| 0.2 |
0.2 |
GO:0002361 |
CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.2 |
1.1 |
GO:0046490 |
isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.2 |
0.5 |
GO:0035162 |
embryonic hemopoiesis(GO:0035162) |
| 0.2 |
0.4 |
GO:0010643 |
cell communication by chemical coupling(GO:0010643) |
| 0.2 |
1.8 |
GO:0030388 |
fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.2 |
0.5 |
GO:0019323 |
pentose catabolic process(GO:0019323) |
| 0.2 |
4.6 |
GO:0034508 |
centromere complex assembly(GO:0034508) |
| 0.2 |
3.2 |
GO:0050909 |
sensory perception of taste(GO:0050909) |
| 0.2 |
0.5 |
GO:1903490 |
regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
| 0.2 |
2.1 |
GO:0043923 |
positive regulation by host of viral transcription(GO:0043923) |
| 0.2 |
1.6 |
GO:0035562 |
negative regulation of chromatin binding(GO:0035562) |
| 0.2 |
0.5 |
GO:0070172 |
positive regulation of tooth mineralization(GO:0070172) |
| 0.2 |
1.6 |
GO:1901409 |
positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.2 |
0.2 |
GO:0001928 |
regulation of exocyst assembly(GO:0001928) |
| 0.2 |
0.2 |
GO:0060753 |
regulation of mast cell chemotaxis(GO:0060753) |
| 0.2 |
0.5 |
GO:0030825 |
positive regulation of cGMP metabolic process(GO:0030825) positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.2 |
0.5 |
GO:0046598 |
positive regulation of viral entry into host cell(GO:0046598) |
| 0.2 |
1.6 |
GO:2000254 |
regulation of male germ cell proliferation(GO:2000254) |
| 0.2 |
0.7 |
GO:0019276 |
UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 |
0.2 |
GO:0034392 |
negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.2 |
0.7 |
GO:0030222 |
eosinophil differentiation(GO:0030222) |
| 0.2 |
0.3 |
GO:0051541 |
elastin metabolic process(GO:0051541) |
| 0.2 |
0.7 |
GO:0072344 |
rescue of stalled ribosome(GO:0072344) |
| 0.2 |
0.5 |
GO:0034162 |
toll-like receptor 9 signaling pathway(GO:0034162) |
| 0.2 |
1.0 |
GO:0002467 |
germinal center formation(GO:0002467) |
| 0.2 |
1.4 |
GO:0060179 |
male mating behavior(GO:0060179) |
| 0.2 |
0.3 |
GO:0072180 |
mesenchymal cell proliferation involved in ureteric bud development(GO:0072138) mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
| 0.2 |
0.3 |
GO:0045950 |
negative regulation of mitotic recombination(GO:0045950) |
| 0.2 |
1.9 |
GO:0032986 |
protein-DNA complex disassembly(GO:0032986) |
| 0.2 |
0.3 |
GO:2001013 |
epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.2 |
0.5 |
GO:0046602 |
regulation of mitotic centrosome separation(GO:0046602) |
| 0.2 |
0.7 |
GO:0072189 |
ureter development(GO:0072189) |
| 0.2 |
0.5 |
GO:1903644 |
regulation of chaperone-mediated protein folding(GO:1903644) |
| 0.2 |
0.3 |
GO:0010641 |
positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
| 0.2 |
0.7 |
GO:0023019 |
signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.2 |
0.2 |
GO:0010870 |
positive regulation of receptor biosynthetic process(GO:0010870) positive regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045716) |
| 0.2 |
0.7 |
GO:0050861 |
positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.2 |
2.5 |
GO:0035115 |
embryonic forelimb morphogenesis(GO:0035115) |
| 0.2 |
1.3 |
GO:0006388 |
tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 |
0.8 |
GO:0035616 |
histone H2B conserved C-terminal lysine deubiquitination(GO:0035616) |
| 0.2 |
0.3 |
GO:0000715 |
nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.2 |
0.5 |
GO:0019343 |
cysteine biosynthetic process via cystathionine(GO:0019343) cysteine biosynthetic process(GO:0019344) |
| 0.2 |
1.8 |
GO:1901030 |
positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.2 |
0.3 |
GO:0034773 |
histone H4-K20 trimethylation(GO:0034773) |
| 0.2 |
0.8 |
GO:0060040 |
retinal bipolar neuron differentiation(GO:0060040) |
| 0.2 |
0.5 |
GO:0046654 |
tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.2 |
0.5 |
GO:1904046 |
negative regulation of vascular endothelial growth factor production(GO:1904046) |
| 0.2 |
0.3 |
GO:0002339 |
B cell selection(GO:0002339) |
| 0.2 |
1.9 |
GO:0048672 |
positive regulation of collateral sprouting(GO:0048672) |
| 0.2 |
0.8 |
GO:0034374 |
low-density lipoprotein particle remodeling(GO:0034374) |
| 0.2 |
0.5 |
GO:1902310 |
positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
| 0.2 |
0.2 |
GO:0030860 |
regulation of polarized epithelial cell differentiation(GO:0030860) |
| 0.2 |
0.6 |
GO:0043584 |
nose development(GO:0043584) |
| 0.2 |
0.5 |
GO:0007341 |
penetration of zona pellucida(GO:0007341) |
| 0.2 |
0.3 |
GO:0034196 |
acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.2 |
0.8 |
GO:0001755 |
neural crest cell migration(GO:0001755) |
| 0.2 |
2.4 |
GO:0071451 |
cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
| 0.2 |
0.5 |
GO:0048478 |
replication fork protection(GO:0048478) |
| 0.2 |
0.5 |
GO:0009414 |
response to water deprivation(GO:0009414) |
| 0.2 |
0.8 |
GO:0071985 |
multivesicular body sorting pathway(GO:0071985) |
| 0.2 |
0.5 |
GO:0032815 |
negative regulation of natural killer cell activation(GO:0032815) |
| 0.2 |
0.9 |
GO:0045606 |
positive regulation of epidermal cell differentiation(GO:0045606) |
| 0.2 |
1.3 |
GO:0018401 |
peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.2 |
0.2 |
GO:0002432 |
granuloma formation(GO:0002432) |
| 0.2 |
0.2 |
GO:0006287 |
base-excision repair, gap-filling(GO:0006287) |
| 0.2 |
0.5 |
GO:0033566 |
gamma-tubulin complex localization(GO:0033566) |
| 0.2 |
2.8 |
GO:0033260 |
nuclear DNA replication(GO:0033260) |
| 0.2 |
1.2 |
GO:0051574 |
positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.2 |
0.5 |
GO:1904751 |
positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.2 |
0.8 |
GO:0000454 |
snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
| 0.2 |
2.7 |
GO:0000028 |
ribosomal small subunit assembly(GO:0000028) |
| 0.2 |
0.5 |
GO:0070574 |
cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.2 |
0.3 |
GO:0098914 |
membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
| 0.2 |
0.5 |
GO:0043570 |
maintenance of DNA repeat elements(GO:0043570) |
| 0.2 |
0.6 |
GO:0042360 |
vitamin E metabolic process(GO:0042360) |
| 0.2 |
0.9 |
GO:1902416 |
positive regulation of mRNA binding(GO:1902416) |
| 0.2 |
0.9 |
GO:0015701 |
bicarbonate transport(GO:0015701) |
| 0.2 |
0.5 |
GO:0060084 |
synaptic transmission involved in micturition(GO:0060084) |
| 0.2 |
0.5 |
GO:0071474 |
cellular hyperosmotic response(GO:0071474) |
| 0.2 |
0.6 |
GO:0030576 |
Cajal body organization(GO:0030576) |
| 0.2 |
0.3 |
GO:1901526 |
positive regulation of macromitophagy(GO:1901526) positive regulation of mitophagy in response to mitochondrial depolarization(GO:1904925) |
| 0.2 |
0.5 |
GO:0021986 |
epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 |
0.6 |
GO:0061086 |
negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 |
0.3 |
GO:0050859 |
negative regulation of B cell receptor signaling pathway(GO:0050859) |
| 0.1 |
0.3 |
GO:1900220 |
semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.1 |
1.0 |
GO:0045793 |
positive regulation of cell size(GO:0045793) |
| 0.1 |
0.7 |
GO:0003383 |
apical constriction(GO:0003383) |
| 0.1 |
0.4 |
GO:0018298 |
protein-chromophore linkage(GO:0018298) |
| 0.1 |
0.1 |
GO:0035087 |
siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.1 |
0.4 |
GO:0090209 |
negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 |
4.7 |
GO:0006284 |
base-excision repair(GO:0006284) |
| 0.1 |
0.6 |
GO:0031053 |
primary miRNA processing(GO:0031053) |
| 0.1 |
0.9 |
GO:0072520 |
seminiferous tubule development(GO:0072520) |
| 0.1 |
0.3 |
GO:1990086 |
lens fiber cell apoptotic process(GO:1990086) |
| 0.1 |
0.6 |
GO:0000050 |
urea cycle(GO:0000050) urea metabolic process(GO:0019627) |
| 0.1 |
0.1 |
GO:0009109 |
coenzyme catabolic process(GO:0009109) |
| 0.1 |
0.1 |
GO:1902445 |
regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 |
0.1 |
GO:0072718 |
response to cisplatin(GO:0072718) |
| 0.1 |
2.4 |
GO:0000338 |
protein deneddylation(GO:0000338) |
| 0.1 |
0.1 |
GO:0019401 |
alditol biosynthetic process(GO:0019401) |
| 0.1 |
0.6 |
GO:0070537 |
histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.1 |
0.4 |
GO:0061180 |
mammary gland epithelium development(GO:0061180) |
| 0.1 |
0.8 |
GO:0060136 |
embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 |
0.1 |
GO:0002052 |
positive regulation of neuroblast proliferation(GO:0002052) |
| 0.1 |
0.8 |
GO:0042574 |
retinal metabolic process(GO:0042574) |
| 0.1 |
0.4 |
GO:1903630 |
regulation of aminoacyl-tRNA ligase activity(GO:1903630) positive regulation of aminoacyl-tRNA ligase activity(GO:1903632) regulation of protein neddylation(GO:2000434) negative regulation of protein neddylation(GO:2000435) |
| 0.1 |
1.1 |
GO:0000395 |
mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 |
0.7 |
GO:0001561 |
fatty acid alpha-oxidation(GO:0001561) |
| 0.1 |
0.4 |
GO:0006106 |
fumarate metabolic process(GO:0006106) |
| 0.1 |
1.0 |
GO:0097428 |
protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.1 |
0.1 |
GO:1902512 |
positive regulation of apoptotic DNA fragmentation(GO:1902512) |
| 0.1 |
0.4 |
GO:0040031 |
snRNA pseudouridine synthesis(GO:0031120) snRNA modification(GO:0040031) |
| 0.1 |
1.0 |
GO:0060501 |
positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.1 |
0.8 |
GO:0042276 |
error-prone translesion synthesis(GO:0042276) |
| 0.1 |
0.6 |
GO:0018242 |
protein O-linked glycosylation via serine(GO:0018242) |
| 0.1 |
1.2 |
GO:0090205 |
positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.1 |
0.1 |
GO:0046544 |
development of secondary male sexual characteristics(GO:0046544) |
| 0.1 |
0.3 |
GO:0046874 |
quinolinate metabolic process(GO:0046874) |
| 0.1 |
0.4 |
GO:0070476 |
rRNA (guanine-N7)-methylation(GO:0070476) |
| 0.1 |
0.1 |
GO:1903377 |
negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 |
0.7 |
GO:0071294 |
cellular response to zinc ion(GO:0071294) |
| 0.1 |
1.4 |
GO:0003084 |
positive regulation of systemic arterial blood pressure(GO:0003084) |
| 0.1 |
1.0 |
GO:0001842 |
neural fold formation(GO:0001842) |
| 0.1 |
0.3 |
GO:1904170 |
regulation of bleb assembly(GO:1904170) |
| 0.1 |
0.7 |
GO:0060576 |
intestinal epithelial cell development(GO:0060576) |
| 0.1 |
0.3 |
GO:0070345 |
negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 |
1.4 |
GO:0007440 |
foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.1 |
1.2 |
GO:0006471 |
protein ADP-ribosylation(GO:0006471) |
| 0.1 |
1.1 |
GO:0090043 |
regulation of tubulin deacetylation(GO:0090043) |
| 0.1 |
0.7 |
GO:0050434 |
positive regulation of viral transcription(GO:0050434) |
| 0.1 |
0.4 |
GO:1990046 |
positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) stress-induced mitochondrial fusion(GO:1990046) |
| 0.1 |
0.3 |
GO:1904690 |
regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 |
0.5 |
GO:0000492 |
box C/D snoRNP assembly(GO:0000492) |
| 0.1 |
0.5 |
GO:0031581 |
hemidesmosome assembly(GO:0031581) |
| 0.1 |
0.5 |
GO:0030202 |
heparin metabolic process(GO:0030202) |
| 0.1 |
0.4 |
GO:0060800 |
regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.1 |
0.3 |
GO:0060677 |
ureteric bud elongation(GO:0060677) |
| 0.1 |
0.4 |
GO:0061739 |
protein lipidation involved in autophagosome assembly(GO:0061739) |
| 0.1 |
0.8 |
GO:0007144 |
female meiosis I(GO:0007144) |
| 0.1 |
0.3 |
GO:1901642 |
purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
| 0.1 |
0.4 |
GO:0015938 |
coenzyme A catabolic process(GO:0015938) nucleoside bisphosphate catabolic process(GO:0033869) ribonucleoside bisphosphate catabolic process(GO:0034031) purine nucleoside bisphosphate catabolic process(GO:0034034) |
| 0.1 |
0.1 |
GO:0010593 |
negative regulation of lamellipodium assembly(GO:0010593) |
| 0.1 |
0.4 |
GO:0034473 |
U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
| 0.1 |
0.4 |
GO:0070634 |
transepithelial ammonium transport(GO:0070634) |
| 0.1 |
1.4 |
GO:0046784 |
viral mRNA export from host cell nucleus(GO:0046784) |
| 0.1 |
0.1 |
GO:0031017 |
exocrine pancreas development(GO:0031017) |
| 0.1 |
0.4 |
GO:1902498 |
regulation of protein autoubiquitination(GO:1902498) |
| 0.1 |
1.4 |
GO:0033234 |
negative regulation of protein sumoylation(GO:0033234) |
| 0.1 |
0.4 |
GO:0014816 |
skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.1 |
0.5 |
GO:0035582 |
sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.1 |
1.5 |
GO:0021978 |
telencephalon regionalization(GO:0021978) |
| 0.1 |
0.4 |
GO:0006546 |
glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 |
0.4 |
GO:0098869 |
cellular oxidant detoxification(GO:0098869) |
| 0.1 |
0.4 |
GO:0006116 |
NADH oxidation(GO:0006116) |
| 0.1 |
0.6 |
GO:0018158 |
protein oxidation(GO:0018158) |
| 0.1 |
0.4 |
GO:0001980 |
regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
| 0.1 |
0.8 |
GO:0006501 |
C-terminal protein lipidation(GO:0006501) |
| 0.1 |
0.4 |
GO:0015793 |
glycerol transport(GO:0015793) |
| 0.1 |
0.1 |
GO:0035456 |
response to interferon-beta(GO:0035456) |
| 0.1 |
1.1 |
GO:0000188 |
inactivation of MAPK activity(GO:0000188) |
| 0.1 |
1.4 |
GO:0008272 |
sulfate transport(GO:0008272) |
| 0.1 |
0.2 |
GO:2000834 |
androgen secretion(GO:0035935) testosterone secretion(GO:0035936) regulation of androgen secretion(GO:2000834) regulation of testosterone secretion(GO:2000843) |
| 0.1 |
0.7 |
GO:0044241 |
lipid digestion(GO:0044241) |
| 0.1 |
0.2 |
GO:0032780 |
negative regulation of ATPase activity(GO:0032780) |
| 0.1 |
0.5 |
GO:0098915 |
membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.1 |
0.4 |
GO:2000383 |
regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.1 |
1.0 |
GO:0042167 |
porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.1 |
1.2 |
GO:0031119 |
tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 |
0.1 |
GO:0046349 |
amino sugar biosynthetic process(GO:0046349) |
| 0.1 |
0.6 |
GO:1990839 |
response to endothelin(GO:1990839) |
| 0.1 |
0.1 |
GO:1902174 |
positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 |
1.2 |
GO:0048934 |
peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.1 |
4.0 |
GO:0045737 |
positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.1 |
0.1 |
GO:0006636 |
unsaturated fatty acid biosynthetic process(GO:0006636) |
| 0.1 |
0.2 |
GO:0006507 |
GPI anchor release(GO:0006507) |
| 0.1 |
0.1 |
GO:0021937 |
cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.1 |
0.6 |
GO:0044829 |
positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 |
1.1 |
GO:0043403 |
skeletal muscle tissue regeneration(GO:0043403) |
| 0.1 |
0.1 |
GO:0021520 |
spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.1 |
0.7 |
GO:0045218 |
zonula adherens maintenance(GO:0045218) |
| 0.1 |
0.5 |
GO:0045759 |
negative regulation of action potential(GO:0045759) |
| 0.1 |
1.2 |
GO:0003334 |
keratinocyte development(GO:0003334) |
| 0.1 |
0.7 |
GO:0036089 |
cleavage furrow formation(GO:0036089) |
| 0.1 |
0.6 |
GO:0006513 |
protein monoubiquitination(GO:0006513) |
| 0.1 |
0.3 |
GO:0032474 |
otolith morphogenesis(GO:0032474) |
| 0.1 |
0.1 |
GO:0035912 |
dorsal aorta morphogenesis(GO:0035912) |
| 0.1 |
0.9 |
GO:2000381 |
negative regulation of mesoderm development(GO:2000381) |
| 0.1 |
6.0 |
GO:0050830 |
defense response to Gram-positive bacterium(GO:0050830) |
| 0.1 |
0.3 |
GO:0018094 |
protein polyglycylation(GO:0018094) |
| 0.1 |
1.9 |
GO:0035067 |
negative regulation of histone acetylation(GO:0035067) |
| 0.1 |
0.3 |
GO:0002940 |
tRNA N2-guanine methylation(GO:0002940) |
| 0.1 |
1.0 |
GO:0043249 |
erythrocyte maturation(GO:0043249) |
| 0.1 |
1.1 |
GO:0060355 |
positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.1 |
0.2 |
GO:0032627 |
interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.1 |
0.5 |
GO:0046909 |
intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
| 0.1 |
0.2 |
GO:0009051 |
pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 |
0.2 |
GO:0035441 |
cell migration involved in vasculogenesis(GO:0035441) |
| 0.1 |
0.8 |
GO:0007320 |
insemination(GO:0007320) |
| 0.1 |
0.3 |
GO:0043456 |
regulation of pentose-phosphate shunt(GO:0043456) |
| 0.1 |
0.9 |
GO:0009048 |
dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.1 |
0.6 |
GO:2000194 |
regulation of female gonad development(GO:2000194) |
| 0.1 |
0.3 |
GO:0072139 |
glomerular parietal epithelial cell differentiation(GO:0072139) |
| 0.1 |
0.4 |
GO:0000303 |
response to superoxide(GO:0000303) |
| 0.1 |
1.7 |
GO:0060261 |
positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.1 |
0.9 |
GO:0000290 |
deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 |
1.7 |
GO:0030150 |
protein import into mitochondrial matrix(GO:0030150) |
| 0.1 |
0.1 |
GO:0061484 |
hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 |
0.4 |
GO:0032525 |
somite rostral/caudal axis specification(GO:0032525) |
| 0.1 |
0.4 |
GO:0001562 |
response to protozoan(GO:0001562) |
| 0.1 |
0.1 |
GO:0046599 |
regulation of centriole replication(GO:0046599) |
| 0.1 |
0.2 |
GO:2000152 |
regulation of ubiquitin-specific protease activity(GO:2000152) |
| 0.1 |
1.4 |
GO:0030890 |
positive regulation of B cell proliferation(GO:0030890) |
| 0.1 |
1.2 |
GO:0061302 |
smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 |
0.1 |
GO:0031622 |
positive regulation of fever generation(GO:0031622) |
| 0.1 |
0.2 |
GO:1902915 |
negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.1 |
0.1 |
GO:0045359 |
positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.1 |
0.3 |
GO:0030043 |
actin filament fragmentation(GO:0030043) |
| 0.1 |
0.9 |
GO:1902749 |
regulation of cell cycle G2/M phase transition(GO:1902749) |
| 0.1 |
0.2 |
GO:1903998 |
regulation of eating behavior(GO:1903998) |
| 0.1 |
0.6 |
GO:0010815 |
bradykinin catabolic process(GO:0010815) |
| 0.1 |
0.2 |
GO:0014846 |
esophagus smooth muscle contraction(GO:0014846) |
| 0.1 |
0.1 |
GO:0002347 |
response to tumor cell(GO:0002347) |
| 0.1 |
0.4 |
GO:1903527 |
positive regulation of membrane tubulation(GO:1903527) |
| 0.1 |
0.4 |
GO:0031937 |
positive regulation of chromatin silencing(GO:0031937) |
| 0.1 |
0.6 |
GO:2000679 |
positive regulation of transcription regulatory region DNA binding(GO:2000679) |
| 0.1 |
1.8 |
GO:1902857 |
positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.1 |
0.8 |
GO:0010606 |
positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.1 |
0.3 |
GO:0048698 |
negative regulation of collateral sprouting in absence of injury(GO:0048698) |
| 0.1 |
0.3 |
GO:1904578 |
response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
| 0.1 |
0.9 |
GO:0048096 |
chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.1 |
0.3 |
GO:0043267 |
negative regulation of potassium ion transport(GO:0043267) |
| 0.1 |
0.5 |
GO:0000447 |
endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 |
0.7 |
GO:0070458 |
detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.1 |
0.3 |
GO:2001137 |
positive regulation of endocytic recycling(GO:2001137) |
| 0.1 |
0.6 |
GO:0021891 |
olfactory bulb interneuron development(GO:0021891) |
| 0.1 |
0.9 |
GO:0031274 |
regulation of pseudopodium assembly(GO:0031272) positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 |
0.4 |
GO:0002553 |
histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 |
0.6 |
GO:0044854 |
plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
| 0.1 |
0.9 |
GO:0042744 |
hydrogen peroxide catabolic process(GO:0042744) |
| 0.1 |
0.2 |
GO:0043415 |
positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 |
1.1 |
GO:0034498 |
early endosome to Golgi transport(GO:0034498) |
| 0.1 |
0.3 |
GO:0046073 |
dTMP biosynthetic process(GO:0006231) dTMP metabolic process(GO:0046073) |
| 0.1 |
0.9 |
GO:1990182 |
exosomal secretion(GO:1990182) |
| 0.1 |
0.5 |
GO:1900017 |
positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 |
1.1 |
GO:0046548 |
retinal rod cell development(GO:0046548) |
| 0.1 |
0.5 |
GO:0051461 |
regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.1 |
0.4 |
GO:0060024 |
rhythmic synaptic transmission(GO:0060024) |
| 0.1 |
0.2 |
GO:0042730 |
fibrinolysis(GO:0042730) |
| 0.1 |
1.0 |
GO:0018065 |
protein-cofactor linkage(GO:0018065) |
| 0.1 |
1.4 |
GO:0051310 |
metaphase plate congression(GO:0051310) |
| 0.1 |
3.0 |
GO:0045600 |
positive regulation of fat cell differentiation(GO:0045600) |
| 0.1 |
1.6 |
GO:0042407 |
cristae formation(GO:0042407) |
| 0.1 |
0.5 |
GO:0001672 |
regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 |
0.4 |
GO:0002862 |
negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
| 0.1 |
0.4 |
GO:1904668 |
positive regulation of ubiquitin protein ligase activity(GO:1904668) |
| 0.1 |
0.4 |
GO:0007064 |
mitotic sister chromatid cohesion(GO:0007064) |
| 0.1 |
0.3 |
GO:0002408 |
myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.1 |
0.4 |
GO:0002175 |
protein localization to paranode region of axon(GO:0002175) |
| 0.1 |
0.2 |
GO:0097527 |
necroptotic signaling pathway(GO:0097527) |
| 0.1 |
0.4 |
GO:0043461 |
proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.1 |
0.1 |
GO:0080144 |
amino acid homeostasis(GO:0080144) |
| 0.1 |
0.4 |
GO:0006420 |
arginyl-tRNA aminoacylation(GO:0006420) |
| 0.1 |
0.2 |
GO:0018149 |
peptide cross-linking(GO:0018149) |
| 0.1 |
0.4 |
GO:0007140 |
male meiosis(GO:0007140) |
| 0.1 |
0.3 |
GO:0031954 |
positive regulation of protein autophosphorylation(GO:0031954) |
| 0.1 |
0.2 |
GO:0045603 |
positive regulation of endothelial cell differentiation(GO:0045603) positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.1 |
0.2 |
GO:0001771 |
immunological synapse formation(GO:0001771) |
| 0.1 |
0.3 |
GO:1902231 |
positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 |
1.1 |
GO:0071392 |
cellular response to estradiol stimulus(GO:0071392) |
| 0.1 |
0.3 |
GO:0006189 |
'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 |
0.1 |
GO:0000727 |
double-strand break repair via break-induced replication(GO:0000727) |
| 0.1 |
0.3 |
GO:0030540 |
female genitalia development(GO:0030540) |
| 0.1 |
0.3 |
GO:0044208 |
'de novo' AMP biosynthetic process(GO:0044208) |
| 0.1 |
0.3 |
GO:0050747 |
positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 |
0.6 |
GO:0070886 |
positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 |
0.2 |
GO:2000823 |
regulation of androgen receptor activity(GO:2000823) |
| 0.1 |
0.3 |
GO:0006549 |
isoleucine metabolic process(GO:0006549) |
| 0.1 |
0.3 |
GO:1902396 |
protein localization to bicellular tight junction(GO:1902396) |
| 0.1 |
0.6 |
GO:0000076 |
DNA replication checkpoint(GO:0000076) |
| 0.1 |
0.3 |
GO:0032497 |
detection of lipopolysaccharide(GO:0032497) |
| 0.1 |
0.4 |
GO:0032331 |
negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.1 |
0.5 |
GO:0072675 |
multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
| 0.1 |
1.1 |
GO:0097284 |
hepatocyte apoptotic process(GO:0097284) |
| 0.1 |
0.2 |
GO:1904666 |
regulation of ubiquitin protein ligase activity(GO:1904666) |
| 0.1 |
0.6 |
GO:0006646 |
phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 |
0.3 |
GO:0035621 |
ER to Golgi ceramide transport(GO:0035621) ceramide transport(GO:0035627) |
| 0.1 |
0.1 |
GO:0021529 |
spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
| 0.1 |
0.5 |
GO:0071459 |
protein localization to kinetochore(GO:0034501) protein localization to chromosome, centromeric region(GO:0071459) |
| 0.1 |
0.2 |
GO:2000628 |
regulation of miRNA metabolic process(GO:2000628) |
| 0.1 |
0.2 |
GO:0002385 |
organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.1 |
0.5 |
GO:0030948 |
negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 |
0.3 |
GO:0006030 |
chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.1 |
0.4 |
GO:0042795 |
snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.1 |
0.6 |
GO:1900262 |
regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.1 |
0.4 |
GO:0035095 |
behavioral response to nicotine(GO:0035095) |
| 0.1 |
0.1 |
GO:0046985 |
positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.1 |
0.2 |
GO:0071649 |
chemokine (C-C motif) ligand 5 production(GO:0071609) regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.1 |
0.4 |
GO:0019731 |
antibacterial humoral response(GO:0019731) |
| 0.1 |
1.1 |
GO:0006516 |
glycoprotein catabolic process(GO:0006516) |
| 0.1 |
0.3 |
GO:0046902 |
regulation of mitochondrial membrane permeability(GO:0046902) regulation of membrane permeability(GO:0090559) |
| 0.1 |
2.1 |
GO:0030901 |
midbrain development(GO:0030901) |
| 0.1 |
0.7 |
GO:0046827 |
positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 |
0.3 |
GO:0006419 |
alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 |
0.7 |
GO:0006968 |
cellular defense response(GO:0006968) |
| 0.1 |
0.3 |
GO:0070813 |
hydrogen sulfide metabolic process(GO:0070813) |
| 0.1 |
0.1 |
GO:0071772 |
response to BMP(GO:0071772) cellular response to BMP stimulus(GO:0071773) |
| 0.1 |
0.4 |
GO:1901164 |
negative regulation of trophoblast cell migration(GO:1901164) |
| 0.1 |
1.8 |
GO:0007566 |
embryo implantation(GO:0007566) |
| 0.1 |
0.8 |
GO:0060390 |
regulation of SMAD protein import into nucleus(GO:0060390) positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.1 |
0.4 |
GO:0007253 |
cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.1 |
0.4 |
GO:0051189 |
molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 |
0.4 |
GO:0044872 |
lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 |
0.1 |
GO:0070782 |
phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.1 |
0.2 |
GO:0038027 |
apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 0.1 |
0.3 |
GO:0001869 |
regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
| 0.1 |
1.3 |
GO:0045672 |
positive regulation of osteoclast differentiation(GO:0045672) |
| 0.1 |
0.1 |
GO:1900377 |
negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 |
0.3 |
GO:0031999 |
negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.1 |
0.3 |
GO:2000653 |
regulation of genetic imprinting(GO:2000653) |
| 0.1 |
1.1 |
GO:0043162 |
ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 |
0.1 |
GO:0051593 |
response to folic acid(GO:0051593) |
| 0.1 |
0.3 |
GO:2000324 |
positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.1 |
0.7 |
GO:0007076 |
mitotic chromosome condensation(GO:0007076) |
| 0.1 |
0.3 |
GO:0009446 |
putrescine biosynthetic process(GO:0009446) |
| 0.1 |
0.3 |
GO:0097070 |
ductus arteriosus closure(GO:0097070) |
| 0.1 |
0.2 |
GO:0061304 |
retinal blood vessel morphogenesis(GO:0061304) |
| 0.1 |
0.3 |
GO:0033313 |
meiotic cell cycle checkpoint(GO:0033313) |
| 0.1 |
1.1 |
GO:0043486 |
histone exchange(GO:0043486) |
| 0.1 |
0.4 |
GO:0031087 |
deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 |
0.2 |
GO:0008625 |
extrinsic apoptotic signaling pathway via death domain receptors(GO:0008625) |
| 0.1 |
0.1 |
GO:0048875 |
chemical homeostasis within a tissue(GO:0048875) |
| 0.1 |
0.1 |
GO:0097011 |
cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.1 |
0.5 |
GO:0001996 |
regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) positive regulation of heart rate by epinephrine(GO:0003065) positive regulation of blood pressure by epinephrine-norepinephrine(GO:0003321) |
| 0.1 |
0.2 |
GO:0042637 |
catagen(GO:0042637) |
| 0.1 |
0.4 |
GO:0090005 |
negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.1 |
0.6 |
GO:0042590 |
antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 |
0.7 |
GO:0050765 |
negative regulation of phagocytosis(GO:0050765) |
| 0.1 |
0.5 |
GO:1903755 |
regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
| 0.1 |
0.2 |
GO:0051315 |
attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.1 |
0.8 |
GO:2000811 |
negative regulation of anoikis(GO:2000811) |
| 0.1 |
0.6 |
GO:0034244 |
negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 |
0.8 |
GO:0046782 |
regulation of viral transcription(GO:0046782) |
| 0.1 |
0.2 |
GO:0090071 |
negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 |
0.4 |
GO:0006048 |
UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.1 |
0.9 |
GO:0030199 |
collagen fibril organization(GO:0030199) |
| 0.1 |
0.2 |
GO:0071394 |
cellular response to testosterone stimulus(GO:0071394) |
| 0.1 |
0.3 |
GO:0046322 |
negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 |
0.3 |
GO:0001955 |
blood vessel maturation(GO:0001955) |
| 0.1 |
0.2 |
GO:0016572 |
histone phosphorylation(GO:0016572) |
| 0.1 |
0.5 |
GO:0006855 |
drug transmembrane transport(GO:0006855) |
| 0.1 |
0.8 |
GO:0021854 |
hypothalamus development(GO:0021854) |
| 0.1 |
0.6 |
GO:0006517 |
protein deglycosylation(GO:0006517) |
| 0.1 |
0.2 |
GO:0051305 |
chromosome movement towards spindle pole(GO:0051305) |
| 0.1 |
0.5 |
GO:0009235 |
cobalamin metabolic process(GO:0009235) |
| 0.1 |
0.2 |
GO:0006336 |
DNA replication-independent nucleosome assembly(GO:0006336) |
| 0.1 |
0.9 |
GO:0051044 |
positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.1 |
0.5 |
GO:0031297 |
replication fork processing(GO:0031297) DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.1 |
1.2 |
GO:1902622 |
regulation of neutrophil migration(GO:1902622) |
| 0.1 |
0.2 |
GO:0060023 |
soft palate development(GO:0060023) |
| 0.1 |
0.1 |
GO:0002589 |
regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
| 0.1 |
0.6 |
GO:0051450 |
myoblast proliferation(GO:0051450) |
| 0.1 |
0.1 |
GO:0042089 |
cytokine biosynthetic process(GO:0042089) cytokine metabolic process(GO:0042107) |
| 0.1 |
0.6 |
GO:0006378 |
mRNA polyadenylation(GO:0006378) |
| 0.1 |
0.1 |
GO:0019244 |
lactate biosynthetic process from pyruvate(GO:0019244) |
| 0.1 |
0.3 |
GO:0046368 |
GDP-L-fucose metabolic process(GO:0046368) |
| 0.1 |
0.1 |
GO:0002295 |
T-helper cell lineage commitment(GO:0002295) |
| 0.1 |
0.2 |
GO:0001180 |
transcription initiation from RNA polymerase I promoter for nuclear large rRNA transcript(GO:0001180) |
| 0.1 |
0.1 |
GO:0048557 |
embryonic digestive tract morphogenesis(GO:0048557) |
| 0.1 |
0.1 |
GO:0046689 |
response to mercury ion(GO:0046689) |
| 0.1 |
0.1 |
GO:0015721 |
bile acid and bile salt transport(GO:0015721) |
| 0.1 |
0.7 |
GO:2000637 |
positive regulation of gene silencing by miRNA(GO:2000637) |
| 0.1 |
0.4 |
GO:0050872 |
white fat cell differentiation(GO:0050872) |
| 0.1 |
0.2 |
GO:0046321 |
positive regulation of fatty acid beta-oxidation(GO:0032000) positive regulation of fatty acid oxidation(GO:0046321) |
| 0.1 |
0.1 |
GO:0097411 |
hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 |
0.2 |
GO:0051030 |
snRNA transport(GO:0051030) |
| 0.1 |
0.1 |
GO:0003162 |
atrioventricular node development(GO:0003162) |
| 0.1 |
0.4 |
GO:0045048 |
protein insertion into ER membrane(GO:0045048) |
| 0.1 |
0.2 |
GO:0001306 |
age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.1 |
0.2 |
GO:0070307 |
lens fiber cell development(GO:0070307) |
| 0.1 |
0.3 |
GO:0098535 |
de novo centriole assembly(GO:0098535) |
| 0.1 |
1.6 |
GO:0016925 |
protein sumoylation(GO:0016925) |
| 0.1 |
0.1 |
GO:0010825 |
positive regulation of centrosome duplication(GO:0010825) |
| 0.1 |
0.1 |
GO:0060414 |
aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.1 |
0.4 |
GO:0090103 |
cochlea morphogenesis(GO:0090103) |
| 0.1 |
0.1 |
GO:2000987 |
positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.1 |
0.1 |
GO:0019400 |
alditol metabolic process(GO:0019400) |
| 0.1 |
0.1 |
GO:0071673 |
positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.1 |
0.8 |
GO:0009299 |
mRNA transcription(GO:0009299) |
| 0.1 |
0.6 |
GO:0051457 |
maintenance of protein location in nucleus(GO:0051457) |
| 0.1 |
0.1 |
GO:0043950 |
positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.1 |
0.2 |
GO:1901857 |
positive regulation of cellular respiration(GO:1901857) |
| 0.1 |
0.2 |
GO:0051096 |
regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 |
0.1 |
GO:0009838 |
abscission(GO:0009838) negative regulation of cytokinesis(GO:0032466) |
| 0.1 |
0.3 |
GO:0032911 |
negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 |
0.3 |
GO:0050857 |
positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) |
| 0.1 |
0.2 |
GO:1901970 |
positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of mitotic sister chromatid separation(GO:1901970) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.1 |
0.3 |
GO:0046645 |
positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
| 0.1 |
0.5 |
GO:0019262 |
N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 |
0.1 |
GO:0070966 |
nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 |
1.8 |
GO:0042168 |
heme metabolic process(GO:0042168) |
| 0.1 |
0.1 |
GO:0006590 |
thyroid hormone generation(GO:0006590) |
| 0.1 |
0.9 |
GO:0043248 |
proteasome assembly(GO:0043248) |
| 0.1 |
0.5 |
GO:0006228 |
UTP biosynthetic process(GO:0006228) |
| 0.1 |
0.3 |
GO:0021511 |
spinal cord patterning(GO:0021511) |
| 0.1 |
0.7 |
GO:0016226 |
iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.1 |
0.1 |
GO:0098912 |
membrane depolarization during atrial cardiac muscle cell action potential(GO:0098912) |
| 0.1 |
0.3 |
GO:0032494 |
response to peptidoglycan(GO:0032494) |
| 0.1 |
2.6 |
GO:0097031 |
NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.1 |
0.3 |
GO:0010574 |
regulation of vascular endothelial growth factor production(GO:0010574) |
| 0.1 |
0.2 |
GO:0046900 |
tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
| 0.1 |
0.4 |
GO:0045792 |
negative regulation of cell size(GO:0045792) |
| 0.1 |
1.1 |
GO:0001913 |
T cell mediated cytotoxicity(GO:0001913) |
| 0.1 |
0.1 |
GO:0035963 |
response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.1 |
0.2 |
GO:0061537 |
glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.1 |
0.2 |
GO:2000314 |
negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
| 0.1 |
0.1 |
GO:0060479 |
lung cell differentiation(GO:0060479) lung epithelial cell differentiation(GO:0060487) |
| 0.1 |
0.2 |
GO:0032510 |
endosome to lysosome transport via multivesicular body sorting pathway(GO:0032510) |
| 0.1 |
0.1 |
GO:0098534 |
centriole replication(GO:0007099) centriole assembly(GO:0098534) |
| 0.1 |
0.3 |
GO:0045217 |
cell-cell junction maintenance(GO:0045217) |
| 0.1 |
0.2 |
GO:1902608 |
regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.1 |
0.3 |
GO:0032836 |
glomerular basement membrane development(GO:0032836) |
| 0.1 |
0.6 |
GO:0014823 |
response to activity(GO:0014823) |
| 0.1 |
0.9 |
GO:0040034 |
regulation of development, heterochronic(GO:0040034) |
| 0.1 |
2.4 |
GO:0043966 |
histone H3 acetylation(GO:0043966) |
| 0.1 |
0.5 |
GO:0039703 |
viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 |
0.4 |
GO:0006363 |
termination of RNA polymerase I transcription(GO:0006363) |
| 0.1 |
0.6 |
GO:0032876 |
regulation of DNA endoreduplication(GO:0032875) negative regulation of DNA endoreduplication(GO:0032876) DNA endoreduplication(GO:0042023) |
| 0.1 |
0.1 |
GO:0032729 |
positive regulation of interferon-gamma production(GO:0032729) |
| 0.1 |
0.4 |
GO:0090169 |
regulation of spindle assembly(GO:0090169) regulation of mitotic spindle assembly(GO:1901673) |
| 0.1 |
0.3 |
GO:2000301 |
negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 |
0.1 |
GO:1902953 |
positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.1 |
0.8 |
GO:1902043 |
positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 |
0.7 |
GO:0009125 |
nucleoside monophosphate catabolic process(GO:0009125) |
| 0.1 |
0.1 |
GO:0090184 |
positive regulation of kidney development(GO:0090184) |
| 0.1 |
0.2 |
GO:0046604 |
positive regulation of mitotic centrosome separation(GO:0046604) |
| 0.1 |
0.6 |
GO:0009404 |
toxin metabolic process(GO:0009404) |
| 0.1 |
0.1 |
GO:1904779 |
regulation of protein localization to centrosome(GO:1904779) |
| 0.1 |
0.5 |
GO:0031572 |
G2 DNA damage checkpoint(GO:0031572) |
| 0.1 |
0.5 |
GO:0030261 |
chromosome condensation(GO:0030261) |
| 0.1 |
0.2 |
GO:0043489 |
RNA stabilization(GO:0043489) |
| 0.1 |
2.7 |
GO:0042073 |
intraciliary transport(GO:0042073) |
| 0.1 |
0.4 |
GO:0015074 |
DNA integration(GO:0015074) |
| 0.1 |
0.9 |
GO:0007614 |
short-term memory(GO:0007614) |
| 0.1 |
0.1 |
GO:0045653 |
negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.1 |
1.3 |
GO:0015985 |
energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 |
0.3 |
GO:1900016 |
negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 |
0.1 |
GO:0003338 |
metanephros morphogenesis(GO:0003338) |
| 0.1 |
0.4 |
GO:0010457 |
centriole-centriole cohesion(GO:0010457) |
| 0.1 |
0.2 |
GO:0002374 |
cytokine secretion involved in immune response(GO:0002374) regulation of cytokine secretion involved in immune response(GO:0002739) positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.1 |
0.1 |
GO:0032532 |
regulation of microvillus length(GO:0032532) |
| 0.1 |
0.2 |
GO:0070633 |
transepithelial transport(GO:0070633) |
| 0.1 |
0.2 |
GO:0006432 |
phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 |
0.1 |
GO:0090269 |
fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.1 |
0.3 |
GO:0070977 |
bone maturation(GO:0070977) |
| 0.1 |
0.4 |
GO:0043201 |
response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.1 |
0.2 |
GO:0036265 |
RNA (guanine-N7)-methylation(GO:0036265) |
| 0.1 |
0.5 |
GO:0060009 |
Sertoli cell development(GO:0060009) |
| 0.1 |
0.6 |
GO:0090224 |
regulation of mitotic spindle organization(GO:0060236) regulation of spindle organization(GO:0090224) |
| 0.1 |
0.1 |
GO:0032056 |
positive regulation of translation in response to stress(GO:0032056) |
| 0.1 |
0.2 |
GO:0071361 |
cellular response to ethanol(GO:0071361) |
| 0.1 |
0.6 |
GO:0030574 |
collagen catabolic process(GO:0030574) |
| 0.1 |
0.3 |
GO:0031397 |
negative regulation of protein ubiquitination(GO:0031397) |
| 0.1 |
0.3 |
GO:0072257 |
nephron tubule epithelial cell differentiation(GO:0072160) metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.1 |
0.2 |
GO:0051533 |
positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.1 |
0.3 |
GO:0045579 |
positive regulation of B cell differentiation(GO:0045579) |
| 0.1 |
2.6 |
GO:0006505 |
GPI anchor metabolic process(GO:0006505) GPI anchor biosynthetic process(GO:0006506) |
| 0.1 |
0.2 |
GO:0009052 |
pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 |
2.2 |
GO:0030490 |
maturation of SSU-rRNA(GO:0030490) |
| 0.1 |
0.6 |
GO:0045662 |
negative regulation of myoblast differentiation(GO:0045662) |
| 0.1 |
0.5 |
GO:0048384 |
retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 |
0.2 |
GO:0001711 |
endodermal cell fate commitment(GO:0001711) |
| 0.1 |
0.3 |
GO:0045086 |
positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 |
0.1 |
GO:0007520 |
myoblast fusion(GO:0007520) |
| 0.1 |
0.2 |
GO:0033145 |
positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.1 |
0.4 |
GO:0035428 |
hexose transmembrane transport(GO:0035428) |
| 0.1 |
0.1 |
GO:0035989 |
tendon development(GO:0035989) |
| 0.1 |
0.2 |
GO:0002756 |
MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
| 0.1 |
0.2 |
GO:0043985 |
histone H4-R3 methylation(GO:0043985) |
| 0.1 |
1.0 |
GO:0008608 |
attachment of spindle microtubules to kinetochore(GO:0008608) |
| 0.1 |
0.1 |
GO:0033632 |
regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.1 |
0.5 |
GO:0090200 |
positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
| 0.1 |
1.5 |
GO:0071230 |
cellular response to amino acid stimulus(GO:0071230) |
| 0.1 |
0.6 |
GO:0042347 |
negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 |
0.5 |
GO:0015868 |
purine ribonucleotide transport(GO:0015868) |
| 0.1 |
0.1 |
GO:0061101 |
neuroendocrine cell differentiation(GO:0061101) |
| 0.1 |
0.5 |
GO:0000920 |
cell separation after cytokinesis(GO:0000920) |
| 0.1 |
0.5 |
GO:0001937 |
negative regulation of endothelial cell proliferation(GO:0001937) |
| 0.1 |
0.6 |
GO:0000463 |
maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 |
0.1 |
GO:2000323 |
regulation of glucocorticoid receptor signaling pathway(GO:2000322) negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.1 |
0.5 |
GO:0018208 |
peptidyl-proline modification(GO:0018208) |
| 0.1 |
0.1 |
GO:0040009 |
regulation of growth rate(GO:0040009) |
| 0.1 |
0.1 |
GO:0002925 |
positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
| 0.1 |
0.3 |
GO:0032467 |
positive regulation of cytokinesis(GO:0032467) |
| 0.1 |
0.2 |
GO:0006207 |
'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.1 |
0.3 |
GO:0018195 |
peptidyl-arginine modification(GO:0018195) |
| 0.1 |
0.2 |
GO:2000348 |
regulation of CD40 signaling pathway(GO:2000348) |
| 0.1 |
0.1 |
GO:0033689 |
negative regulation of osteoblast proliferation(GO:0033689) |
| 0.1 |
0.2 |
GO:0016480 |
negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 |
0.1 |
GO:2001015 |
negative regulation of skeletal muscle cell differentiation(GO:2001015) |
| 0.1 |
0.2 |
GO:0022417 |
protein maturation by protein folding(GO:0022417) |
| 0.1 |
0.1 |
GO:0045840 |
positive regulation of mitotic nuclear division(GO:0045840) |
| 0.1 |
0.2 |
GO:2001270 |
regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
| 0.1 |
0.2 |
GO:0032803 |
low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
| 0.1 |
0.2 |
GO:0019852 |
L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 |
0.3 |
GO:0036065 |
fucosylation(GO:0036065) |
| 0.1 |
0.1 |
GO:1901838 |
positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.1 |
0.1 |
GO:1901184 |
regulation of ERBB signaling pathway(GO:1901184) |
| 0.1 |
0.8 |
GO:0006379 |
mRNA cleavage(GO:0006379) |
| 0.1 |
0.4 |
GO:0045815 |
positive regulation of gene expression, epigenetic(GO:0045815) |
| 0.1 |
0.1 |
GO:0006119 |
regulation of oxidative phosphorylation(GO:0002082) oxidative phosphorylation(GO:0006119) |
| 0.1 |
1.2 |
GO:0006493 |
protein O-linked glycosylation(GO:0006493) |
| 0.1 |
0.2 |
GO:0006289 |
nucleotide-excision repair(GO:0006289) |
| 0.1 |
0.6 |
GO:0007492 |
endoderm development(GO:0007492) |
| 0.0 |
0.4 |
GO:0051307 |
meiotic chromosome separation(GO:0051307) |
| 0.0 |
0.0 |
GO:0006011 |
UDP-glucose metabolic process(GO:0006011) |
| 0.0 |
0.3 |
GO:0051013 |
microtubule severing(GO:0051013) |
| 0.0 |
0.1 |
GO:0051974 |
negative regulation of telomerase activity(GO:0051974) |
| 0.0 |
0.1 |
GO:0061085 |
regulation of histone H3-K27 methylation(GO:0061085) |
| 0.0 |
0.2 |
GO:2000210 |
positive regulation of anoikis(GO:2000210) |
| 0.0 |
0.6 |
GO:0033119 |
negative regulation of RNA splicing(GO:0033119) |
| 0.0 |
0.1 |
GO:0006167 |
AMP biosynthetic process(GO:0006167) |
| 0.0 |
0.1 |
GO:0018214 |
peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
| 0.0 |
0.0 |
GO:1990523 |
bone regeneration(GO:1990523) |
| 0.0 |
0.1 |
GO:0031953 |
negative regulation of protein autophosphorylation(GO:0031953) |
| 0.0 |
0.2 |
GO:0060338 |
regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.0 |
0.2 |
GO:0042304 |
regulation of fatty acid biosynthetic process(GO:0042304) |
| 0.0 |
2.3 |
GO:0002181 |
cytoplasmic translation(GO:0002181) |
| 0.0 |
0.2 |
GO:0006543 |
glutamine catabolic process(GO:0006543) |
| 0.0 |
0.0 |
GO:0019389 |
glucuronoside metabolic process(GO:0019389) |
| 0.0 |
0.6 |
GO:0070389 |
chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 |
0.4 |
GO:0006907 |
pinocytosis(GO:0006907) |
| 0.0 |
0.5 |
GO:0006474 |
N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 |
0.2 |
GO:0071267 |
amino acid salvage(GO:0043102) L-methionine salvage(GO:0071267) |
| 0.0 |
0.3 |
GO:0016973 |
poly(A)+ mRNA export from nucleus(GO:0016973) |
| 0.0 |
0.0 |
GO:0061051 |
positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 |
1.2 |
GO:0042775 |
mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.0 |
0.4 |
GO:0090288 |
negative regulation of cellular response to growth factor stimulus(GO:0090288) |
| 0.0 |
1.0 |
GO:0006383 |
transcription from RNA polymerase III promoter(GO:0006383) |
| 0.0 |
0.2 |
GO:0032506 |
cytokinetic process(GO:0032506) |
| 0.0 |
0.2 |
GO:0010998 |
regulation of translational initiation by eIF2 alpha phosphorylation(GO:0010998) |
| 0.0 |
0.1 |
GO:0035790 |
platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.0 |
0.3 |
GO:0035520 |
monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.0 |
0.8 |
GO:0000460 |
maturation of 5.8S rRNA(GO:0000460) |
| 0.0 |
0.4 |
GO:1904293 |
negative regulation of ERAD pathway(GO:1904293) |
| 0.0 |
0.3 |
GO:0061732 |
mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 |
0.3 |
GO:0009435 |
NAD biosynthetic process(GO:0009435) |
| 0.0 |
0.1 |
GO:0006348 |
chromatin silencing at telomere(GO:0006348) |
| 0.0 |
0.2 |
GO:0033140 |
negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
| 0.0 |
0.2 |
GO:0005981 |
regulation of glycogen catabolic process(GO:0005981) |
| 0.0 |
0.8 |
GO:0015936 |
coenzyme A metabolic process(GO:0015936) |
| 0.0 |
0.3 |
GO:0070102 |
interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.0 |
0.2 |
GO:0090050 |
positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.0 |
1.6 |
GO:0048747 |
muscle fiber development(GO:0048747) |
| 0.0 |
0.2 |
GO:0031342 |
negative regulation of cell killing(GO:0031342) |
| 0.0 |
0.4 |
GO:0043488 |
regulation of mRNA stability(GO:0043488) |
| 0.0 |
0.2 |
GO:0038166 |
angiotensin-activated signaling pathway(GO:0038166) |
| 0.0 |
0.2 |
GO:0034316 |
negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.0 |
0.2 |
GO:1903608 |
protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 |
0.1 |
GO:1903715 |
regulation of aerobic respiration(GO:1903715) |
| 0.0 |
0.1 |
GO:1901727 |
positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 |
0.2 |
GO:0060591 |
chondroblast differentiation(GO:0060591) |
| 0.0 |
0.1 |
GO:0060392 |
negative regulation of SMAD protein import into nucleus(GO:0060392) |
| 0.0 |
0.5 |
GO:0045879 |
negative regulation of smoothened signaling pathway(GO:0045879) |
| 0.0 |
0.1 |
GO:0016095 |
polyprenol catabolic process(GO:0016095) |
| 0.0 |
0.2 |
GO:0070236 |
regulation of activation-induced cell death of T cells(GO:0070235) negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 |
0.5 |
GO:0006754 |
ATP biosynthetic process(GO:0006754) |
| 0.0 |
0.1 |
GO:0080111 |
oxidative DNA demethylation(GO:0035511) DNA demethylation(GO:0080111) |
| 0.0 |
0.0 |
GO:0030951 |
establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.0 |
1.3 |
GO:0008584 |
male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
| 0.0 |
0.1 |
GO:0017185 |
peptidyl-lysine hydroxylation(GO:0017185) |
| 0.0 |
0.3 |
GO:0036037 |
CD8-positive, alpha-beta T cell activation(GO:0036037) |
| 0.0 |
0.1 |
GO:1900029 |
positive regulation of ruffle assembly(GO:1900029) |
| 0.0 |
0.2 |
GO:0015012 |
heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.0 |
0.1 |
GO:0045990 |
carbon catabolite regulation of transcription(GO:0045990) |
| 0.0 |
0.1 |
GO:0042420 |
dopamine catabolic process(GO:0042420) |
| 0.0 |
0.2 |
GO:0061436 |
establishment of skin barrier(GO:0061436) |
| 0.0 |
0.1 |
GO:0007006 |
mitochondrial membrane organization(GO:0007006) |
| 0.0 |
0.3 |
GO:0036342 |
post-anal tail morphogenesis(GO:0036342) |
| 0.0 |
0.2 |
GO:0000291 |
nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.0 |
0.1 |
GO:0016561 |
protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 |
0.0 |
GO:0016264 |
gap junction assembly(GO:0016264) |
| 0.0 |
0.2 |
GO:0032211 |
negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.0 |
0.1 |
GO:0045900 |
negative regulation of translational elongation(GO:0045900) |
| 0.0 |
0.6 |
GO:0050873 |
brown fat cell differentiation(GO:0050873) |
| 0.0 |
0.4 |
GO:2001273 |
regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.0 |
0.2 |
GO:1903232 |
melanosome assembly(GO:1903232) |
| 0.0 |
0.1 |
GO:0015712 |
hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 |
0.0 |
GO:0036295 |
cellular response to increased oxygen levels(GO:0036295) |
| 0.0 |
0.1 |
GO:0097201 |
negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
| 0.0 |
1.4 |
GO:0010501 |
RNA secondary structure unwinding(GO:0010501) |
| 0.0 |
0.1 |
GO:0030854 |
positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 |
0.1 |
GO:0019236 |
response to pheromone(GO:0019236) |
| 0.0 |
0.1 |
GO:0006997 |
nucleus organization(GO:0006997) |
| 0.0 |
0.8 |
GO:0002011 |
morphogenesis of an epithelial sheet(GO:0002011) |
| 0.0 |
2.6 |
GO:0044264 |
cellular polysaccharide metabolic process(GO:0044264) |
| 0.0 |
0.6 |
GO:0007179 |
transforming growth factor beta receptor signaling pathway(GO:0007179) |
| 0.0 |
0.1 |
GO:0006026 |
aminoglycan catabolic process(GO:0006026) |
| 0.0 |
0.1 |
GO:0071947 |
protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 |
0.0 |
GO:1904749 |
regulation of protein localization to nucleolus(GO:1904749) |
| 0.0 |
0.3 |
GO:0031639 |
plasminogen activation(GO:0031639) |
| 0.0 |
0.0 |
GO:0071838 |
cell proliferation in bone marrow(GO:0071838) |
| 0.0 |
0.1 |
GO:0006303 |
double-strand break repair via nonhomologous end joining(GO:0006303) |
| 0.0 |
0.5 |
GO:0033962 |
cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.0 |
0.2 |
GO:0043967 |
histone H4 acetylation(GO:0043967) |
| 0.0 |
0.2 |
GO:0018126 |
protein hydroxylation(GO:0018126) |
| 0.0 |
0.2 |
GO:0070914 |
UV-damage excision repair(GO:0070914) |
| 0.0 |
0.1 |
GO:0060050 |
positive regulation of protein glycosylation(GO:0060050) |
| 0.0 |
0.3 |
GO:0051923 |
sulfation(GO:0051923) |
| 0.0 |
0.4 |
GO:0050435 |
beta-amyloid metabolic process(GO:0050435) |
| 0.0 |
0.1 |
GO:0071670 |
smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 |
0.3 |
GO:0045070 |
positive regulation of viral genome replication(GO:0045070) |
| 0.0 |
0.5 |
GO:0016180 |
snRNA processing(GO:0016180) |
| 0.0 |
0.3 |
GO:0048701 |
embryonic cranial skeleton morphogenesis(GO:0048701) |
| 0.0 |
0.2 |
GO:0034982 |
mitochondrial protein processing(GO:0034982) |
| 0.0 |
0.2 |
GO:0032957 |
inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 |
1.8 |
GO:0032543 |
mitochondrial translation(GO:0032543) |
| 0.0 |
0.3 |
GO:0046596 |
regulation of viral entry into host cell(GO:0046596) negative regulation of viral entry into host cell(GO:0046597) |
| 0.0 |
0.1 |
GO:1990022 |
RNA polymerase II complex import to nucleus(GO:0044376) RNA polymerase III complex localization to nucleus(GO:1990022) |
| 0.0 |
0.1 |
GO:0075525 |
viral translational termination-reinitiation(GO:0075525) |
| 0.0 |
0.1 |
GO:0045638 |
negative regulation of myeloid cell differentiation(GO:0045638) |
| 0.0 |
0.6 |
GO:0035036 |
binding of sperm to zona pellucida(GO:0007339) sperm-egg recognition(GO:0035036) |
| 0.0 |
2.3 |
GO:0008033 |
tRNA processing(GO:0008033) |
| 0.0 |
0.1 |
GO:0002755 |
MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
| 0.0 |
0.1 |
GO:0035356 |
cellular triglyceride homeostasis(GO:0035356) |
| 0.0 |
0.9 |
GO:0000387 |
spliceosomal snRNP assembly(GO:0000387) |
| 0.0 |
1.2 |
GO:0042273 |
ribosomal large subunit biogenesis(GO:0042273) |
| 0.0 |
0.3 |
GO:0008156 |
negative regulation of DNA replication(GO:0008156) |
| 0.0 |
0.1 |
GO:0021780 |
oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.0 |
0.6 |
GO:0007050 |
cell cycle arrest(GO:0007050) |
| 0.0 |
0.0 |
GO:0046121 |
deoxyribonucleoside catabolic process(GO:0046121) |
| 0.0 |
0.6 |
GO:0061077 |
chaperone-mediated protein folding(GO:0061077) |
| 0.0 |
0.1 |
GO:0052428 |
modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.0 |
0.6 |
GO:0000184 |
nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 |
0.1 |
GO:0055070 |
copper ion homeostasis(GO:0055070) |
| 0.0 |
0.2 |
GO:1903298 |
regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
| 0.0 |
0.2 |
GO:1903273 |
regulation of sodium ion export(GO:1903273) regulation of sodium ion export from cell(GO:1903276) |
| 0.0 |
0.6 |
GO:0010259 |
multicellular organism aging(GO:0010259) |
| 0.0 |
0.5 |
GO:0070303 |
negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.0 |
1.3 |
GO:0000245 |
spliceosomal complex assembly(GO:0000245) |
| 0.0 |
0.2 |
GO:0033045 |
regulation of sister chromatid segregation(GO:0033045) |
| 0.0 |
0.7 |
GO:0003301 |
physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 |
0.7 |
GO:0006414 |
translational elongation(GO:0006414) |
| 0.0 |
0.1 |
GO:0046015 |
regulation of transcription by glucose(GO:0046015) |
| 0.0 |
0.1 |
GO:0035523 |
protein K29-linked deubiquitination(GO:0035523) |
| 0.0 |
0.1 |
GO:0071800 |
podosome assembly(GO:0071800) |
| 0.0 |
0.2 |
GO:0036158 |
outer dynein arm assembly(GO:0036158) |
| 0.0 |
0.1 |
GO:0033182 |
regulation of histone ubiquitination(GO:0033182) |
| 0.0 |
0.1 |
GO:0019348 |
dolichol metabolic process(GO:0019348) |
| 0.0 |
0.3 |
GO:0009303 |
rRNA transcription(GO:0009303) |
| 0.0 |
0.3 |
GO:2000001 |
regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 |
0.1 |
GO:0045039 |
protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 |
0.2 |
GO:0030035 |
microspike assembly(GO:0030035) |
| 0.0 |
0.2 |
GO:0001709 |
cell fate determination(GO:0001709) |
| 0.0 |
0.3 |
GO:0051693 |
actin filament capping(GO:0051693) |
| 0.0 |
0.1 |
GO:0055090 |
acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.0 |
0.0 |
GO:0030050 |
vesicle transport along actin filament(GO:0030050) |
| 0.0 |
0.1 |
GO:0002088 |
lens development in camera-type eye(GO:0002088) |
| 0.0 |
0.1 |
GO:0044253 |
positive regulation of collagen metabolic process(GO:0010714) positive regulation of collagen biosynthetic process(GO:0032967) positive regulation of multicellular organismal metabolic process(GO:0044253) |
| 0.0 |
0.2 |
GO:0006801 |
superoxide metabolic process(GO:0006801) |
| 0.0 |
0.1 |
GO:0016576 |
histone dephosphorylation(GO:0016576) |
| 0.0 |
0.1 |
GO:0014819 |
regulation of skeletal muscle contraction(GO:0014819) |
| 0.0 |
0.2 |
GO:1904217 |
regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 |
0.0 |
GO:0045933 |
positive regulation of muscle contraction(GO:0045933) |
| 0.0 |
0.2 |
GO:0051085 |
chaperone mediated protein folding requiring cofactor(GO:0051085) |
| 0.0 |
0.1 |
GO:0071391 |
cellular response to estrogen stimulus(GO:0071391) |
| 0.0 |
0.1 |
GO:0006556 |
S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 |
0.0 |
GO:0045065 |
cytotoxic T cell differentiation(GO:0045065) |
| 0.0 |
0.0 |
GO:0030238 |
male sex determination(GO:0030238) |
| 0.0 |
0.3 |
GO:0097034 |
mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.0 |
0.3 |
GO:0045116 |
protein neddylation(GO:0045116) |
| 0.0 |
0.1 |
GO:0019433 |
triglyceride catabolic process(GO:0019433) |
| 0.0 |
0.3 |
GO:0090161 |
Golgi ribbon formation(GO:0090161) |
| 0.0 |
0.2 |
GO:0050901 |
leukocyte tethering or rolling(GO:0050901) |
| 0.0 |
0.0 |
GO:0001923 |
B-1 B cell differentiation(GO:0001923) |
| 0.0 |
0.2 |
GO:0060159 |
regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 |
0.5 |
GO:0045599 |
negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 |
0.3 |
GO:0043252 |
sodium-independent organic anion transport(GO:0043252) |
| 0.0 |
0.4 |
GO:0010972 |
negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 0.0 |
0.4 |
GO:0008637 |
apoptotic mitochondrial changes(GO:0008637) |
| 0.0 |
0.1 |
GO:0060706 |
cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.0 |
0.2 |
GO:0036297 |
interstrand cross-link repair(GO:0036297) |
| 0.0 |
0.0 |
GO:0000722 |
telomere maintenance via recombination(GO:0000722) |
| 0.0 |
0.0 |
GO:0038061 |
NIK/NF-kappaB signaling(GO:0038061) |
| 0.0 |
0.1 |
GO:0071883 |
activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.0 |
0.1 |
GO:0051901 |
positive regulation of mitochondrial depolarization(GO:0051901) |
| 0.0 |
0.2 |
GO:1900027 |
regulation of ruffle assembly(GO:1900027) |
| 0.0 |
0.6 |
GO:0010633 |
negative regulation of epithelial cell migration(GO:0010633) |
| 0.0 |
4.3 |
GO:0008380 |
RNA splicing(GO:0008380) |
| 0.0 |
0.0 |
GO:0019530 |
taurine metabolic process(GO:0019530) |
| 0.0 |
0.2 |
GO:1901071 |
glucosamine-containing compound metabolic process(GO:1901071) |
| 0.0 |
0.1 |
GO:0006953 |
acute-phase response(GO:0006953) |
| 0.0 |
0.0 |
GO:0051775 |
response to redox state(GO:0051775) |
| 0.0 |
0.1 |
GO:0032608 |
interferon-beta production(GO:0032608) regulation of interferon-beta production(GO:0032648) |
| 0.0 |
0.3 |
GO:0002474 |
antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
| 0.0 |
0.0 |
GO:0090370 |
negative regulation of sterol transport(GO:0032372) negative regulation of cholesterol transport(GO:0032375) negative regulation of cholesterol efflux(GO:0090370) |
| 0.0 |
0.1 |
GO:0045669 |
positive regulation of osteoblast differentiation(GO:0045669) |
| 0.0 |
0.1 |
GO:0042572 |
retinol metabolic process(GO:0042572) |
| 0.0 |
0.3 |
GO:0060325 |
face morphogenesis(GO:0060325) |
| 0.0 |
0.3 |
GO:0050684 |
regulation of mRNA processing(GO:0050684) |
| 0.0 |
0.0 |
GO:0001920 |
negative regulation of receptor recycling(GO:0001920) |
| 0.0 |
0.1 |
GO:0045838 |
positive regulation of membrane potential(GO:0045838) |
| 0.0 |
0.0 |
GO:0072378 |
blood coagulation, fibrin clot formation(GO:0072378) |
| 0.0 |
0.2 |
GO:0050853 |
B cell receptor signaling pathway(GO:0050853) |
| 0.0 |
0.0 |
GO:0070315 |
G1 to G0 transition involved in cell differentiation(GO:0070315) |
| 0.0 |
0.0 |
GO:2000774 |
positive regulation of cellular senescence(GO:2000774) |
| 0.0 |
0.1 |
GO:0070508 |
sterol import(GO:0035376) cholesterol import(GO:0070508) |
| 0.0 |
0.1 |
GO:0080184 |
response to stilbenoid(GO:0035634) response to phenylpropanoid(GO:0080184) |
| 0.0 |
0.1 |
GO:0001867 |
complement activation, lectin pathway(GO:0001867) |
| 0.0 |
0.1 |
GO:1903966 |
monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.0 |
0.2 |
GO:0030497 |
fatty acid elongation(GO:0030497) |
| 0.0 |
0.1 |
GO:0097194 |
execution phase of apoptosis(GO:0097194) |
| 0.0 |
0.1 |
GO:0007094 |
mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.0 |
0.1 |
GO:0006362 |
transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 |
0.0 |
GO:2000404 |
regulation of T cell migration(GO:2000404) |
| 0.0 |
0.0 |
GO:0006544 |
glycine metabolic process(GO:0006544) |
| 0.0 |
3.7 |
GO:0006412 |
translation(GO:0006412) |
| 0.0 |
0.1 |
GO:0048661 |
positive regulation of smooth muscle cell proliferation(GO:0048661) |
| 0.0 |
0.1 |
GO:0051016 |
barbed-end actin filament capping(GO:0051016) |
| 0.0 |
0.1 |
GO:0006691 |
leukotriene metabolic process(GO:0006691) |
| 0.0 |
0.1 |
GO:0032688 |
negative regulation of interferon-beta production(GO:0032688) |
| 0.0 |
0.1 |
GO:0046294 |
formaldehyde catabolic process(GO:0046294) |
| 0.0 |
0.0 |
GO:0006586 |
tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
| 0.0 |
0.0 |
GO:0009068 |
aspartate family amino acid catabolic process(GO:0009068) |
| 0.0 |
0.3 |
GO:0000187 |
activation of MAPK activity(GO:0000187) |
| 0.0 |
0.0 |
GO:0019730 |
antimicrobial humoral response(GO:0019730) |
| 0.0 |
0.1 |
GO:0043518 |
negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 |
0.4 |
GO:0051225 |
spindle assembly(GO:0051225) |
| 0.0 |
0.4 |
GO:0031122 |
cytoplasmic microtubule organization(GO:0031122) |
| 0.0 |
0.0 |
GO:0060575 |
intestinal epithelial cell differentiation(GO:0060575) |
| 0.0 |
0.2 |
GO:0009083 |
branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 |
0.0 |
GO:0007196 |
adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.0 |
0.7 |
GO:0042254 |
ribosome biogenesis(GO:0042254) |
| 0.0 |
0.1 |
GO:0046415 |
urate metabolic process(GO:0046415) |
| 0.0 |
0.0 |
GO:1903020 |
positive regulation of glycoprotein metabolic process(GO:1903020) |
| 0.0 |
0.1 |
GO:0098838 |
reduced folate transmembrane transport(GO:0098838) |
| 0.0 |
0.1 |
GO:2001022 |
positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.0 |
0.1 |
GO:0006825 |
copper ion transport(GO:0006825) |
| 0.0 |
0.0 |
GO:0061179 |
negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 |
0.0 |
GO:0061635 |
regulation of protein complex stability(GO:0061635) |
| 0.0 |
0.0 |
GO:0032365 |
intracellular lipid transport(GO:0032365) |
| 0.0 |
0.0 |
GO:0006667 |
sphinganine metabolic process(GO:0006667) |
| 0.0 |
0.0 |
GO:0032968 |
positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.0 |
0.0 |
GO:0006597 |
spermine biosynthetic process(GO:0006597) |
| 0.0 |
0.3 |
GO:0035082 |
axoneme assembly(GO:0035082) |
| 0.0 |
0.0 |
GO:0046208 |
spermine catabolic process(GO:0046208) |
| 0.0 |
0.1 |
GO:0071763 |
nuclear membrane organization(GO:0071763) |
| 0.0 |
0.0 |
GO:0007217 |
tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 |
0.1 |
GO:0030224 |
monocyte differentiation(GO:0030224) |
| 0.0 |
0.1 |
GO:1900383 |
regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
| 0.0 |
0.0 |
GO:0048861 |
leukemia inhibitory factor signaling pathway(GO:0048861) |
