Motif ID: Maz_Zfp281
Z-value: 1.394
Transcription factors associated with Maz_Zfp281:
Gene Symbol | Entrez ID | Gene Name |
---|---|---|
Maz | ENSMUSG00000030678.6 | Maz |
Zfp281 | ENSMUSG00000041483.8 | Zfp281 |
Activity-expression correlation:
Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Maz | mm10_v2_chr7_-_127026479_127026496 | 0.66 | 3.2e-03 | Click! |
Zfp281 | mm10_v2_chr1_+_136624901_136624949 | -0.02 | 9.4e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.7 | 5.0 | GO:0030421 | defecation(GO:0030421) |
1.5 | 1.5 | GO:0060994 | regulation of transcription from RNA polymerase II promoter involved in kidney development(GO:0060994) |
1.5 | 7.5 | GO:0035262 | gonad morphogenesis(GO:0035262) |
1.3 | 4.0 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
1.1 | 3.4 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
1.1 | 3.3 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
1.0 | 3.1 | GO:0046022 | regulation of transcription from RNA polymerase II promoter, mitotic(GO:0046021) positive regulation of transcription from RNA polymerase II promoter during mitosis(GO:0046022) |
1.0 | 1.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
1.0 | 3.1 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.9 | 2.8 | GO:1904274 | tricellular tight junction assembly(GO:1904274) |
0.9 | 5.5 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.8 | 4.2 | GO:0048382 | mesendoderm development(GO:0048382) |
0.7 | 2.2 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.7 | 1.5 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
0.7 | 0.7 | GO:0090194 | negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) |
0.7 | 0.7 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
0.7 | 3.3 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.7 | 2.6 | GO:0035606 | peptidyl-cysteine S-trans-nitrosylation(GO:0035606) |
0.6 | 1.9 | GO:0036166 | phenotypic switching(GO:0036166) |
0.6 | 1.3 | GO:0014028 | notochord formation(GO:0014028) |
0.6 | 2.5 | GO:1904565 | response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904565) cellular response to 1-oleoyl-sn-glycerol 3-phosphate(GO:1904566) |
0.6 | 1.8 | GO:0001869 | regulation of complement activation, lectin pathway(GO:0001868) negative regulation of complement activation, lectin pathway(GO:0001869) |
0.6 | 1.8 | GO:0097350 | neutrophil clearance(GO:0097350) |
0.6 | 2.3 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.6 | 1.7 | GO:0003360 | brainstem development(GO:0003360) |
0.6 | 1.7 | GO:0002302 | CD8-positive, alpha-beta T cell differentiation involved in immune response(GO:0002302) |
0.6 | 0.6 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
0.6 | 2.3 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.6 | 1.1 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
0.6 | 1.7 | GO:1902162 | regulation of DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:1902162) |
0.5 | 3.8 | GO:0072086 | specification of loop of Henle identity(GO:0072086) |
0.5 | 1.6 | GO:0006226 | dUMP biosynthetic process(GO:0006226) |
0.5 | 1.6 | GO:0035604 | fibroblast growth factor receptor signaling pathway involved in negative regulation of apoptotic process in bone marrow(GO:0035602) fibroblast growth factor receptor signaling pathway involved in hemopoiesis(GO:0035603) fibroblast growth factor receptor signaling pathway involved in positive regulation of cell proliferation in bone marrow(GO:0035604) coronal suture morphogenesis(GO:0060365) squamous basal epithelial stem cell differentiation involved in prostate gland acinus development(GO:0060529) |
0.5 | 1.6 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.5 | 2.1 | GO:0030091 | protein repair(GO:0030091) |
0.5 | 2.6 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.5 | 2.6 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.5 | 1.5 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.5 | 2.1 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.5 | 3.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.5 | 2.0 | GO:0086048 | membrane depolarization during bundle of His cell action potential(GO:0086048) |
0.5 | 0.5 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.5 | 2.0 | GO:0061312 | BMP signaling pathway involved in heart development(GO:0061312) |
0.5 | 1.5 | GO:0010248 | B cell negative selection(GO:0002352) establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.5 | 1.5 | GO:0030200 | heparan sulfate proteoglycan catabolic process(GO:0030200) |
0.5 | 1.4 | GO:1904020 | regulation of G-protein coupled receptor internalization(GO:1904020) |
0.5 | 6.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.5 | 0.9 | GO:0072190 | ureter urothelium development(GO:0072190) |
0.5 | 1.8 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
0.5 | 1.4 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.5 | 0.5 | GO:0007352 | zygotic specification of dorsal/ventral axis(GO:0007352) |
0.5 | 0.5 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.5 | 4.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.5 | 2.7 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.4 | 1.3 | GO:0045819 | plasmacytoid dendritic cell activation(GO:0002270) positive regulation of glycogen catabolic process(GO:0045819) |
0.4 | 1.3 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.4 | 1.8 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.4 | 0.4 | GO:0048369 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.4 | 2.6 | GO:0072070 | loop of Henle development(GO:0072070) |
0.4 | 1.7 | GO:0035989 | tendon development(GO:0035989) |
0.4 | 1.3 | GO:0019405 | alditol catabolic process(GO:0019405) |
0.4 | 1.3 | GO:0060598 | dichotomous subdivision of terminal units involved in mammary gland duct morphogenesis(GO:0060598) |
0.4 | 1.7 | GO:1900224 | positive regulation of nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900224) positive regulation of mesoderm development(GO:2000382) |
0.4 | 0.8 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
0.4 | 2.9 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.4 | 3.7 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.4 | 1.2 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) |
0.4 | 0.4 | GO:0007501 | mesodermal cell fate specification(GO:0007501) |
0.4 | 2.7 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.4 | 2.3 | GO:0006452 | translational frameshifting(GO:0006452) positive regulation of translational termination(GO:0045905) |
0.4 | 0.4 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.4 | 6.4 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.4 | 1.1 | GO:1903048 | regulation of acetylcholine-gated cation channel activity(GO:1903048) |
0.4 | 3.0 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.4 | 1.8 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.4 | 1.1 | GO:0019230 | proprioception(GO:0019230) |
0.4 | 0.7 | GO:0098912 | membrane depolarization during atrial cardiac muscle cell action potential(GO:0098912) |
0.4 | 0.7 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.4 | 0.4 | GO:0061198 | fungiform papilla formation(GO:0061198) |
0.4 | 1.4 | GO:0002248 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) |
0.4 | 1.4 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.4 | 0.7 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.4 | 2.1 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.3 | 2.4 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) canonical Wnt signaling pathway involved in positive regulation of epithelial to mesenchymal transition(GO:0044334) |
0.3 | 2.4 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.3 | 2.8 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.3 | 2.0 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.3 | 1.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.3 | 0.7 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.3 | 1.0 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.3 | 0.7 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.3 | 0.7 | GO:0023016 | signal transduction by trans-phosphorylation(GO:0023016) |
0.3 | 2.4 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.3 | 0.7 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.3 | 0.3 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
0.3 | 0.7 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.3 | 0.7 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.3 | 2.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.3 | 1.6 | GO:0001842 | neural fold formation(GO:0001842) |
0.3 | 2.3 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.3 | 6.1 | GO:0035115 | embryonic forelimb morphogenesis(GO:0035115) |
0.3 | 3.2 | GO:0072189 | ureter development(GO:0072189) |
0.3 | 0.6 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.3 | 0.6 | GO:2000191 | regulation of fatty acid transport(GO:2000191) |
0.3 | 0.6 | GO:0090118 | receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) |
0.3 | 1.9 | GO:0031946 | regulation of glucocorticoid biosynthetic process(GO:0031946) |
0.3 | 1.3 | GO:0032053 | ciliary basal body organization(GO:0032053) |
0.3 | 0.3 | GO:0043696 | dedifferentiation(GO:0043696) cell dedifferentiation(GO:0043697) |
0.3 | 1.6 | GO:1903609 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
0.3 | 1.2 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.3 | 1.8 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.3 | 0.6 | GO:0060364 | frontal suture morphogenesis(GO:0060364) |
0.3 | 0.3 | GO:1903463 | regulation of mitotic cell cycle DNA replication(GO:1903463) |
0.3 | 2.4 | GO:2000380 | regulation of mesoderm development(GO:2000380) |
0.3 | 0.9 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.3 | 1.2 | GO:0007056 | spindle assembly involved in female meiosis(GO:0007056) |
0.3 | 0.9 | GO:0060217 | hemangioblast cell differentiation(GO:0060217) |
0.3 | 0.6 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.3 | 0.6 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.3 | 1.2 | GO:2000319 | negative regulation of T-helper 17 type immune response(GO:2000317) regulation of T-helper 17 cell differentiation(GO:2000319) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
0.3 | 1.4 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.3 | 2.3 | GO:0048617 | embryonic foregut morphogenesis(GO:0048617) |
0.3 | 2.5 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.3 | 1.1 | GO:2000182 | regulation of progesterone biosynthetic process(GO:2000182) |
0.3 | 0.6 | GO:0044837 | assembly of actomyosin apparatus involved in cytokinesis(GO:0000912) actomyosin contractile ring assembly(GO:0000915) actomyosin contractile ring organization(GO:0044837) |
0.3 | 1.4 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.3 | 1.9 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.3 | 1.4 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.3 | 1.6 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.3 | 2.7 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.3 | 1.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) |
0.3 | 0.3 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.3 | 0.8 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) negative regulation of neutrophil differentiation(GO:0045659) |
0.3 | 0.8 | GO:1903070 | negative regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903070) |
0.3 | 1.6 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.3 | 0.8 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.3 | 1.8 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.3 | 1.0 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.3 | 2.8 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
0.3 | 1.3 | GO:0019659 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.3 | 1.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.3 | 0.8 | GO:0071707 | immunoglobulin heavy chain V-D-J recombination(GO:0071707) |
0.2 | 2.5 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.2 | 0.7 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
0.2 | 0.5 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.2 | 0.5 | GO:0060242 | contact inhibition(GO:0060242) |
0.2 | 0.7 | GO:0086053 | AV node cell to bundle of His cell communication by electrical coupling(GO:0086053) |
0.2 | 2.4 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.2 | 1.5 | GO:0048105 | establishment of body hair or bristle planar orientation(GO:0048104) establishment of body hair planar orientation(GO:0048105) |
0.2 | 0.2 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.2 | 0.7 | GO:0060821 | inactivation of X chromosome by DNA methylation(GO:0060821) |
0.2 | 1.7 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.2 | 0.7 | GO:0019323 | pentose catabolic process(GO:0019323) |
0.2 | 3.4 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.2 | 0.7 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.2 | 0.7 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.2 | 1.2 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.2 | 0.7 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.2 | 0.7 | GO:1904975 | response to bleomycin(GO:1904975) cellular response to bleomycin(GO:1904976) |
0.2 | 0.5 | GO:1904245 | regulation of polynucleotide adenylyltransferase activity(GO:1904245) |
0.2 | 2.6 | GO:0014856 | skeletal muscle cell proliferation(GO:0014856) |
0.2 | 1.6 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.2 | 1.1 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.2 | 1.6 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.2 | 1.4 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.2 | 0.5 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
0.2 | 1.6 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.2 | 0.9 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) |
0.2 | 1.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.2 | 0.9 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.2 | 1.6 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.2 | 1.6 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) |
0.2 | 1.3 | GO:0044351 | macropinocytosis(GO:0044351) |
0.2 | 0.2 | GO:0071166 | ribonucleoprotein complex localization(GO:0071166) ribonucleoprotein complex export from nucleus(GO:0071426) |
0.2 | 0.7 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.2 | 3.4 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
0.2 | 0.7 | GO:1902566 | regulation of eosinophil activation(GO:1902566) |
0.2 | 0.2 | GO:0001787 | natural killer cell proliferation(GO:0001787) NK T cell activation(GO:0051132) |
0.2 | 1.5 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.2 | 0.9 | GO:0006529 | asparagine biosynthetic process(GO:0006529) |
0.2 | 1.9 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.2 | 1.1 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
0.2 | 0.4 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.2 | 2.5 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.2 | 0.8 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.2 | 1.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.2 | 0.4 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.2 | 0.2 | GO:0033128 | negative regulation of histone phosphorylation(GO:0033128) |
0.2 | 0.6 | GO:0071579 | regulation of zinc ion transport(GO:0071579) |
0.2 | 0.4 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.2 | 0.4 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) |
0.2 | 2.1 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.2 | 0.2 | GO:0016332 | establishment or maintenance of polarity of embryonic epithelium(GO:0016332) |
0.2 | 1.5 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
0.2 | 0.2 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.2 | 2.3 | GO:0060539 | diaphragm development(GO:0060539) |
0.2 | 0.6 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
0.2 | 0.8 | GO:0032901 | positive regulation of neurotrophin production(GO:0032901) |
0.2 | 2.8 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.2 | 2.6 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.2 | 0.6 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.2 | 0.2 | GO:1903519 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.2 | 1.0 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
0.2 | 0.8 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.2 | 0.8 | GO:2001045 | negative regulation of integrin-mediated signaling pathway(GO:2001045) |
0.2 | 0.4 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.2 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.2 | 1.2 | GO:0060026 | convergent extension(GO:0060026) |
0.2 | 0.2 | GO:0072202 | cell differentiation involved in metanephros development(GO:0072202) |
0.2 | 0.4 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.2 | 1.4 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.2 | 1.6 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.2 | 0.6 | GO:0043586 | tongue development(GO:0043586) |
0.2 | 1.9 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
0.2 | 1.3 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.2 | 0.6 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.2 | 1.9 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.2 | 1.2 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.2 | 1.3 | GO:0048664 | neuron fate determination(GO:0048664) |
0.2 | 1.0 | GO:0071499 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
0.2 | 0.2 | GO:0071824 | protein-DNA complex subunit organization(GO:0071824) |
0.2 | 1.0 | GO:0043383 | negative T cell selection(GO:0043383) negative thymic T cell selection(GO:0045060) |
0.2 | 0.4 | GO:0045799 | positive regulation of chromatin assembly or disassembly(GO:0045799) |
0.2 | 0.8 | GO:0001887 | selenium compound metabolic process(GO:0001887) selenocysteine metabolic process(GO:0016259) |
0.2 | 0.6 | GO:0034334 | adherens junction maintenance(GO:0034334) |
0.2 | 0.6 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.2 | 0.7 | GO:0015705 | iodide transport(GO:0015705) |
0.2 | 1.5 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.2 | 1.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.2 | 0.7 | GO:0060857 | establishment of glial blood-brain barrier(GO:0060857) |
0.2 | 1.1 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.2 | 0.7 | GO:0010288 | response to lead ion(GO:0010288) |
0.2 | 0.5 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.2 | 0.7 | GO:0007113 | endomitotic cell cycle(GO:0007113) |
0.2 | 0.4 | GO:0051124 | synaptic growth at neuromuscular junction(GO:0051124) |
0.2 | 0.2 | GO:0070873 | regulation of glycogen metabolic process(GO:0070873) |
0.2 | 0.4 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.2 | 0.2 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.2 | 1.1 | GO:0001980 | regulation of systemic arterial blood pressure by ischemic conditions(GO:0001980) |
0.2 | 0.9 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.2 | 1.1 | GO:0046666 | retinal cell programmed cell death(GO:0046666) |
0.2 | 1.8 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.2 | 0.2 | GO:0002432 | granuloma formation(GO:0002432) |
0.2 | 0.9 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.2 | 0.2 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.2 | 0.9 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
0.2 | 1.0 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.2 | 0.5 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
0.2 | 0.3 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.2 | 0.8 | GO:0031580 | membrane raft polarization(GO:0001766) membrane raft distribution(GO:0031580) |
0.2 | 1.0 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.2 | 2.0 | GO:0051451 | myoblast migration(GO:0051451) |
0.2 | 0.2 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
0.2 | 3.0 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.2 | 0.5 | GO:1903644 | regulation of chaperone-mediated protein folding(GO:1903644) |
0.2 | 0.7 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.2 | 0.2 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
0.2 | 0.7 | GO:0015888 | thiamine transport(GO:0015888) |
0.2 | 0.3 | GO:0042097 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
0.2 | 0.8 | GO:2001184 | regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
0.2 | 0.7 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.2 | 0.6 | GO:0070269 | pyroptosis(GO:0070269) |
0.2 | 0.8 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.2 | 0.3 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.2 | 0.5 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.2 | 0.2 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
0.2 | 0.3 | GO:0010273 | detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to copper ion(GO:1990169) |
0.2 | 0.2 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.2 | 0.3 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.2 | 0.3 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.2 | 0.3 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.2 | 0.8 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.2 | 0.8 | GO:0098914 | membrane repolarization during atrial cardiac muscle cell action potential(GO:0098914) |
0.2 | 0.5 | GO:0003245 | cardiac muscle tissue growth involved in heart morphogenesis(GO:0003245) |
0.2 | 0.5 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.2 | 0.3 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.2 | 1.2 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.2 | 0.8 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.2 | 0.8 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.2 | 0.5 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.2 | 0.3 | GO:0033484 | nitric oxide homeostasis(GO:0033484) |
0.2 | 0.5 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.2 | 1.9 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.2 | 0.8 | GO:0098706 | ferric iron import into cell(GO:0097461) ferric iron import across plasma membrane(GO:0098706) |
0.2 | 0.3 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
0.2 | 0.8 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.2 | 0.5 | GO:1902310 | positive regulation of peptidyl-serine dephosphorylation(GO:1902310) |
0.2 | 0.6 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
0.2 | 0.8 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.2 | 1.1 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.2 | 0.6 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.2 | 0.5 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.1 | 0.3 | GO:0036292 | DNA rewinding(GO:0036292) |
0.1 | 1.8 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.1 | 0.4 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
0.1 | 0.6 | GO:0015867 | ATP transport(GO:0015867) |
0.1 | 0.3 | GO:1905065 | regulation of vascular smooth muscle cell differentiation(GO:1905063) positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
0.1 | 0.6 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) cellular response to lipid hydroperoxide(GO:0071449) |
0.1 | 0.6 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.1 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.1 | 1.0 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.1 | GO:0048570 | notochord morphogenesis(GO:0048570) |
0.1 | 0.3 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.1 | 1.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.4 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.1 | 0.9 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.1 | GO:0042117 | monocyte activation(GO:0042117) |
0.1 | 0.1 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
0.1 | 0.1 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) |
0.1 | 0.4 | GO:1901355 | response to rapamycin(GO:1901355) |
0.1 | 0.7 | GO:0044806 | G-quadruplex DNA unwinding(GO:0044806) |
0.1 | 0.1 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) |
0.1 | 0.4 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
0.1 | 0.4 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.1 | 1.7 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.1 | 0.8 | GO:0040031 | snRNA modification(GO:0040031) |
0.1 | 0.8 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.4 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.1 | 0.4 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.7 | GO:0040032 | post-embryonic body morphogenesis(GO:0040032) |
0.1 | 0.4 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 1.3 | GO:0045616 | regulation of keratinocyte differentiation(GO:0045616) |
0.1 | 0.9 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.1 | 1.5 | GO:0036344 | platelet morphogenesis(GO:0036344) |
0.1 | 1.2 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 1.9 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.1 | 0.1 | GO:0072554 | blood vessel lumenization(GO:0072554) |
0.1 | 0.1 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.1 | 0.1 | GO:0038163 | thrombopoietin-mediated signaling pathway(GO:0038163) |
0.1 | 1.2 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) |
0.1 | 0.5 | GO:0002484 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
0.1 | 0.4 | GO:1904154 | protein localization to endoplasmic reticulum exit site(GO:0070973) positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.1 | 0.4 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.3 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.1 | 0.5 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.1 | 0.3 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
0.1 | 0.9 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.1 | 0.4 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.1 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.1 | 0.5 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.4 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.1 | 0.8 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.1 | 0.4 | GO:0030202 | heparin metabolic process(GO:0030202) |
0.1 | 0.3 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.4 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.6 | GO:0007144 | female meiosis I(GO:0007144) |
0.1 | 0.3 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.1 | 0.3 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.1 | 0.5 | GO:0019287 | isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.3 | GO:0036302 | atrioventricular canal development(GO:0036302) |
0.1 | 1.0 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
0.1 | 1.3 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.1 | 0.1 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
0.1 | 0.9 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) |
0.1 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.1 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.4 | GO:1990046 | positive regulation of mitochondrial DNA replication(GO:0090297) regulation of cardiolipin metabolic process(GO:1900208) positive regulation of cardiolipin metabolic process(GO:1900210) positive regulation of mitochondrial DNA metabolic process(GO:1901860) stress-induced mitochondrial fusion(GO:1990046) |
0.1 | 0.9 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.4 | GO:0001193 | maintenance of transcriptional fidelity during DNA-templated transcription elongation(GO:0001192) maintenance of transcriptional fidelity during DNA-templated transcription elongation from RNA polymerase II promoter(GO:0001193) |
0.1 | 1.0 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.1 | 0.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.1 | 0.4 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.1 | 0.2 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.1 | 0.2 | GO:0046947 | hydroxylysine metabolic process(GO:0046946) hydroxylysine biosynthetic process(GO:0046947) |
0.1 | 0.4 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.1 | 0.1 | GO:0001978 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
0.1 | 0.6 | GO:0001711 | endodermal cell fate commitment(GO:0001711) |
0.1 | 0.4 | GO:0006116 | NADH oxidation(GO:0006116) |
0.1 | 1.2 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.1 | 0.8 | GO:0060736 | prostate gland growth(GO:0060736) |
0.1 | 0.5 | GO:0097152 | mesenchymal cell apoptotic process(GO:0097152) |
0.1 | 1.0 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.1 | 0.5 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.4 | GO:0019441 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) kynurenine metabolic process(GO:0070189) |
0.1 | 1.5 | GO:0036065 | fucosylation(GO:0036065) |
0.1 | 0.5 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.1 | 0.6 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) chloride ion homeostasis(GO:0055064) |
0.1 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.7 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.1 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.1 | 0.5 | GO:0018158 | protein oxidation(GO:0018158) |
0.1 | 0.2 | GO:1901563 | response to camptothecin(GO:1901563) |
0.1 | 0.5 | GO:0070829 | heterochromatin maintenance(GO:0070829) |
0.1 | 0.2 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.1 | 1.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.1 | 0.3 | GO:0090559 | regulation of membrane permeability(GO:0090559) |
0.1 | 0.6 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.1 | 0.8 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.1 | 1.9 | GO:0043921 | modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
0.1 | 1.6 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
0.1 | 0.1 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.1 | 0.2 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.1 | 0.2 | GO:0009814 | defense response, incompatible interaction(GO:0009814) |
0.1 | 0.2 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.1 | 0.6 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.8 | GO:0090234 | regulation of centromere complex assembly(GO:0090230) regulation of kinetochore assembly(GO:0090234) |
0.1 | 1.7 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.1 | 0.9 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.1 | 1.8 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.1 | 4.3 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.1 | 0.1 | GO:0002295 | T-helper cell lineage commitment(GO:0002295) CD4-positive, alpha-beta T cell lineage commitment(GO:0043373) |
0.1 | 0.5 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.2 | GO:0097501 | stress response to metal ion(GO:0097501) |
0.1 | 1.4 | GO:0045672 | positive regulation of osteoclast differentiation(GO:0045672) |
0.1 | 0.1 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.1 | 0.9 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
0.1 | 0.6 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.1 | 0.8 | GO:0015791 | polyol transport(GO:0015791) |
0.1 | 0.1 | GO:0042637 | catagen(GO:0042637) |
0.1 | 0.3 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
0.1 | 0.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.6 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.1 | 0.6 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.1 | 0.4 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.1 | 0.2 | GO:0000454 | snoRNA guided rRNA pseudouridine synthesis(GO:0000454) |
0.1 | 0.1 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.1 | 0.2 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
0.1 | 0.4 | GO:0051309 | female meiosis chromosome separation(GO:0051309) |
0.1 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.2 | GO:0032493 | response to bacterial lipoprotein(GO:0032493) |
0.1 | 0.1 | GO:1905076 | regulation of interleukin-17 secretion(GO:1905076) |
0.1 | 0.1 | GO:0060426 | lung vasculature development(GO:0060426) |
0.1 | 0.2 | GO:0002371 | dendritic cell cytokine production(GO:0002371) regulation of dendritic cell cytokine production(GO:0002730) |
0.1 | 0.3 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.1 | 0.5 | GO:0050684 | regulation of mRNA processing(GO:0050684) regulation of mRNA metabolic process(GO:1903311) |
0.1 | 0.4 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.3 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.1 | 1.2 | GO:0001675 | acrosome assembly(GO:0001675) |
0.1 | 0.5 | GO:0033140 | negative regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033140) |
0.1 | 0.9 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 1.0 | GO:0007141 | male meiosis I(GO:0007141) |
0.1 | 0.3 | GO:1904719 | excitatory chemical synaptic transmission(GO:0098976) positive regulation of AMPA glutamate receptor clustering(GO:1904719) |
0.1 | 0.2 | GO:0002339 | B cell selection(GO:0002339) |
0.1 | 0.4 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.1 | 0.4 | GO:0009071 | serine family amino acid catabolic process(GO:0009071) |
0.1 | 1.1 | GO:0021511 | spinal cord patterning(GO:0021511) |
0.1 | 0.4 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.1 | 0.5 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.1 | 0.4 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.1 | 1.1 | GO:2000580 | positive regulation of microtubule motor activity(GO:2000576) regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000580) positive regulation of ATP-dependent microtubule motor activity, plus-end-directed(GO:2000582) |
0.1 | 0.5 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.1 | 1.1 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.1 | 0.4 | GO:0042730 | fibrinolysis(GO:0042730) |
0.1 | 0.2 | GO:1990523 | bone regeneration(GO:1990523) |
0.1 | 0.2 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.1 | 0.5 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.1 | 0.7 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.1 | 0.2 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.1 | 1.4 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.1 | 0.6 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.1 | 0.1 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.1 | 0.3 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.1 | 0.3 | GO:2000393 | negative regulation of lamellipodium morphogenesis(GO:2000393) |
0.1 | 0.6 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.1 | 0.3 | GO:1990859 | cellular response to endothelin(GO:1990859) |
0.1 | 0.3 | GO:1903490 | regulation of cytokinetic process(GO:0032954) regulation of mitotic cytokinetic process(GO:1903436) positive regulation of mitotic cytokinetic process(GO:1903438) positive regulation of mitotic cytokinesis(GO:1903490) |
0.1 | 0.5 | GO:0090103 | cochlea morphogenesis(GO:0090103) |
0.1 | 0.3 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.1 | 0.3 | GO:0051026 | chiasma assembly(GO:0051026) |
0.1 | 1.0 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.1 | 0.2 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
0.1 | 0.7 | GO:0006968 | cellular defense response(GO:0006968) |
0.1 | 0.3 | GO:0072126 | positive regulation of glomerular mesangial cell proliferation(GO:0072126) |
0.1 | 0.8 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.1 | 1.0 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.8 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
0.1 | 0.1 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) |
0.1 | 0.2 | GO:0019255 | glucose 1-phosphate metabolic process(GO:0019255) |
0.1 | 2.1 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.1 | 0.8 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.1 | 0.5 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.2 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.1 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 0.2 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 1.6 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.1 | 0.3 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
0.1 | 0.3 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.1 | GO:0044243 | multicellular organism catabolic process(GO:0044243) |
0.1 | 0.4 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.1 | 0.2 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.6 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.1 | 0.1 | GO:2000314 | negative regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000314) |
0.1 | 0.1 | GO:1903960 | negative regulation of anion transmembrane transport(GO:1903960) |
0.1 | 0.3 | GO:0002940 | tRNA N2-guanine methylation(GO:0002940) |
0.1 | 0.4 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.1 | GO:0017185 | peptidyl-lysine hydroxylation(GO:0017185) |
0.1 | 0.4 | GO:0002143 | tRNA wobble position uridine thiolation(GO:0002143) |
0.1 | 0.2 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 0.4 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.8 | GO:1901623 | regulation of lymphocyte chemotaxis(GO:1901623) |
0.1 | 0.4 | GO:0000492 | box C/D snoRNP assembly(GO:0000492) |
0.1 | 1.8 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.1 | 0.4 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.1 | 0.1 | GO:0071649 | chemokine (C-C motif) ligand 5 production(GO:0071609) regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
0.1 | 0.8 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.1 | 0.2 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.1 | 0.3 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.1 | 0.3 | GO:0030576 | Cajal body organization(GO:0030576) |
0.1 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 0.7 | GO:0070874 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
0.1 | 0.3 | GO:1904578 | response to thapsigargin(GO:1904578) cellular response to thapsigargin(GO:1904579) |
0.1 | 0.9 | GO:0031100 | organ regeneration(GO:0031100) |
0.1 | 0.2 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
0.1 | 0.3 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.1 | 0.3 | GO:0006742 | NADP catabolic process(GO:0006742) pyridine nucleotide catabolic process(GO:0019364) |
0.1 | 0.5 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.1 | 0.3 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.1 | 0.3 | GO:0000022 | mitotic spindle elongation(GO:0000022) |
0.1 | 2.2 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
0.1 | 3.0 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.1 | 0.8 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.1 | 0.7 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.5 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.1 | 0.3 | GO:1903976 | negative regulation of glial cell migration(GO:1903976) |
0.1 | 1.3 | GO:0048535 | lymph node development(GO:0048535) |
0.1 | 0.6 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.1 | 0.1 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) |
0.1 | 0.2 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.1 | 0.2 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.5 | GO:0002643 | regulation of tolerance induction(GO:0002643) |
0.1 | 0.1 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.1 | 1.2 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.1 | 0.2 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.1 | 1.1 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.1 | 0.5 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) |
0.1 | 0.7 | GO:0044319 | wound healing, spreading of cells(GO:0044319) epiboly(GO:0090504) epiboly involved in wound healing(GO:0090505) |
0.1 | 0.2 | GO:2000416 | regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
0.1 | 0.2 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.1 | 0.2 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.1 | 0.2 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.1 | 1.3 | GO:0000338 | protein deneddylation(GO:0000338) |
0.1 | 0.2 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.1 | 0.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.1 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.4 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
0.1 | 2.1 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.1 | 0.1 | GO:0036296 | cellular response to increased oxygen levels(GO:0036295) response to increased oxygen levels(GO:0036296) |
0.1 | 0.2 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.1 | 0.1 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.1 | 0.4 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.9 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
0.1 | 0.3 | GO:1901837 | negative regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901837) |
0.1 | 0.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.3 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.1 | 0.2 | GO:0006586 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
0.1 | 0.6 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.1 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.1 | 0.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.1 | 0.1 | GO:0021849 | neuroblast division in subventricular zone(GO:0021849) |
0.1 | 0.2 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
0.1 | 1.2 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.1 | 0.2 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.9 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.1 | 0.2 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.1 | 0.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.2 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.1 | 0.4 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 0.2 | GO:0072160 | nephron tubule epithelial cell differentiation(GO:0072160) |
0.1 | 0.8 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.1 | 0.8 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.1 | 0.1 | GO:0044275 | cellular carbohydrate catabolic process(GO:0044275) |
0.1 | 0.2 | GO:1902995 | regulation of phospholipid efflux(GO:1902994) positive regulation of phospholipid efflux(GO:1902995) |
0.1 | 0.1 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.1 | 0.1 | GO:0072103 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
0.1 | 0.4 | GO:0090312 | positive regulation of protein deacetylation(GO:0090312) |
0.1 | 0.1 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
0.1 | 0.6 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.4 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.1 | 0.3 | GO:0006751 | glutathione catabolic process(GO:0006751) |
0.1 | 0.3 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.1 | 0.3 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.1 | 0.5 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.2 | GO:0002374 | cytokine secretion involved in immune response(GO:0002374) regulation of cytokine secretion involved in immune response(GO:0002739) positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.1 | 0.7 | GO:0018195 | peptidyl-arginine modification(GO:0018195) |
0.1 | 0.3 | GO:0032691 | negative regulation of interleukin-1 beta production(GO:0032691) |
0.1 | 0.4 | GO:0043584 | nose development(GO:0043584) |
0.1 | 0.5 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) |
0.1 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.3 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) |
0.1 | 0.4 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.1 | 0.1 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
0.1 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.1 | 0.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.4 | GO:0019883 | antigen processing and presentation of endogenous peptide antigen(GO:0002483) antigen processing and presentation of endogenous antigen(GO:0019883) |
0.1 | 0.2 | GO:0046016 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) positive regulation of transcription by glucose(GO:0046016) |
0.1 | 0.2 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.1 | 0.1 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
0.1 | 0.5 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
0.1 | 0.5 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.1 | 0.2 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.1 | 0.6 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.1 | 2.7 | GO:0070206 | protein trimerization(GO:0070206) |
0.1 | 0.1 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
0.1 | 1.3 | GO:0030199 | collagen fibril organization(GO:0030199) |
0.1 | 0.3 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) collagen-activated signaling pathway(GO:0038065) |
0.1 | 1.0 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.1 | 2.7 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.1 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.1 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.1 | 0.3 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.1 | 0.4 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.1 | 0.6 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.1 | 0.5 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.1 | 0.2 | GO:2000833 | positive regulation of steroid hormone secretion(GO:2000833) |
0.1 | 0.2 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.1 | 0.5 | GO:0014029 | neural crest formation(GO:0014029) |
0.1 | 0.4 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.1 | 0.7 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.1 | 0.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.3 | GO:0045780 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
0.1 | 0.3 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
0.1 | 0.3 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.7 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 1.3 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.1 | 0.3 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.1 | 0.1 | GO:0001757 | somite specification(GO:0001757) |
0.1 | 0.4 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.1 | 0.3 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.1 | 0.1 | GO:0032782 | bile acid secretion(GO:0032782) |
0.1 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.1 | 0.3 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.1 | 0.1 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.1 | 0.3 | GO:0051461 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
0.1 | 1.8 | GO:1902750 | negative regulation of cell cycle G2/M phase transition(GO:1902750) |
0.1 | 0.1 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.1 | 0.2 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
0.1 | 0.1 | GO:0036090 | cleavage furrow ingression(GO:0036090) |
0.1 | 1.1 | GO:0048240 | sperm capacitation(GO:0048240) |
0.1 | 0.1 | GO:0060900 | embryonic camera-type eye formation(GO:0060900) |
0.1 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.2 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
0.1 | 0.5 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.1 | 0.2 | GO:0031204 | posttranslational protein targeting to membrane, translocation(GO:0031204) |
0.1 | 0.4 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.1 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.7 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.1 | 0.4 | GO:0015675 | nickel cation transport(GO:0015675) |
0.1 | 0.2 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
0.1 | 0.1 | GO:0086098 | angiotensin-activated signaling pathway involved in heart process(GO:0086098) |
0.1 | 1.9 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.1 | 0.6 | GO:0017145 | stem cell division(GO:0017145) |
0.1 | 0.4 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.1 | 0.3 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.4 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.1 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.1 | 0.2 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.1 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
0.1 | 1.0 | GO:0000303 | response to superoxide(GO:0000303) |
0.1 | 0.2 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
0.1 | 0.4 | GO:0001709 | cell fate determination(GO:0001709) |
0.1 | 0.2 | GO:0007320 | insemination(GO:0007320) |
0.1 | 0.2 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.4 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.1 | 0.1 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.1 | 0.9 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.1 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.7 | GO:1900383 | regulation of synaptic plasticity by receptor localization to synapse(GO:1900383) |
0.1 | 0.6 | GO:0008272 | sulfate transport(GO:0008272) |
0.1 | 0.3 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.1 | 0.1 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.1 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.5 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.1 | 0.6 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.1 | 0.1 | GO:0072344 | rescue of stalled ribosome(GO:0072344) |
0.1 | 0.1 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.1 | 0.8 | GO:0046596 | regulation of viral entry into host cell(GO:0046596) |
0.1 | 0.2 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.1 | 1.5 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.1 | 0.2 | GO:0097201 | negative regulation of transcription from RNA polymerase II promoter in response to stress(GO:0097201) |
0.1 | 0.3 | GO:0032306 | regulation of prostaglandin secretion(GO:0032306) |
0.1 | 0.1 | GO:1990379 | lipid transport across blood brain barrier(GO:1990379) |
0.1 | 0.8 | GO:0043486 | histone exchange(GO:0043486) |
0.1 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 1.3 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.1 | 0.2 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
0.1 | 0.4 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.1 | 0.1 | GO:0002585 | positive regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002582) positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) positive regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002588) detection of peptidoglycan(GO:0032499) |
0.1 | 0.3 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.1 | GO:1904751 | positive regulation of protein localization to nucleolus(GO:1904751) |
0.1 | 0.1 | GO:0040010 | positive regulation of growth rate(GO:0040010) |
0.1 | 0.1 | GO:0019062 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
0.1 | 0.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.3 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.3 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.1 | 0.2 | GO:0010872 | regulation of cholesterol esterification(GO:0010872) |
0.1 | 0.2 | GO:0043328 | protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.1 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.1 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.1 | 0.6 | GO:0007530 | sex determination(GO:0007530) |
0.1 | 0.1 | GO:0001946 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.1 | 0.1 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
0.1 | 0.2 | GO:0090005 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.1 | 0.1 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.2 | GO:0070476 | rRNA (guanine-N7)-methylation(GO:0070476) |
0.1 | 0.4 | GO:0031498 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) |
0.1 | 0.1 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.1 | 0.2 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.1 | 0.1 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.1 | 0.2 | GO:0035752 | lysosomal lumen pH elevation(GO:0035752) |
0.1 | 0.1 | GO:0003161 | cardiac conduction system development(GO:0003161) |
0.1 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.1 | 0.7 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.1 | 0.6 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.1 | 0.9 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.1 | 0.4 | GO:0072176 | nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
0.1 | 0.1 | GO:1990839 | response to endothelin(GO:1990839) |
0.1 | 0.3 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.2 | GO:0030225 | macrophage differentiation(GO:0030225) |
0.1 | 2.0 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.0 | 0.3 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.0 | 0.1 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.4 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.0 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
0.0 | 0.1 | GO:0007512 | adult heart development(GO:0007512) |
0.0 | 0.4 | GO:0007549 | dosage compensation(GO:0007549) |
0.0 | 0.1 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) |
0.0 | 0.0 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.1 | GO:0010641 | positive regulation of platelet-derived growth factor receptor signaling pathway(GO:0010641) |
0.0 | 0.3 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.4 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.7 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.2 | GO:0002188 | translation reinitiation(GO:0002188) |
0.0 | 0.1 | GO:0060290 | transdifferentiation(GO:0060290) |
0.0 | 0.1 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.0 | 0.0 | GO:0051593 | response to folic acid(GO:0051593) |
0.0 | 0.5 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.0 | 0.5 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.0 | 0.1 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.0 | 0.1 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.2 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
0.0 | 0.1 | GO:0006507 | GPI anchor release(GO:0006507) |
0.0 | 0.2 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.0 | 0.6 | GO:0050909 | sensory perception of taste(GO:0050909) |
0.0 | 0.0 | GO:0045606 | positive regulation of epidermal cell differentiation(GO:0045606) |
0.0 | 0.1 | GO:1904046 | negative regulation of vascular endothelial growth factor production(GO:1904046) |
0.0 | 0.0 | GO:0036228 | protein targeting to nuclear inner membrane(GO:0036228) |
0.0 | 0.4 | GO:0043029 | T cell homeostasis(GO:0043029) |
0.0 | 0.1 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.0 | 0.5 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
0.0 | 0.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.2 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.0 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
0.0 | 0.2 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.2 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.0 | 0.3 | GO:1901409 | positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.2 | GO:0070633 | transepithelial transport(GO:0070633) |
0.0 | 1.2 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.7 | GO:0014904 | myotube cell development(GO:0014904) |
0.0 | 0.2 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.5 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.9 | GO:0048747 | muscle fiber development(GO:0048747) |
0.0 | 0.0 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate metabolic process(GO:0009138) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.0 | 0.2 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
0.0 | 0.1 | GO:0018126 | protein hydroxylation(GO:0018126) |
0.0 | 0.0 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.0 | 0.1 | GO:0097401 | synaptic vesicle lumen acidification(GO:0097401) |
0.0 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.0 | 0.1 | GO:0051883 | disruption of cells of other organism involved in symbiotic interaction(GO:0051818) killing of cells in other organism involved in symbiotic interaction(GO:0051883) |
0.0 | 0.3 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.2 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.3 | GO:1990173 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.0 | 0.3 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.0 | 0.3 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
0.0 | 0.2 | GO:0046459 | short-chain fatty acid metabolic process(GO:0046459) |
0.0 | 0.5 | GO:0002011 | morphogenesis of an epithelial sheet(GO:0002011) |
0.0 | 0.7 | GO:0030901 | midbrain development(GO:0030901) |
0.0 | 0.2 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 1.3 | GO:0070303 | negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
0.0 | 0.2 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.0 | 0.2 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.0 | 0.0 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) |
0.0 | 0.2 | GO:0046909 | intermembrane transport(GO:0046909) protein transport from ciliary membrane to plasma membrane(GO:1903445) |
0.0 | 1.2 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.1 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.1 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.2 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.0 | 0.0 | GO:0036035 | osteoclast development(GO:0036035) |
0.0 | 1.0 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.2 | GO:0045445 | myoblast differentiation(GO:0045445) |
0.0 | 0.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.0 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.0 | 0.2 | GO:1900015 | regulation of cytokine production involved in inflammatory response(GO:1900015) |
0.0 | 0.0 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.2 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) regulation of protein homooligomerization(GO:0032462) negative regulation of protein homooligomerization(GO:0032463) |
0.0 | 0.3 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.1 | GO:0003214 | cardiac left ventricle morphogenesis(GO:0003214) |
0.0 | 0.1 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.0 | GO:0002578 | negative regulation of antigen processing and presentation(GO:0002578) |
0.0 | 0.2 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.2 | GO:1904407 | positive regulation of nitric oxide biosynthetic process(GO:0045429) positive regulation of nitric oxide metabolic process(GO:1904407) |
0.0 | 0.2 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.0 | 0.3 | GO:0030035 | microspike assembly(GO:0030035) |
0.0 | 0.6 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.1 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.1 | GO:0042275 | error-free postreplication DNA repair(GO:0042275) |
0.0 | 0.3 | GO:0006682 | galactosylceramide biosynthetic process(GO:0006682) galactolipid biosynthetic process(GO:0019375) |
0.0 | 0.1 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
0.0 | 0.2 | GO:0061157 | RNA destabilization(GO:0050779) mRNA destabilization(GO:0061157) |
0.0 | 0.1 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) |
0.0 | 0.2 | GO:0021678 | third ventricle development(GO:0021678) |
0.0 | 0.1 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.0 | 0.1 | GO:0090670 | RNA localization to Cajal body(GO:0090670) telomerase RNA localization to Cajal body(GO:0090671) telomerase RNA localization(GO:0090672) |
0.0 | 0.3 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
0.0 | 0.5 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.4 | GO:0006378 | mRNA polyadenylation(GO:0006378) |
0.0 | 0.3 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.0 | 0.3 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.0 | 0.3 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.1 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.0 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.0 | 0.1 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
0.0 | 0.3 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.1 | GO:0090190 | positive regulation of mesonephros development(GO:0061213) regulation of mesonephros development(GO:0061217) regulation of branching involved in ureteric bud morphogenesis(GO:0090189) positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
0.0 | 0.1 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
0.0 | 0.6 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.0 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.0 | 0.2 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.1 | GO:0030224 | monocyte differentiation(GO:0030224) |
0.0 | 0.3 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.0 | GO:0031660 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) |
0.0 | 0.2 | GO:0001682 | tRNA 5'-leader removal(GO:0001682) |
0.0 | 0.1 | GO:0006788 | heme oxidation(GO:0006788) |
0.0 | 0.1 | GO:0060392 | negative regulation of SMAD protein import into nucleus(GO:0060392) |
0.0 | 0.5 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:0006907 | pinocytosis(GO:0006907) |
0.0 | 0.2 | GO:0007602 | phototransduction(GO:0007602) |
0.0 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.0 | 0.1 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.0 | 0.2 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.0 | 0.1 | GO:0060439 | trachea morphogenesis(GO:0060439) |
0.0 | 0.1 | GO:0033580 | protein glycosylation at cell surface(GO:0033575) protein galactosylation at cell surface(GO:0033580) protein galactosylation(GO:0042125) |
0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 1.3 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.4 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.1 | GO:0043388 | positive regulation of DNA binding(GO:0043388) |
0.0 | 0.5 | GO:0019731 | antibacterial humoral response(GO:0019731) |
0.0 | 0.4 | GO:0035067 | negative regulation of histone acetylation(GO:0035067) |
0.0 | 0.3 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.0 | 0.5 | GO:0000578 | embryonic axis specification(GO:0000578) |
0.0 | 0.4 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.1 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) |
0.0 | 0.1 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.0 | 0.2 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.2 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.0 | 0.0 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.1 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
0.0 | 0.3 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.0 | 0.2 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.0 | 0.1 | GO:0045061 | thymic T cell selection(GO:0045061) |
0.0 | 2.4 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 0.1 | GO:0000054 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
0.0 | 0.1 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.0 | 0.1 | GO:0070836 | caveola assembly(GO:0070836) |
0.0 | 0.0 | GO:0046166 | glyceraldehyde-3-phosphate biosynthetic process(GO:0046166) |
0.0 | 0.1 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.5 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.1 | GO:0046294 | formaldehyde catabolic process(GO:0046294) |
0.0 | 1.6 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 0.1 | GO:0045048 | protein insertion into ER membrane(GO:0045048) |
0.0 | 0.3 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.1 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.1 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.1 | GO:0080111 | DNA demethylation(GO:0080111) |
0.0 | 0.1 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
0.0 | 0.1 | GO:0071028 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.0 | 0.1 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.1 | GO:0036337 | Fas signaling pathway(GO:0036337) |
0.0 | 0.2 | GO:0060706 | cell differentiation involved in embryonic placenta development(GO:0060706) |
0.0 | 0.1 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.0 | 0.0 | GO:0061739 | protein lipidation involved in autophagosome assembly(GO:0061739) |
0.0 | 0.1 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.1 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.0 | GO:0002385 | organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.0 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
0.0 | 0.6 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.0 | 0.0 | GO:0046851 | negative regulation of bone remodeling(GO:0046851) |
0.0 | 1.3 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
0.0 | 0.0 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 1.9 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.1 | GO:0006121 | mitochondrial electron transport, succinate to ubiquinone(GO:0006121) |
0.0 | 0.0 | GO:0006112 | energy reserve metabolic process(GO:0006112) |
0.0 | 0.2 | GO:0007140 | male meiosis(GO:0007140) |
0.0 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.1 | GO:0050904 | diapedesis(GO:0050904) |
0.0 | 0.1 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
0.0 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.1 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
0.0 | 0.2 | GO:0045638 | negative regulation of myeloid cell differentiation(GO:0045638) |
0.0 | 0.6 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
0.0 | 0.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.1 | GO:0016445 | somatic diversification of immunoglobulins(GO:0016445) |
0.0 | 1.2 | GO:0006342 | chromatin silencing(GO:0006342) |
0.0 | 0.0 | GO:0046476 | glycosylceramide biosynthetic process(GO:0046476) |
0.0 | 0.2 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.0 | 0.2 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 1.0 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.2 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.0 | 0.0 | GO:1903351 | response to dopamine(GO:1903350) cellular response to dopamine(GO:1903351) |
0.0 | 0.1 | GO:2000194 | regulation of female gonad development(GO:2000194) |
0.0 | 0.1 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.0 | 0.0 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.0 | GO:0080144 | amino acid homeostasis(GO:0080144) |
0.0 | 0.1 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.4 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 0.0 | GO:0001575 | globoside metabolic process(GO:0001575) |
0.0 | 0.1 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.0 | 0.1 | GO:0045076 | regulation of interleukin-2 biosynthetic process(GO:0045076) positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.7 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.1 | GO:0036120 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.0 | 0.0 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.0 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.0 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.0 | 0.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.1 | GO:0046900 | tetrahydrofolylpolyglutamate metabolic process(GO:0046900) |
0.0 | 0.0 | GO:1902990 | telomere maintenance via semi-conservative replication(GO:0032201) mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.0 | 0.1 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.0 | 0.1 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.1 | GO:1902475 | L-glutamate transmembrane transport(GO:0089711) L-alpha-amino acid transmembrane transport(GO:1902475) |
0.0 | 0.2 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.1 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.0 | 0.0 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.0 | 0.0 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.3 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.1 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.0 | 0.1 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
0.0 | 0.1 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.0 | 0.1 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.0 | 0.0 | GO:0042938 | dipeptide transport(GO:0042938) |
0.0 | 0.3 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.2 | GO:1900027 | regulation of ruffle assembly(GO:1900027) |
0.0 | 0.0 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.3 | GO:0043489 | RNA stabilization(GO:0043489) |
0.0 | 0.0 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.0 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
0.0 | 0.1 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.3 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.1 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.3 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.1 | GO:0019243 | methylglyoxal metabolic process(GO:0009438) methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) ketone catabolic process(GO:0042182) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.0 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.0 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) |
0.0 | 0.1 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.0 | 0.1 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 1.5 | GO:0016072 | rRNA metabolic process(GO:0016072) |
0.0 | 0.0 | GO:0006014 | D-ribose metabolic process(GO:0006014) |
0.0 | 0.2 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 0.1 | GO:0035617 | stress granule disassembly(GO:0035617) |
0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.6 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
0.0 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.0 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.0 | 0.5 | GO:0072376 | protein activation cascade(GO:0072376) |
0.0 | 0.0 | GO:0010586 | miRNA metabolic process(GO:0010586) |
0.0 | 0.1 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.4 | GO:0008589 | regulation of smoothened signaling pathway(GO:0008589) |
0.0 | 0.0 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
0.0 | 0.1 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.0 | 0.4 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.0 | GO:1904760 | myofibroblast differentiation(GO:0036446) regulation of myofibroblast differentiation(GO:1904760) |
0.0 | 0.1 | GO:0090169 | regulation of spindle assembly(GO:0090169) |
0.0 | 0.1 | GO:2000726 | negative regulation of cardiac muscle cell differentiation(GO:2000726) |
0.0 | 0.1 | GO:0070986 | left/right axis specification(GO:0070986) |
0.0 | 0.0 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.0 | 0.0 | GO:0030043 | actin filament fragmentation(GO:0030043) |
0.0 | 0.0 | GO:0072734 | response to staurosporine(GO:0072733) cellular response to staurosporine(GO:0072734) |
0.0 | 0.1 | GO:1903755 | regulation of SUMO transferase activity(GO:1903182) positive regulation of SUMO transferase activity(GO:1903755) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.1 | GO:0016559 | peroxisome fission(GO:0016559) |
0.0 | 0.0 | GO:0006409 | tRNA export from nucleus(GO:0006409) tRNA-containing ribonucleoprotein complex export from nucleus(GO:0071431) |
0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.6 | GO:0034637 | cellular carbohydrate biosynthetic process(GO:0034637) |
0.0 | 0.1 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.1 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
0.0 | 0.8 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.3 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.0 | GO:1902165 | regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902165) negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.0 | 0.2 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 0.1 | GO:0050855 | regulation of B cell receptor signaling pathway(GO:0050855) positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.2 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
0.0 | 0.1 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.0 | 0.0 | GO:1902218 | regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) |
0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.2 | GO:0050832 | defense response to fungus(GO:0050832) |
0.0 | 0.1 | GO:0015822 | ornithine transport(GO:0015822) |
0.0 | 0.0 | GO:0046462 | monoacylglycerol metabolic process(GO:0046462) |
0.0 | 0.2 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
0.0 | 0.1 | GO:0031639 | plasminogen activation(GO:0031639) |
0.0 | 0.1 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.2 | GO:0050830 | defense response to Gram-positive bacterium(GO:0050830) |
0.0 | 0.1 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.0 | 0.0 | GO:0048698 | negative regulation of collateral sprouting in absence of injury(GO:0048698) |
0.0 | 0.0 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
0.0 | 0.5 | GO:0007224 | smoothened signaling pathway(GO:0007224) |
0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.3 | GO:0045727 | positive regulation of translation(GO:0045727) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.1 | GO:0006206 | pyrimidine nucleobase metabolic process(GO:0006206) |
0.0 | 0.4 | GO:0071479 | cellular response to ionizing radiation(GO:0071479) |
0.0 | 0.0 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.0 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.0 | GO:1903527 | regulation of membrane tubulation(GO:1903525) positive regulation of membrane tubulation(GO:1903527) |
0.0 | 0.3 | GO:0007368 | determination of left/right symmetry(GO:0007368) |
0.0 | 0.0 | GO:0070266 | necroptotic process(GO:0070266) |
0.0 | 0.0 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.0 | 0.5 | GO:0042073 | intraciliary transport(GO:0042073) |
0.0 | 0.0 | GO:0046885 | regulation of hormone biosynthetic process(GO:0046885) |
0.0 | 0.1 | GO:0036353 | histone H2A-K119 monoubiquitination(GO:0036353) |
0.0 | 0.2 | GO:0007569 | cell aging(GO:0007569) |
0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.1 | GO:0055012 | ventricular cardiac muscle cell differentiation(GO:0055012) |
0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.1 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.0 | 0.1 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.1 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
0.0 | 0.0 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.0 | 0.1 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
0.0 | 0.5 | GO:0030838 | positive regulation of actin filament polymerization(GO:0030838) |
0.0 | 0.0 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
0.0 | 0.0 | GO:0016132 | brassinosteroid metabolic process(GO:0016131) brassinosteroid biosynthetic process(GO:0016132) |
0.0 | 0.0 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
0.0 | 0.0 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.1 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.0 | 0.0 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
0.0 | 0.1 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.0 | 0.1 | GO:0045143 | homologous chromosome segregation(GO:0045143) |
0.0 | 0.0 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.0 | GO:0044861 | protein transport into plasma membrane raft(GO:0044861) |
0.0 | 0.0 | GO:0019433 | triglyceride catabolic process(GO:0019433) |
0.0 | 0.2 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.5 | GO:0051225 | spindle assembly(GO:0051225) |
0.0 | 0.0 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.1 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.0 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
Gene overrepresentation in cellular_component category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.5 | GO:0031680 | G-protein beta/gamma-subunit complex(GO:0031680) |
0.8 | 2.3 | GO:0005584 | collagen type I trimer(GO:0005584) |
0.7 | 3.4 | GO:0005861 | troponin complex(GO:0005861) |
0.6 | 1.7 | GO:0097059 | CNTFR-CLCF1 complex(GO:0097059) |
0.5 | 0.5 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
0.5 | 1.6 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.5 | 5.4 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.5 | 1.5 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
0.5 | 3.4 | GO:0001740 | Barr body(GO:0001740) |
0.5 | 3.3 | GO:0097452 | GAIT complex(GO:0097452) |
0.5 | 3.3 | GO:0042627 | chylomicron(GO:0042627) |
0.4 | 1.3 | GO:0070557 | PCNA-p21 complex(GO:0070557) |
0.4 | 1.7 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.4 | 1.6 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.4 | 1.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.4 | 1.1 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
0.3 | 1.0 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.3 | 1.9 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.3 | 2.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.3 | 0.9 | GO:0071953 | elastic fiber(GO:0071953) |
0.3 | 1.2 | GO:0060187 | cell pole(GO:0060187) |
0.3 | 0.9 | GO:0033193 | Lsd1/2 complex(GO:0033193) |
0.3 | 3.8 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.3 | 2.9 | GO:0005642 | annulate lamellae(GO:0005642) |
0.3 | 1.6 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.3 | 3.4 | GO:0043219 | lateral loop(GO:0043219) |
0.3 | 1.5 | GO:0035976 | AP1 complex(GO:0035976) |
0.2 | 1.2 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.2 | 1.0 | GO:0008623 | CHRAC(GO:0008623) |
0.2 | 1.0 | GO:0097129 | cyclin D2-CDK4 complex(GO:0097129) |
0.2 | 1.7 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.2 | 0.7 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 0.7 | GO:0071595 | Nem1-Spo7 phosphatase complex(GO:0071595) |
0.2 | 1.6 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.2 | 0.2 | GO:0035061 | interchromatin granule(GO:0035061) |
0.2 | 1.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.2 | 2.5 | GO:0005915 | zonula adherens(GO:0005915) |
0.2 | 0.9 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.2 | 0.4 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.2 | 0.8 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.2 | 0.6 | GO:0043224 | nuclear SCF ubiquitin ligase complex(GO:0043224) |
0.2 | 3.6 | GO:0097470 | ribbon synapse(GO:0097470) |
0.2 | 0.9 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.2 | 0.2 | GO:0070436 | Grb2-EGFR complex(GO:0070436) |
0.2 | 1.2 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.2 | 1.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.2 | 0.9 | GO:0097226 | sperm mitochondrial sheath(GO:0097226) |
0.2 | 0.5 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.2 | 1.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.2 | 8.0 | GO:0000791 | euchromatin(GO:0000791) |
0.2 | 2.7 | GO:0042588 | zymogen granule(GO:0042588) |
0.2 | 0.2 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) |
0.2 | 0.8 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.2 | 0.5 | GO:0098559 | cytoplasmic side of early endosome membrane(GO:0098559) |
0.2 | 3.2 | GO:0045120 | pronucleus(GO:0045120) |
0.2 | 0.6 | GO:0061702 | inflammasome complex(GO:0061702) |
0.2 | 2.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.2 | 1.4 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.2 | 1.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.2 | 0.5 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.2 | 0.6 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.7 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 10.9 | GO:0005844 | polysome(GO:0005844) |
0.1 | 0.9 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.4 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
0.1 | 1.2 | GO:0001739 | sex chromatin(GO:0001739) |
0.1 | 1.0 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 0.7 | GO:0072487 | MSL complex(GO:0072487) |
0.1 | 0.9 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 1.8 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 2.7 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 0.1 | GO:1902737 | dendritic filopodium(GO:1902737) |
0.1 | 0.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.9 | GO:0097165 | nuclear stress granule(GO:0097165) |
0.1 | 2.8 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.1 | 0.9 | GO:0098644 | complex of collagen trimers(GO:0098644) |
0.1 | 1.4 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 0.5 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.1 | 3.2 | GO:0005685 | U1 snRNP(GO:0005685) |
0.1 | 0.8 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 2.7 | GO:0016580 | Sin3 complex(GO:0016580) |
0.1 | 0.3 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 1.0 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 1.6 | GO:0005862 | muscle thin filament tropomyosin(GO:0005862) |
0.1 | 0.5 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.1 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.4 | GO:0000801 | central element(GO:0000801) |
0.1 | 1.0 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.7 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 1.0 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 1.0 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 1.0 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.7 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.1 | 0.4 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.6 | GO:1990131 | Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.1 | 0.5 | GO:0030906 | retromer, cargo-selective complex(GO:0030906) |
0.1 | 1.5 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 1.6 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.1 | 0.7 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 0.1 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.1 | 0.2 | GO:0044305 | calyx of Held(GO:0044305) |
0.1 | 0.3 | GO:0000939 | condensed chromosome inner kinetochore(GO:0000939) |
0.1 | 0.4 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.9 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 1.5 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 0.4 | GO:0000438 | core TFIIH complex portion of holo TFIIH complex(GO:0000438) |
0.1 | 0.7 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.1 | 0.3 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 0.4 | GO:1990590 | ATF1-ATF4 transcription factor complex(GO:1990590) |
0.1 | 0.2 | GO:0035101 | FACT complex(GO:0035101) |
0.1 | 1.1 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.1 | 10.7 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.1 | 0.3 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.5 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.8 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.1 | 0.5 | GO:0000839 | Hrd1p ubiquitin ligase ERAD-L complex(GO:0000839) |
0.1 | 0.3 | GO:0036125 | mitochondrial fatty acid beta-oxidation multienzyme complex(GO:0016507) fatty acid beta-oxidation multienzyme complex(GO:0036125) |
0.1 | 0.4 | GO:0045283 | mitochondrial respiratory chain complex II, succinate dehydrogenase complex (ubiquinone)(GO:0005749) succinate dehydrogenase complex (ubiquinone)(GO:0045257) respiratory chain complex II(GO:0045273) succinate dehydrogenase complex(GO:0045281) fumarate reductase complex(GO:0045283) |
0.1 | 0.8 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.6 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 4.2 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 0.1 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 1.8 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.5 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.1 | 0.5 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.5 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 1.1 | GO:0031011 | Ino80 complex(GO:0031011) |
0.1 | 0.4 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.1 | 0.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.1 | 0.2 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.1 | 0.4 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.1 | GO:0071920 | cleavage body(GO:0071920) |
0.1 | 2.9 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 0.8 | GO:0061617 | MICOS complex(GO:0061617) |
0.1 | 0.5 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 0.7 | GO:0002177 | manchette(GO:0002177) |
0.1 | 0.7 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.4 | GO:0000235 | astral microtubule(GO:0000235) |
0.1 | 0.5 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 1.5 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 0.4 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 0.3 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 0.3 | GO:0002111 | BRCA2-BRAF35 complex(GO:0002111) |
0.1 | 4.0 | GO:0005581 | collagen trimer(GO:0005581) |
0.1 | 0.5 | GO:0043256 | laminin complex(GO:0043256) |
0.1 | 0.9 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.8 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.1 | 0.5 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.1 | 0.2 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 0.2 | GO:0071914 | prominosome(GO:0071914) |
0.1 | 0.5 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.1 | 0.8 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 0.8 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.2 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.4 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 2.4 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.1 | 0.9 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.4 | GO:0036396 | MIS complex(GO:0036396) mRNA editing complex(GO:0045293) |
0.1 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 0.5 | GO:0000974 | Prp19 complex(GO:0000974) |
0.1 | 1.1 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.1 | 0.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.1 | 0.4 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.6 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 1.0 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 0.3 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 0.6 | GO:0090543 | Flemming body(GO:0090543) |
0.1 | 0.5 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 0.3 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.1 | 0.5 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 1.0 | GO:0016363 | nuclear matrix(GO:0016363) |
0.1 | 0.7 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 2.4 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 0.5 | GO:0042825 | TAP complex(GO:0042825) |
0.1 | 0.3 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.1 | 1.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.1 | 0.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 0.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.1 | 0.3 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.1 | 1.9 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.1 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.1 | 0.8 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 1.1 | GO:0043657 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.4 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.1 | 0.1 | GO:0043073 | germ cell nucleus(GO:0043073) |
0.1 | 0.2 | GO:0030690 | Noc1p-Noc2p complex(GO:0030690) |
0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.7 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.1 | 2.8 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
0.1 | 0.1 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.5 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.2 | GO:0034751 | aryl hydrocarbon receptor complex(GO:0034751) |
0.1 | 0.3 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.1 | 0.9 | GO:0097225 | sperm midpiece(GO:0097225) |
0.1 | 0.4 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.9 | GO:0030914 | STAGA complex(GO:0030914) |
0.1 | 0.4 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.4 | GO:0042382 | paraspeckles(GO:0042382) |
0.1 | 0.6 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.1 | GO:1990730 | VCP-NSFL1C complex(GO:1990730) |
0.1 | 1.7 | GO:0097546 | ciliary base(GO:0097546) |
0.1 | 1.7 | GO:0032420 | stereocilium(GO:0032420) |
0.1 | 0.3 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 0.4 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 0.3 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.4 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.0 | 0.2 | GO:0043564 | Ku70:Ku80 complex(GO:0043564) |
0.0 | 2.1 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.3 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) |
0.0 | 1.2 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
0.0 | 0.6 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 16.2 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.0 | 0.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 1.5 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 3.1 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.0 | 0.3 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.0 | 0.2 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.7 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.3 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.2 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 2.4 | GO:0044391 | ribosomal subunit(GO:0044391) |
0.0 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.5 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.3 | GO:0042611 | MHC protein complex(GO:0042611) |
0.0 | 0.0 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.5 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.6 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 2.1 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.2 | GO:1990452 | Parkin-FBXW7-Cul1 ubiquitin ligase complex(GO:1990452) |
0.0 | 0.9 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.7 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.3 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.3 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.6 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.0 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.6 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.1 | GO:0030905 | retromer, tubulation complex(GO:0030905) |
0.0 | 0.1 | GO:1990682 | CSF1-CSF1R complex(GO:1990682) |
0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 0.4 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.1 | GO:0032311 | angiogenin-PRI complex(GO:0032311) |
0.0 | 2.8 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.2 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.7 | GO:0030286 | dynein complex(GO:0030286) |
0.0 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.3 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.8 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.5 | GO:0032993 | protein-DNA complex(GO:0032993) |
0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 2.5 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.1 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.0 | GO:0097233 | lamellar body membrane(GO:0097232) alveolar lamellar body membrane(GO:0097233) |
0.0 | 0.2 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.0 | 0.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 2.3 | GO:0000793 | condensed chromosome(GO:0000793) |
0.0 | 0.4 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.9 | GO:1990391 | DNA repair complex(GO:1990391) |
0.0 | 2.4 | GO:0005924 | cell-substrate adherens junction(GO:0005924) cell-substrate junction(GO:0030055) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.1 | GO:0044754 | secondary lysosome(GO:0005767) autolysosome(GO:0044754) |
0.0 | 0.0 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.0 | 0.8 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.3 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.2 | GO:0043218 | compact myelin(GO:0043218) |
0.0 | 1.5 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.2 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 1.9 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.3 | GO:0001741 | XY body(GO:0001741) |
0.0 | 0.0 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
0.0 | 0.0 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.2 | GO:0070469 | respiratory chain(GO:0070469) |
0.0 | 0.3 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.0 | 0.1 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
0.0 | 0.6 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.1 | GO:0018444 | translation release factor complex(GO:0018444) |
0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.0 | 1.1 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 0.1 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.0 | 5.9 | GO:0000228 | nuclear chromosome(GO:0000228) |
0.0 | 0.0 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 1.0 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.5 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.3 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.2 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
0.0 | 0.2 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:0031510 | SUMO activating enzyme complex(GO:0031510) |
0.0 | 0.3 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 5.6 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 4.0 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.0 | 1.0 | GO:0030684 | preribosome(GO:0030684) |
0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.9 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) cytoplasmic side of late endosome membrane(GO:0098560) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0017109 | glutamate-cysteine ligase complex(GO:0017109) |
0.0 | 0.2 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.1 | GO:0042720 | mitochondrial inner membrane peptidase complex(GO:0042720) |
0.0 | 1.4 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.1 | GO:0099573 | glutamatergic postsynaptic density(GO:0099573) |
0.0 | 0.3 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.0 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.0 | 0.1 | GO:1990047 | spindle matrix(GO:1990047) |
0.0 | 0.2 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.8 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.0 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 1.0 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.0 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.3 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.1 | GO:1990356 | sumoylated E2 ligase complex(GO:1990356) |
0.0 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.4 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.5 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.0 | GO:0048269 | methionine adenosyltransferase complex(GO:0048269) |
0.0 | 0.1 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.6 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 0.3 | GO:0045178 | basal part of cell(GO:0045178) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.2 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.0 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 1.2 | GO:0000785 | chromatin(GO:0000785) |
0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.2 | GO:0032156 | septin cytoskeleton(GO:0032156) |
0.0 | 0.0 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.1 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.0 | GO:0030532 | small nuclear ribonucleoprotein complex(GO:0030532) |
0.0 | 0.1 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.0 | GO:0009328 | phenylalanine-tRNA ligase complex(GO:0009328) |
Gene overrepresentation in molecular_function category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 6.4 | GO:0019828 | aspartic-type endopeptidase inhibitor activity(GO:0019828) |
0.7 | 2.8 | GO:0097100 | supercoiled DNA binding(GO:0097100) |
0.7 | 3.4 | GO:0031014 | troponin T binding(GO:0031014) |
0.7 | 5.3 | GO:0016618 | hydroxypyruvate reductase activity(GO:0016618) glyoxylate reductase (NADP) activity(GO:0030267) |
0.6 | 0.6 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
0.6 | 2.3 | GO:0008142 | oxysterol binding(GO:0008142) |
0.6 | 1.1 | GO:0070052 | collagen V binding(GO:0070052) |
0.5 | 4.4 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.5 | 1.6 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.5 | 1.6 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.5 | 1.6 | GO:0035939 | microsatellite binding(GO:0035939) |
0.5 | 1.5 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.5 | 2.5 | GO:0001010 | transcription factor activity, sequence-specific DNA binding transcription factor recruiting(GO:0001010) |
0.5 | 2.5 | GO:0050265 | RNA uridylyltransferase activity(GO:0050265) |
0.5 | 5.8 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.4 | 1.3 | GO:0000402 | open form four-way junction DNA binding(GO:0000401) crossed form four-way junction DNA binding(GO:0000402) |
0.4 | 2.6 | GO:0019841 | retinol binding(GO:0019841) |
0.4 | 2.6 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.4 | 1.7 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.4 | 1.7 | GO:0004921 | interleukin-11 receptor activity(GO:0004921) interleukin-11 binding(GO:0019970) |
0.4 | 0.4 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.4 | 1.6 | GO:0044729 | hemi-methylated DNA-binding(GO:0044729) |
0.4 | 6.4 | GO:0003680 | AT DNA binding(GO:0003680) |
0.4 | 3.2 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) |
0.4 | 1.6 | GO:0072320 | volume-sensitive chloride channel activity(GO:0072320) |
0.4 | 1.5 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
0.4 | 2.2 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.4 | 3.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.4 | 1.1 | GO:0004335 | galactokinase activity(GO:0004335) |
0.4 | 2.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.4 | 1.8 | GO:0035614 | snRNA stem-loop binding(GO:0035614) |
0.4 | 2.5 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.4 | 1.4 | GO:0038049 | glucocorticoid receptor activity(GO:0004883) transcription factor activity, ligand-activated RNA polymerase II transcription factor binding(GO:0038049) glucocorticoid-activated RNA polymerase II transcription factor binding transcription factor activity(GO:0038051) |
0.3 | 1.3 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.3 | 1.3 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.3 | 1.3 | GO:0046920 | alpha-(1->3)-fucosyltransferase activity(GO:0046920) |
0.3 | 1.6 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
0.3 | 0.9 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.3 | 0.3 | GO:0003681 | bent DNA binding(GO:0003681) |
0.3 | 1.5 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.3 | 0.9 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.3 | 1.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.3 | 0.3 | GO:0001846 | opsonin binding(GO:0001846) |
0.3 | 2.3 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.3 | 0.6 | GO:0034046 | poly(G) binding(GO:0034046) |
0.3 | 5.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.3 | 0.8 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.3 | 1.1 | GO:0086075 | gap junction channel activity involved in cardiac conduction electrical coupling(GO:0086075) gap junction channel activity involved in cell communication by electrical coupling(GO:1903763) |
0.3 | 1.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.3 | 0.8 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.3 | 6.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.3 | 2.4 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) collagen receptor activity(GO:0038064) |
0.3 | 1.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.3 | 1.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.3 | 2.1 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.3 | 0.8 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.3 | 0.8 | GO:0031208 | POZ domain binding(GO:0031208) |
0.3 | 0.3 | GO:0005534 | galactose binding(GO:0005534) |
0.2 | 0.5 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.2 | 1.2 | GO:0043515 | kinetochore binding(GO:0043515) |
0.2 | 1.0 | GO:0017077 | oxidative phosphorylation uncoupler activity(GO:0017077) |
0.2 | 4.0 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.2 | 0.9 | GO:0031687 | A2A adenosine receptor binding(GO:0031687) |
0.2 | 1.4 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.2 | 4.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.2 | 1.3 | GO:0043426 | MRF binding(GO:0043426) |
0.2 | 2.7 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.2 | 5.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.2 | 1.1 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.2 | 0.9 | GO:0004066 | asparagine synthase (glutamine-hydrolyzing) activity(GO:0004066) |
0.2 | 0.9 | GO:0086038 | calcium:sodium antiporter activity involved in regulation of cardiac muscle cell membrane potential(GO:0086038) |
0.2 | 1.1 | GO:0004142 | diacylglycerol cholinephosphotransferase activity(GO:0004142) |
0.2 | 1.0 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.2 | 2.1 | GO:0035198 | miRNA binding(GO:0035198) |
0.2 | 0.4 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.2 | 2.3 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.2 | 2.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.2 | 0.8 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.2 | 0.6 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
0.2 | 2.6 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.2 | 0.8 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.2 | 1.4 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.2 | 1.6 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.2 | 0.4 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.2 | 0.4 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.2 | 8.7 | GO:0070888 | E-box binding(GO:0070888) |
0.2 | 0.6 | GO:0015403 | thiamine uptake transmembrane transporter activity(GO:0015403) |
0.2 | 2.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.2 | 0.6 | GO:0036132 | 13-prostaglandin reductase activity(GO:0036132) 15-oxoprostaglandin 13-oxidase activity(GO:0047522) |
0.2 | 0.7 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.2 | 0.5 | GO:0004454 | ketohexokinase activity(GO:0004454) |
0.2 | 6.0 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.2 | 0.2 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.2 | 1.6 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.2 | 0.7 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.2 | 2.5 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.2 | 1.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.2 | 1.2 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.2 | 0.9 | GO:1904047 | S-adenosyl-L-methionine binding(GO:1904047) |
0.2 | 0.7 | GO:0070279 | vitamin B6 binding(GO:0070279) |
0.2 | 0.7 | GO:0000700 | mismatch base pair DNA N-glycosylase activity(GO:0000700) |
0.2 | 0.9 | GO:0003839 | gamma-glutamylcyclotransferase activity(GO:0003839) |
0.2 | 1.0 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) |
0.2 | 0.7 | GO:0016230 | sphingomyelin phosphodiesterase activator activity(GO:0016230) |
0.2 | 0.7 | GO:0003844 | 1,4-alpha-glucan branching enzyme activity(GO:0003844) |
0.2 | 0.8 | GO:0008494 | translation activator activity(GO:0008494) |
0.2 | 12.4 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.2 | 3.1 | GO:0001848 | complement binding(GO:0001848) |
0.2 | 0.2 | GO:0008967 | phosphoglycolate phosphatase activity(GO:0008967) |
0.2 | 2.5 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.2 | 2.6 | GO:0051400 | BH domain binding(GO:0051400) |
0.2 | 1.0 | GO:0002135 | CTP binding(GO:0002135) |
0.2 | 0.8 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
0.2 | 0.8 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.2 | 2.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.2 | 1.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.2 | 1.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.2 | 1.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.2 | 1.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.2 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.2 | 0.5 | GO:0004647 | phosphoserine phosphatase activity(GO:0004647) |
0.2 | 0.8 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.2 | 3.8 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 1.6 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 1.0 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 1.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.3 | GO:0061649 | ubiquitinated histone binding(GO:0061649) |
0.1 | 0.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.4 | GO:0043183 | vascular endothelial growth factor receptor 1 binding(GO:0043183) |
0.1 | 0.4 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 1.0 | GO:1901612 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
0.1 | 1.4 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
0.1 | 0.6 | GO:1990948 | ligase inhibitor activity(GO:0055104) ubiquitin ligase inhibitor activity(GO:1990948) |
0.1 | 0.3 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 0.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.1 | 1.3 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.1 | 0.4 | GO:0036470 | tyrosine 3-monooxygenase activator activity(GO:0036470) L-dopa decarboxylase activator activity(GO:0036478) |
0.1 | 0.3 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.1 | 1.0 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 0.7 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) O-palmitoyltransferase activity(GO:0016416) |
0.1 | 0.5 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 0.8 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.7 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
0.1 | 0.7 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.1 | 1.5 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.1 | 0.9 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.3 | GO:0033680 | ATP-dependent DNA/RNA helicase activity(GO:0033680) |
0.1 | 0.4 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 0.5 | GO:0015254 | glycerol channel activity(GO:0015254) |
0.1 | 0.5 | GO:0003998 | acylphosphatase activity(GO:0003998) |
0.1 | 0.5 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 1.6 | GO:0033764 | steroid dehydrogenase activity, acting on the CH-OH group of donors, NAD or NADP as acceptor(GO:0033764) |
0.1 | 0.6 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.1 | 0.5 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.1 | 0.8 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.1 | 1.0 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.1 | 0.9 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.1 | 0.4 | GO:0070736 | protein-glycine ligase activity(GO:0070735) protein-glycine ligase activity, initiating(GO:0070736) |
0.1 | 0.5 | GO:0004064 | arylesterase activity(GO:0004064) |
0.1 | 0.9 | GO:0048101 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.1 | 0.9 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.1 | 1.0 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.6 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.1 | 0.4 | GO:0004489 | methylenetetrahydrofolate reductase (NAD(P)H) activity(GO:0004489) |
0.1 | 2.1 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
0.1 | 0.5 | GO:0045131 | pre-mRNA branch point binding(GO:0045131) |
0.1 | 0.4 | GO:0070140 | isopeptidase activity(GO:0070122) ubiquitin-like protein-specific isopeptidase activity(GO:0070138) SUMO-specific isopeptidase activity(GO:0070140) |
0.1 | 0.5 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.1 | 1.7 | GO:0070717 | poly-purine tract binding(GO:0070717) |
0.1 | 0.7 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.5 | GO:2001069 | glycogen binding(GO:2001069) |
0.1 | 1.5 | GO:0019825 | oxygen binding(GO:0019825) |
0.1 | 0.4 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.1 | 0.9 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 1.6 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.2 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 1.6 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.1 | 0.3 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.1 | 0.9 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 0.8 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.1 | 0.3 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.1 | 0.2 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.3 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 1.8 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.1 | 0.6 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 3.5 | GO:0005109 | frizzled binding(GO:0005109) |
0.1 | 0.6 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.1 | 1.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.1 | 0.1 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) glycerol transmembrane transporter activity(GO:0015168) |
0.1 | 0.3 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.1 | 0.3 | GO:0034597 | phosphatidylinositol-4,5-bisphosphate 4-phosphatase activity(GO:0034597) |
0.1 | 0.3 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.6 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.1 | 1.1 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 0.4 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 0.3 | GO:0035402 | histone kinase activity (H3-T11 specific)(GO:0035402) |
0.1 | 0.3 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 0.5 | GO:1990188 | euchromatin binding(GO:1990188) |
0.1 | 3.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.1 | 11.9 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.1 | 0.3 | GO:0016314 | phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase activity(GO:0016314) |
0.1 | 3.6 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 0.3 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.1 | 2.3 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 0.3 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 2.9 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.1 | 0.4 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 0.4 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 2.1 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.1 | 0.6 | GO:0048185 | activin binding(GO:0048185) |
0.1 | 0.9 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.1 | 1.2 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.3 | GO:0019002 | GMP binding(GO:0019002) |
0.1 | 0.2 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.1 | 0.3 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.1 | 0.3 | GO:0051870 | methotrexate binding(GO:0051870) |
0.1 | 0.3 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.3 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.1 | 0.4 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 1.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 0.2 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.3 | GO:0003979 | UDP-glucose 6-dehydrogenase activity(GO:0003979) |
0.1 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 1.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 1.8 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.1 | 0.8 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
0.1 | 0.4 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 0.6 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.4 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.3 | GO:0044715 | 8-oxo-dGDP phosphatase activity(GO:0044715) |
0.1 | 0.9 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.3 | GO:0046899 | nucleoside triphosphate adenylate kinase activity(GO:0046899) |
0.1 | 0.9 | GO:0001618 | virus receptor activity(GO:0001618) |
0.1 | 0.3 | GO:0016708 | nitric oxide dioxygenase activity(GO:0008941) oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of two atoms of oxygen into one donor(GO:0016708) iron-cytochrome-c reductase activity(GO:0047726) |
0.1 | 1.9 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.1 | 0.3 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.4 | GO:0004954 | icosanoid receptor activity(GO:0004953) prostanoid receptor activity(GO:0004954) prostaglandin receptor activity(GO:0004955) |
0.1 | 0.4 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.5 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.1 | 0.7 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 0.9 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.1 | 0.9 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.1 | 0.3 | GO:0004392 | heme oxygenase (decyclizing) activity(GO:0004392) |
0.1 | 0.5 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 0.3 | GO:0050661 | NADP binding(GO:0050661) |
0.1 | 0.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 18.6 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.1 | 0.2 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.1 | 1.3 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.7 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.1 | 0.3 | GO:0008802 | betaine-aldehyde dehydrogenase activity(GO:0008802) |
0.1 | 0.6 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.5 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 0.2 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 0.8 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 1.2 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.3 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.1 | 1.0 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 0.4 | GO:0042610 | CD8 receptor binding(GO:0042610) |
0.1 | 0.4 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.5 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.1 | 0.7 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.4 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.8 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.1 | 0.4 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 0.2 | GO:0036033 | mediator complex binding(GO:0036033) |
0.1 | 0.6 | GO:0019956 | chemokine binding(GO:0019956) |
0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.5 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.1 | 0.4 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.1 | 0.4 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.1 | 3.7 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.1 | 0.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 1.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 0.4 | GO:0004852 | uroporphyrinogen-III synthase activity(GO:0004852) |
0.1 | 0.9 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.1 | 0.7 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.1 | 0.8 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 1.1 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.1 | 0.3 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 0.3 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.5 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.1 | 0.2 | GO:0004998 | transferrin receptor activity(GO:0004998) |
0.1 | 0.3 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.5 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.1 | 0.3 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
0.1 | 0.6 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 0.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 1.0 | GO:0045182 | translation regulator activity(GO:0045182) |
0.1 | 0.7 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.1 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.4 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.1 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.6 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.1 | 0.8 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.1 | 1.6 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.1 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.1 | 0.3 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 0.4 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 0.2 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.4 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.1 | 0.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 2.8 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.1 | 6.2 | GO:0008201 | heparin binding(GO:0008201) |
0.1 | 1.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.1 | 0.2 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 2.7 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.1 | 0.4 | GO:0015099 | nickel cation transmembrane transporter activity(GO:0015099) |
0.1 | 0.5 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.1 | GO:0046969 | histone deacetylase activity (H3-K9 specific)(GO:0032129) NAD-dependent histone deacetylase activity (H3-K9 specific)(GO:0046969) |
0.1 | 0.4 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 0.2 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) |
0.1 | 0.3 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.1 | 0.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.1 | 0.2 | GO:0008176 | tRNA (guanine-N7-)-methyltransferase activity(GO:0008176) |
0.1 | 0.2 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.2 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.6 | GO:0019531 | secondary active sulfate transmembrane transporter activity(GO:0008271) oxalate transmembrane transporter activity(GO:0019531) |
0.1 | 0.3 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 0.5 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) inositol trisphosphate phosphatase activity(GO:0046030) |
0.1 | 0.3 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 8.6 | GO:0001159 | core promoter proximal region DNA binding(GO:0001159) |
0.1 | 2.0 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.1 | 0.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.9 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 8.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.2 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.8 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.1 | 0.3 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 1.3 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.1 | 0.3 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.1 | 2.6 | GO:0001047 | core promoter binding(GO:0001047) |
0.1 | 1.7 | GO:0000982 | transcription factor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0000982) |
0.1 | 0.7 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.2 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) sodium:inorganic phosphate symporter activity(GO:0015319) |
0.1 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.3 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.1 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 0.5 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.1 | 0.4 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 1.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.2 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) enone reductase activity(GO:0035671) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.1 | 0.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.3 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.0 | GO:0004104 | cholinesterase activity(GO:0004104) choline binding(GO:0033265) |
0.0 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.3 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.2 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.5 | GO:0000981 | RNA polymerase II transcription factor activity, sequence-specific DNA binding(GO:0000981) |
0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.5 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.1 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 0.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.2 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.1 | GO:0044547 | DNA topoisomerase binding(GO:0044547) |
0.0 | 0.3 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 1.2 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 1.0 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
0.0 | 0.5 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 2.6 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.4 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.4 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 1.1 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.0 | 0.5 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.0 | 0.6 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 1.8 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.4 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.1 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
0.0 | 0.2 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.5 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.5 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 1.3 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.2 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.0 | 0.5 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 0.2 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 0.2 | GO:0008569 | ATP-dependent microtubule motor activity, minus-end-directed(GO:0008569) |
0.0 | 0.0 | GO:0016422 | mRNA (2'-O-methyladenosine-N6-)-methyltransferase activity(GO:0016422) |
0.0 | 0.2 | GO:0089720 | caspase binding(GO:0089720) |
0.0 | 0.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.0 | 1.6 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.4 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.4 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
0.0 | 3.1 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
0.0 | 0.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.2 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.0 | 0.3 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.0 | 0.2 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.1 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.1 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 0.1 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.0 | 0.3 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 0.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.6 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.0 | 0.3 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
0.0 | 0.1 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.3 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 2.2 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.0 | GO:0001179 | RNA polymerase I transcription factor binding(GO:0001179) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.6 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.2 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 1.1 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.0 | 0.5 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.2 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.2 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.6 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 1.3 | GO:0097472 | cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.1 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.0 | 0.4 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.6 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.1 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.1 | GO:0046964 | 3'-phosphoadenosine 5'-phosphosulfate transmembrane transporter activity(GO:0046964) |
0.0 | 0.1 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
0.0 | 0.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:0004140 | dephospho-CoA kinase activity(GO:0004140) |
0.0 | 0.4 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.2 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.6 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.0 | 0.2 | GO:0016504 | peptidase activator activity(GO:0016504) |
0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.1 | GO:0042834 | peptidoglycan binding(GO:0042834) |
0.0 | 0.5 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.0 | 0.2 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 1.0 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.1 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.0 | 0.1 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.2 | GO:0070290 | phospholipase D activity(GO:0004630) N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.5 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.0 | 0.5 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.1 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.0 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.1 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 1.1 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 4.2 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.1 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.0 | 0.1 | GO:0018738 | S-formylglutathione hydrolase activity(GO:0018738) |
0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.1 | GO:0004357 | glutamate-cysteine ligase activity(GO:0004357) |
0.0 | 0.2 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.5 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.0 | 0.1 | GO:0003938 | IMP dehydrogenase activity(GO:0003938) |
0.0 | 0.4 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.1 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.0 | 0.2 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.0 | 0.3 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.0 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 0.7 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.0 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.0 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.2 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.0 | 0.4 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.0 | 0.4 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.0 | 0.1 | GO:0004531 | deoxyribonuclease II activity(GO:0004531) |
0.0 | 0.2 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.2 | GO:0044388 | small protein activating enzyme binding(GO:0044388) |
0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.4 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.1 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.5 | GO:0004532 | exoribonuclease activity(GO:0004532) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.1 | GO:0016901 | glycerol-3-phosphate dehydrogenase activity(GO:0004368) oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.3 | GO:0008528 | G-protein coupled peptide receptor activity(GO:0008528) |
0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.0 | GO:0097677 | STAT family protein binding(GO:0097677) |
0.0 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.1 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.4 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 6.0 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.0 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.0 | 0.4 | GO:0016706 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors(GO:0016706) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.0 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.0 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.0 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.4 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.0 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.0 | 0.0 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.0 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.0 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.3 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 1.3 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 0.0 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.1 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.0 | 0.0 | GO:0016206 | catechol O-methyltransferase activity(GO:0016206) |
0.0 | 0.0 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.0 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.1 | GO:0003678 | DNA helicase activity(GO:0003678) |
0.0 | 0.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.8 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 0.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.1 | GO:0070568 | guanylyltransferase activity(GO:0070568) |
0.0 | 0.0 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.1 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.7 | GO:0008186 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.3 | GO:0001098 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
0.0 | 0.1 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.0 | GO:0015189 | L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 1.4 | GO:0008134 | transcription factor binding(GO:0008134) |
0.0 | 0.1 | GO:0052654 | branched-chain-amino-acid transaminase activity(GO:0004084) L-leucine transaminase activity(GO:0052654) L-valine transaminase activity(GO:0052655) L-isoleucine transaminase activity(GO:0052656) |
0.0 | 0.0 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.4 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
0.0 | 0.1 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.1 | GO:0004984 | olfactory receptor activity(GO:0004984) |
0.0 | 0.2 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.4 | GO:0034062 | RNA polymerase activity(GO:0034062) |
0.0 | 0.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.0 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.0 | GO:0004450 | isocitrate dehydrogenase (NADP+) activity(GO:0004450) |
0.0 | 0.3 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.1 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.0 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) |
Gene overrepresentation in C2:CP category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 0.8 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
0.5 | 6.7 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.2 | 6.1 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
0.2 | 1.8 | SA_G2_AND_M_PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.2 | 12.8 | PID_INTEGRIN1_PATHWAY | Beta1 integrin cell surface interactions |
0.2 | 18.6 | WNT_SIGNALING | Genes related to Wnt-mediated signal transduction |
0.2 | 8.3 | PID_BMP_PATHWAY | BMP receptor signaling |
0.1 | 0.1 | PID_PDGFRA_PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.7 | PID_NEPHRIN_NEPH1_PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 0.1 | PID_TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.1 | 0.1 | PID_PI3K_PLC_TRK_PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.1 | 0.1 | PID_NFKAPPAB_ATYPICAL_PATHWAY | Atypical NF-kappaB pathway |
0.1 | 0.8 | PID_WNT_NONCANONICAL_PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 5.9 | PID_AURORA_B_PATHWAY | Aurora B signaling |
0.1 | 3.8 | PID_TCR_CALCIUM_PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 2.2 | PID_RANBP2_PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 5.6 | PID_PLK1_PATHWAY | PLK1 signaling events |
0.1 | 6.6 | PID_HES_HEY_PATHWAY | Notch-mediated HES/HEY network |
0.1 | 2.4 | PID_ALK1_PATHWAY | ALK1 signaling events |
0.1 | 2.2 | PID_PRL_SIGNALING_EVENTS_PATHWAY | Signaling events mediated by PRL |
0.1 | 10.2 | PID_MYC_ACTIV_PATHWAY | Validated targets of C-MYC transcriptional activation |
0.1 | 3.3 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 1.5 | PID_FRA_PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.1 | 1.7 | PID_CIRCADIAN_PATHWAY | Circadian rhythm pathway |
0.1 | 3.5 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
0.1 | 1.4 | NABA_BASEMENT_MEMBRANES | Genes encoding structural components of basement membranes |
0.1 | 3.3 | PID_AP1_PATHWAY | AP-1 transcription factor network |
0.1 | 0.2 | PID_IL3_PATHWAY | IL3-mediated signaling events |
0.1 | 0.2 | PID_ALK2_PATHWAY | ALK2 signaling events |
0.1 | 3.0 | PID_P38_MK2_PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 6.3 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 1.1 | PID_INTEGRIN_A9B1_PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 0.4 | SA_FAS_SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 0.7 | PID_TCR_JNK_PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 1.5 | SA_PROGRAMMED_CELL_DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 0.1 | ST_T_CELL_SIGNAL_TRANSDUCTION | T Cell Signal Transduction |
0.1 | 1.6 | PID_AURORA_A_PATHWAY | Aurora A signaling |
0.1 | 2.3 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
0.1 | 0.5 | PID_SYNDECAN_4_PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 2.4 | PID_ILK_PATHWAY | Integrin-linked kinase signaling |
0.1 | 1.0 | PID_IL23_PATHWAY | IL23-mediated signaling events |
0.1 | 3.0 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
0.1 | 0.1 | PID_REELIN_PATHWAY | Reelin signaling pathway |
0.1 | 1.7 | PID_HIF1_TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 1.9 | PID_IL12_2PATHWAY | IL12-mediated signaling events |
0.1 | 1.5 | PID_TOLL_ENDOGENOUS_PATHWAY | Endogenous TLR signaling |
0.1 | 0.1 | SA_PTEN_PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 0.4 | PID_SMAD2_3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 0.8 | PID_EPHA2_FWD_PATHWAY | EPHA2 forward signaling |
0.1 | 1.4 | PID_IGF1_PATHWAY | IGF1 pathway |
0.1 | 0.9 | PID_HIF1A_PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.1 | PID_GMCSF_PATHWAY | GMCSF-mediated signaling events |
0.1 | 2.0 | PID_DELTA_NP63_PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 0.1 | PID_TCR_RAS_PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.1 | 1.0 | ST_P38_MAPK_PATHWAY | p38 MAPK Pathway |
0.1 | 0.2 | PID_ANTHRAX_PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 0.7 | SA_B_CELL_RECEPTOR_COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.1 | 1.4 | PID_ATR_PATHWAY | ATR signaling pathway |
0.0 | 0.4 | PID_EPO_PATHWAY | EPO signaling pathway |
0.0 | 0.6 | PID_TRAIL_PATHWAY | TRAIL signaling pathway |
0.0 | 1.3 | NABA_PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.1 | PID_PTP1B_PATHWAY | Signaling events mediated by PTP1B |
0.0 | 1.6 | PID_E2F_PATHWAY | E2F transcription factor network |
0.0 | 0.1 | PID_TCPTP_PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.3 | PID_GLYPICAN_1PATHWAY | Glypican 1 network |
0.0 | 0.8 | PID_BARD1_PATHWAY | BARD1 signaling events |
0.0 | 0.6 | PID_FOXM1_PATHWAY | FOXM1 transcription factor network |
0.0 | 0.2 | PID_ERB_GENOMIC_PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 4.5 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.5 | PID_CONE_PATHWAY | Visual signal transduction: Cones |
0.0 | 0.8 | PID_NECTIN_PATHWAY | Nectin adhesion pathway |
0.0 | 2.1 | PID_CMYB_PATHWAY | C-MYB transcription factor network |
0.0 | 0.4 | PID_PS1_PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.7 | NABA_COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.5 | PID_FANCONI_PATHWAY | Fanconi anemia pathway |
0.0 | 0.7 | SIG_INSULIN_RECEPTOR_PATHWAY_IN_CARDIAC_MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 1.4 | PID_CDC42_PATHWAY | CDC42 signaling events |
0.0 | 1.4 | PID_HDAC_CLASSI_PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 1.2 | PID_CASPASE_PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.7 | SIG_REGULATION_OF_THE_ACTIN_CYTOSKELETON_BY_RHO_GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.1 | PID_INTEGRIN5_PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.6 | PID_P38_ALPHA_BETA_PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.1 | PID_IL12_STAT4_PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 3.2 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.5 | PID_FCER1_PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 1.0 | PID_FGF_PATHWAY | FGF signaling pathway |
0.0 | 0.4 | PID_ATM_PATHWAY | ATM pathway |
0.0 | 0.9 | PID_NOTCH_PATHWAY | Notch signaling pathway |
0.0 | 0.4 | PID_CERAMIDE_PATHWAY | Ceramide signaling pathway |
0.0 | 0.1 | PID_AR_NONGENOMIC_PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.8 | PID_AR_TF_PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.0 | PID_LYMPH_ANGIOGENESIS_PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.2 | PID_ALPHA_SYNUCLEIN_PATHWAY | Alpha-synuclein signaling |
0.0 | 0.2 | PID_CD40_PATHWAY | CD40/CD40L signaling |
0.0 | 0.5 | PID_TAP63_PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.2 | PID_PI3KCI_PATHWAY | Class I PI3K signaling events |
0.0 | 0.2 | PID_RAC1_PATHWAY | RAC1 signaling pathway |
0.0 | 0.1 | ST_GAQ_PATHWAY | G alpha q Pathway |
0.0 | 0.2 | PID_EPHA_FWDPATHWAY | EPHA forward signaling |
0.0 | 0.0 | ST_WNT_CA2_CYCLIC_GMP_PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.3 | PID_ECADHERIN_STABILIZATION_PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.4 | PID_P53_REGULATION_PATHWAY | p53 pathway |
Gene overrepresentation in C2:CP:REACTOME category:
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 4.2 | REACTOME_APOBEC3G_MEDIATED_RESISTANCE_TO_HIV1_INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.4 | 0.4 | REACTOME_SCF_BETA_TRCP_MEDIATED_DEGRADATION_OF_EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.3 | 3.2 | REACTOME_FGFR2C_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.3 | 0.3 | REACTOME_SIGNALING_BY_FGFR3_MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.3 | 0.3 | REACTOME_ANTIGEN_PRESENTATION_FOLDING_ASSEMBLY_AND_PEPTIDE_LOADING_OF_CLASS_I_MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.3 | 10.3 | REACTOME_SMAD2_SMAD3_SMAD4_HETEROTRIMER_REGULATES_TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.3 | 2.3 | REACTOME_PLATELET_ADHESION_TO_EXPOSED_COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.2 | 0.5 | REACTOME_CONVERSION_FROM_APC_C_CDC20_TO_APC_C_CDH1_IN_LATE_ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.2 | 5.7 | REACTOME_STRIATED_MUSCLE_CONTRACTION | Genes involved in Striated Muscle Contraction |
0.2 | 5.7 | REACTOME_PRE_NOTCH_TRANSCRIPTION_AND_TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.2 | 4.4 | REACTOME_G0_AND_EARLY_G1 | Genes involved in G0 and Early G1 |
0.2 | 8.0 | REACTOME_GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.2 | 0.2 | REACTOME_APC_C_CDC20_MEDIATED_DEGRADATION_OF_MITOTIC_PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.2 | 1.4 | REACTOME_PRESYNAPTIC_NICOTINIC_ACETYLCHOLINE_RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.2 | 1.8 | REACTOME_INTRINSIC_PATHWAY | Genes involved in Intrinsic Pathway |
0.2 | 1.7 | REACTOME_KERATAN_SULFATE_DEGRADATION | Genes involved in Keratan sulfate degradation |
0.2 | 3.8 | REACTOME_HS_GAG_DEGRADATION | Genes involved in HS-GAG degradation |
0.2 | 0.8 | REACTOME_CELL_DEATH_SIGNALLING_VIA_NRAGE_NRIF_AND_NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.2 | 0.2 | REACTOME_CTLA4_INHIBITORY_SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.2 | 1.3 | REACTOME_CDC6_ASSOCIATION_WITH_THE_ORC_ORIGIN_COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.2 | 0.9 | REACTOME_IRAK2_MEDIATED_ACTIVATION_OF_TAK1_COMPLEX_UPON_TLR7_8_OR_9_STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.2 | 2.5 | REACTOME_DESTABILIZATION_OF_MRNA_BY_BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.2 | 2.5 | REACTOME_REGULATION_OF_INSULIN_LIKE_GROWTH_FACTOR_IGF_ACTIVITY_BY_INSULIN_LIKE_GROWTH_FACTOR_BINDING_PROTEINS_IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.2 | 1.4 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.2 | 3.9 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 2.2 | REACTOME_TETRAHYDROBIOPTERIN_BH4_SYNTHESIS_RECYCLING_SALVAGE_AND_REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 1.6 | REACTOME_DESTABILIZATION_OF_MRNA_BY_AUF1_HNRNP_D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 0.1 | REACTOME_PROSTACYCLIN_SIGNALLING_THROUGH_PROSTACYCLIN_RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 3.6 | REACTOME_REGULATION_OF_GENE_EXPRESSION_IN_BETA_CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 11.4 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.1 | 2.1 | REACTOME_ADVANCED_GLYCOSYLATION_ENDPRODUCT_RECEPTOR_SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.1 | 0.3 | REACTOME_RETROGRADE_NEUROTROPHIN_SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.1 | 1.1 | REACTOME_SYNTHESIS_OF_BILE_ACIDS_AND_BILE_SALTS_VIA_24_HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.1 | 0.1 | REACTOME_MRNA_DECAY_BY_3_TO_5_EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 0.4 | REACTOME_NEGATIVE_REGULATION_OF_THE_PI3K_AKT_NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 1.4 | REACTOME_CHYLOMICRON_MEDIATED_LIPID_TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.1 | 1.6 | REACTOME_ENOS_ACTIVATION_AND_REGULATION | Genes involved in eNOS activation and regulation |
0.1 | 1.6 | REACTOME_CYCLIN_A_B1_ASSOCIATED_EVENTS_DURING_G2_M_TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 1.9 | REACTOME_SYNTHESIS_SECRETION_AND_DEACYLATION_OF_GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 1.4 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 0.9 | REACTOME_RECEPTOR_LIGAND_BINDING_INITIATES_THE_SECOND_PROTEOLYTIC_CLEAVAGE_OF_NOTCH_RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 3.0 | REACTOME_RNA_POL_I_TRANSCRIPTION_INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.1 | 5.5 | REACTOME_RNA_POL_I_TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.1 | 1.2 | REACTOME_PROLACTIN_RECEPTOR_SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 2.3 | REACTOME_CITRIC_ACID_CYCLE_TCA_CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 1.6 | REACTOME_GENERATION_OF_SECOND_MESSENGER_MOLECULES | Genes involved in Generation of second messenger molecules |
0.1 | 0.6 | REACTOME_G2_M_DNA_DAMAGE_CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 1.5 | REACTOME_PROCESSIVE_SYNTHESIS_ON_THE_LAGGING_STRAND | Genes involved in Processive synthesis on the lagging strand |
0.1 | 0.1 | REACTOME_INFLUENZA_LIFE_CYCLE | Genes involved in Influenza Life Cycle |
0.1 | 2.3 | REACTOME_PYRIMIDINE_METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 1.6 | REACTOME_EXTENSION_OF_TELOMERES | Genes involved in Extension of Telomeres |
0.1 | 2.9 | REACTOME_BMAL1_CLOCK_NPAS2_ACTIVATES_CIRCADIAN_EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 1.3 | REACTOME_PECAM1_INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 1.7 | REACTOME_MITOCHONDRIAL_FATTY_ACID_BETA_OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 10.3 | REACTOME_MITOTIC_PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 0.2 | REACTOME_INTERACTIONS_OF_VPR_WITH_HOST_CELLULAR_PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.1 | 1.5 | REACTOME_P38MAPK_EVENTS | Genes involved in p38MAPK events |
0.1 | 0.3 | REACTOME_HORMONE_LIGAND_BINDING_RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 4.0 | REACTOME_O_LINKED_GLYCOSYLATION_OF_MUCINS | Genes involved in O-linked glycosylation of mucins |
0.1 | 2.7 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
0.1 | 1.8 | REACTOME_FORMATION_OF_ATP_BY_CHEMIOSMOTIC_COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 0.8 | REACTOME_PASSIVE_TRANSPORT_BY_AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.1 | 2.5 | REACTOME_G1_PHASE | Genes involved in G1 Phase |
0.1 | 0.4 | REACTOME_TRAF6_MEDIATED_NFKB_ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.1 | 0.6 | REACTOME_FORMATION_OF_FIBRIN_CLOT_CLOTTING_CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
0.1 | 0.7 | REACTOME_REGULATION_OF_ORNITHINE_DECARBOXYLASE_ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.1 | 1.9 | REACTOME_TGF_BETA_RECEPTOR_SIGNALING_IN_EMT_EPITHELIAL_TO_MESENCHYMAL_TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.2 | REACTOME_P53_DEPENDENT_G1_DNA_DAMAGE_RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.1 | 0.3 | REACTOME_PEPTIDE_CHAIN_ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 0.7 | REACTOME_REGULATION_OF_KIT_SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 1.6 | REACTOME_SIGNAL_ATTENUATION | Genes involved in Signal attenuation |
0.1 | 1.2 | REACTOME_OXYGEN_DEPENDENT_PROLINE_HYDROXYLATION_OF_HYPOXIA_INDUCIBLE_FACTOR_ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 0.5 | REACTOME_APOPTOTIC_CLEAVAGE_OF_CELL_ADHESION_PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 4.2 | REACTOME_CROSS_PRESENTATION_OF_SOLUBLE_EXOGENOUS_ANTIGENS_ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.1 | 0.3 | REACTOME_ETHANOL_OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 0.6 | REACTOME_SIGNALING_BY_NODAL | Genes involved in Signaling by NODAL |
0.1 | 0.3 | REACTOME_REGULATION_OF_THE_FANCONI_ANEMIA_PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.1 | 1.7 | REACTOME_PTM_GAMMA_CARBOXYLATION_HYPUSINE_FORMATION_AND_ARYLSULFATASE_ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.1 | 9.7 | REACTOME_MRNA_SPLICING | Genes involved in mRNA Splicing |
0.1 | 0.7 | REACTOME_DEPOSITION_OF_NEW_CENPA_CONTAINING_NUCLEOSOMES_AT_THE_CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 0.3 | REACTOME_REGULATION_OF_INSULIN_SECRETION_BY_ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.3 | REACTOME_ANDROGEN_BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.1 | 0.4 | REACTOME_AQUAPORIN_MEDIATED_TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.1 | 0.5 | REACTOME_CS_DS_DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 1.4 | REACTOME_KINESINS | Genes involved in Kinesins |
0.1 | 0.5 | REACTOME_GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 0.9 | REACTOME_GLYCOGEN_BREAKDOWN_GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 0.3 | REACTOME_RIP_MEDIATED_NFKB_ACTIVATION_VIA_DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.1 | 1.0 | REACTOME_ACTIVATION_OF_BH3_ONLY_PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 6.0 | REACTOME_INFLUENZA_VIRAL_RNA_TRANSCRIPTION_AND_REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.1 | 10.5 | REACTOME_ANTIGEN_PROCESSING_UBIQUITINATION_PROTEASOME_DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 1.0 | REACTOME_MEIOTIC_RECOMBINATION | Genes involved in Meiotic Recombination |
0.1 | 1.4 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
0.1 | 0.4 | REACTOME_FORMATION_OF_RNA_POL_II_ELONGATION_COMPLEX_ | Genes involved in Formation of RNA Pol II elongation complex |
0.1 | 0.3 | REACTOME_P130CAS_LINKAGE_TO_MAPK_SIGNALING_FOR_INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.1 | 0.5 | REACTOME_TRAFFICKING_AND_PROCESSING_OF_ENDOSOMAL_TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 3.0 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
0.1 | 0.6 | REACTOME_VEGF_LIGAND_RECEPTOR_INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.8 | REACTOME_ANTIGEN_PROCESSING_CROSS_PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.0 | 0.4 | REACTOME_HDL_MEDIATED_LIPID_TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.4 | REACTOME_PROCESSING_OF_CAPPED_INTRON_CONTAINING_PRE_MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.0 | 0.0 | REACTOME_LATENT_INFECTION_OF_HOMO_SAPIENS_WITH_MYCOBACTERIUM_TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.4 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 0.0 | REACTOME_CD28_DEPENDENT_VAV1_PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.9 | REACTOME_RNA_POL_II_PRE_TRANSCRIPTION_EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |
0.0 | 0.6 | REACTOME_RESOLUTION_OF_AP_SITES_VIA_THE_SINGLE_NUCLEOTIDE_REPLACEMENT_PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 3.2 | REACTOME_RESPIRATORY_ELECTRON_TRANSPORT_ATP_SYNTHESIS_BY_CHEMIOSMOTIC_COUPLING_AND_HEAT_PRODUCTION_BY_UNCOUPLING_PROTEINS_ | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.0 | 1.6 | REACTOME_DOWNSTREAM_SIGNALING_EVENTS_OF_B_CELL_RECEPTOR_BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.0 | 0.9 | REACTOME_ACTIVATION_OF_ATR_IN_RESPONSE_TO_REPLICATION_STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 0.9 | REACTOME_SMOOTH_MUSCLE_CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.4 | REACTOME_TRYPTOPHAN_CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.4 | REACTOME_HYALURONAN_METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.6 | REACTOME_IONOTROPIC_ACTIVITY_OF_KAINATE_RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 0.6 | REACTOME_METABOLISM_OF_NON_CODING_RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.8 | REACTOME_INTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.6 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.2 | REACTOME_DOWNREGULATION_OF_SMAD2_3_SMAD4_TRANSCRIPTIONAL_ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.6 | REACTOME_FORMATION_OF_THE_TERNARY_COMPLEX_AND_SUBSEQUENTLY_THE_43S_COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.4 | REACTOME_GLOBAL_GENOMIC_NER_GG_NER | Genes involved in Global Genomic NER (GG-NER) |
0.0 | 0.4 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.2 | REACTOME_ACTIVATION_OF_GENES_BY_ATF4 | Genes involved in Activation of Genes by ATF4 |
0.0 | 0.1 | REACTOME_SYNTHESIS_OF_PE | Genes involved in Synthesis of PE |
0.0 | 0.1 | REACTOME_HOMOLOGOUS_RECOMBINATION_REPAIR_OF_REPLICATION_INDEPENDENT_DOUBLE_STRAND_BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.1 | REACTOME_PLATELET_AGGREGATION_PLUG_FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.1 | REACTOME_G_BETA_GAMMA_SIGNALLING_THROUGH_PLC_BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.2 | REACTOME_G_ALPHA1213_SIGNALLING_EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.6 | REACTOME_ZINC_TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.1 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.4 | REACTOME_FANCONI_ANEMIA_PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.8 | REACTOME_NEP_NS2_INTERACTS_WITH_THE_CELLULAR_EXPORT_MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 1.2 | REACTOME_NOTCH1_INTRACELLULAR_DOMAIN_REGULATES_TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.3 | REACTOME_AMINE_DERIVED_HORMONES | Genes involved in Amine-derived hormones |
0.0 | 1.3 | REACTOME_MITOCHONDRIAL_PROTEIN_IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.3 | REACTOME_EXTRINSIC_PATHWAY_FOR_APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 1.4 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.2 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_ATF6_ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.5 | REACTOME_SULFUR_AMINO_ACID_METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.8 | REACTOME_SYNTHESIS_OF_VERY_LONG_CHAIN_FATTY_ACYL_COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.0 | 0.3 | REACTOME_SEMA3A_PAK_DEPENDENT_AXON_REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.9 | REACTOME_LYSOSOME_VESICLE_BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.2 | REACTOME_IL_6_SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.5 | REACTOME_PYRUVATE_METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 0.2 | REACTOME_CREATION_OF_C4_AND_C2_ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.6 | REACTOME_CHOLESTEROL_BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.5 | REACTOME_AMINO_ACID_SYNTHESIS_AND_INTERCONVERSION_TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.2 | REACTOME_THROMBIN_SIGNALLING_THROUGH_PROTEINASE_ACTIVATED_RECEPTORS_PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.3 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.5 | REACTOME_DNA_REPAIR | Genes involved in DNA Repair |
0.0 | 1.1 | REACTOME_RESPONSE_TO_ELEVATED_PLATELET_CYTOSOLIC_CA2_ | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.1 | REACTOME_ELEVATION_OF_CYTOSOLIC_CA2_LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.2 | REACTOME_PURINE_CATABOLISM | Genes involved in Purine catabolism |
0.0 | 0.9 | REACTOME_INTEGRIN_CELL_SURFACE_INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.3 | REACTOME_PPARA_ACTIVATES_GENE_EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.2 | REACTOME_REGULATION_OF_MRNA_STABILITY_BY_PROTEINS_THAT_BIND_AU_RICH_ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.0 | 0.4 | REACTOME_METABOLISM_OF_PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.1 | REACTOME_SYNTHESIS_OF_BILE_ACIDS_AND_BILE_SALTS_VIA_7ALPHA_HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 0.2 | REACTOME_METABOLISM_OF_STEROID_HORMONES_AND_VITAMINS_A_AND_D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.2 | REACTOME_LIPID_DIGESTION_MOBILIZATION_AND_TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.0 | 0.5 | REACTOME_MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.4 | REACTOME_GLYCOSPHINGOLIPID_METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.1 | REACTOME_ACYL_CHAIN_REMODELLING_OF_PE | Genes involved in Acyl chain remodelling of PE |
0.0 | 0.5 | REACTOME_TRANSLATION | Genes involved in Translation |
0.0 | 0.1 | REACTOME_SIGNALLING_TO_RAS | Genes involved in Signalling to RAS |
0.0 | 0.5 | REACTOME_GOLGI_ASSOCIATED_VESICLE_BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.2 | REACTOME_PRE_NOTCH_EXPRESSION_AND_PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.0 | 0.4 | REACTOME_POST_TRANSLATIONAL_MODIFICATION_SYNTHESIS_OF_GPI_ANCHORED_PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.2 | REACTOME_DEADENYLATION_OF_MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.2 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.6 | REACTOME_METABOLISM_OF_VITAMINS_AND_COFACTORS | Genes involved in Metabolism of vitamins and cofactors |