Motif ID: Pou3f4
Z-value: 0.525
Transcription factors associated with Pou3f4:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Pou3f4 | ENSMUSG00000056854.3 | Pou3f4 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Pou3f4 | mm10_v2_chrX_+_110814390_110814413 | -0.65 | 3.7e-03 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.7 | GO:1903244 | positive regulation of cardiac muscle adaptation(GO:0010615) positive regulation of cardiac muscle hypertrophy in response to stress(GO:1903244) regulation of connective tissue replacement(GO:1905203) |
| 0.2 | 0.8 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.2 | 1.1 | GO:1904936 | forebrain anterior/posterior pattern specification(GO:0021797) cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
| 0.2 | 0.5 | GO:0002030 | inhibitory G-protein coupled receptor phosphorylation(GO:0002030) |
| 0.1 | 1.2 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.1 | 0.4 | GO:1900141 | regulation of oligodendrocyte apoptotic process(GO:1900141) negative regulation of oligodendrocyte apoptotic process(GO:1900142) |
| 0.1 | 0.6 | GO:0061743 | motor learning(GO:0061743) |
| 0.1 | 0.6 | GO:0072235 | distal convoluted tubule development(GO:0072025) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) |
| 0.1 | 2.0 | GO:0034390 | smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
| 0.1 | 0.5 | GO:0021648 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) cranial nerve formation(GO:0021603) vestibulocochlear nerve morphogenesis(GO:0021648) |
| 0.1 | 1.7 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) |
| 0.1 | 1.0 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.1 | 0.4 | GO:0023041 | neuronal signal transduction(GO:0023041) |
| 0.1 | 0.5 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.5 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.1 | 0.5 | GO:1902746 | regulation of lens fiber cell differentiation(GO:1902746) |
| 0.1 | 0.2 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.1 | 0.2 | GO:1903860 | negative regulation of dendrite extension(GO:1903860) regulation of neuron remodeling(GO:1904799) negative regulation of neuron remodeling(GO:1904800) |
| 0.1 | 0.4 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.1 | 1.2 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.4 | GO:1900194 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
| 0.0 | 0.5 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.0 | 0.2 | GO:0070171 | negative regulation of tooth mineralization(GO:0070171) |
| 0.0 | 0.6 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 0.3 | GO:0021555 | rhombomere development(GO:0021546) midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.0 | 0.5 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.0 | 0.4 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.0 | 0.2 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) |
| 0.0 | 0.5 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.5 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.0 | 0.1 | GO:0044830 | modulation by host of viral RNA genome replication(GO:0044830) |
| 0.0 | 0.2 | GO:0070494 | regulation of thrombin receptor signaling pathway(GO:0070494) negative regulation of thrombin receptor signaling pathway(GO:0070495) |
| 0.0 | 0.1 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.0 | 0.7 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.5 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.1 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.0 | 0.2 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.4 | GO:0000338 | protein deneddylation(GO:0000338) |
| 0.0 | 0.1 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.0 | 0.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.0 | 0.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
| 0.0 | 0.2 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.1 | GO:0018377 | N-terminal protein myristoylation(GO:0006499) protein myristoylation(GO:0018377) |
| 0.0 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.0 | 0.6 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.2 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
| 0.0 | 0.1 | GO:0061470 | interleukin-21 production(GO:0032625) T follicular helper cell differentiation(GO:0061470) interleukin-21 secretion(GO:0072619) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.5 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
| 0.1 | 1.2 | GO:0070369 | beta-catenin-TCF7L2 complex(GO:0070369) |
| 0.1 | 0.7 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.4 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 0.4 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.1 | 0.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.5 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.3 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
| 0.0 | 0.2 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.0 | 0.5 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.0 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 1.2 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
| 0.0 | 0.2 | GO:0097227 | sperm annulus(GO:0097227) |
| 0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.1 | GO:0000235 | astral microtubule(GO:0000235) |
| 0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.1 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.6 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 2.9 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 0.7 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 2.0 | GO:0048101 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.2 | 0.5 | GO:0004335 | galactokinase activity(GO:0004335) |
| 0.1 | 0.7 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 1.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 0.3 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 1.0 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.1 | 0.5 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.1 | 0.4 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.1 | 0.2 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.1 | 1.2 | GO:0070016 | gamma-catenin binding(GO:0045295) armadillo repeat domain binding(GO:0070016) |
| 0.1 | 0.8 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 0.2 | GO:0005008 | hepatocyte growth factor-activated receptor activity(GO:0005008) |
| 0.1 | 0.2 | GO:0036468 | aromatic-L-amino-acid decarboxylase activity(GO:0004058) L-dopa decarboxylase activity(GO:0036468) |
| 0.1 | 0.6 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.2 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.5 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.2 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) lysophosphatidic acid receptor activity(GO:0070915) |
| 0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 1.9 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
| 0.0 | 0.4 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.1 | GO:0022848 | acetylcholine-gated cation channel activity(GO:0022848) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.4 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 1.2 | NABA_PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.2 | PID_LPA4_PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.9 | PID_SYNDECAN_1_PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.7 | PID_CD8_TCR_DOWNSTREAM_PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 1.2 | PID_AP1_PATHWAY | AP-1 transcription factor network |
| 0.0 | 0.4 | PID_PDGFRA_PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.2 | PID_TCR_CALCIUM_PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.4 | PID_IGF1_PATHWAY | IGF1 pathway |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 2.0 | REACTOME_CGMP_EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.2 | REACTOME_P2Y_RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 1.2 | REACTOME_FORMATION_OF_THE_TERNARY_COMPLEX_AND_SUBSEQUENTLY_THE_43S_COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.2 | REACTOME_AMINE_DERIVED_HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.3 | REACTOME_MRNA_DECAY_BY_5_TO_3_EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.7 | REACTOME_LYSOSOME_VESICLE_BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 0.7 | REACTOME_DARPP_32_EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.5 | REACTOME_GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
