Motif ID: Smad4
Z-value: 1.302
Transcription factors associated with Smad4:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Smad4 | ENSMUSG00000024515.7 | Smad4 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Smad4 | mm10_v2_chr18_-_73703739_73703806 | -0.27 | 2.8e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 5.1 | GO:0060849 | regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.9 | 2.8 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.8 | 3.2 | GO:0006751 | glutathione catabolic process(GO:0006751) |
| 0.7 | 2.8 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.7 | 4.0 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
| 0.6 | 2.9 | GO:0021764 | amygdala development(GO:0021764) |
| 0.5 | 1.5 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.5 | 2.0 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.5 | 3.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.5 | 9.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.5 | 2.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.5 | 1.4 | GO:1905203 | regulation of connective tissue replacement(GO:1905203) |
| 0.4 | 3.5 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.4 | 0.8 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.3 | 2.8 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.3 | 1.5 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.3 | 0.8 | GO:1904347 | intestine smooth muscle contraction(GO:0014827) regulation of gastro-intestinal system smooth muscle contraction(GO:1904304) regulation of small intestine smooth muscle contraction(GO:1904347) small intestine smooth muscle contraction(GO:1990770) |
| 0.3 | 2.4 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.3 | 0.8 | GO:0061537 | glycine secretion(GO:0061536) glycine secretion, neurotransmission(GO:0061537) |
| 0.3 | 4.7 | GO:0048368 | lateral mesoderm development(GO:0048368) |
| 0.2 | 0.7 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
| 0.2 | 3.9 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.2 | 1.0 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
| 0.2 | 1.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.2 | 1.1 | GO:0006447 | regulation of translational initiation by iron(GO:0006447) positive regulation of translational initiation by iron(GO:0045994) |
| 0.2 | 1.2 | GO:0051461 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.2 | 0.6 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
| 0.2 | 0.6 | GO:0060023 | soft palate development(GO:0060023) |
| 0.2 | 0.5 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.2 | 0.9 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.2 | 0.5 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.2 | 0.8 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.2 | 1.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.2 | 2.2 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.2 | 2.0 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.1 | 0.4 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.1 | 0.9 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
| 0.1 | 0.4 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.1 | 0.4 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.1 | 0.7 | GO:1904672 | regulation of somatic stem cell population maintenance(GO:1904672) |
| 0.1 | 2.0 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
| 0.1 | 0.4 | GO:0032241 | positive regulation of nucleobase-containing compound transport(GO:0032241) |
| 0.1 | 0.6 | GO:0002339 | B cell selection(GO:0002339) |
| 0.1 | 1.5 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.1 | 0.3 | GO:2001160 | regulation of histone H3-K79 methylation(GO:2001160) |
| 0.1 | 1.4 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.1 | 0.7 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) |
| 0.1 | 0.4 | GO:0014005 | microglia differentiation(GO:0014004) microglia development(GO:0014005) |
| 0.1 | 0.3 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 2.3 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.1 | 0.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.6 | GO:0001945 | lymph vessel development(GO:0001945) |
| 0.1 | 0.2 | GO:0031660 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031660) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G2/M transition of mitotic cell cycle(GO:0031662) positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.1 | 0.4 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.1 | 1.3 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.1 | 0.6 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.1 | 0.2 | GO:0055071 | cellular manganese ion homeostasis(GO:0030026) Golgi calcium ion homeostasis(GO:0032468) manganese ion homeostasis(GO:0055071) |
| 0.1 | 0.5 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 1.5 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 | 1.0 | GO:0031295 | lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
| 0.0 | 1.5 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.0 | 2.0 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
| 0.0 | 0.3 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.2 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.0 | 0.3 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
| 0.0 | 0.3 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.0 | 0.1 | GO:0043686 | co-translational protein modification(GO:0043686) |
| 0.0 | 1.9 | GO:1901998 | toxin transport(GO:1901998) |
| 0.0 | 0.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 1.3 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 | 1.0 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.4 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.0 | 0.6 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
| 0.0 | 1.7 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.0 | 0.2 | GO:1903299 | regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
| 0.0 | 2.6 | GO:0006342 | chromatin silencing(GO:0006342) |
| 0.0 | 0.6 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.6 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.0 | 0.2 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
| 0.0 | 1.3 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.0 | 1.6 | GO:0016525 | negative regulation of angiogenesis(GO:0016525) |
| 0.0 | 1.2 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.5 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.0 | 1.2 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.0 | 1.7 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.5 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.3 | GO:0033622 | integrin activation(GO:0033622) |
| 0.0 | 0.7 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
| 0.0 | 1.4 | GO:0021954 | central nervous system neuron development(GO:0021954) |
| 0.0 | 1.2 | GO:0051225 | spindle assembly(GO:0051225) |
| 0.0 | 0.1 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 4.7 | GO:0071149 | TEAD-2-YAP complex(GO:0071149) |
| 0.8 | 2.3 | GO:0038045 | large latent transforming growth factor-beta complex(GO:0038045) |
| 0.3 | 1.2 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.2 | 6.7 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.2 | 1.1 | GO:0035976 | AP1 complex(GO:0035976) |
| 0.2 | 2.0 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.2 | 0.5 | GO:0044302 | dentate gyrus mossy fiber(GO:0044302) |
| 0.1 | 1.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.1 | 3.2 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.1 | 0.4 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.1 | 4.0 | GO:0000786 | nucleosome(GO:0000786) |
| 0.1 | 2.5 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 1.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 1.3 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.2 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 1.4 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 1.0 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 0.2 | GO:0043540 | 6-phosphofructo-2-kinase/fructose-2,6-biphosphatase complex(GO:0043540) |
| 0.1 | 1.0 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 4.8 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 0.7 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 0.9 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.4 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.5 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 1.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.5 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 3.4 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.6 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.9 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.4 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 1.0 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.4 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 1.2 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 1.3 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.0 | 1.4 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.8 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.6 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.0 | 0.2 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 4.9 | GO:0000790 | nuclear chromatin(GO:0000790) |
| 0.0 | 1.6 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 1.1 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.1 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 3.8 | GO:0050436 | microfibril binding(GO:0050436) |
| 0.9 | 2.8 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.6 | 2.4 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.5 | 6.1 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.5 | 3.2 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.4 | 2.7 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.3 | 1.0 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.3 | 1.5 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
| 0.3 | 2.0 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.3 | 3.4 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.2 | 1.2 | GO:0005052 | peroxisome matrix targeting signal-1 binding(GO:0005052) |
| 0.2 | 4.7 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.2 | 3.9 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.2 | 0.5 | GO:0036004 | GAF domain binding(GO:0036004) |
| 0.2 | 1.3 | GO:0031432 | titin binding(GO:0031432) |
| 0.2 | 1.6 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.2 | 0.6 | GO:0004692 | cGMP-dependent protein kinase activity(GO:0004692) |
| 0.1 | 2.3 | GO:0098641 | cadherin binding involved in cell-cell adhesion(GO:0098641) |
| 0.1 | 1.2 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 0.8 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.1 | 1.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 1.8 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 1.5 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.1 | 0.5 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.8 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.1 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 1.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 0.2 | GO:0008311 | double-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008311) |
| 0.1 | 2.0 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.1 | 0.3 | GO:0001165 | RNA polymerase I upstream control element sequence-specific DNA binding(GO:0001165) |
| 0.1 | 0.2 | GO:0015410 | manganese-transporting ATPase activity(GO:0015410) |
| 0.1 | 1.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 1.0 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.6 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.1 | 2.2 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
| 0.1 | 2.9 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.0 | 2.4 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 1.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.5 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 1.5 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.6 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 9.4 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.5 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.6 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.0 | 0.3 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.2 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 0.8 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.0 | 0.5 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.4 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 1.0 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 5.3 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 1.4 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
| 0.0 | 1.3 | GO:0019955 | cytokine binding(GO:0019955) |
| 0.0 | 0.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.2 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 1.9 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
| 0.0 | 0.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.2 | GO:0051861 | glycolipid binding(GO:0051861) |
| 0.0 | 0.9 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 2.4 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 0.8 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.4 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.1 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 6.1 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
| 0.1 | 3.0 | PID_WNT_SIGNALING_PATHWAY | Wnt signaling network |
| 0.1 | 1.7 | PID_INTEGRIN_CS_PATHWAY | Integrin family cell surface interactions |
| 0.1 | 4.8 | PID_RAC1_REG_PATHWAY | Regulation of RAC1 activity |
| 0.1 | 2.8 | PID_BMP_PATHWAY | BMP receptor signaling |
| 0.1 | 1.0 | PID_EPHRINB_REV_PATHWAY | Ephrin B reverse signaling |
| 0.0 | 2.3 | PID_AURORA_B_PATHWAY | Aurora B signaling |
| 0.0 | 3.9 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 1.6 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 1.1 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
| 0.0 | 1.1 | PID_RXR_VDR_PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 2.2 | PID_P75_NTR_PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 3.9 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 3.9 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.5 | PID_CIRCADIAN_PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.6 | PID_P38_ALPHA_BETA_PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.7 | NABA_COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.8 | PID_KIT_PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.8 | ST_FAS_SIGNALING_PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.3 | PID_FOXM1_PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.5 | PID_RHOA_REG_PATHWAY | Regulation of RhoA activity |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 9.7 | REACTOME_PACKAGING_OF_TELOMERE_ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.3 | 2.8 | REACTOME_PURINE_CATABOLISM | Genes involved in Purine catabolism |
| 0.2 | 6.2 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 3.2 | REACTOME_GLUTATHIONE_CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 2.8 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
| 0.1 | 3.9 | REACTOME_DOWNREGULATION_OF_SMAD2_3_SMAD4_TRANSCRIPTIONAL_ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.1 | 0.8 | REACTOME_FGFR4_LIGAND_BINDING_AND_ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.1 | 1.4 | REACTOME_ADVANCED_GLYCOSYLATION_ENDPRODUCT_RECEPTOR_SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 1.1 | REACTOME_ACTIVATION_OF_THE_AP1_FAMILY_OF_TRANSCRIPTION_FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.1 | 0.8 | REACTOME_NA_CL_DEPENDENT_NEUROTRANSMITTER_TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 5.1 | REACTOME_TRANSCRIPTIONAL_REGULATION_OF_WHITE_ADIPOCYTE_DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.1 | 0.7 | REACTOME_MRNA_DECAY_BY_3_TO_5_EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 4.2 | REACTOME_NUCLEAR_RECEPTOR_TRANSCRIPTION_PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.1 | 1.5 | REACTOME_KINESINS | Genes involved in Kinesins |
| 0.1 | 1.0 | REACTOME_FORMATION_OF_ATP_BY_CHEMIOSMOTIC_COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 0.3 | REACTOME_RNA_POL_I_PROMOTER_OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 1.1 | REACTOME_CGMP_EFFECTS | Genes involved in cGMP effects |
| 0.0 | 3.9 | REACTOME_SIGNALING_BY_RHO_GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.5 | REACTOME_SYNTHESIS_OF_SUBSTRATES_IN_N_GLYCAN_BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.5 | REACTOME_BMAL1_CLOCK_NPAS2_ACTIVATES_CIRCADIAN_EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 2.8 | REACTOME_CELL_DEATH_SIGNALLING_VIA_NRAGE_NRIF_AND_NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.0 | 0.5 | REACTOME_CONVERSION_FROM_APC_C_CDC20_TO_APC_C_CDH1_IN_LATE_ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.5 | REACTOME_REGULATION_OF_KIT_SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 1.7 | REACTOME_CELL_SURFACE_INTERACTIONS_AT_THE_VASCULAR_WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.0 | 0.8 | REACTOME_SMOOTH_MUSCLE_CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.0 | 1.6 | REACTOME_FACTORS_INVOLVED_IN_MEGAKARYOCYTE_DEVELOPMENT_AND_PLATELET_PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 2.1 | REACTOME_3_UTR_MEDIATED_TRANSLATIONAL_REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.0 | 0.2 | REACTOME_GAP_JUNCTION_ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 2.2 | REACTOME_G_ALPHA_I_SIGNALLING_EVENTS | Genes involved in G alpha (i) signalling events |
| 0.0 | 0.4 | REACTOME_NEGATIVE_REGULATORS_OF_RIG_I_MDA5_SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 0.7 | REACTOME_COLLAGEN_FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.5 | REACTOME_AUTODEGRADATION_OF_CDH1_BY_CDH1_APC_C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |


