Motif ID: Tead3_Tead4
Z-value: 2.151
Transcription factors associated with Tead3_Tead4:
| Gene Symbol | Entrez ID | Gene Name |
|---|---|---|
| Tead3 | ENSMUSG00000002249.11 | Tead3 |
| Tead4 | ENSMUSG00000030353.9 | Tead4 |
Activity-expression correlation:
| Gene Symbol | Promoter | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|
| Tead3 | mm10_v2_chr17_-_28350600_28350681 | 0.36 | 1.4e-01 | Click! |
Top targets:
Gene overrepresentation in biological_process category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.7 | 8.5 | GO:1903609 | negative regulation of peptidyl-tyrosine autophosphorylation(GO:1900085) negative regulation of inward rectifier potassium channel activity(GO:1903609) |
| 1.7 | 20.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 1.5 | 3.0 | GO:0072190 | ureter urothelium development(GO:0072190) ureter morphogenesis(GO:0072197) |
| 1.4 | 4.2 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 1.3 | 3.8 | GO:1904580 | regulation of intracellular mRNA localization(GO:1904580) |
| 1.2 | 8.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 1.1 | 4.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 1.0 | 8.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 1.0 | 1.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 1.0 | 2.9 | GO:0060745 | mammary gland branching involved in pregnancy(GO:0060745) |
| 0.9 | 3.7 | GO:1902724 | positive regulation of skeletal muscle satellite cell proliferation(GO:1902724) positive regulation of growth factor dependent skeletal muscle satellite cell proliferation(GO:1902728) |
| 0.9 | 4.4 | GO:0032346 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
| 0.8 | 2.3 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.7 | 4.4 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.7 | 1.4 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.6 | 2.6 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.6 | 4.5 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.6 | 3.1 | GO:0038018 | Wnt receptor catabolic process(GO:0038018) |
| 0.6 | 2.4 | GO:1900220 | semaphorin-plexin signaling pathway involved in bone trabecula morphogenesis(GO:1900220) |
| 0.6 | 2.3 | GO:2001045 | closure of optic fissure(GO:0061386) negative regulation of integrin-mediated signaling pathway(GO:2001045) |
| 0.5 | 2.2 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.5 | 2.7 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.5 | 1.6 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) regulation of interleukin-6-mediated signaling pathway(GO:0070103) negative regulation of interleukin-6-mediated signaling pathway(GO:0070104) |
| 0.5 | 1.6 | GO:1904395 | positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 0.5 | 2.1 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.5 | 1.5 | GO:1905000 | regulation of membrane repolarization during atrial cardiac muscle cell action potential(GO:1905000) |
| 0.5 | 1.9 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
| 0.5 | 1.4 | GO:0001757 | somite specification(GO:0001757) cell-cell signaling involved in cell fate commitment(GO:0045168) arterial endothelial cell fate commitment(GO:0060844) blood vessel endothelial cell fate commitment(GO:0060846) endothelial cell fate specification(GO:0060847) Notch signaling pathway involved in arterial endothelial cell fate commitment(GO:0060853) blood vessel endothelial cell fate specification(GO:0097101) |
| 0.4 | 2.2 | GO:0052428 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.4 | 1.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.4 | 0.7 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.3 | 6.6 | GO:0071803 | keratinocyte development(GO:0003334) positive regulation of podosome assembly(GO:0071803) |
| 0.3 | 2.3 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.3 | 1.3 | GO:0014846 | esophagus smooth muscle contraction(GO:0014846) |
| 0.3 | 1.6 | GO:0060849 | regulation of transcription involved in lymphatic endothelial cell fate commitment(GO:0060849) |
| 0.3 | 1.3 | GO:0000415 | negative regulation of histone H3-K36 methylation(GO:0000415) |
| 0.3 | 2.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.3 | 2.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
| 0.3 | 1.4 | GO:0019230 | proprioception(GO:0019230) |
| 0.3 | 0.8 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 0.3 | 1.8 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.3 | 1.8 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
| 0.3 | 0.8 | GO:0060558 | regulation of calcidiol 1-monooxygenase activity(GO:0060558) |
| 0.2 | 1.4 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.2 | 0.7 | GO:0070309 | notochord formation(GO:0014028) lens fiber cell morphogenesis(GO:0070309) negative regulation of lymphangiogenesis(GO:1901491) |
| 0.2 | 1.1 | GO:0032298 | positive regulation of DNA-dependent DNA replication initiation(GO:0032298) |
| 0.2 | 0.7 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 | 0.9 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.2 | 0.9 | GO:1903028 | regulation of opsonization(GO:1903027) positive regulation of opsonization(GO:1903028) |
| 0.2 | 1.5 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.2 | 1.0 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.2 | 0.6 | GO:0070973 | COPI-coated vesicle budding(GO:0035964) protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.2 | 0.6 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) terminal web assembly(GO:1902896) |
| 0.2 | 2.1 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.2 | 0.7 | GO:0007343 | egg activation(GO:0007343) |
| 0.1 | 0.7 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
| 0.1 | 2.1 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.1 | 0.7 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.1 | 1.6 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.1 | 0.4 | GO:2000850 | negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
| 0.1 | 1.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.4 | GO:1902396 | protein localization to bicellular tight junction(GO:1902396) |
| 0.1 | 0.5 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 | 0.6 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 | 0.7 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.1 | 0.9 | GO:1990504 | dense core granule exocytosis(GO:1990504) |
| 0.1 | 0.9 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.1 | 0.4 | GO:0071550 | death-inducing signaling complex assembly(GO:0071550) |
| 0.1 | 0.5 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.1 | 3.2 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.1 | 0.2 | GO:1904685 | positive regulation of metalloendopeptidase activity(GO:1904685) |
| 0.1 | 0.3 | GO:0061324 | canonical Wnt signaling pathway involved in positive regulation of cardiac outflow tract cell proliferation(GO:0061324) planar cell polarity pathway involved in outflow tract morphogenesis(GO:0061347) planar cell polarity pathway involved in ventricular septum morphogenesis(GO:0061348) planar cell polarity pathway involved in cardiac right atrium morphogenesis(GO:0061349) planar cell polarity pathway involved in cardiac muscle tissue morphogenesis(GO:0061350) planar cell polarity pathway involved in pericardium morphogenesis(GO:0061354) receptor-mediated endocytosis of low-density lipoprotein particle involved in cholesterol transport(GO:0090118) regulation of cell proliferation involved in outflow tract morphogenesis(GO:1901963) |
| 0.1 | 1.6 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.1 | 1.9 | GO:0001946 | lymphangiogenesis(GO:0001946) |
| 0.1 | 1.0 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 0.5 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
| 0.1 | 0.9 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.1 | 0.4 | GO:0060372 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) |
| 0.1 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 1.2 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 | 1.2 | GO:0002467 | germinal center formation(GO:0002467) |
| 0.1 | 1.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 1.2 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.1 | 1.3 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
| 0.1 | 4.8 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
| 0.1 | 1.9 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
| 0.1 | 4.5 | GO:0035411 | catenin import into nucleus(GO:0035411) |
| 0.1 | 0.5 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.1 | 0.7 | GO:0034351 | regulation of glial cell apoptotic process(GO:0034350) negative regulation of glial cell apoptotic process(GO:0034351) |
| 0.1 | 0.8 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.1 | 2.2 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 | 0.3 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) |
| 0.1 | 0.5 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.1 | 2.4 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.1 | 1.0 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.1 | 0.3 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.1 | 0.3 | GO:0019074 | viral genome packaging(GO:0019072) viral RNA genome packaging(GO:0019074) |
| 0.1 | 0.3 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 0.7 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.1 | 1.5 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.1 | 0.2 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.1 | 0.4 | GO:0042891 | antibiotic transport(GO:0042891) dipeptide transport(GO:0042938) |
| 0.1 | 0.5 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
| 0.1 | 0.4 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
| 0.1 | 0.3 | GO:0044828 | negative regulation by host of viral process(GO:0044793) negative regulation by host of viral genome replication(GO:0044828) |
| 0.1 | 1.8 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.1 | 0.7 | GO:0051255 | spindle midzone assembly(GO:0051255) mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 1.6 | GO:0006825 | copper ion transport(GO:0006825) |
| 0.1 | 0.8 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.1 | 1.0 | GO:0005980 | polysaccharide catabolic process(GO:0000272) glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.1 | 0.9 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.1 | 0.7 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
| 0.1 | 2.9 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.1 | 0.3 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
| 0.1 | 0.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 1.7 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.1 | 0.3 | GO:0007021 | tubulin complex assembly(GO:0007021) |
| 0.1 | 0.8 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.1 | 0.4 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 | 1.8 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.0 | 1.0 | GO:2001273 | regulation of glucose import in response to insulin stimulus(GO:2001273) |
| 0.0 | 0.4 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.2 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.0 | 1.1 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.3 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 0.4 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 | 0.2 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.0 | 0.3 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 0.6 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 4.4 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
| 0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 1.5 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 | 1.6 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.6 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
| 0.0 | 1.6 | GO:0006940 | regulation of smooth muscle contraction(GO:0006940) |
| 0.0 | 0.9 | GO:0006826 | iron ion transport(GO:0006826) |
| 0.0 | 0.2 | GO:0045654 | positive regulation of nuclease activity(GO:0032075) positive regulation of megakaryocyte differentiation(GO:0045654) |
| 0.0 | 0.1 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.0 | 0.9 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 1.5 | GO:0019319 | hexose biosynthetic process(GO:0019319) |
| 0.0 | 0.7 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
| 0.0 | 2.4 | GO:0007050 | cell cycle arrest(GO:0007050) |
| 0.0 | 0.6 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 1.2 | GO:0048747 | muscle fiber development(GO:0048747) |
| 0.0 | 0.2 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 | 0.6 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
| 0.0 | 0.2 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
| 0.0 | 1.4 | GO:0010811 | positive regulation of cell-substrate adhesion(GO:0010811) |
| 0.0 | 0.2 | GO:0007141 | male meiosis I(GO:0007141) |
| 0.0 | 0.2 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
| 0.0 | 0.7 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.0 | 0.3 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.0 | 0.2 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.0 | 0.6 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.1 | GO:2000124 | regulation of endocannabinoid signaling pathway(GO:2000124) |
| 0.0 | 0.2 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
| 0.0 | 0.5 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.0 | GO:2000319 | negative regulation of T-helper 17 type immune response(GO:2000317) regulation of T-helper 17 cell differentiation(GO:2000319) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
| 0.0 | 1.0 | GO:0006261 | DNA-dependent DNA replication(GO:0006261) |
| 0.0 | 0.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
Gene overrepresentation in cellular_component category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 4.4 | GO:0070022 | transforming growth factor beta receptor homodimeric complex(GO:0070022) |
| 0.7 | 2.2 | GO:1990667 | PCSK9-AnxA2 complex(GO:1990667) |
| 0.6 | 8.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.5 | 1.6 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.5 | 2.1 | GO:0042567 | insulin-like growth factor ternary complex(GO:0042567) |
| 0.5 | 1.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.4 | 2.9 | GO:0097550 | transcriptional preinitiation complex(GO:0097550) |
| 0.4 | 1.1 | GO:0097135 | cyclin E2-CDK2 complex(GO:0097135) |
| 0.3 | 1.3 | GO:0008623 | CHRAC(GO:0008623) |
| 0.3 | 4.2 | GO:0043219 | lateral loop(GO:0043219) |
| 0.3 | 1.5 | GO:0031523 | Myb complex(GO:0031523) |
| 0.3 | 2.0 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.2 | 0.7 | GO:0034679 | integrin alpha2-beta1 complex(GO:0034666) integrin alpha3-beta1 complex(GO:0034667) integrin alpha9-beta1 complex(GO:0034679) |
| 0.2 | 1.8 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.2 | 0.6 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.2 | 1.8 | GO:0030478 | actin cap(GO:0030478) |
| 0.2 | 2.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.2 | 1.6 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.2 | 1.5 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.2 | 1.6 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.2 | 6.6 | GO:0002102 | podosome(GO:0002102) |
| 0.2 | 1.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.1 | 1.9 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.1 | 0.5 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.1 | 2.7 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.1 | 1.7 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 0.6 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 0.3 | GO:0002944 | cyclin K-CDK12 complex(GO:0002944) |
| 0.1 | 2.1 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.1 | 1.0 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 0.7 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.1 | 10.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 0.6 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.4 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.1 | 1.3 | GO:0008305 | integrin complex(GO:0008305) protein complex involved in cell adhesion(GO:0098636) |
| 0.1 | 4.5 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.1 | 21.3 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.1 | 4.3 | GO:0016459 | myosin complex(GO:0016459) |
| 0.1 | 0.5 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 1.1 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 1.3 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.1 | 0.3 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 0.5 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.4 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.0 | 0.5 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.0 | 2.3 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.6 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.7 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.2 | GO:0097442 | CA3 pyramidal cell dendrite(GO:0097442) |
| 0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.3 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 6.4 | GO:0044798 | nuclear transcription factor complex(GO:0044798) |
| 0.0 | 2.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.0 | 0.4 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 2.7 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.1 | GO:0044447 | axoneme part(GO:0044447) |
| 0.0 | 11.6 | GO:0005925 | focal adhesion(GO:0005925) |
| 0.0 | 1.5 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 1.6 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.0 | 2.7 | GO:0005923 | bicellular tight junction(GO:0005923) |
| 0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 1.4 | GO:0005912 | adherens junction(GO:0005912) |
| 0.0 | 0.2 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.0 | 1.1 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 1.5 | GO:0005884 | actin filament(GO:0005884) |
| 0.0 | 2.1 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 1.8 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 1.0 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 1.5 | GO:0005875 | microtubule associated complex(GO:0005875) |
| 0.0 | 0.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 3.4 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.0 | 0.7 | GO:0001669 | acrosomal vesicle(GO:0001669) |
| 0.0 | 0.7 | GO:0016234 | inclusion body(GO:0016234) |
Gene overrepresentation in molecular_function category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.2 | 20.1 | GO:0038062 | protein tyrosine kinase collagen receptor activity(GO:0038062) |
| 1.7 | 8.5 | GO:0070320 | inward rectifier potassium channel inhibitor activity(GO:0070320) |
| 1.4 | 4.2 | GO:0001042 | RNA polymerase I core binding(GO:0001042) |
| 1.0 | 2.9 | GO:0031798 | type 1 metabotropic glutamate receptor binding(GO:0031798) RNA polymerase II transcription factor activity, estrogen-activated sequence-specific DNA binding(GO:0038052) |
| 0.8 | 2.3 | GO:1990450 | linear polyubiquitin binding(GO:1990450) |
| 0.7 | 6.6 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.6 | 1.7 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.5 | 2.2 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) phospholipase A2 inhibitor activity(GO:0019834) |
| 0.5 | 1.6 | GO:0004923 | leukemia inhibitory factor receptor activity(GO:0004923) oncostatin-M receptor activity(GO:0004924) |
| 0.5 | 6.9 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.5 | 2.3 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.4 | 8.7 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.4 | 3.7 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.4 | 1.5 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.4 | 2.3 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.3 | 4.4 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.3 | 4.4 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.3 | 2.9 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.3 | 1.6 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.3 | 2.6 | GO:0043237 | laminin-1 binding(GO:0043237) |
| 0.3 | 3.9 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.3 | 3.0 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
| 0.3 | 0.8 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) enone reductase activity(GO:0035671) cholestenone 5-alpha-reductase activity(GO:0047751) |
| 0.3 | 3.8 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.2 | 1.0 | GO:0005113 | patched binding(GO:0005113) |
| 0.2 | 0.7 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.2 | 1.5 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.2 | 1.5 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.2 | 1.9 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.2 | 2.1 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.2 | 1.3 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.2 | 2.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.2 | 0.5 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.2 | 1.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.2 | 0.5 | GO:0030156 | benzodiazepine receptor binding(GO:0030156) |
| 0.1 | 1.2 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
| 0.1 | 1.8 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.1 | 1.4 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 1.2 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 1.6 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.1 | 0.4 | GO:0042936 | dipeptide transporter activity(GO:0042936) |
| 0.1 | 4.7 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.1 | 0.3 | GO:0071936 | coreceptor activity involved in Wnt signaling pathway(GO:0071936) |
| 0.1 | 2.6 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.1 | 0.3 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.1 | 0.3 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.1 | 1.4 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 2.0 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.1 | 4.8 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.1 | 1.0 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.5 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.1 | 0.8 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 0.9 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
| 0.1 | 1.1 | GO:0035173 | histone kinase activity(GO:0035173) |
| 0.1 | 0.4 | GO:0033188 | sphingomyelin synthase activity(GO:0033188) ceramide cholinephosphotransferase activity(GO:0047493) |
| 0.1 | 2.9 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 0.7 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.1 | 0.6 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 1.5 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 0.2 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 0.4 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 0.3 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 1.0 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
| 0.1 | 0.7 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.1 | 0.2 | GO:0035243 | protein-arginine omega-N symmetric methyltransferase activity(GO:0035243) |
| 0.0 | 1.0 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.0 | 0.9 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 2.1 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.8 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.7 | GO:0008510 | sodium:bicarbonate symporter activity(GO:0008510) |
| 0.0 | 1.9 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) |
| 0.0 | 5.8 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.2 | GO:0047134 | protein-disulfide reductase activity(GO:0047134) |
| 0.0 | 1.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.7 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.2 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.1 | GO:0070892 | lipoteichoic acid receptor activity(GO:0070892) |
| 0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.0 | 0.7 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.0 | 0.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.3 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.8 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.9 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.8 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.0 | 0.2 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.0 | 0.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.0 | 1.3 | GO:0004407 | histone deacetylase activity(GO:0004407) |
| 0.0 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.4 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 3.3 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
| 0.0 | 1.5 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 1.7 | GO:0005539 | glycosaminoglycan binding(GO:0005539) |
| 0.0 | 0.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.2 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.4 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.7 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 1.0 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.7 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 1.3 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 1.2 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.3 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 1.4 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.2 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 3.2 | GO:0003713 | transcription coactivator activity(GO:0003713) |
| 0.0 | 1.0 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.0 | 0.2 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.3 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.0 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.6 | GO:0019894 | kinesin binding(GO:0019894) |
Gene overrepresentation in C2:CP category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 8.9 | PID_WNT_CANONICAL_PATHWAY | Canonical Wnt signaling pathway |
| 0.3 | 5.3 | PID_IL27_PATHWAY | IL27-mediated signaling events |
| 0.3 | 2.1 | PID_INTEGRIN2_PATHWAY | Beta2 integrin cell surface interactions |
| 0.3 | 11.5 | PID_AMB2_NEUTROPHILS_PATHWAY | amb2 Integrin signaling |
| 0.1 | 2.0 | SA_REG_CASCADE_OF_CYCLIN_EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.1 | 8.6 | PID_AP1_PATHWAY | AP-1 transcription factor network |
| 0.1 | 2.9 | PID_SMAD2_3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 9.9 | PID_MYC_REPRESS_PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.1 | 3.3 | PID_HEDGEHOG_2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 3.5 | ST_TUMOR_NECROSIS_FACTOR_PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.1 | 3.9 | SIG_REGULATION_OF_THE_ACTIN_CYTOSKELETON_BY_RHO_GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.1 | 2.0 | PID_IL2_STAT5_PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 1.3 | PID_INTEGRIN_CS_PATHWAY | Integrin family cell surface interactions |
| 0.1 | 0.7 | PID_EPHA2_FWD_PATHWAY | EPHA2 forward signaling |
| 0.1 | 1.4 | PID_S1P_S1P2_PATHWAY | S1P2 pathway |
| 0.1 | 1.5 | PID_NETRIN_PATHWAY | Netrin-mediated signaling events |
| 0.1 | 3.1 | PID_ECADHERIN_NASCENT_AJ_PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.1 | 4.4 | PID_TGFBR_PATHWAY | TGF-beta receptor signaling |
| 0.1 | 2.6 | PID_FAK_PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 2.2 | PID_CASPASE_PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 1.4 | PID_PS1_PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 1.7 | PID_HNF3A_PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.7 | PID_IL1_PATHWAY | IL1-mediated signaling events |
| 0.0 | 1.5 | ST_INTEGRIN_SIGNALING_PATHWAY | Integrin Signaling Pathway |
| 0.0 | 1.2 | PID_FCER1_PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 2.2 | PID_RHOA_REG_PATHWAY | Regulation of RhoA activity |
| 0.0 | 1.6 | PID_ERA_GENOMIC_PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 4.5 | NABA_ECM_GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.6 | PID_BMP_PATHWAY | BMP receptor signaling |
| 0.0 | 1.7 | PID_SMAD2_3NUCLEAR_PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.6 | PID_ARF6_PATHWAY | Arf6 signaling events |
| 0.0 | 0.4 | PID_IL2_PI3K_PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.3 | ST_WNT_BETA_CATENIN_PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 2.1 | PID_MYC_ACTIV_PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 0.9 | PID_AR_PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 0.3 | ST_WNT_CA2_CYCLIC_GMP_PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.3 | PID_E2F_PATHWAY | E2F transcription factor network |
| 0.0 | 0.8 | PID_P53_REGULATION_PATHWAY | p53 pathway |
| 0.0 | 1.6 | NABA_ECM_REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
Gene overrepresentation in C2:CP:REACTOME category:
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 6.6 | REACTOME_P130CAS_LINKAGE_TO_MAPK_SIGNALING_FOR_INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 0.4 | 5.3 | REACTOME_IL_6_SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.4 | 8.4 | REACTOME_HORMONE_SENSITIVE_LIPASE_HSL_MEDIATED_TRIACYLGLYCEROL_HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.3 | 0.3 | REACTOME_MRNA_DECAY_BY_3_TO_5_EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.3 | 2.6 | REACTOME_THE_ACTIVATION_OF_ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.3 | 9.7 | REACTOME_SIGNALING_BY_HIPPO | Genes involved in Signaling by Hippo |
| 0.3 | 4.2 | REACTOME_DOWNREGULATION_OF_ERBB2_ERBB3_SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.2 | 3.8 | REACTOME_DESTABILIZATION_OF_MRNA_BY_BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.2 | 0.6 | REACTOME_NEGATIVE_REGULATION_OF_THE_PI3K_AKT_NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.2 | 2.3 | REACTOME_IKK_COMPLEX_RECRUITMENT_MEDIATED_BY_RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.2 | 1.8 | REACTOME_RECEPTOR_LIGAND_BINDING_INITIATES_THE_SECOND_PROTEOLYTIC_CLEAVAGE_OF_NOTCH_RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.2 | 0.8 | REACTOME_ANDROGEN_BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.2 | 2.4 | REACTOME_REGULATION_OF_INSULIN_LIKE_GROWTH_FACTOR_IGF_ACTIVITY_BY_INSULIN_LIKE_GROWTH_FACTOR_BINDING_PROTEINS_IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.2 | 4.2 | REACTOME_YAP1_AND_WWTR1_TAZ_STIMULATED_GENE_EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 2.6 | REACTOME_GAP_JUNCTION_DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 3.4 | REACTOME_CELL_EXTRACELLULAR_MATRIX_INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 2.3 | REACTOME_AMINE_COMPOUND_SLC_TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.1 | 2.4 | REACTOME_CASPASE_MEDIATED_CLEAVAGE_OF_CYTOSKELETAL_PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 1.8 | REACTOME_MTORC1_MEDIATED_SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.1 | 1.4 | REACTOME_SYNTHESIS_OF_PIPS_AT_THE_EARLY_ENDOSOME_MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 1.2 | REACTOME_RIP_MEDIATED_NFKB_ACTIVATION_VIA_DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.1 | 1.8 | REACTOME_SOS_MEDIATED_SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.1 | 2.9 | REACTOME_NUCLEAR_SIGNALING_BY_ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.1 | 2.8 | REACTOME_TIGHT_JUNCTION_INTERACTIONS | Genes involved in Tight junction interactions |
| 0.1 | 1.7 | REACTOME_CHONDROITIN_SULFATE_BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.1 | 2.0 | REACTOME_G0_AND_EARLY_G1 | Genes involved in G0 and Early G1 |
| 0.1 | 2.1 | REACTOME_SYNTHESIS_OF_VERY_LONG_CHAIN_FATTY_ACYL_COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 2.4 | REACTOME_SEMA4D_INDUCED_CELL_MIGRATION_AND_GROWTH_CONE_COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.1 | 1.0 | REACTOME_PURINE_RIBONUCLEOSIDE_MONOPHOSPHATE_BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 1.0 | REACTOME_GLYCOGEN_BREAKDOWN_GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 1.2 | REACTOME_SIGNALING_BY_NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 2.1 | REACTOME_SIGNALING_BY_ROBO_RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.1 | 1.8 | REACTOME_SMOOTH_MUSCLE_CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 0.6 | REACTOME_COPI_MEDIATED_TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.9 | REACTOME_DOWNREGULATION_OF_SMAD2_3_SMAD4_TRANSCRIPTIONAL_ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 3.1 | REACTOME_TRANSCRIPTIONAL_REGULATION_OF_WHITE_ADIPOCYTE_DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 1.2 | REACTOME_METAL_ION_SLC_TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.7 | REACTOME_ENOS_ACTIVATION_AND_REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.7 | REACTOME_CONVERSION_FROM_APC_C_CDC20_TO_APC_C_CDH1_IN_LATE_ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.9 | REACTOME_SIGNALING_BY_FGFR1_FUSION_MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 1.5 | REACTOME_ACTIVATION_OF_CHAPERONE_GENES_BY_XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.5 | REACTOME_METABOLISM_OF_POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.6 | REACTOME_SIGNALING_BY_BMP | Genes involved in Signaling by BMP |
| 0.0 | 1.3 | REACTOME_SIGNAL_TRANSDUCTION_BY_L1 | Genes involved in Signal transduction by L1 |
| 0.0 | 0.3 | REACTOME_BILE_SALT_AND_ORGANIC_ANION_SLC_TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 3.9 | REACTOME_SIGNALING_BY_RHO_GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.4 | REACTOME_NEPHRIN_INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.6 | REACTOME_SYNTHESIS_OF_GLYCOSYLPHOSPHATIDYLINOSITOL_GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.8 | REACTOME_MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.2 | REACTOME_POST_TRANSLATIONAL_MODIFICATION_SYNTHESIS_OF_GPI_ANCHORED_PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 0.4 | REACTOME_DEADENYLATION_OF_MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.3 | REACTOME_MRNA_DECAY_BY_5_TO_3_EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.2 | REACTOME_APOPTOSIS_INDUCED_DNA_FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.4 | REACTOME_PI3K_AKT_ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.0 | 0.3 | REACTOME_CHOLESTEROL_BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 1.0 | REACTOME_CLASS_B_2_SECRETIN_FAMILY_RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |


